mirror of
				https://github.com/python/cpython.git
				synced 2025-10-31 13:41:24 +00:00 
			
		
		
		
	
		
			
				
	
	
		
			4031 lines
		
	
	
	
		
			136 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
			
		
		
	
	
			4031 lines
		
	
	
	
		
			136 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
| #
 | |
| # turtle.py: a Tkinter based turtle graphics module for Python
 | |
| # Version 1.0b1 - 31. 5. 2008
 | |
| #
 | |
| # Copyright (C) 2006 - 2008  Gregor Lingl
 | |
| # email: glingl@aon.at
 | |
| #
 | |
| # This software is provided 'as-is', without any express or implied
 | |
| # warranty.  In no event will the authors be held liable for any damages
 | |
| # arising from the use of this software.
 | |
| #
 | |
| # Permission is granted to anyone to use this software for any purpose,
 | |
| # including commercial applications, and to alter it and redistribute it
 | |
| # freely, subject to the following restrictions:
 | |
| #
 | |
| # 1. The origin of this software must not be misrepresented; you must not
 | |
| #    claim that you wrote the original software. If you use this software
 | |
| #    in a product, an acknowledgment in the product documentation would be
 | |
| #    appreciated but is not required.
 | |
| # 2. Altered source versions must be plainly marked as such, and must not be
 | |
| #    misrepresented as being the original software.
 | |
| # 3. This notice may not be removed or altered from any source distribution.
 | |
| 
 | |
| 
 | |
| """
 | |
| Turtle graphics is a popular way for introducing programming to
 | |
| kids. It was part of the original Logo programming language developed
 | |
| by Wally Feurzig and Seymour Papert in 1966.
 | |
| 
 | |
| Imagine a robotic turtle starting at (0, 0) in the x-y plane. Give it
 | |
| the command turtle.forward(15), and it moves (on-screen!) 15 pixels in
 | |
| the direction it is facing, drawing a line as it moves. Give it the
 | |
| command turtle.left(25), and it rotates in-place 25 degrees clockwise.
 | |
| 
 | |
| By combining together these and similar commands, intricate shapes and
 | |
| pictures can easily be drawn.
 | |
| 
 | |
| ----- turtle.py
 | |
| 
 | |
| This module is an extended reimplementation of turtle.py from the
 | |
| Python standard distribution up to Python 2.5. (See: http:\\www.python.org)
 | |
| 
 | |
| It tries to keep the merits of turtle.py and to be (nearly) 100%
 | |
| compatible with it. This means in the first place to enable the
 | |
| learning programmer to use all the commands, classes and methods
 | |
| interactively when using the module from within IDLE run with
 | |
| the -n switch.
 | |
| 
 | |
| Roughly it has the following features added:
 | |
| 
 | |
| - Better animation of the turtle movements, especially of turning the
 | |
|   turtle. So the turtles can more easily be used as a visual feedback
 | |
|   instrument by the (beginning) programmer.
 | |
| 
 | |
| - Different turtle shapes, gif-images as turtle shapes, user defined
 | |
|   and user controllable turtle shapes, among them compound
 | |
|   (multicolored) shapes. Turtle shapes can be stgretched and tilted, which
 | |
|   makes turtles zu very versatile geometrical objects.
 | |
| 
 | |
| - Fine control over turtle movement and screen updates via delay(),
 | |
|   and enhanced tracer() and speed() methods.
 | |
| 
 | |
| - Aliases for the most commonly used commands, like fd for forward etc.,
 | |
|   following the early Logo traditions. This reduces the boring work of
 | |
|   typing long sequences of commands, which often occur in a natural way
 | |
|   when kids try to program fancy pictures on their first encounter with
 | |
|   turtle graphcis.
 | |
| 
 | |
| - Turtles now have an undo()-method with configurable undo-buffer.
 | |
| 
 | |
| - Some simple commands/methods for creating event driven programs
 | |
|   (mouse-, key-, timer-events). Especially useful for programming games.
 | |
| 
 | |
| - A scrollable Canvas class. The default scrollable Canvas can be
 | |
|   extended interactively as needed while playing around with the turtle(s).
 | |
| 
 | |
| - A TurtleScreen class with methods controlling background color or
 | |
|   background image, window and canvas size and other properties of the
 | |
|   TurtleScreen.
 | |
| 
 | |
| - There is a method, setworldcoordinates(), to install a user defined
 | |
|   coordinate-system for the TurtleScreen.
 | |
| 
 | |
| - The implementation uses a 2-vector class named Vec2D, derived from tuple.
 | |
|   This class is public, so it can be imported by the application programmer,
 | |
|   which makes certain types of computations very natural and compact.
 | |
| 
 | |
| - Appearance of the TurtleScreen and the Turtles at startup/import can be
 | |
|   configured by means of a turtle.cfg configuration file.
 | |
|   The default configuration mimics the appearance of the old turtle module.
 | |
| 
 | |
| - If configured appropriately the module reads in docstrings from a docstring
 | |
|   dictionary in some different language, supplied separately  and replaces
 | |
|   the english ones by those read in. There is a utility function
 | |
|   write_docstringdict() to write a dictionary with the original (english)
 | |
|   docstrings to disc, so it can serve as a template for translations.
 | |
| 
 | |
| Behind the scenes there are some features included with possible
 | |
| extensionsin in mind. These will be commented and documented elsewhere.
 | |
| 
 | |
| """
 | |
| 
 | |
| _ver = "turtle 1.0b1 - for Python 2.6   -  30. 5. 2008, 18:08"
 | |
| 
 | |
| #print _ver
 | |
| 
 | |
| import Tkinter as TK
 | |
| import types
 | |
| import math
 | |
| import time
 | |
| import os
 | |
| 
 | |
| from os.path import isfile, split, join
 | |
| from copy import deepcopy
 | |
| 
 | |
| from math import *    ## for compatibility with old turtle module
 | |
| 
 | |
| _tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen',
 | |
|                'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D']
 | |
| _tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye',
 | |
|         'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas',
 | |
|         'getshapes', 'listen', 'mode', 'onkey', 'onscreenclick', 'ontimer',
 | |
|         'register_shape', 'resetscreen', 'screensize', 'setup',
 | |
|         'setworldcoordinates', 'title', 'tracer', 'turtles', 'update',
 | |
|         'window_height', 'window_width']
 | |
| _tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk',
 | |
|         'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color',
 | |
|         'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd',
 | |
|         'fill', 'fillcolor', 'forward', 'get_poly', 'getpen', 'getscreen',
 | |
|         'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown',
 | |
|         'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd',
 | |
|         'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position',
 | |
|         'pu', 'radians', 'right', 'reset', 'resizemode', 'rt',
 | |
|         'seth', 'setheading', 'setpos', 'setposition', 'settiltangle',
 | |
|         'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'showturtle',
 | |
|         'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', 'tracer',
 | |
|         'turtlesize', 'undo', 'undobufferentries', 'up', 'width',
 | |
|         'window_height', 'window_width', 'write', 'xcor', 'ycor']
 | |
| _tg_utilities = ['write_docstringdict', 'done', 'mainloop']
 | |
| _math_functions = ['acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'cosh',
 | |
|         'e', 'exp', 'fabs', 'floor', 'fmod', 'frexp', 'hypot', 'ldexp', 'log',
 | |
|         'log10', 'modf', 'pi', 'pow', 'sin', 'sinh', 'sqrt', 'tan', 'tanh']
 | |
| 
 | |
| __all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions +
 | |
|            _tg_utilities + _math_functions)
 | |
| 
 | |
| _alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos',
 | |
|                'pu', 'rt', 'seth', 'setpos', 'setposition', 'st',
 | |
|                'turtlesize', 'up', 'width']
 | |
| 
 | |
| _CFG = {"width" : 0.5,               # Screen
 | |
|         "height" : 0.75,
 | |
|         "canvwidth" : 400,
 | |
|         "canvheight": 300,
 | |
|         "leftright": None,
 | |
|         "topbottom": None,
 | |
|         "mode": "standard",          # TurtleScreen
 | |
|         "colormode": 1.0,
 | |
|         "delay": 10,
 | |
|         "undobuffersize": 1000,      # RawTurtle
 | |
|         "shape": "classic",
 | |
|         "pencolor" : "black",
 | |
|         "fillcolor" : "black",
 | |
|         "resizemode" : "noresize",
 | |
|         "visible" : True,
 | |
|         "language": "english",        # docstrings
 | |
|         "exampleturtle": "turtle",
 | |
|         "examplescreen": "screen",
 | |
|         "title": "Python Turtle Graphics",
 | |
|         "using_IDLE": False
 | |
|        }
 | |
| 
 | |
| ##print "cwd:", os.getcwd()
 | |
| ##print "__file__:", __file__
 | |
| ##
 | |
| ##def show(dictionary):
 | |
| ##    print "=========================="
 | |
| ##    for key in sorted(dictionary.keys()):
 | |
| ##        print key, ":", dictionary[key]
 | |
| ##    print "=========================="
 | |
| ##    print
 | |
| 
 | |
| def config_dict(filename):
 | |
|     """Convert content of config-file into dictionary."""
 | |
|     f = open(filename, "r")
 | |
|     cfglines = f.readlines()
 | |
|     f.close()
 | |
|     cfgdict = {}
 | |
|     for line in cfglines:
 | |
|         line = line.strip()
 | |
|         if not line or line.startswith("#"):
 | |
|             continue
 | |
|         try:
 | |
|             key, value = line.split("=")
 | |
|         except:
 | |
|             print "Bad line in config-file %s:\n%s" % (filename,line)
 | |
|             continue
 | |
|         key = key.strip()
 | |
|         value = value.strip()
 | |
|         if value in ["True", "False", "None", "''", '""']:
 | |
|             value = eval(value)
 | |
|         else:
 | |
|             try:
 | |
|                 if "." in value:
 | |
|                     value = float(value)
 | |
|                 else:
 | |
|                     value = int(value)
 | |
|             except:
 | |
|                 pass # value need not be converted
 | |
|         cfgdict[key] = value
 | |
|     return cfgdict
 | |
| 
 | |
| def readconfig(cfgdict):
 | |
|     """Read config-files, change configuration-dict accordingly.
 | |
| 
 | |
|     If there is a turtle.cfg file in the current working directory,
 | |
|     read it from there. If this contains an importconfig-value,
 | |
|     say 'myway', construct filename turtle_mayway.cfg else use
 | |
|     turtle.cfg and read it from the import-directory, where
 | |
|     turtle.py is located.
 | |
|     Update configuration dictionary first according to config-file,
 | |
|     in the import directory, then according to config-file in the
 | |
|     current working directory.
 | |
|     If no config-file is found, the default configuration is used.
 | |
|     """
 | |
|     default_cfg = "turtle.cfg"
 | |
|     cfgdict1 = {}
 | |
|     cfgdict2 = {}
 | |
|     if isfile(default_cfg):
 | |
|         cfgdict1 = config_dict(default_cfg)
 | |
|         #print "1. Loading config-file %s from: %s" % (default_cfg, os.getcwd())
 | |
|     if "importconfig" in cfgdict1:
 | |
|         default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"]
 | |
|     try:
 | |
|         head, tail = split(__file__)
 | |
|         cfg_file2 = join(head, default_cfg)
 | |
|     except:
 | |
|         cfg_file2 = ""
 | |
|     if isfile(cfg_file2):
 | |
|         #print "2. Loading config-file %s:" % cfg_file2
 | |
|         cfgdict2 = config_dict(cfg_file2)
 | |
| ##    show(_CFG)
 | |
| ##    show(cfgdict2)
 | |
|     _CFG.update(cfgdict2)
 | |
| ##    show(_CFG)
 | |
| ##    show(cfgdict1)
 | |
|     _CFG.update(cfgdict1)
 | |
| ##    show(_CFG)
 | |
| 
 | |
| try:
 | |
|     readconfig(_CFG)
 | |
| except:
 | |
|     print "No configfile read, reason unknown"
 | |
| 
 | |
| 
 | |
| class Vec2D(tuple):
 | |
|     """A 2 dimensional vector class, used as a helper class
 | |
|     for implementing turtle graphics.
 | |
|     May be useful for turtle graphics programs also.
 | |
|     Derived from tuple, so a vector is a tuple!
 | |
| 
 | |
|     Provides (for a, b vectors, k number):
 | |
|        a+b vector addition
 | |
|        a-b vector subtraction
 | |
|        a*b inner product
 | |
|        k*a and a*k multiplication with scalar
 | |
|        |a| absolute value of a
 | |
|        a.rotate(angle) rotation
 | |
|     """
 | |
|     def __new__(cls, x, y):
 | |
|         return tuple.__new__(cls, (x, y))
 | |
|     def __add__(self, other):
 | |
|         return Vec2D(self[0]+other[0], self[1]+other[1])
 | |
|     def __mul__(self, other):
 | |
|         if isinstance(other, Vec2D):
 | |
|             return self[0]*other[0]+self[1]*other[1]
 | |
|         return Vec2D(self[0]*other, self[1]*other)
 | |
|     def __rmul__(self, other):
 | |
|         if isinstance(other, int) or isinstance(other, float):
 | |
|             return Vec2D(self[0]*other, self[1]*other)
 | |
|     def __sub__(self, other):
 | |
|         return Vec2D(self[0]-other[0], self[1]-other[1])
 | |
|     def __neg__(self):
 | |
|         return Vec2D(-self[0], -self[1])
 | |
|     def __abs__(self):
 | |
|         return (self[0]**2 + self[1]**2)**0.5
 | |
|     def rotate(self, angle):
 | |
|         """rotate self counterclockwise by angle
 | |
|         """
 | |
|         perp = Vec2D(-self[1], self[0])
 | |
|         angle = angle * math.pi / 180.0
 | |
|         c, s = math.cos(angle), math.sin(angle)
 | |
|         return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s)
 | |
|     def __getnewargs__(self):
 | |
|         return (self[0], self[1])
 | |
|     def __repr__(self):
 | |
|         return "(%.2f,%.2f)" % self
 | |
| 
 | |
| 
 | |
| ##############################################################################
 | |
| ### From here up to line    : Tkinter - Interface for turtle.py            ###
 | |
| ### May be replaced by an interface to some different graphcis-toolkit     ###
 | |
| ##############################################################################
 | |
| 
 | |
| ## helper functions for Scrolled Canvas, to forward Canvas-methods
 | |
| ## to ScrolledCanvas class
 | |
| 
 | |
| def __methodDict(cls, _dict):
 | |
|     """helper function for Scrolled Canvas"""
 | |
|     baseList = list(cls.__bases__)
 | |
|     baseList.reverse()
 | |
|     for _super in baseList:
 | |
|         __methodDict(_super, _dict)
 | |
|     for key, value in cls.__dict__.items():
 | |
|         if type(value) == types.FunctionType:
 | |
|             _dict[key] = value
 | |
| 
 | |
| def __methods(cls):
 | |
|     """helper function for Scrolled Canvas"""
 | |
|     _dict = {}
 | |
|     __methodDict(cls, _dict)
 | |
|     return _dict.keys()
 | |
| 
 | |
| __stringBody = (
 | |
|     'def %(method)s(self, *args, **kw): return ' +
 | |
|     'self.%(attribute)s.%(method)s(*args, **kw)')
 | |
| 
 | |
| def __forwardmethods(fromClass, toClass, toPart, exclude = ()):
 | |
|     """Helper functions for Scrolled Canvas, used to forward
 | |
|     ScrolledCanvas-methods to Tkinter.Canvas class.
 | |
|     """
 | |
|     _dict = {}
 | |
|     __methodDict(toClass, _dict)
 | |
|     for ex in _dict.keys():
 | |
|         if ex[:1] == '_' or ex[-1:] == '_':
 | |
|             del _dict[ex]
 | |
|     for ex in exclude:
 | |
|         if _dict.has_key(ex):
 | |
|             del _dict[ex]
 | |
|     for ex in __methods(fromClass):
 | |
|         if _dict.has_key(ex):
 | |
|             del _dict[ex]
 | |
| 
 | |
|     for method, func in _dict.items():
 | |
|         d = {'method': method, 'func': func}
 | |
|         if type(toPart) == types.StringType:
 | |
|             execString = \
 | |
|                 __stringBody % {'method' : method, 'attribute' : toPart}
 | |
|         exec execString in d
 | |
|         fromClass.__dict__[method] = d[method]
 | |
| 
 | |
| 
 | |
| class ScrolledCanvas(TK.Frame):
 | |
|     """Modeled after the scrolled canvas class from Grayons's Tkinter book.
 | |
| 
 | |
|     Used as the default canvas, which pops up automatically when
 | |
|     using turtle graphics functions or the Turtle class.
 | |
|     """
 | |
|     def __init__(self, master, width=500, height=350,
 | |
|                                           canvwidth=600, canvheight=500):
 | |
|         TK.Frame.__init__(self, master, width=width, height=height)
 | |
|         self._rootwindow = self.winfo_toplevel()
 | |
|         self.width, self.height = width, height
 | |
|         self.canvwidth, self.canvheight = canvwidth, canvheight
 | |
|         self.bg = "white"
 | |
|         self._canvas = TK.Canvas(master, width=width, height=height,
 | |
|                                  bg=self.bg, relief=TK.SUNKEN, borderwidth=2)
 | |
|         self.hscroll = TK.Scrollbar(master, command=self._canvas.xview,
 | |
|                                     orient=TK.HORIZONTAL)
 | |
|         self.vscroll = TK.Scrollbar(master, command=self._canvas.yview)
 | |
|         self._canvas.configure(xscrollcommand=self.hscroll.set,
 | |
|                                yscrollcommand=self.vscroll.set)
 | |
|         self.rowconfigure(0, weight=1, minsize=0)
 | |
|         self.columnconfigure(0, weight=1, minsize=0)
 | |
|         self._canvas.grid(padx=1, in_ = self, pady=1, row=0,
 | |
|                 column=0, rowspan=1, columnspan=1, sticky='news')
 | |
|         self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
 | |
|                 column=1, rowspan=1, columnspan=1, sticky='news')
 | |
|         self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
 | |
|                 column=0, rowspan=1, columnspan=1, sticky='news')
 | |
|         self.reset()
 | |
|         self._rootwindow.bind('<Configure>', self.onResize)
 | |
| 
 | |
|     def reset(self, canvwidth=None, canvheight=None, bg = None):
 | |
|         """Ajust canvas and scrollbars according to given canvas size."""
 | |
|         if canvwidth:
 | |
|             self.canvwidth = canvwidth
 | |
|         if canvheight:
 | |
|             self.canvheight = canvheight
 | |
|         if bg:
 | |
|             self.bg = bg
 | |
|         self._canvas.config(bg=bg,
 | |
|                         scrollregion=(-self.canvwidth//2, -self.canvheight//2,
 | |
|                                        self.canvwidth//2, self.canvheight//2))
 | |
|         self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) /
 | |
|                                                                self.canvwidth)
 | |
|         self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) /
 | |
|                                                               self.canvheight)
 | |
|         self.adjustScrolls()
 | |
| 
 | |
| 
 | |
|     def adjustScrolls(self):
 | |
|         """ Adjust scrollbars according to window- and canvas-size.
 | |
|         """
 | |
|         cwidth = self._canvas.winfo_width()
 | |
|         cheight = self._canvas.winfo_height()
 | |
|         self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth)
 | |
|         self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight)
 | |
|         if cwidth < self.canvwidth or cheight < self.canvheight:
 | |
|             self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
 | |
|                               column=0, rowspan=1, columnspan=1, sticky='news')
 | |
|             self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
 | |
|                               column=1, rowspan=1, columnspan=1, sticky='news')
 | |
|         else:
 | |
|             self.hscroll.grid_forget()
 | |
|             self.vscroll.grid_forget()
 | |
| 
 | |
|     def onResize(self, event):
 | |
|         """self-explanatory"""
 | |
|         self.adjustScrolls()
 | |
| 
 | |
|     def bbox(self, *args):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         return self._canvas.bbox(*args)
 | |
| 
 | |
|     def cget(self, *args, **kwargs):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         return self._canvas.cget(*args, **kwargs)
 | |
| 
 | |
|     def config(self, *args, **kwargs):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         self._canvas.config(*args, **kwargs)
 | |
| 
 | |
|     def bind(self, *args, **kwargs):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         self._canvas.bind(*args, **kwargs)
 | |
| 
 | |
|     def unbind(self, *args, **kwargs):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         self._canvas.unbind(*args, **kwargs)
 | |
| 
 | |
|     def focus_force(self):
 | |
|         """ 'forward' method, which canvas itself has inherited...
 | |
|         """
 | |
|         self._canvas.focus_force()
 | |
| 
 | |
| __forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas')
 | |
| 
 | |
| 
 | |
| class _Root(TK.Tk):
 | |
|     """Root class for Screen based on Tkinter."""
 | |
|     def __init__(self):
 | |
|         TK.Tk.__init__(self)
 | |
| 
 | |
|     def setupcanvas(self, width, height, cwidth, cheight):
 | |
|         self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight)
 | |
|         self._canvas.pack(expand=1, fill="both")
 | |
| 
 | |
|     def _getcanvas(self):
 | |
|         return self._canvas
 | |
| 
 | |
|     def set_geometry(self, width, height, startx, starty):
 | |
|         self.geometry("%dx%d%+d%+d"%(width, height, startx, starty))
 | |
| 
 | |
|     def ondestroy(self, destroy):
 | |
|         self.wm_protocol("WM_DELETE_WINDOW", destroy)
 | |
| 
 | |
|     def win_width(self):
 | |
|         return self.winfo_screenwidth()
 | |
| 
 | |
|     def win_height(self):
 | |
|         return self.winfo_screenheight()
 | |
| 
 | |
| Canvas = TK.Canvas
 | |
| 
 | |
| 
 | |
| class TurtleScreenBase(object):
 | |
|     """Provide the basic graphics functionality.
 | |
|        Interface between Tkinter and turtle.py.
 | |
| 
 | |
|        To port turtle.py to some different graphics toolkit
 | |
|        a corresponding TurtleScreenBase class has to be implemented.
 | |
|     """
 | |
| 
 | |
|     @staticmethod
 | |
|     def _blankimage():
 | |
|         """return a blank image object
 | |
|         """
 | |
|         img = TK.PhotoImage(width=1, height=1)
 | |
|         img.blank()
 | |
|         return img
 | |
| 
 | |
|     @staticmethod
 | |
|     def _image(filename):
 | |
|         """return an image object containing the
 | |
|         imagedata from a gif-file named filename.
 | |
|         """
 | |
|         return TK.PhotoImage(file=filename)
 | |
| 
 | |
|     def __init__(self, cv):
 | |
|         self.cv = cv
 | |
|         if isinstance(cv, ScrolledCanvas):
 | |
|             w = self.cv.canvwidth
 | |
|             h = self.cv.canvheight
 | |
|         else:  # expected: ordinary TK.Canvas
 | |
|             w = int(self.cv.cget("width"))
 | |
|             h = int(self.cv.cget("height"))
 | |
|             self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 ))
 | |
|         self.canvwidth = w
 | |
|         self.canvheight = h
 | |
|         self.xscale = self.yscale = 1.0
 | |
| 
 | |
|     def _createpoly(self):
 | |
|         """Create an invisible polygon item on canvas self.cv)
 | |
|         """
 | |
|         return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="")
 | |
| 
 | |
|     def _drawpoly(self, polyitem, coordlist, fill=None,
 | |
|                   outline=None, width=None, top=False):
 | |
|         """Configure polygonitem polyitem according to provided
 | |
|         arguments:
 | |
|         coordlist is sequence of coordinates
 | |
|         fill is filling color
 | |
|         outline is outline color
 | |
|         top is a boolean value, which specifies if polyitem
 | |
|         will be put on top of the canvas' displaylist so it
 | |
|         will not be covered by other items.
 | |
|         """
 | |
|         cl = []
 | |
|         for x, y in coordlist:
 | |
|             cl.append(x * self.xscale)
 | |
|             cl.append(-y * self.yscale)
 | |
|         self.cv.coords(polyitem, *cl)
 | |
|         if fill is not None:
 | |
|             self.cv.itemconfigure(polyitem, fill=fill)
 | |
|         if outline is not None:
 | |
|             self.cv.itemconfigure(polyitem, outline=outline)
 | |
|         if width is not None:
 | |
|             self.cv.itemconfigure(polyitem, width=width)
 | |
|         if top:
 | |
|             self.cv.tag_raise(polyitem)
 | |
| 
 | |
|     def _createline(self):
 | |
|         """Create an invisible line item on canvas self.cv)
 | |
|         """
 | |
|         return self.cv.create_line(0, 0, 0, 0, fill="", width=2,
 | |
|                                    capstyle = TK.ROUND)
 | |
| 
 | |
|     def _drawline(self, lineitem, coordlist=None,
 | |
|                   fill=None, width=None, top=False):
 | |
|         """Configure lineitem according to provided arguments:
 | |
|         coordlist is sequence of coordinates
 | |
|         fill is drawing color
 | |
|         width is width of drawn line.
 | |
|         top is a boolean value, which specifies if polyitem
 | |
|         will be put on top of the canvas' displaylist so it
 | |
|         will not be covered by other items.
 | |
|         """
 | |
|         if coordlist is not None:
 | |
|             cl = []
 | |
|             for x, y in coordlist:
 | |
|                 cl.append(x * self.xscale)
 | |
|                 cl.append(-y * self.yscale)
 | |
|             self.cv.coords(lineitem, *cl)
 | |
|         if fill is not None:
 | |
|             self.cv.itemconfigure(lineitem, fill=fill)
 | |
|         if width is not None:
 | |
|             self.cv.itemconfigure(lineitem, width=width)
 | |
|         if top:
 | |
|             self.cv.tag_raise(lineitem)
 | |
| 
 | |
|     def _delete(self, item):
 | |
|         """Delete graphics item from canvas.
 | |
|         If item is"all" delete all graphics items.
 | |
|         """
 | |
|         self.cv.delete(item)
 | |
| 
 | |
|     def _update(self):
 | |
|         """Redraw graphics items on canvas
 | |
|         """
 | |
|         self.cv.update()
 | |
| 
 | |
|     def _delay(self, delay):
 | |
|         """Delay subsequent canvas actions for delay ms."""
 | |
|         self.cv.after(delay)
 | |
| 
 | |
|     def _iscolorstring(self, color):
 | |
|         """Check if the string color is a legal Tkinter color string.
 | |
|         """
 | |
|         try:
 | |
|             rgb = self.cv.winfo_rgb(color)
 | |
|             ok = True
 | |
|         except TK.TclError:
 | |
|             ok = False
 | |
|         return ok
 | |
| 
 | |
|     def _bgcolor(self, color=None):
 | |
|         """Set canvas' backgroundcolor if color is not None,
 | |
|         else return backgroundcolor."""
 | |
|         if color is not None:
 | |
|             self.cv.config(bg = color)
 | |
|             self._update()
 | |
|         else:
 | |
|             return self.cv.cget("bg")
 | |
| 
 | |
|     def _write(self, pos, txt, align, font, pencolor):
 | |
|         """Write txt at pos in canvas with specified font
 | |
|         and color.
 | |
|         Return text item and x-coord of right bottom corner
 | |
|         of text's bounding box."""
 | |
|         x, y = pos
 | |
|         x = x * self.xscale
 | |
|         y = y * self.yscale
 | |
|         anchor = {"left":"sw", "center":"s", "right":"se" }
 | |
|         item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align],
 | |
|                                         fill = pencolor, font = font)
 | |
|         x0, y0, x1, y1 = self.cv.bbox(item)
 | |
|         self.cv.update()
 | |
|         return item, x1-1
 | |
| 
 | |
| ##    def _dot(self, pos, size, color):
 | |
| ##        """may be implemented for some other graphics toolkit"""
 | |
| 
 | |
|     def _onclick(self, item, fun, num=1, add=None):
 | |
|         """Bind fun to mouse-click event on turtle.
 | |
|         fun must be a function with two arguments, the coordinates
 | |
|         of the clicked point on the canvas.
 | |
|         num, the number of the mouse-button defaults to 1
 | |
|         """
 | |
|         if fun is None:
 | |
|             self.cv.tag_unbind(item, "<Button-%s>" % num)
 | |
|         else:
 | |
|             def eventfun(event):
 | |
|                 x, y = (self.cv.canvasx(event.x)/self.xscale,
 | |
|                         -self.cv.canvasy(event.y)/self.yscale)
 | |
|                 fun(x, y)
 | |
|             self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add)
 | |
| 
 | |
|     def _onrelease(self, item, fun, num=1, add=None):
 | |
|         """Bind fun to mouse-button-release event on turtle.
 | |
|         fun must be a function with two arguments, the coordinates
 | |
|         of the point on the canvas where mouse button is released.
 | |
|         num, the number of the mouse-button defaults to 1
 | |
| 
 | |
|         If a turtle is clicked, first _onclick-event will be performed,
 | |
|         then _onscreensclick-event.
 | |
|         """
 | |
|         if fun is None:
 | |
|             self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num)
 | |
|         else:
 | |
|             def eventfun(event):
 | |
|                 x, y = (self.cv.canvasx(event.x)/self.xscale,
 | |
|                         -self.cv.canvasy(event.y)/self.yscale)
 | |
|                 fun(x, y)
 | |
|             self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num,
 | |
|                              eventfun, add)
 | |
| 
 | |
|     def _ondrag(self, item, fun, num=1, add=None):
 | |
|         """Bind fun to mouse-move-event (with pressed mouse button) on turtle.
 | |
|         fun must be a function with two arguments, the coordinates of the
 | |
|         actual mouse position on the canvas.
 | |
|         num, the number of the mouse-button defaults to 1
 | |
| 
 | |
|         Every sequence of mouse-move-events on a turtle is preceded by a
 | |
|         mouse-click event on that turtle.
 | |
|         """
 | |
|         if fun is None:
 | |
|             self.cv.tag_unbind(item, "<Button%s-Motion>" % num)
 | |
|         else:
 | |
|             def eventfun(event):
 | |
|                 try:
 | |
|                     x, y = (self.cv.canvasx(event.x)/self.xscale,
 | |
|                            -self.cv.canvasy(event.y)/self.yscale)
 | |
|                     fun(x, y)
 | |
|                 except:
 | |
|                     pass
 | |
|             self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add)
 | |
| 
 | |
|     def _onscreenclick(self, fun, num=1, add=None):
 | |
|         """Bind fun to mouse-click event on canvas.
 | |
|         fun must be a function with two arguments, the coordinates
 | |
|         of the clicked point on the canvas.
 | |
|         num, the number of the mouse-button defaults to 1
 | |
| 
 | |
|         If a turtle is clicked, first _onclick-event will be performed,
 | |
|         then _onscreensclick-event.
 | |
|         """
 | |
|         if fun is None:
 | |
|             self.cv.unbind("<Button-%s>" % num)
 | |
|         else:
 | |
|             def eventfun(event):
 | |
|                 x, y = (self.cv.canvasx(event.x)/self.xscale,
 | |
|                         -self.cv.canvasy(event.y)/self.yscale)
 | |
|                 fun(x, y)
 | |
|             self.cv.bind("<Button-%s>" % num, eventfun, add)
 | |
| 
 | |
|     def _onkey(self, fun, key):
 | |
|         """Bind fun to key-release event of key.
 | |
|         Canvas must have focus. See method listen
 | |
|         """
 | |
|         if fun is None:
 | |
|             self.cv.unbind("<KeyRelease-%s>" % key, None)
 | |
|         else:
 | |
|             def eventfun(event):
 | |
|                 fun()
 | |
|             self.cv.bind("<KeyRelease-%s>" % key, eventfun)
 | |
| 
 | |
|     def _listen(self):
 | |
|         """Set focus on canvas (in order to collect key-events)
 | |
|         """
 | |
|         self.cv.focus_force()
 | |
| 
 | |
|     def _ontimer(self, fun, t):
 | |
|         """Install a timer, which calls fun after t milliseconds.
 | |
|         """
 | |
|         if t == 0:
 | |
|             self.cv.after_idle(fun)
 | |
|         else:
 | |
|             self.cv.after(t, fun)
 | |
| 
 | |
|     def _createimage(self, image):
 | |
|         """Create and return image item on canvas.
 | |
|         """
 | |
|         return self.cv.create_image(0, 0, image=image)
 | |
| 
 | |
|     def _drawimage(self, item, (x, y), image):
 | |
|         """Configure image item as to draw image object
 | |
|         at position (x,y) on canvas)
 | |
|         """
 | |
|         self.cv.coords(item, (x * self.xscale, -y * self.yscale))
 | |
|         self.cv.itemconfig(item, image=image)
 | |
| 
 | |
|     def _setbgpic(self, item, image):
 | |
|         """Configure image item as to draw image object
 | |
|         at center of canvas. Set item to the first item
 | |
|         in the displaylist, so it will be drawn below
 | |
|         any other item ."""
 | |
|         self.cv.itemconfig(item, image=image)
 | |
|         self.cv.tag_lower(item)
 | |
| 
 | |
|     def _type(self, item):
 | |
|         """Return 'line' or 'polygon' or 'image' depending on
 | |
|         type of item.
 | |
|         """
 | |
|         return self.cv.type(item)
 | |
| 
 | |
|     def _pointlist(self, item):
 | |
|         """returns list of coordinate-pairs of points of item
 | |
|         Example (for insiders):
 | |
|         >>> from turtle import *
 | |
|         >>> getscreen()._pointlist(getturtle().turtle._item)
 | |
|         [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982),
 | |
|         (9.9999999999999982, 0.0)]
 | |
|         >>> """
 | |
|         cl = self.cv.coords(item)
 | |
|         pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)]
 | |
|         return  pl
 | |
| 
 | |
|     def _setscrollregion(self, srx1, sry1, srx2, sry2):
 | |
|         self.cv.config(scrollregion=(srx1, sry1, srx2, sry2))
 | |
| 
 | |
|     def _rescale(self, xscalefactor, yscalefactor):
 | |
|         items = self.cv.find_all()
 | |
|         for item in items:
 | |
|             coordinates = self.cv.coords(item)
 | |
|             newcoordlist = []
 | |
|             while coordinates:
 | |
|                 x, y = coordinates[:2]
 | |
|                 newcoordlist.append(x * xscalefactor)
 | |
|                 newcoordlist.append(y * yscalefactor)
 | |
|                 coordinates = coordinates[2:]
 | |
|             self.cv.coords(item, *newcoordlist)
 | |
| 
 | |
|     def _resize(self, canvwidth=None, canvheight=None, bg=None):
 | |
|         """Resize the canvas, the turtles are drawing on. Does
 | |
|         not alter the drawing window.
 | |
|         """
 | |
|         # needs amendment
 | |
|         if not isinstance(self.cv, ScrolledCanvas):
 | |
|             return self.canvwidth, self.canvheight
 | |
|         if canvwidth is None and canvheight is None and bg is None:
 | |
|             return self.cv.canvwidth, self.cv.canvheight
 | |
|         if canvwidth is not None:
 | |
|             self.canvwidth = canvwidth
 | |
|         if canvheight is not None:
 | |
|             self.canvheight = canvheight
 | |
|         self.cv.reset(canvwidth, canvheight, bg)
 | |
| 
 | |
|     def _window_size(self):
 | |
|         """ Return the width and height of the turtle window.
 | |
|         """
 | |
|         width = self.cv.winfo_width()
 | |
|         if width <= 1:  # the window isn't managed by a geometry manager
 | |
|             width = self.cv['width']
 | |
|         height = self.cv.winfo_height()
 | |
|         if height <= 1: # the window isn't managed by a geometry manager
 | |
|             height = self.cv['height']
 | |
|         return width, height
 | |
| 
 | |
| 
 | |
| ##############################################################################
 | |
| ###                  End of Tkinter - interface                            ###
 | |
| ##############################################################################
 | |
| 
 | |
| 
 | |
| class Terminator (Exception):
 | |
|     """Will be raised in TurtleScreen.update, if _RUNNING becomes False.
 | |
| 
 | |
|     Thus stops execution of turtle graphics script. Main purpose: use in
 | |
|     in the Demo-Viewer turtle.Demo.py.
 | |
|     """
 | |
|     pass
 | |
| 
 | |
| 
 | |
| class TurtleGraphicsError(Exception):
 | |
|     """Some TurtleGraphics Error
 | |
|     """
 | |
| 
 | |
| 
 | |
| class Shape(object):
 | |
|     """Data structure modeling shapes.
 | |
| 
 | |
|     attribute _type is one of "polygon", "image", "compound"
 | |
|     attribute _data is - depending on _type a poygon-tuple,
 | |
|     an image or a list constructed using the addcomponent method.
 | |
|     """
 | |
|     def __init__(self, type_, data=None):
 | |
|         self._type = type_
 | |
|         if type_ == "polygon":
 | |
|             if isinstance(data, list):
 | |
|                 data = tuple(data)
 | |
|         elif type_ == "image":
 | |
|             if isinstance(data, str):
 | |
|                 if data.lower().endswith(".gif") and isfile(data):
 | |
|                     data = TurtleScreen._image(data)
 | |
|                 # else data assumed to be Photoimage
 | |
|         elif type_ == "compound":
 | |
|             data = []
 | |
|         else:
 | |
|             raise TurtleGraphicsError("There is no shape type %s" % type_)
 | |
|         self._data = data
 | |
| 
 | |
|     def addcomponent(self, poly, fill, outline=None):
 | |
|         """Add component to a shape of type compound.
 | |
| 
 | |
|         Arguments: poly is a polygon, i. e. a tuple of number pairs.
 | |
|         fill is the fillcolor of the component,
 | |
|         outline is the outline color of the component.
 | |
| 
 | |
|         call (for a Shapeobject namend s):
 | |
|         --   s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue")
 | |
| 
 | |
|         Example:
 | |
|         >>> poly = ((0,0),(10,-5),(0,10),(-10,-5))
 | |
|         >>> s = Shape("compound")
 | |
|         >>> s.addcomponent(poly, "red", "blue")
 | |
|         ### .. add more components and then use register_shape()
 | |
|         """
 | |
|         if self._type != "compound":
 | |
|             raise TurtleGraphicsError("Cannot add component to %s Shape"
 | |
|                                                                 % self._type)
 | |
|         if outline is None:
 | |
|             outline = fill
 | |
|         self._data.append([poly, fill, outline])
 | |
| 
 | |
| 
 | |
| class Tbuffer(object):
 | |
|     """Ring buffer used as undobuffer for RawTurtle objects."""
 | |
|     def __init__(self, bufsize=10):
 | |
|         self.bufsize = bufsize
 | |
|         self.buffer = [[None]] * bufsize
 | |
|         self.ptr = -1
 | |
|         self.cumulate = False
 | |
|     def reset(self, bufsize=None):
 | |
|         if bufsize is None:
 | |
|             for i in range(self.bufsize):
 | |
|                 self.buffer[i] = [None]
 | |
|         else:
 | |
|             self.bufsize = bufsize
 | |
|             self.buffer = [[None]] * bufsize
 | |
|         self.ptr = -1
 | |
|     def push(self, item):
 | |
|         if self.bufsize > 0:
 | |
|             if not self.cumulate:
 | |
|                 self.ptr = (self.ptr + 1) % self.bufsize
 | |
|                 self.buffer[self.ptr] = item
 | |
|             else:
 | |
|                 self.buffer[self.ptr].append(item)
 | |
|     def pop(self):
 | |
|         if self.bufsize > 0:
 | |
|             item = self.buffer[self.ptr]
 | |
|             if item is None:
 | |
|                 return None
 | |
|             else:
 | |
|                 self.buffer[self.ptr] = [None]
 | |
|                 self.ptr = (self.ptr - 1) % self.bufsize
 | |
|                 return (item)
 | |
|     def nr_of_items(self):
 | |
|         return self.bufsize - self.buffer.count([None])
 | |
|     def __repr__(self):
 | |
|         return str(self.buffer) + " " + str(self.ptr)
 | |
| 
 | |
| 
 | |
| 
 | |
| class TurtleScreen(TurtleScreenBase):
 | |
|     """Provides screen oriented methods like setbg etc.
 | |
| 
 | |
|     Only relies upon the methods of TurtleScreenBase and NOT
 | |
|     upon components of the underlying graphics toolkit -
 | |
|     which is Tkinter in this case.
 | |
|     """
 | |
| #    _STANDARD_DELAY = 5
 | |
|     _RUNNING = True
 | |
| 
 | |
|     def __init__(self, cv, mode=_CFG["mode"],
 | |
|                  colormode=_CFG["colormode"], delay=_CFG["delay"]):
 | |
|         self._shapes = {
 | |
|                    "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))),
 | |
|                   "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7),
 | |
|                               (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6),
 | |
|                               (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6),
 | |
|                               (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10),
 | |
|                               (2,14))),
 | |
|                   "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88),
 | |
|                               (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51),
 | |
|                               (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0),
 | |
|                               (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09),
 | |
|                               (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51),
 | |
|                               (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))),
 | |
|                   "square" : Shape("polygon", ((10,-10), (10,10), (-10,10),
 | |
|                               (-10,-10))),
 | |
|                 "triangle" : Shape("polygon", ((10,-5.77), (0,11.55),
 | |
|                               (-10,-5.77))),
 | |
|                   "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))),
 | |
|                    "blank" : Shape("image", self._blankimage())
 | |
|                   }
 | |
| 
 | |
|         self._bgpics = {"nopic" : ""}
 | |
| 
 | |
|         TurtleScreenBase.__init__(self, cv)
 | |
|         self._mode = mode
 | |
|         self._delayvalue = delay
 | |
|         self._colormode = _CFG["colormode"]
 | |
|         self._keys = []
 | |
|         self.clear()
 | |
| 
 | |
|     def clear(self):
 | |
|         """Delete all drawings and all turtles from the TurtleScreen.
 | |
| 
 | |
|         Reset empty TurtleScreen to it's initial state: white background,
 | |
|         no backgroundimage, no eventbindings and tracing on.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         screen.clear()
 | |
| 
 | |
|         Note: this method is not available as function.
 | |
|         """
 | |
|         self._delayvalue = _CFG["delay"]
 | |
|         self._colormode = _CFG["colormode"]
 | |
|         self._delete("all")
 | |
|         self._bgpic = self._createimage("")
 | |
|         self._bgpicname = "nopic"
 | |
|         self._tracing = 1
 | |
|         self._updatecounter = 0
 | |
|         self._turtles = []
 | |
|         self.bgcolor("white")
 | |
|         for btn in 1, 2, 3:
 | |
|             self.onclick(None, btn)
 | |
|         for key in self._keys[:]:
 | |
|             self.onkey(None, key)
 | |
|         Turtle._pen = None
 | |
| 
 | |
|     def mode(self, mode=None):
 | |
|         """Set turtle-mode ('standard', 'logo' or 'world') and perform reset.
 | |
| 
 | |
|         Optional argument:
 | |
|         mode -- on of the strings 'standard', 'logo' or 'world'
 | |
| 
 | |
|         Mode 'standard' is compatible with turtle.py.
 | |
|         Mode 'logo' is compatible with most Logo-Turtle-Graphics.
 | |
|         Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in
 | |
|         this mode angles appear distorted if x/y unit-ratio doesn't equal 1.
 | |
|         If mode is not given, return the current mode.
 | |
| 
 | |
|              Mode      Initial turtle heading     positive angles
 | |
|          ------------|-------------------------|-------------------
 | |
|           'standard'    to the right (east)       counterclockwise
 | |
|             'logo'        upward    (north)         clockwise
 | |
| 
 | |
|         Examples:
 | |
|         >>> mode('logo')   # resets turtle heading to north
 | |
|         >>> mode()
 | |
|         'logo'
 | |
|         """
 | |
|         if mode == None:
 | |
|             return self._mode
 | |
|         mode = mode.lower()
 | |
|         if mode not in ["standard", "logo", "world"]:
 | |
|             raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode)
 | |
|         self._mode = mode
 | |
|         if mode in ["standard", "logo"]:
 | |
|             self._setscrollregion(-self.canvwidth//2, -self.canvheight//2,
 | |
|                                        self.canvwidth//2, self.canvheight//2)
 | |
|             self.xscale = self.yscale = 1.0
 | |
|         self.reset()
 | |
| 
 | |
|     def setworldcoordinates(self, llx, lly, urx, ury):
 | |
|         """Set up a user defined coordinate-system.
 | |
| 
 | |
|         Arguments:
 | |
|         llx -- a number, x-coordinate of lower left corner of canvas
 | |
|         lly -- a number, y-coordinate of lower left corner of canvas
 | |
|         urx -- a number, x-coordinate of upper right corner of canvas
 | |
|         ury -- a number, y-coordinate of upper right corner of canvas
 | |
| 
 | |
|         Set up user coodinat-system and switch to mode 'world' if necessary.
 | |
|         This performs a screen.reset. If mode 'world' is already active,
 | |
|         all drawings are redrawn according to the new coordinates.
 | |
| 
 | |
|         But ATTENTION: in user-defined coordinatesystems angles may appear
 | |
|         distorted. (see Screen.mode())
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.setworldcoordinates(-10,-0.5,50,1.5)
 | |
|         >>> for _ in range(36):
 | |
|                 left(10)
 | |
|                 forward(0.5)
 | |
|         """
 | |
|         if self.mode() != "world":
 | |
|             self.mode("world")
 | |
|         xspan = float(urx - llx)
 | |
|         yspan = float(ury - lly)
 | |
|         wx, wy = self._window_size()
 | |
|         self.screensize(wx-20, wy-20)
 | |
|         oldxscale, oldyscale = self.xscale, self.yscale
 | |
|         self.xscale = self.canvwidth / xspan
 | |
|         self.yscale = self.canvheight / yspan
 | |
|         srx1 = llx * self.xscale
 | |
|         sry1 = -ury * self.yscale
 | |
|         srx2 = self.canvwidth + srx1
 | |
|         sry2 = self.canvheight + sry1
 | |
|         self._setscrollregion(srx1, sry1, srx2, sry2)
 | |
|         self._rescale(self.xscale/oldxscale, self.yscale/oldyscale)
 | |
|         self.update()
 | |
| 
 | |
|     def register_shape(self, name, shape=None):
 | |
|         """Adds a turtle shape to TurtleScreen's shapelist.
 | |
| 
 | |
|         Arguments:
 | |
|         (1) name is the name of a gif-file and shape is None.
 | |
|             Installs the corresponding image shape.
 | |
|             !! Image-shapes DO NOT rotate when turning the turtle,
 | |
|             !! so they do not display the heading of the turtle!
 | |
|         (2) name is an arbitrary string and shape is a tuple
 | |
|             of pairs of coordinates. Installs the corresponding
 | |
|             polygon shape
 | |
|         (3) name is an arbitrary string and shape is a
 | |
|             (compound) Shape object. Installs the corresponding
 | |
|             compound shape.
 | |
|         To use a shape, you have to issue the command shape(shapename).
 | |
| 
 | |
|         call: register_shape("turtle.gif")
 | |
|         --or: register_shape("tri", ((0,0), (10,10), (-10,10)))
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3)))
 | |
| 
 | |
|         """
 | |
|         if shape is None:
 | |
|             # image
 | |
|             if name.lower().endswith(".gif"):
 | |
|                 shape = Shape("image", self._image(name))
 | |
|             else:
 | |
|                 raise TurtleGraphicsError("Bad arguments for register_shape.\n"
 | |
|                                           + "Use  help(register_shape)" )
 | |
|         elif isinstance(shape, tuple):
 | |
|             shape = Shape("polygon", shape)
 | |
|         ## else shape assumed to be Shape-instance
 | |
|         self._shapes[name] = shape
 | |
|         # print "shape added:" , self._shapes
 | |
| 
 | |
|     def _colorstr(self, color):
 | |
|         """Return color string corresponding to args.
 | |
| 
 | |
|         Argument may be a string or a tuple of three
 | |
|         numbers corresponding to actual colormode,
 | |
|         i.e. in the range 0<=n<=colormode.
 | |
| 
 | |
|         If the argument doesn't represent a color,
 | |
|         an error is raised.
 | |
|         """
 | |
|         if len(color) == 1:
 | |
|             color = color[0]
 | |
|         if isinstance(color, str):
 | |
|             if self._iscolorstring(color) or color == "":
 | |
|                 return color
 | |
|             else:
 | |
|                 raise TurtleGraphicsError("bad color string: %s" % str(color))
 | |
|         try:
 | |
|             r, g, b = color
 | |
|         except:
 | |
|             raise TurtleGraphicsError("bad color arguments: %s" % str(color))
 | |
|         if self._colormode == 1.0:
 | |
|             r, g, b = [round(255.0*x) for x in (r, g, b)]
 | |
|         if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
 | |
|             raise TurtleGraphicsError("bad color sequence: %s" % str(color))
 | |
|         return "#%02x%02x%02x" % (r, g, b)
 | |
| 
 | |
|     def _color(self, cstr):
 | |
|         if not cstr.startswith("#"):
 | |
|             return cstr
 | |
|         if len(cstr) == 7:
 | |
|             cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)]
 | |
|         elif len(cstr) == 4:
 | |
|             cl = [16*int(cstr[h], 16) for h in cstr[1:]]
 | |
|         else:
 | |
|             raise TurtleGraphicsError("bad colorstring: %s" % cstr)
 | |
|         return tuple([c * self._colormode/255 for c in cl])
 | |
| 
 | |
|     def colormode(self, cmode=None):
 | |
|         """Return the colormode or set it to 1.0 or 255.
 | |
| 
 | |
|         Optional argument:
 | |
|         cmode -- one of the values 1.0 or 255
 | |
| 
 | |
|         r, g, b values of colortriples have to be in range 0..cmode.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.colormode()
 | |
|         1.0
 | |
|         >>> screen.colormode(255)
 | |
|         >>> turtle.pencolor(240,160,80)
 | |
|         """
 | |
|         if cmode is None:
 | |
|             return self._colormode
 | |
|         if cmode == 1.0:
 | |
|             self._colormode = float(cmode)
 | |
|         elif cmode == 255:
 | |
|             self._colormode = int(cmode)
 | |
| 
 | |
|     def reset(self):
 | |
|         """Reset all Turtles on the Screen to their initial state.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.reset()
 | |
|         """
 | |
|         for turtle in self._turtles:
 | |
|             turtle._setmode(self._mode)
 | |
|             turtle.reset()
 | |
| 
 | |
|     def turtles(self):
 | |
|         """Return the list of turtles on the screen.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.turtles()
 | |
|         [<turtle.Turtle object at 0x00E11FB0>]
 | |
|         """
 | |
|         return self._turtles
 | |
| 
 | |
|     def bgcolor(self, *args):
 | |
|         """Set or return backgroundcolor of the TurtleScreen.
 | |
| 
 | |
|         Arguments (if given): a color string or three numbers
 | |
|         in the range 0..colormode or a 3-tuple of such numbers.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.bgcolor("orange")
 | |
|         >>> screen.bgcolor()
 | |
|         'orange'
 | |
|         >>> screen.bgcolor(0.5,0,0.5)
 | |
|         >>> screen.bgcolor()
 | |
|         '#800080'
 | |
|         """
 | |
|         if args:
 | |
|             color = self._colorstr(args)
 | |
|         else:
 | |
|             color = None
 | |
|         color = self._bgcolor(color)
 | |
|         if color is not None:
 | |
|             color = self._color(color)
 | |
|         return color
 | |
| 
 | |
|     def tracer(self, n=None, delay=None):
 | |
|         """Turns turtle animation on/off and set delay for update drawings.
 | |
| 
 | |
|         Optional arguments:
 | |
|         n -- nonnegative  integer
 | |
|         delay -- nonnegative  integer
 | |
| 
 | |
|         If n is given, only each n-th regular screen update is really performed.
 | |
|         (Can be used to accelerate the drawing of complex graphics.)
 | |
|         Second arguments sets delay value (see RawTurtle.delay())
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.tracer(8, 25)
 | |
|         >>> dist = 2
 | |
|         >>> for i in range(200):
 | |
|                 fd(dist)
 | |
|                 rt(90)
 | |
|                 dist += 2
 | |
|         """
 | |
|         if n is None:
 | |
|             return self._tracing
 | |
|         self._tracing = int(n)
 | |
|         self._updatecounter = 0
 | |
|         if delay is not None:
 | |
|             self._delayvalue = int(delay)
 | |
|         if self._tracing:
 | |
|             self.update()
 | |
| 
 | |
|     def delay(self, delay=None):
 | |
|         """ Return or set the drawing delay in milliseconds.
 | |
| 
 | |
|         Optional argument:
 | |
|         delay -- positive integer
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.delay(15)
 | |
|         >>> screen.delay()
 | |
|         15
 | |
|         """
 | |
|         if delay is None:
 | |
|             return self._delayvalue
 | |
|         self._delayvalue = int(delay)
 | |
| 
 | |
|     def _incrementudc(self):
 | |
|         "Increment upadate counter."""
 | |
|         if not TurtleScreen._RUNNING:
 | |
|             TurtleScreen._RUNNNING = True
 | |
|             raise Terminator
 | |
|         if self._tracing > 0:
 | |
|             self._updatecounter += 1
 | |
|             self._updatecounter %= self._tracing
 | |
| 
 | |
|     def update(self):
 | |
|         """Perform a TurtleScreen update.
 | |
|         """
 | |
|         for t in self.turtles():
 | |
|             t._update_data()
 | |
|             t._drawturtle()
 | |
|         self._update()
 | |
| 
 | |
|     def window_width(self):
 | |
|         """ Return the width of the turtle window.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.window_width()
 | |
|         640
 | |
|         """
 | |
|         return self._window_size()[0]
 | |
| 
 | |
|     def window_height(self):
 | |
|         """ Return the height of the turtle window.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.window_height()
 | |
|         480
 | |
|         """
 | |
|         return self._window_size()[1]
 | |
| 
 | |
|     def getcanvas(self):
 | |
|         """Return the Canvas of this TurtleScreen.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Screen instance named screen):
 | |
|         >>> cv = screen.getcanvas()
 | |
|         >>> cv
 | |
|         <turtle.ScrolledCanvas instance at 0x010742D8>
 | |
|         """
 | |
|         return self.cv
 | |
| 
 | |
|     def getshapes(self):
 | |
|         """Return a list of names of all currently available turtle shapes.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.getshapes()
 | |
|         ['arrow', 'blank', 'circle', ... , 'turtle']
 | |
|         """
 | |
|         return sorted(self._shapes.keys())
 | |
| 
 | |
|     def onclick(self, fun, btn=1, add=None):
 | |
|         """Bind fun to mouse-click event on canvas.
 | |
| 
 | |
|         Arguments:
 | |
|         fun -- a function with two arguments, the coordinates of the
 | |
|                clicked point on the canvas.
 | |
|         num -- the number of the mouse-button, defaults to 1
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen
 | |
|         and a Turtle instance named turtle):
 | |
| 
 | |
|         >>> screen.onclick(turtle.goto)
 | |
| 
 | |
|         ### Subsequently clicking into the TurtleScreen will
 | |
|         ### make the turtle move to the clicked point.
 | |
|         >>> screen.onclick(None)
 | |
| 
 | |
|         ### event-binding will be removed
 | |
|         """
 | |
|         self._onscreenclick(fun, btn, add)
 | |
| 
 | |
|     def onkey(self, fun, key):
 | |
|         """Bind fun to key-release event of key.
 | |
| 
 | |
|         Arguments:
 | |
|         fun -- a function with no arguments
 | |
|         key -- a string: key (e.g. "a") or key-symbol (e.g. "space")
 | |
| 
 | |
|         In order ro be able to register key-events, TurtleScreen
 | |
|         must have focus. (See method listen.)
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen
 | |
|         and a Turtle instance named turtle):
 | |
| 
 | |
|         >>> def f():
 | |
|                 fd(50)
 | |
|                 lt(60)
 | |
| 
 | |
| 
 | |
|         >>> screen.onkey(f, "Up")
 | |
|         >>> screen.listen()
 | |
| 
 | |
|         ### Subsequently the turtle can be moved by
 | |
|         ### repeatedly pressing the up-arrow key,
 | |
|         ### consequently drawing a hexagon
 | |
|         """
 | |
|         if fun == None:
 | |
|             self._keys.remove(key)
 | |
|         elif key not in self._keys:
 | |
|             self._keys.append(key)
 | |
|         self._onkey(fun, key)
 | |
| 
 | |
|     def listen(self, xdummy=None, ydummy=None):
 | |
|         """Set focus on TurtleScreen (in order to collect key-events)
 | |
| 
 | |
|         No arguments.
 | |
|         Dummy arguments are provided in order
 | |
|         to be able to pass listen to the onclick method.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.listen()
 | |
|         """
 | |
|         self._listen()
 | |
| 
 | |
|     def ontimer(self, fun, t=0):
 | |
|         """Install a timer, which calls fun after t milliseconds.
 | |
| 
 | |
|         Arguments:
 | |
|         fun -- a function with no arguments.
 | |
|         t -- a number >= 0
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
| 
 | |
|         >>> running = True
 | |
|         >>> def f():
 | |
|                 if running:
 | |
|                         fd(50)
 | |
|                         lt(60)
 | |
|                         screen.ontimer(f, 250)
 | |
| 
 | |
|         >>> f()   ### makes the turtle marching around
 | |
|         >>> running = False
 | |
|         """
 | |
|         self._ontimer(fun, t)
 | |
| 
 | |
|     def bgpic(self, picname=None):
 | |
|         """Set background image or return name of current backgroundimage.
 | |
| 
 | |
|         Optional argument:
 | |
|         picname -- a string, name of a gif-file or "nopic".
 | |
| 
 | |
|         If picname is a filename, set the corresponing image as background.
 | |
|         If picname is "nopic", delete backgroundimage, if present.
 | |
|         If picname is None, return the filename of the current backgroundimage.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.bgpic()
 | |
|         'nopic'
 | |
|         >>> screen.bgpic("landscape.gif")
 | |
|         >>> screen.bgpic()
 | |
|         'landscape.gif'
 | |
|         """
 | |
|         if picname is None:
 | |
|             return self._bgpicname
 | |
|         if picname not in self._bgpics:
 | |
|             self._bgpics[picname] = self._image(picname)
 | |
|         self._setbgpic(self._bgpic, self._bgpics[picname])
 | |
|         self._bgpicname = picname
 | |
| 
 | |
|     def screensize(self, canvwidth=None, canvheight=None, bg=None):
 | |
|         """Resize the canvas, the turtles are drawing on.
 | |
| 
 | |
|         Optional arguments:
 | |
|         canvwidth -- positive integer, new width of canvas in pixels
 | |
|         canvheight --  positive integer, new height of canvas in pixels
 | |
|         bg -- colorstring or color-tupel, new backgroundcolor
 | |
|         If no arguments are given, return current (canvaswidth, canvasheight)
 | |
| 
 | |
|         Do not alter the drawing window. To observe hidden parts of
 | |
|         the canvas use the scrollbars. (Can make visible those parts
 | |
|         of a drawing, which were outside the canvas before!)
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.screensize(2000,1500)
 | |
|             ### e. g. to search for an erroneously escaped turtle ;-)
 | |
|         """
 | |
|         return self._resize(canvwidth, canvheight, bg)
 | |
| 
 | |
|     onscreenclick = onclick
 | |
|     resetscreen = reset
 | |
|     clearscreen = clear
 | |
|     addshape = register_shape
 | |
| 
 | |
| class TNavigator(object):
 | |
|     """Navigation part of the RawTurtle.
 | |
|     Implements methods for turtle movement.
 | |
|     """
 | |
|     START_ORIENTATION = {
 | |
|         "standard": Vec2D(1.0, 0.0),
 | |
|         "world"   : Vec2D(1.0, 0.0),
 | |
|         "logo"    : Vec2D(0.0, 1.0)  }
 | |
|     DEFAULT_MODE = "standard"
 | |
|     DEFAULT_ANGLEOFFSET = 0
 | |
|     DEFAULT_ANGLEORIENT = 1
 | |
| 
 | |
|     def __init__(self, mode=DEFAULT_MODE):
 | |
|         self._angleOffset = self.DEFAULT_ANGLEOFFSET
 | |
|         self._angleOrient = self.DEFAULT_ANGLEORIENT
 | |
|         self._mode = mode
 | |
|         self.undobuffer = None
 | |
|         self.degrees()
 | |
|         self._mode = None
 | |
|         self._setmode(mode)
 | |
|         TNavigator.reset(self)
 | |
| 
 | |
|     def reset(self):
 | |
|         """reset turtle to its initial values
 | |
| 
 | |
|         Will be overwritten by parent class
 | |
|         """
 | |
|         self._position = Vec2D(0.0, 0.0)
 | |
|         self._orient =  TNavigator.START_ORIENTATION[self._mode]
 | |
| 
 | |
|     def _setmode(self, mode=None):
 | |
|         """Set turtle-mode to 'standard', 'world' or 'logo'.
 | |
|         """
 | |
|         if mode == None:
 | |
|             return self._mode
 | |
|         if mode not in ["standard", "logo", "world"]:
 | |
|             return
 | |
|         self._mode = mode
 | |
|         if mode in ["standard", "world"]:
 | |
|             self._angleOffset = 0
 | |
|             self._angleOrient = 1
 | |
|         else: # mode == "logo":
 | |
|             self._angleOffset = self._fullcircle/4.
 | |
|             self._angleOrient = -1
 | |
| 
 | |
|     def _setDegreesPerAU(self, fullcircle):
 | |
|         """Helper function for degrees() and radians()"""
 | |
|         self._fullcircle = fullcircle
 | |
|         self._degreesPerAU = 360/fullcircle
 | |
|         if self._mode == "standard":
 | |
|             self._angleOffset = 0
 | |
|         else:
 | |
|             self._angleOffset = fullcircle/4.
 | |
| 
 | |
|     def degrees(self, fullcircle=360.0):
 | |
|         """ Set angle measurement units to degrees.
 | |
| 
 | |
|         Optional argument:
 | |
|         fullcircle -  a number
 | |
| 
 | |
|         Set angle measurement units, i. e. set number
 | |
|         of 'degrees' for a full circle. Dafault value is
 | |
|         360 degrees.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.heading()
 | |
|         90
 | |
|         >>> turtle.degrees(400.0)  # angle measurement in gon
 | |
|         >>> turtle.heading()
 | |
|         100
 | |
| 
 | |
|         """
 | |
|         self._setDegreesPerAU(fullcircle)
 | |
| 
 | |
|     def radians(self):
 | |
|         """ Set the angle measurement units to radians.
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.heading()
 | |
|         90
 | |
|         >>> turtle.radians()
 | |
|         >>> turtle.heading()
 | |
|         1.5707963267948966
 | |
|         """
 | |
|         self._setDegreesPerAU(2*math.pi)
 | |
| 
 | |
|     def _go(self, distance):
 | |
|         """move turtle forward by specified distance"""
 | |
|         ende = self._position + self._orient * distance
 | |
|         self._goto(ende)
 | |
| 
 | |
|     def _rotate(self, angle):
 | |
|         """Turn turtle counterclockwise by specified angle if angle > 0."""
 | |
|         angle *= self._degreesPerAU
 | |
|         self._orient = self._orient.rotate(angle)
 | |
| 
 | |
|     def _goto(self, end):
 | |
|         """move turtle to position end."""
 | |
|         self._position = end
 | |
| 
 | |
|     def forward(self, distance):
 | |
|         """Move the turtle forward by the specified distance.
 | |
| 
 | |
|         Aliases: forward | fd
 | |
| 
 | |
|         Argument:
 | |
|         distance -- a number (integer or float)
 | |
| 
 | |
|         Move the turtle forward by the specified distance, in the direction
 | |
|         the turtle is headed.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.position()
 | |
|         (0.00, 0.00)
 | |
|         >>> turtle.forward(25)
 | |
|         >>> turtle.position()
 | |
|         (25.00,0.00)
 | |
|         >>> turtle.forward(-75)
 | |
|         >>> turtle.position()
 | |
|         (-50.00,0.00)
 | |
|         """
 | |
|         self._go(distance)
 | |
| 
 | |
|     def back(self, distance):
 | |
|         """Move the turtle backward by distance.
 | |
| 
 | |
|         Aliases: back | backward | bk
 | |
| 
 | |
|         Argument:
 | |
|         distance -- a number
 | |
| 
 | |
|         Move the turtle backward by distance ,opposite to the direction the
 | |
|         turtle is headed. Do not change the turtle's heading.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.position()
 | |
|         (0.00, 0.00)
 | |
|         >>> turtle.backward(30)
 | |
|         >>> turtle.position()
 | |
|         (-30.00, 0.00)
 | |
|         """
 | |
|         self._go(-distance)
 | |
| 
 | |
|     def right(self, angle):
 | |
|         """Turn turtle right by angle units.
 | |
| 
 | |
|         Aliases: right | rt
 | |
| 
 | |
|         Argument:
 | |
|         angle -- a number (integer or float)
 | |
| 
 | |
|         Turn turtle right by angle units. (Units are by default degrees,
 | |
|         but can be set via the degrees() and radians() functions.)
 | |
|         Angle orientation depends on mode. (See this.)
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.heading()
 | |
|         22.0
 | |
|         >>> turtle.right(45)
 | |
|         >>> turtle.heading()
 | |
|         337.0
 | |
|         """
 | |
|         self._rotate(-angle)
 | |
| 
 | |
|     def left(self, angle):
 | |
|         """Turn turtle left by angle units.
 | |
| 
 | |
|         Aliases: left | lt
 | |
| 
 | |
|         Argument:
 | |
|         angle -- a number (integer or float)
 | |
| 
 | |
|         Turn turtle left by angle units. (Units are by default degrees,
 | |
|         but can be set via the degrees() and radians() functions.)
 | |
|         Angle orientation depends on mode. (See this.)
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.heading()
 | |
|         22.0
 | |
|         >>> turtle.left(45)
 | |
|         >>> turtle.heading()
 | |
|         67.0
 | |
|         """
 | |
|         self._rotate(angle)
 | |
| 
 | |
|     def pos(self):
 | |
|         """Return the turtle's current location (x,y), as a Vec2D-vector.
 | |
| 
 | |
|         Aliases: pos | position
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pos()
 | |
|         (0.00, 240.00)
 | |
|         """
 | |
|         return self._position
 | |
| 
 | |
|     def xcor(self):
 | |
|         """ Return the turtle's x coordinate.
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> reset()
 | |
|         >>> turtle.left(60)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> print turtle.xcor()
 | |
|         50.0
 | |
|         """
 | |
|         return self._position[0]
 | |
| 
 | |
|     def ycor(self):
 | |
|         """ Return the turtle's y coordinate
 | |
|         ---
 | |
|         No arguments.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> reset()
 | |
|         >>> turtle.left(60)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> print turtle.ycor()
 | |
|         86.6025403784
 | |
|         """
 | |
|         return self._position[1]
 | |
| 
 | |
| 
 | |
|     def goto(self, x, y=None):
 | |
|         """Move turtle to an absolute position.
 | |
| 
 | |
|         Aliases: setpos | setposition | goto:
 | |
| 
 | |
|         Arguments:
 | |
|         x -- a number      or     a pair/vector of numbers
 | |
|         y -- a number             None
 | |
| 
 | |
|         call: goto(x, y)         # two coordinates
 | |
|         --or: goto((x, y))       # a pair (tuple) of coordinates
 | |
|         --or: goto(vec)          # e.g. as returned by pos()
 | |
| 
 | |
|         Move turtle to an absolute position. If the pen is down,
 | |
|         a line will be drawn. The turtle's orientation does not change.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> tp = turtle.pos()
 | |
|         >>> tp
 | |
|         (0.00, 0.00)
 | |
|         >>> turtle.setpos(60,30)
 | |
|         >>> turtle.pos()
 | |
|         (60.00,30.00)
 | |
|         >>> turtle.setpos((20,80))
 | |
|         >>> turtle.pos()
 | |
|         (20.00,80.00)
 | |
|         >>> turtle.setpos(tp)
 | |
|         >>> turtle.pos()
 | |
|         (0.00,0.00)
 | |
|         """
 | |
|         if y is None:
 | |
|             self._goto(Vec2D(*x))
 | |
|         else:
 | |
|             self._goto(Vec2D(x, y))
 | |
| 
 | |
|     def home(self):
 | |
|         """Move turtle to the origin - coordinates (0,0).
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Move turtle to the origin - coordinates (0,0) and set it's
 | |
|         heading to it's start-orientation (which depends on mode).
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.home()
 | |
|         """
 | |
|         self.goto(0, 0)
 | |
|         self.setheading(0)
 | |
| 
 | |
|     def setx(self, x):
 | |
|         """Set the turtle's first coordinate to x
 | |
| 
 | |
|         Argument:
 | |
|         x -- a number (integer or float)
 | |
| 
 | |
|         Set the turtle's first coordinate to x, leave second coordinate
 | |
|         unchanged.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.position()
 | |
|         (0.00, 240.00)
 | |
|         >>> turtle.setx(10)
 | |
|         >>> turtle.position()
 | |
|         (10.00, 240.00)
 | |
|         """
 | |
|         self._goto(Vec2D(x, self._position[1]))
 | |
| 
 | |
|     def sety(self, y):
 | |
|         """Set the turtle's second coordinate to y
 | |
| 
 | |
|         Argument:
 | |
|         y -- a number (integer or float)
 | |
| 
 | |
|         Set the turtle's first coordinate to x, second coordinate remains
 | |
|         unchanged.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.position()
 | |
|         (0.00, 40.00)
 | |
|         >>> turtle.sety(-10)
 | |
|         >>> turtle.position()
 | |
|         (0.00, -10.00)
 | |
|         """
 | |
|         self._goto(Vec2D(self._position[0], y))
 | |
| 
 | |
|     def distance(self, x, y=None):
 | |
|         """Return the distance from the turtle to (x,y) in turtle step units.
 | |
| 
 | |
|         Arguments:
 | |
|         x -- a number   or  a pair/vector of numbers   or   a turtle instance
 | |
|         y -- a number       None                            None
 | |
| 
 | |
|         call: distance(x, y)         # two coordinates
 | |
|         --or: distance((x, y))       # a pair (tuple) of coordinates
 | |
|         --or: distance(vec)          # e.g. as returned by pos()
 | |
|         --or: distance(mypen)        # where mypen is another turtle
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pos()
 | |
|         (0.00, 0.00)
 | |
|         >>> turtle.distance(30,40)
 | |
|         50.0
 | |
|         >>> pen = Turtle()
 | |
|         >>> pen.forward(77)
 | |
|         >>> turtle.distance(pen)
 | |
|         77.0
 | |
|         """
 | |
|         if y is not None:
 | |
|             pos = Vec2D(x, y)
 | |
|         if isinstance(x, Vec2D):
 | |
|             pos = x
 | |
|         elif isinstance(x, tuple):
 | |
|             pos = Vec2D(*x)
 | |
|         elif isinstance(x, TNavigator):
 | |
|             pos = x._position
 | |
|         return abs(pos - self._position)
 | |
| 
 | |
|     def towards(self, x, y=None):
 | |
|         """Return the angle of the line from the turtle's position to (x, y).
 | |
| 
 | |
|         Arguments:
 | |
|         x -- a number   or  a pair/vector of numbers   or   a turtle instance
 | |
|         y -- a number       None                            None
 | |
| 
 | |
|         call: distance(x, y)         # two coordinates
 | |
|         --or: distance((x, y))       # a pair (tuple) of coordinates
 | |
|         --or: distance(vec)          # e.g. as returned by pos()
 | |
|         --or: distance(mypen)        # where mypen is another turtle
 | |
| 
 | |
|         Return the angle, between the line from turtle-position to position
 | |
|         specified by x, y and the turtle's start orientation. (Depends on
 | |
|         modes - "standard" or "logo")
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pos()
 | |
|         (10.00, 10.00)
 | |
|         >>> turtle.towards(0,0)
 | |
|         225.0
 | |
|         """
 | |
|         if y is not None:
 | |
|             pos = Vec2D(x, y)
 | |
|         if isinstance(x, Vec2D):
 | |
|             pos = x
 | |
|         elif isinstance(x, tuple):
 | |
|             pos = Vec2D(*x)
 | |
|         elif isinstance(x, TNavigator):
 | |
|             pos = x._position
 | |
|         x, y = pos - self._position
 | |
|         result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
 | |
|         result /= self._degreesPerAU
 | |
|         return (self._angleOffset + self._angleOrient*result) % self._fullcircle
 | |
| 
 | |
|     def heading(self):
 | |
|         """ Return the turtle's current heading.
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.left(67)
 | |
|         >>> turtle.heading()
 | |
|         67.0
 | |
|         """
 | |
|         x, y = self._orient
 | |
|         result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
 | |
|         result /= self._degreesPerAU
 | |
|         return (self._angleOffset + self._angleOrient*result) % self._fullcircle
 | |
| 
 | |
|     def setheading(self, to_angle):
 | |
|         """Set the orientation of the turtle to to_angle.
 | |
| 
 | |
|         Aliases:  setheading | seth
 | |
| 
 | |
|         Argument:
 | |
|         to_angle -- a number (integer or float)
 | |
| 
 | |
|         Set the orientation of the turtle to to_angle.
 | |
|         Here are some common directions in degrees:
 | |
| 
 | |
|          standard - mode:          logo-mode:
 | |
|         -------------------|--------------------
 | |
|            0 - east                0 - north
 | |
|           90 - north              90 - east
 | |
|          180 - west              180 - south
 | |
|          270 - south             270 - west
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.setheading(90)
 | |
|         >>> turtle.heading()
 | |
|         90
 | |
|         """
 | |
|         angle = (to_angle - self.heading())*self._angleOrient
 | |
|         full = self._fullcircle
 | |
|         angle = (angle+full/2.)%full - full/2.
 | |
|         self._rotate(angle)
 | |
| 
 | |
|     def circle(self, radius, extent = None, steps = None):
 | |
|         """ Draw a circle with given radius.
 | |
| 
 | |
|         Arguments:
 | |
|         radius -- a number
 | |
|         extent (optional) -- a number
 | |
|         steps (optional) -- an integer
 | |
| 
 | |
|         Draw a circle with given radius. The center is radius units left
 | |
|         of the turtle; extent - an angle - determines which part of the
 | |
|         circle is drawn. If extent is not given, draw the entire circle.
 | |
|         If extent is not a full circle, one endpoint of the arc is the
 | |
|         current pen position. Draw the arc in counterclockwise direction
 | |
|         if radius is positive, otherwise in clockwise direction. Finally
 | |
|         the direction of the turtle is changed by the amount of extent.
 | |
| 
 | |
|         As the circle is approximated by an inscribed regular polygon,
 | |
|         steps determines the number of steps to use. If not given,
 | |
|         it will be calculated automatically. Maybe used to draw regular
 | |
|         polygons.
 | |
| 
 | |
|         call: circle(radius)                  # full circle
 | |
|         --or: circle(radius, extent)          # arc
 | |
|         --or: circle(radius, extent, steps)
 | |
|         --or: circle(radius, steps=6)         # 6-sided polygon
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.circle(50)
 | |
|         >>> turtle.circle(120, 180)  # semicircle
 | |
|         """
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(["seq"])
 | |
|             self.undobuffer.cumulate = True
 | |
|         speed = self.speed()
 | |
|         if extent is None:
 | |
|             extent = self._fullcircle
 | |
|         if steps is None:
 | |
|             frac = abs(extent)/self._fullcircle
 | |
|             steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac)
 | |
|         w = 1.0 * extent / steps
 | |
|         w2 = 0.5 * w
 | |
|         l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU)
 | |
|         if radius < 0:
 | |
|             l, w, w2 = -l, -w, -w2
 | |
|         tr = self.tracer()
 | |
|         dl = self._delay()
 | |
|         if speed == 0:
 | |
|             self.tracer(0, 0)
 | |
|         else:
 | |
|             self.speed(0)
 | |
|         self._rotate(w2)
 | |
|         for i in range(steps):
 | |
|             self.speed(speed)
 | |
|             self._go(l)
 | |
|             self.speed(0)
 | |
|             self._rotate(w)
 | |
|         self._rotate(-w2)
 | |
|         if speed == 0:
 | |
|             self.tracer(tr, dl)
 | |
|         self.speed(speed)
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.cumulate = False
 | |
| 
 | |
| ## three dummy methods to be implemented by child class:
 | |
| 
 | |
|     def speed(self, s=0):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
|     def tracer(self, a=None, b=None):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
|     def _delay(self, n=None):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
| 
 | |
|     fd = forward
 | |
|     bk = back
 | |
|     backward = back
 | |
|     rt = right
 | |
|     lt = left
 | |
|     position = pos
 | |
|     setpos = goto
 | |
|     setposition = goto
 | |
|     seth = setheading
 | |
| 
 | |
| 
 | |
| class TPen(object):
 | |
|     """Drawing part of the RawTurtle.
 | |
|     Implements drawing properties.
 | |
|     """
 | |
|     def __init__(self, resizemode=_CFG["resizemode"]):
 | |
|         self._resizemode = resizemode # or "user" or "noresize"
 | |
|         self.undobuffer = None
 | |
|         TPen._reset(self)
 | |
| 
 | |
|     def _reset(self, pencolor=_CFG["pencolor"],
 | |
|                      fillcolor=_CFG["fillcolor"]):
 | |
|         self._pensize = 1
 | |
|         self._shown = True
 | |
|         self._pencolor = pencolor
 | |
|         self._fillcolor = fillcolor
 | |
|         self._drawing = True
 | |
|         self._speed = 3
 | |
|         self._stretchfactor = (1, 1)
 | |
|         self._tilt = 0
 | |
|         self._outlinewidth = 1
 | |
|         ### self.screen = None  # to override by child class
 | |
| 
 | |
|     def resizemode(self, rmode=None):
 | |
|         """Set resizemode to one of the values: "auto", "user", "noresize".
 | |
| 
 | |
|         (Optional) Argument:
 | |
|         rmode -- one of the strings "auto", "user", "noresize"
 | |
| 
 | |
|         Different resizemodes have the following effects:
 | |
|           - "auto" adapts the appearance of the turtle
 | |
|                    corresponding to the value of pensize.
 | |
|           - "user" adapts the appearance of the turtle according to the
 | |
|                    values of stretchfactor and outlinewidth (outline),
 | |
|                    which are set by shapesize()
 | |
|           - "noresize" no adaption of the turtle's appearance takes place.
 | |
|         If no argument is given, return current resizemode.
 | |
|         resizemode("user") is called by a call of shapesize with arguments.
 | |
| 
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.resizemode("noresize")
 | |
|         >>> turtle.resizemode()
 | |
|         'noresize'
 | |
|         """
 | |
|         if rmode is None:
 | |
|             return self._resizemode
 | |
|         rmode = rmode.lower()
 | |
|         if rmode in ["auto", "user", "noresize"]:
 | |
|             self.pen(resizemode=rmode)
 | |
| 
 | |
|     def pensize(self, width=None):
 | |
|         """Set or return the line thickness.
 | |
| 
 | |
|         Aliases:  pensize | width
 | |
| 
 | |
|         Argument:
 | |
|         width -- positive number
 | |
| 
 | |
|         Set the line thickness to width or return it. If resizemode is set
 | |
|         to "auto" and turtleshape is a polygon, that polygon is drawn with
 | |
|         the same line thickness. If no argument is given, current pensize
 | |
|         is returned.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pensize()
 | |
|         1
 | |
|         turtle.pensize(10)   # from here on lines of width 10 are drawn
 | |
|         """
 | |
|         if width is None:
 | |
|             return self._pensize
 | |
|         self.pen(pensize=width)
 | |
| 
 | |
| 
 | |
|     def penup(self):
 | |
|         """Pull the pen up -- no drawing when moving.
 | |
| 
 | |
|         Aliases: penup | pu | up
 | |
| 
 | |
|         No argument
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.penup()
 | |
|         """
 | |
|         if not self._drawing:
 | |
|             return
 | |
|         self.pen(pendown=False)
 | |
| 
 | |
|     def pendown(self):
 | |
|         """Pull the pen down -- drawing when moving.
 | |
| 
 | |
|         Aliases: pendown | pd | down
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pendown()
 | |
|         """
 | |
|         if self._drawing:
 | |
|             return
 | |
|         self.pen(pendown=True)
 | |
| 
 | |
|     def isdown(self):
 | |
|         """Return True if pen is down, False if it's up.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.penup()
 | |
|         >>> turtle.isdown()
 | |
|         False
 | |
|         >>> turtle.pendown()
 | |
|         >>> turtle.isdown()
 | |
|         True
 | |
|         """
 | |
|         return self._drawing
 | |
| 
 | |
|     def speed(self, speed=None):
 | |
|         """ Return or set the turtle's speed.
 | |
| 
 | |
|         Optional argument:
 | |
|         speed -- an integer in the range 0..10 or a speedstring (see below)
 | |
| 
 | |
|         Set the turtle's speed to an integer value in the range 0 .. 10.
 | |
|         If no argument is given: return current speed.
 | |
| 
 | |
|         If input is a number greater than 10 or smaller than 0.5,
 | |
|         speed is set to 0.
 | |
|         Speedstrings  are mapped to speedvalues in the following way:
 | |
|             'fastest' :  0
 | |
|             'fast'    :  10
 | |
|             'normal'  :  6
 | |
|             'slow'    :  3
 | |
|             'slowest' :  1
 | |
|         speeds from 1 to 10 enforce increasingly faster animation of
 | |
|         line drawing and turtle turning.
 | |
| 
 | |
|         Attention:
 | |
|         speed = 0 : *no* animation takes place. forward/back makes turtle jump
 | |
|         and likewise left/right make the turtle turn instantly.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.speed(3)
 | |
|         """
 | |
|         speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 }
 | |
|         if speed is None:
 | |
|             return self._speed
 | |
|         if speed in speeds:
 | |
|             speed = speeds[speed]
 | |
|         elif 0.5 < speed < 10.5:
 | |
|             speed = int(round(speed))
 | |
|         else:
 | |
|             speed = 0
 | |
|         self.pen(speed=speed)
 | |
| 
 | |
|     def color(self, *args):
 | |
|         """Return or set the pencolor and fillcolor.
 | |
| 
 | |
|         Arguments:
 | |
|         Several input formats are allowed.
 | |
|         They use 0, 1, 2, or 3 arguments as follows:
 | |
| 
 | |
|         color()
 | |
|             Return the current pencolor and the current fillcolor
 | |
|             as a pair of color specification strings as are returned
 | |
|             by pencolor and fillcolor.
 | |
|         color(colorstring), color((r,g,b)), color(r,g,b)
 | |
|             inputs as in pencolor, set both, fillcolor and pencolor,
 | |
|             to the given value.
 | |
|         color(colorstring1, colorstring2),
 | |
|         color((r1,g1,b1), (r2,g2,b2))
 | |
|             equivalent to pencolor(colorstring1) and fillcolor(colorstring2)
 | |
|             and analogously, if the other input format is used.
 | |
| 
 | |
|         If turtleshape is a polygon, outline and interior of that polygon
 | |
|         is drawn with the newly set colors.
 | |
|         For mor info see: pencolor, fillcolor
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.color('red', 'green')
 | |
|         >>> turtle.color()
 | |
|         ('red', 'green')
 | |
|         >>> colormode(255)
 | |
|         >>> color((40, 80, 120), (160, 200, 240))
 | |
|         >>> color()
 | |
|         ('#285078', '#a0c8f0')
 | |
|         """
 | |
|         if args:
 | |
|             l = len(args)
 | |
|             if l == 1:
 | |
|                 pcolor = fcolor = args[0]
 | |
|             elif l == 2:
 | |
|                 pcolor, fcolor = args
 | |
|             elif l == 3:
 | |
|                 pcolor = fcolor = args
 | |
|             pcolor = self._colorstr(pcolor)
 | |
|             fcolor = self._colorstr(fcolor)
 | |
|             self.pen(pencolor=pcolor, fillcolor=fcolor)
 | |
|         else:
 | |
|             return self._color(self._pencolor), self._color(self._fillcolor)
 | |
| 
 | |
|     def pencolor(self, *args):
 | |
|         """ Return or set the pencolor.
 | |
| 
 | |
|         Arguments:
 | |
|         Four input formats are allowed:
 | |
|           - pencolor()
 | |
|             Return the current pencolor as color specification string,
 | |
|             possibly in hex-number format (see example).
 | |
|             May be used as input to another color/pencolor/fillcolor call.
 | |
|           - pencolor(colorstring)
 | |
|             s is a Tk color specification string, such as "red" or "yellow"
 | |
|           - pencolor((r, g, b))
 | |
|             *a tuple* of r, g, and b, which represent, an RGB color,
 | |
|             and each of r, g, and b are in the range 0..colormode,
 | |
|             where colormode is either 1.0 or 255
 | |
|           - pencolor(r, g, b)
 | |
|             r, g, and b represent an RGB color, and each of r, g, and b
 | |
|             are in the range 0..colormode
 | |
| 
 | |
|         If turtleshape is a polygon, the outline of that polygon is drawn
 | |
|         with the newly set pencolor.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.pencolor('brown')
 | |
|         >>> tup = (0.2, 0.8, 0.55)
 | |
|         >>> turtle.pencolor(tup)
 | |
|         >>> turtle.pencolor()
 | |
|         '#33cc8c'
 | |
|         """
 | |
|         if args:
 | |
|             color = self._colorstr(args)
 | |
|             if color == self._pencolor:
 | |
|                 return
 | |
|             self.pen(pencolor=color)
 | |
|         else:
 | |
|             return self._color(self._pencolor)
 | |
| 
 | |
|     def fillcolor(self, *args):
 | |
|         """ Return or set the fillcolor.
 | |
| 
 | |
|         Arguments:
 | |
|         Four input formats are allowed:
 | |
|           - fillcolor()
 | |
|             Return the current fillcolor as color specification string,
 | |
|             possibly in hex-number format (see example).
 | |
|             May be used as input to another color/pencolor/fillcolor call.
 | |
|           - fillcolor(colorstring)
 | |
|             s is a Tk color specification string, such as "red" or "yellow"
 | |
|           - fillcolor((r, g, b))
 | |
|             *a tuple* of r, g, and b, which represent, an RGB color,
 | |
|             and each of r, g, and b are in the range 0..colormode,
 | |
|             where colormode is either 1.0 or 255
 | |
|           - fillcolor(r, g, b)
 | |
|             r, g, and b represent an RGB color, and each of r, g, and b
 | |
|             are in the range 0..colormode
 | |
| 
 | |
|         If turtleshape is a polygon, the interior of that polygon is drawn
 | |
|         with the newly set fillcolor.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.fillcolor('violet')
 | |
|         >>> col = turtle.pencolor()
 | |
|         >>> turtle.fillcolor(col)
 | |
|         >>> turtle.fillcolor(0, .5, 0)
 | |
|         """
 | |
|         if args:
 | |
|             color = self._colorstr(args)
 | |
|             if color == self._fillcolor:
 | |
|                 return
 | |
|             self.pen(fillcolor=color)
 | |
|         else:
 | |
|             return self._color(self._fillcolor)
 | |
| 
 | |
|     def showturtle(self):
 | |
|         """Makes the turtle visible.
 | |
| 
 | |
|         Aliases: showturtle | st
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.hideturtle()
 | |
|         >>> turtle.showturtle()
 | |
|         """
 | |
|         self.pen(shown=True)
 | |
| 
 | |
|     def hideturtle(self):
 | |
|         """Makes the turtle invisible.
 | |
| 
 | |
|         Aliases: hideturtle | ht
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         It's a good idea to do this while you're in the
 | |
|         middle of a complicated drawing, because hiding
 | |
|         the turtle speeds up the drawing observably.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.hideturtle()
 | |
|         """
 | |
|         self.pen(shown=False)
 | |
| 
 | |
|     def isvisible(self):
 | |
|         """Return True if the Turtle is shown, False if it's hidden.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.hideturtle()
 | |
|         >>> print turtle.isvisible():
 | |
|         False
 | |
|         """
 | |
|         return self._shown
 | |
| 
 | |
|     def pen(self, pen=None, **pendict):
 | |
|         """Return or set the pen's attributes.
 | |
| 
 | |
|         Arguments:
 | |
|             pen -- a dictionary with some or all of the below listed keys.
 | |
|             **pendict -- one or more keyword-arguments with the below
 | |
|                          listed keys as keywords.
 | |
| 
 | |
|         Return or set the pen's attributes in a 'pen-dictionary'
 | |
|         with the following key/value pairs:
 | |
|            "shown"      :   True/False
 | |
|            "pendown"    :   True/False
 | |
|            "pencolor"   :   color-string or color-tuple
 | |
|            "fillcolor"  :   color-string or color-tuple
 | |
|            "pensize"    :   positive number
 | |
|            "speed"      :   number in range 0..10
 | |
|            "resizemode" :   "auto" or "user" or "noresize"
 | |
|            "stretchfactor": (positive number, positive number)
 | |
|            "outline"    :   positive number
 | |
|            "tilt"       :   number
 | |
| 
 | |
|         This dicionary can be used as argument for a subsequent
 | |
|         pen()-call to restore the former pen-state. Moreover one
 | |
|         or more of these attributes can be provided as keyword-arguments.
 | |
|         This can be used to set several pen attributes in one statement.
 | |
| 
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10)
 | |
|         >>> turtle.pen()
 | |
|         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | |
|         'pencolor': 'red', 'pendown': True, 'fillcolor': 'black',
 | |
|         'stretchfactor': (1,1), 'speed': 3}
 | |
|         >>> penstate=turtle.pen()
 | |
|         >>> turtle.color("yellow","")
 | |
|         >>> turtle.penup()
 | |
|         >>> turtle.pen()
 | |
|         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | |
|         'pencolor': 'yellow', 'pendown': False, 'fillcolor': '',
 | |
|         'stretchfactor': (1,1), 'speed': 3}
 | |
|         >>> p.pen(penstate, fillcolor="green")
 | |
|         >>> p.pen()
 | |
|         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | |
|         'pencolor': 'red', 'pendown': True, 'fillcolor': 'green',
 | |
|         'stretchfactor': (1,1), 'speed': 3}
 | |
|         """
 | |
|         _pd =  {"shown"         : self._shown,
 | |
|                 "pendown"       : self._drawing,
 | |
|                 "pencolor"      : self._pencolor,
 | |
|                 "fillcolor"     : self._fillcolor,
 | |
|                 "pensize"       : self._pensize,
 | |
|                 "speed"         : self._speed,
 | |
|                 "resizemode"    : self._resizemode,
 | |
|                 "stretchfactor" : self._stretchfactor,
 | |
|                 "outline"       : self._outlinewidth,
 | |
|                 "tilt"          : self._tilt
 | |
|                }
 | |
| 
 | |
|         if not (pen or pendict):
 | |
|             return _pd
 | |
| 
 | |
|         if isinstance(pen, dict):
 | |
|             p = pen
 | |
|         else:
 | |
|             p = {}
 | |
|         p.update(pendict)
 | |
| 
 | |
|         _p_buf = {}
 | |
|         for key in p:
 | |
|             _p_buf[key] = _pd[key]
 | |
| 
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(("pen", _p_buf))
 | |
| 
 | |
|         newLine = False
 | |
|         if "pendown" in p:
 | |
|             if self._drawing != p["pendown"]:
 | |
|                 newLine = True
 | |
|         if "pencolor" in p:
 | |
|             if isinstance(p["pencolor"], tuple):
 | |
|                 p["pencolor"] = self._colorstr((p["pencolor"],))
 | |
|             if self._pencolor != p["pencolor"]:
 | |
|                 newLine = True
 | |
|         if "pensize" in p:
 | |
|             if self._pensize != p["pensize"]:
 | |
|                 newLine = True
 | |
|         if newLine:
 | |
|             self._newLine()
 | |
|         if "pendown" in p:
 | |
|             self._drawing = p["pendown"]
 | |
|         if "pencolor" in p:
 | |
|             self._pencolor = p["pencolor"]
 | |
|         if "pensize" in p:
 | |
|             self._pensize = p["pensize"]
 | |
|         if "fillcolor" in p:
 | |
|             if isinstance(p["fillcolor"], tuple):
 | |
|                 p["fillcolor"] = self._colorstr((p["fillcolor"],))
 | |
|             self._fillcolor = p["fillcolor"]
 | |
|         if "speed" in p:
 | |
|             self._speed = p["speed"]
 | |
|         if "resizemode" in p:
 | |
|             self._resizemode = p["resizemode"]
 | |
|         if "stretchfactor" in p:
 | |
|             sf = p["stretchfactor"]
 | |
|             if isinstance(sf, (int, float)):
 | |
|                 sf = (sf, sf)
 | |
|             self._stretchfactor = sf
 | |
|         if "outline" in p:
 | |
|             self._outlinewidth = p["outline"]
 | |
|         if "shown" in p:
 | |
|             self._shown = p["shown"]
 | |
|         if "tilt" in p:
 | |
|             self._tilt = p["tilt"]
 | |
|         self._update()
 | |
| 
 | |
| ## three dummy methods to be implemented by child class:
 | |
| 
 | |
|     def _newLine(self, usePos = True):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
|     def _update(self, count=True, forced=False):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
|     def _color(self, args):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
|     def _colorstr(self, args):
 | |
|         """dummy method - to be overwritten by child class"""
 | |
| 
 | |
|     width = pensize
 | |
|     up = penup
 | |
|     pu = penup
 | |
|     pd = pendown
 | |
|     down = pendown
 | |
|     st = showturtle
 | |
|     ht = hideturtle
 | |
| 
 | |
| 
 | |
| class _TurtleImage(object):
 | |
|     """Helper class: Datatype to store Turtle attributes
 | |
|     """
 | |
| 
 | |
|     def __init__(self, screen, shapeIndex):
 | |
|         self.screen = screen
 | |
|         self._type = None
 | |
|         self._setshape(shapeIndex)
 | |
| 
 | |
|     def _setshape(self, shapeIndex):
 | |
|         screen = self.screen # RawTurtle.screens[self.screenIndex]
 | |
|         self.shapeIndex = shapeIndex
 | |
|         if self._type == "polygon" == screen._shapes[shapeIndex]._type:
 | |
|             return
 | |
|         if self._type == "image" == screen._shapes[shapeIndex]._type:
 | |
|             return
 | |
|         if self._type in ["image", "polygon"]:
 | |
|             screen._delete(self._item)
 | |
|         elif self._type == "compound":
 | |
|             for item in self._item:
 | |
|                 screen._delete(item)
 | |
|         self._type = screen._shapes[shapeIndex]._type
 | |
|         if self._type == "polygon":
 | |
|             self._item = screen._createpoly()
 | |
|         elif self._type == "image":
 | |
|             self._item = screen._createimage(screen._shapes["blank"]._data)
 | |
|         elif self._type == "compound":
 | |
|             self._item = [screen._createpoly() for item in
 | |
|                                           screen._shapes[shapeIndex]._data]
 | |
| 
 | |
| 
 | |
| class RawTurtle(TPen, TNavigator):
 | |
|     """Animation part of the RawTurtle.
 | |
|     Puts RawTurtle upon a TurtleScreen and provides tools for
 | |
|     it's animation.
 | |
|     """
 | |
|     screens = []
 | |
| 
 | |
|     def __init__(self, canvas=None,
 | |
|                  shape=_CFG["shape"],
 | |
|                  undobuffersize=_CFG["undobuffersize"],
 | |
|                  visible=_CFG["visible"]):
 | |
|         if isinstance(canvas, _Screen):
 | |
|             self.screen = canvas
 | |
|         elif isinstance(canvas, TurtleScreen):
 | |
|             if canvas not in RawTurtle.screens:
 | |
|                 RawTurtle.screens.append(canvas)
 | |
|             self.screen = canvas
 | |
|         elif isinstance(canvas, (ScrolledCanvas, Canvas)):
 | |
|             for screen in RawTurtle.screens:
 | |
|                 if screen.cv == canvas:
 | |
|                     self.screen = screen
 | |
|                     break
 | |
|             else:
 | |
|                 self.screen = TurtleScreen(canvas)
 | |
|                 RawTurtle.screens.append(self.screen)
 | |
|         else:
 | |
|             raise TurtleGraphicsError("bad cavas argument %s" % canvas)
 | |
| 
 | |
|         screen = self.screen
 | |
|         TNavigator.__init__(self, screen.mode())
 | |
|         TPen.__init__(self)
 | |
|         screen._turtles.append(self)
 | |
|         self.drawingLineItem = screen._createline()
 | |
|         self.turtle = _TurtleImage(screen, shape)
 | |
|         self._poly = None
 | |
|         self._creatingPoly = False
 | |
|         self._fillitem = self._fillpath = None
 | |
|         self._shown = visible
 | |
|         self._hidden_from_screen = False
 | |
|         self.currentLineItem = screen._createline()
 | |
|         self.currentLine = [self._position]
 | |
|         self.items = [self.currentLineItem]
 | |
|         self.stampItems = []
 | |
|         self._undobuffersize = undobuffersize
 | |
|         self.undobuffer = Tbuffer(undobuffersize)
 | |
|         self._update()
 | |
| 
 | |
|     def reset(self):
 | |
|         """Delete the turtle's drawings and restore it's default values.
 | |
| 
 | |
|         No argument.
 | |
| ,
 | |
|         Delete the turtle's drawings from the screen, re-center the turtle
 | |
|         and set variables to the default values.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.position()
 | |
|         (0.00,-22.00)
 | |
|         >>> turtle.heading()
 | |
|         100.0
 | |
|         >>> turtle.reset()
 | |
|         >>> turtle.position()
 | |
|         (0.00,0.00)
 | |
|         >>> turtle.heading()
 | |
|         0.0
 | |
|         """
 | |
|         TNavigator.reset(self)
 | |
|         TPen._reset(self)
 | |
|         self._clear()
 | |
|         self._drawturtle()
 | |
|         self._update()
 | |
| 
 | |
|     def setundobuffer(self, size):
 | |
|         """Set or disable undobuffer.
 | |
| 
 | |
|         Argument:
 | |
|         size -- an integer or None
 | |
| 
 | |
|         If size is an integer an empty undobuffer of given size is installed.
 | |
|         Size gives the maximum number of turtle-actions that can be undone
 | |
|         by the undo() function.
 | |
|         If size is None, no undobuffer is present.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.setundobuffer(42)
 | |
|         """
 | |
|         if size is None:
 | |
|             self.undobuffer = None
 | |
|         else:
 | |
|             self.undobuffer = Tbuffer(size)
 | |
| 
 | |
|     def undobufferentries(self):
 | |
|         """Return count of entries in the undobuffer.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> while undobufferentries():
 | |
|                 undo()
 | |
|         """
 | |
|         if self.undobuffer is None:
 | |
|             return 0
 | |
|         return self.undobuffer.nr_of_items()
 | |
| 
 | |
|     def _clear(self):
 | |
|         """Delete all of pen's drawings"""
 | |
|         self._fillitem = self._fillpath = None
 | |
|         for item in self.items:
 | |
|             self.screen._delete(item)
 | |
|         self.currentLineItem = self.screen._createline()
 | |
|         self.currentLine = []
 | |
|         if self._drawing:
 | |
|             self.currentLine.append(self._position)
 | |
|         self.items = [self.currentLineItem]
 | |
|         self.clearstamps()
 | |
|         self.setundobuffer(self._undobuffersize)
 | |
| 
 | |
| 
 | |
|     def clear(self):
 | |
|         """Delete the turtle's drawings from the screen. Do not move turtle.
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Delete the turtle's drawings from the screen. Do not move turtle.
 | |
|         State and position of the turtle as well as drawings of other
 | |
|         turtles are not affected.
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.clear()
 | |
|         """
 | |
|         self._clear()
 | |
|         self._update()
 | |
| 
 | |
|     def _update_data(self):
 | |
|         self.screen._incrementudc()
 | |
|         if self.screen._updatecounter != 0:
 | |
|             return
 | |
|         if len(self.currentLine)>1:
 | |
|             self.screen._drawline(self.currentLineItem, self.currentLine,
 | |
|                                   self._pencolor, self._pensize)
 | |
| 
 | |
|     def _update(self):
 | |
|         """Perform a Turtle-data update.
 | |
|         """
 | |
|         screen = self.screen
 | |
|         if screen._tracing == 0:
 | |
|             return
 | |
|         elif screen._tracing == 1:
 | |
|             self._update_data()
 | |
|             self._drawturtle()
 | |
|             screen._update()                  # TurtleScreenBase
 | |
|             screen._delay(screen._delayvalue) # TurtleScreenBase
 | |
|         else:
 | |
|             self._update_data()
 | |
|             if screen._updatecounter == 0:
 | |
|                 for t in screen.turtles():
 | |
|                     t._drawturtle()
 | |
|                 screen._update()
 | |
| 
 | |
|     def tracer(self, flag=None, delay=None):
 | |
|         """Turns turtle animation on/off and set delay for update drawings.
 | |
| 
 | |
|         Optional arguments:
 | |
|         n -- nonnegative  integer
 | |
|         delay -- nonnegative  integer
 | |
| 
 | |
|         If n is given, only each n-th regular screen update is really performed.
 | |
|         (Can be used to accelerate the drawing of complex graphics.)
 | |
|         Second arguments sets delay value (see RawTurtle.delay())
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.tracer(8, 25)
 | |
|         >>> dist = 2
 | |
|         >>> for i in range(200):
 | |
|                 turtle.fd(dist)
 | |
|                 turtle.rt(90)
 | |
|                 dist += 2
 | |
|         """
 | |
|         return self.screen.tracer(flag, delay)
 | |
| 
 | |
|     def _color(self, args):
 | |
|         return self.screen._color(args)
 | |
| 
 | |
|     def _colorstr(self, args):
 | |
|         return self.screen._colorstr(args)
 | |
| 
 | |
|     def _cc(self, args):
 | |
|         """Convert colortriples to hexstrings.
 | |
|         """
 | |
|         if isinstance(args, str):
 | |
|             return args
 | |
|         try:
 | |
|             r, g, b = args
 | |
|         except:
 | |
|             raise TurtleGraphicsError("bad color arguments: %s" % str(args))
 | |
|         if self.screen._colormode == 1.0:
 | |
|             r, g, b = [round(255.0*x) for x in (r, g, b)]
 | |
|         if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
 | |
|             raise TurtleGraphicsError("bad color sequence: %s" % str(args))
 | |
|         return "#%02x%02x%02x" % (r, g, b)
 | |
| 
 | |
|     def clone(self):
 | |
|         """Create and return a clone of the turtle.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Create and return a clone of the turtle with same position, heading
 | |
|         and turtle properties.
 | |
| 
 | |
|         Example (for a Turtle instance named mick):
 | |
|         mick = Turtle()
 | |
|         joe = mick.clone()
 | |
|         """
 | |
|         screen = self.screen
 | |
|         self._newLine(self._drawing)
 | |
| 
 | |
|         turtle = self.turtle
 | |
|         self.screen = None
 | |
|         self.turtle = None  # too make self deepcopy-able
 | |
| 
 | |
|         q = deepcopy(self)
 | |
| 
 | |
|         self.screen = screen
 | |
|         self.turtle = turtle
 | |
| 
 | |
|         q.screen = screen
 | |
|         q.turtle = _TurtleImage(screen, self.turtle.shapeIndex)
 | |
| 
 | |
|         screen._turtles.append(q)
 | |
|         ttype = screen._shapes[self.turtle.shapeIndex]._type
 | |
|         if ttype == "polygon":
 | |
|             q.turtle._item = screen._createpoly()
 | |
|         elif ttype == "image":
 | |
|             q.turtle._item = screen._createimage(screen._shapes["blank"]._data)
 | |
|         elif ttype == "compound":
 | |
|             q.turtle._item = [screen._createpoly() for item in
 | |
|                               screen._shapes[self.turtle.shapeIndex]._data]
 | |
|         q.currentLineItem = screen._createline()
 | |
|         q._update()
 | |
|         return q
 | |
| 
 | |
|     def shape(self, name=None):
 | |
|         """Set turtle shape to shape with given name / return current shapename.
 | |
| 
 | |
|         Optional argument:
 | |
|         name -- a string, which is a valid shapename
 | |
| 
 | |
|         Set turtle shape to shape with given name or, if name is not given,
 | |
|         return name of current shape.
 | |
|         Shape with name must exist in the TurtleScreen's shape dictionary.
 | |
|         Initially there are the following polygon shapes:
 | |
|         'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'.
 | |
|         To learn about how to deal with shapes see Screen-method register_shape.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.shape()
 | |
|         'arrow'
 | |
|         >>> turtle.shape("turtle")
 | |
|         >>> turtle.shape()
 | |
|         'turtle'
 | |
|         """
 | |
|         if name is None:
 | |
|             return self.turtle.shapeIndex
 | |
|         if not name in self.screen.getshapes():
 | |
|             raise TurtleGraphicsError("There is no shape named %s" % name)
 | |
|         self.turtle._setshape(name)
 | |
|         self._update()
 | |
| 
 | |
|     def shapesize(self, stretch_wid=None, stretch_len=None, outline=None):
 | |
|         """Set/return turtle's stretchfactors/outline. Set resizemode to "user".
 | |
| 
 | |
|         Optinonal arguments:
 | |
|            stretch_wid : positive number
 | |
|            stretch_len : positive number
 | |
|            outline  : positive number
 | |
| 
 | |
|         Return or set the pen's attributes x/y-stretchfactors and/or outline.
 | |
|         Set resizemode to "user".
 | |
|         If and only if resizemode is set to "user", the turtle will be displayed
 | |
|         stretched according to its stretchfactors:
 | |
|         stretch_wid is stretchfactor perpendicular to orientation
 | |
|         stretch_len is stretchfactor in direction of turtles orientation.
 | |
|         outline determines the width of the shapes's outline.
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.resizemode("user")
 | |
|         >>> turtle.shapesize(5, 5, 12)
 | |
|         >>> turtle.shapesize(outline=8)
 | |
|         """
 | |
|         if stretch_wid is None and stretch_len is None and outline == None:
 | |
|             stretch_wid, stretch_len = self._stretchfactor
 | |
|             return stretch_wid, stretch_len, self._outlinewidth
 | |
|         if stretch_wid is not None:
 | |
|             if stretch_len is None:
 | |
|                 stretchfactor = stretch_wid, stretch_wid
 | |
|             else:
 | |
|                 stretchfactor = stretch_wid, stretch_len
 | |
|         elif stretch_len is not None:
 | |
|             stretchfactor = self._stretchfactor[0], stretch_len
 | |
|         else:
 | |
|             stretchfactor = self._stretchfactor
 | |
|         if outline is None:
 | |
|             outline = self._outlinewidth
 | |
|         self.pen(resizemode="user",
 | |
|                  stretchfactor=stretchfactor, outline=outline)
 | |
| 
 | |
|     def settiltangle(self, angle):
 | |
|         """Rotate the turtleshape to point in the specified direction
 | |
| 
 | |
|         Optional argument:
 | |
|         angle -- number
 | |
| 
 | |
|         Rotate the turtleshape to point in the direction specified by angle,
 | |
|         regardless of its current tilt-angle. DO NOT change the turtle's
 | |
|         heading (direction of movement).
 | |
| 
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.shape("circle")
 | |
|         >>> turtle.shapesize(5,2)
 | |
|         >>> turtle.settiltangle(45)
 | |
|         >>> stamp()
 | |
|         >>> turtle.fd(50)
 | |
|         >>> turtle.settiltangle(-45)
 | |
|         >>> stamp()
 | |
|         >>> turtle.fd(50)
 | |
|         """
 | |
|         tilt = -angle * self._degreesPerAU * self._angleOrient
 | |
|         tilt = (tilt * math.pi / 180.0) % (2*math.pi)
 | |
|         self.pen(resizemode="user", tilt=tilt)
 | |
| 
 | |
|     def tiltangle(self):
 | |
|         """Return the current tilt-angle.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Return the current tilt-angle, i. e. the angle between the
 | |
|         orientation of the turtleshape and the heading of the turtle
 | |
|         (it's direction of movement).
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.shape("circle")
 | |
|         >>> turtle.shapesize(5,2)
 | |
|         >>> turtle.tilt(45)
 | |
|         >>> turtle.tiltangle()
 | |
|         >>>
 | |
|         """
 | |
|         tilt = -self._tilt * (180.0/math.pi) * self._angleOrient
 | |
|         return (tilt / self._degreesPerAU) % self._fullcircle
 | |
| 
 | |
|     def tilt(self, angle):
 | |
|         """Rotate the turtleshape by angle.
 | |
| 
 | |
|         Argument:
 | |
|         angle - a number
 | |
| 
 | |
|         Rotate the turtleshape by angle from its current tilt-angle,
 | |
|         but do NOT change the turtle's heading (direction of movement).
 | |
| 
 | |
|         Examples (for a Turtle instance named turtle):
 | |
|         >>> turtle.shape("circle")
 | |
|         >>> turtle.shapesize(5,2)
 | |
|         >>> turtle.tilt(30)
 | |
|         >>> turtle.fd(50)
 | |
|         >>> turtle.tilt(30)
 | |
|         >>> turtle.fd(50)
 | |
|         """
 | |
|         self.settiltangle(angle + self.tiltangle())
 | |
| 
 | |
|     def _polytrafo(self, poly):
 | |
|         """Computes transformed polygon shapes from a shape
 | |
|         according to current position and heading.
 | |
|         """
 | |
|         screen = self.screen
 | |
|         p0, p1 = self._position
 | |
|         e0, e1 = self._orient
 | |
|         e = Vec2D(e0, e1 * screen.yscale / screen.xscale)
 | |
|         e0, e1 = (1.0 / abs(e)) * e
 | |
|         return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale)
 | |
|                                                            for (x, y) in poly]
 | |
| 
 | |
|     def _drawturtle(self):
 | |
|         """Manages the correct rendering of the turtle with respect to
 | |
|         it's shape, resizemode, strech and tilt etc."""
 | |
|         screen = self.screen
 | |
|         shape = screen._shapes[self.turtle.shapeIndex]
 | |
|         ttype = shape._type
 | |
|         titem = self.turtle._item
 | |
|         if self._shown and screen._updatecounter == 0 and screen._tracing > 0:
 | |
|             self._hidden_from_screen = False
 | |
|             tshape = shape._data
 | |
|             if ttype == "polygon":
 | |
|                 if self._resizemode == "noresize":
 | |
|                     w = 1
 | |
|                     shape = tshape
 | |
|                 else:
 | |
|                     if self._resizemode == "auto":
 | |
|                         lx = ly = max(1, self._pensize/5.0)
 | |
|                         w = self._pensize
 | |
|                         tiltangle = 0
 | |
|                     elif self._resizemode == "user":
 | |
|                         lx, ly = self._stretchfactor
 | |
|                         w = self._outlinewidth
 | |
|                         tiltangle = self._tilt
 | |
|                     shape = [(lx*x, ly*y) for (x, y) in tshape]
 | |
|                     t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
 | |
|                     shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
 | |
|                 shape = self._polytrafo(shape)
 | |
|                 fc, oc = self._fillcolor, self._pencolor
 | |
|                 screen._drawpoly(titem, shape, fill=fc, outline=oc,
 | |
|                                                       width=w, top=True)
 | |
|             elif ttype == "image":
 | |
|                 screen._drawimage(titem, self._position, tshape)
 | |
|             elif ttype == "compound":
 | |
|                 lx, ly = self._stretchfactor
 | |
|                 w = self._outlinewidth
 | |
|                 for item, (poly, fc, oc) in zip(titem, tshape):
 | |
|                     poly = [(lx*x, ly*y) for (x, y) in poly]
 | |
|                     poly = self._polytrafo(poly)
 | |
|                     screen._drawpoly(item, poly, fill=self._cc(fc),
 | |
|                                      outline=self._cc(oc), width=w, top=True)
 | |
|         else:
 | |
|             if self._hidden_from_screen:
 | |
|                 return
 | |
|             if ttype == "polygon":
 | |
|                 screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "")
 | |
|             elif ttype == "image":
 | |
|                 screen._drawimage(titem, self._position,
 | |
|                                           screen._shapes["blank"]._data)
 | |
|             elif ttype == "compound":
 | |
|                 for item in titem:
 | |
|                     screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "")
 | |
|             self._hidden_from_screen = True
 | |
| 
 | |
| ##############################  stamp stuff  ###############################
 | |
| 
 | |
|     def stamp(self):
 | |
|         """Stamp a copy of the turtleshape onto the canvas and return it's id.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Stamp a copy of the turtle shape onto the canvas at the current
 | |
|         turtle position. Return a stamp_id for that stamp, which can be
 | |
|         used to delete it by calling clearstamp(stamp_id).
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.color("blue")
 | |
|         >>> turtle.stamp()
 | |
|         13
 | |
|         >>> turtle.fd(50)
 | |
|         """
 | |
|         screen = self.screen
 | |
|         shape = screen._shapes[self.turtle.shapeIndex]
 | |
|         ttype = shape._type
 | |
|         tshape = shape._data
 | |
|         if ttype == "polygon":
 | |
|             stitem = screen._createpoly()
 | |
|             if self._resizemode == "noresize":
 | |
|                 w = 1
 | |
|                 shape = tshape
 | |
|             else:
 | |
|                 if self._resizemode == "auto":
 | |
|                     lx = ly = max(1, self._pensize/5.0)
 | |
|                     w = self._pensize
 | |
|                     tiltangle = 0
 | |
|                 elif self._resizemode == "user":
 | |
|                     lx, ly = self._stretchfactor
 | |
|                     w = self._outlinewidth
 | |
|                     tiltangle = self._tilt
 | |
|                 shape = [(lx*x, ly*y) for (x, y) in tshape]
 | |
|                 t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
 | |
|                 shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
 | |
|             shape = self._polytrafo(shape)
 | |
|             fc, oc = self._fillcolor, self._pencolor
 | |
|             screen._drawpoly(stitem, shape, fill=fc, outline=oc,
 | |
|                                                   width=w, top=True)
 | |
|         elif ttype == "image":
 | |
|             stitem = screen._createimage("")
 | |
|             screen._drawimage(stitem, self._position, tshape)
 | |
|         elif ttype == "compound":
 | |
|             stitem = []
 | |
|             for element in tshape:
 | |
|                 item = screen._createpoly()
 | |
|                 stitem.append(item)
 | |
|             stitem = tuple(stitem)
 | |
|             lx, ly = self._stretchfactor
 | |
|             w = self._outlinewidth
 | |
|             for item, (poly, fc, oc) in zip(stitem, tshape):
 | |
|                 poly = [(lx*x, ly*y) for (x, y) in poly]
 | |
|                 poly = self._polytrafo(poly)
 | |
|                 screen._drawpoly(item, poly, fill=self._cc(fc),
 | |
|                                  outline=self._cc(oc), width=w, top=True)
 | |
|         self.stampItems.append(stitem)
 | |
|         self.undobuffer.push(("stamp", stitem))
 | |
|         return stitem
 | |
| 
 | |
|     def _clearstamp(self, stampid):
 | |
|         """does the work for clearstamp() and clearstamps()
 | |
|         """
 | |
|         if stampid in self.stampItems:
 | |
|             if isinstance(stampid, tuple):
 | |
|                 for subitem in stampid:
 | |
|                     self.screen._delete(subitem)
 | |
|             else:
 | |
|                 self.screen._delete(stampid)
 | |
|             self.stampItems.remove(stampid)
 | |
|         # Delete stampitem from undobuffer if necessary
 | |
|         # if clearstamp is called directly.
 | |
|         item = ("stamp", stampid)
 | |
|         buf = self.undobuffer
 | |
|         if item not in buf.buffer:
 | |
|             return
 | |
|         index = buf.buffer.index(item)
 | |
|         buf.buffer.remove(item)
 | |
|         if index <= buf.ptr:
 | |
|             buf.ptr = (buf.ptr - 1) % buf.bufsize
 | |
|         buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None])
 | |
| 
 | |
|     def clearstamp(self, stampid):
 | |
|         """Delete stamp with given stampid
 | |
| 
 | |
|         Argument:
 | |
|         stampid - an integer, must be return value of previous stamp() call.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.color("blue")
 | |
|         >>> astamp = turtle.stamp()
 | |
|         >>> turtle.fd(50)
 | |
|         >>> turtle.clearstamp(astamp)
 | |
|         """
 | |
|         self._clearstamp(stampid)
 | |
|         self._update()
 | |
| 
 | |
|     def clearstamps(self, n=None):
 | |
|         """Delete all or first/last n of turtle's stamps.
 | |
| 
 | |
|         Optional argument:
 | |
|         n -- an integer
 | |
| 
 | |
|         If n is None, delete all of pen's stamps,
 | |
|         else if n > 0 delete first n stamps
 | |
|         else if n < 0 delete last n stamps.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> for i in range(8):
 | |
|                 turtle.stamp(); turtle.fd(30)
 | |
|         ...
 | |
|         >>> turtle.clearstamps(2)
 | |
|         >>> turtle.clearstamps(-2)
 | |
|         >>> turtle.clearstamps()
 | |
|         """
 | |
|         if n is None:
 | |
|             toDelete = self.stampItems[:]
 | |
|         elif n >= 0:
 | |
|             toDelete = self.stampItems[:n]
 | |
|         else:
 | |
|             toDelete = self.stampItems[n:]
 | |
|         for item in toDelete:
 | |
|             self._clearstamp(item)
 | |
|         self._update()
 | |
| 
 | |
|     def _goto(self, end):
 | |
|         """Move the pen to the point end, thereby drawing a line
 | |
|         if pen is down. All other methodes for turtle movement depend
 | |
|         on this one.
 | |
|         """
 | |
|         ## Version mit undo-stuff
 | |
|         go_modes = ( self._drawing,
 | |
|                      self._pencolor,
 | |
|                      self._pensize,
 | |
|                      isinstance(self._fillpath, list))
 | |
|         screen = self.screen
 | |
|         undo_entry = ("go", self._position, end, go_modes,
 | |
|                       (self.currentLineItem,
 | |
|                       self.currentLine[:],
 | |
|                       screen._pointlist(self.currentLineItem),
 | |
|                       self.items[:])
 | |
|                       )
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(undo_entry)
 | |
|         start = self._position
 | |
|         if self._speed and screen._tracing == 1:
 | |
|             diff = (end-start)
 | |
|             diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
 | |
|             nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
 | |
|             delta = diff * (1.0/nhops)
 | |
|             for n in range(1, nhops):
 | |
|                 if n == 1:
 | |
|                     top = True
 | |
|                 else:
 | |
|                     top = False
 | |
|                 self._position = start + delta * n
 | |
|                 if self._drawing:
 | |
|                     screen._drawline(self.drawingLineItem,
 | |
|                                      (start, self._position),
 | |
|                                      self._pencolor, self._pensize, top)
 | |
|                 self._update()
 | |
|             if self._drawing:
 | |
|                 screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
 | |
|                                                fill="", width=self._pensize)
 | |
|         # Turtle now at end,
 | |
|         if self._drawing: # now update currentLine
 | |
|             self.currentLine.append(end)
 | |
|         if isinstance(self._fillpath, list):
 | |
|             self._fillpath.append(end)
 | |
|         ######    vererbung!!!!!!!!!!!!!!!!!!!!!!
 | |
|         self._position = end
 | |
|         if self._creatingPoly:
 | |
|             self._poly.append(end)
 | |
|         if len(self.currentLine) > 42: # 42! answer to the ultimate question
 | |
|                                        # of life, the universe and everything
 | |
|             self._newLine()
 | |
|         self._update() #count=True)
 | |
| 
 | |
|     def _undogoto(self, entry):
 | |
|         """Reverse a _goto. Used for undo()
 | |
|         """
 | |
|         old, new, go_modes, coodata = entry
 | |
|         drawing, pc, ps, filling = go_modes
 | |
|         cLI, cL, pl, items = coodata
 | |
|         screen = self.screen
 | |
|         if abs(self._position - new) > 0.5:
 | |
|             print "undogoto: HALLO-DA-STIMMT-WAS-NICHT!"
 | |
|         # restore former situation
 | |
|         self.currentLineItem = cLI
 | |
|         self.currentLine = cL
 | |
| 
 | |
|         if pl == [(0, 0), (0, 0)]:
 | |
|             usepc = ""
 | |
|         else:
 | |
|             usepc = pc
 | |
|         screen._drawline(cLI, pl, fill=usepc, width=ps)
 | |
| 
 | |
|         todelete = [i for i in self.items if (i not in items) and
 | |
|                                        (screen._type(i) == "line")]
 | |
|         for i in todelete:
 | |
|             screen._delete(i)
 | |
|             self.items.remove(i)
 | |
| 
 | |
|         start = old
 | |
|         if self._speed and screen._tracing == 1:
 | |
|             diff = old - new
 | |
|             diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
 | |
|             nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
 | |
|             delta = diff * (1.0/nhops)
 | |
|             for n in range(1, nhops):
 | |
|                 if n == 1:
 | |
|                     top = True
 | |
|                 else:
 | |
|                     top = False
 | |
|                 self._position = new + delta * n
 | |
|                 if drawing:
 | |
|                     screen._drawline(self.drawingLineItem,
 | |
|                                      (start, self._position),
 | |
|                                      pc, ps, top)
 | |
|                 self._update()
 | |
|             if drawing:
 | |
|                 screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
 | |
|                                                fill="", width=ps)
 | |
|         # Turtle now at position old,
 | |
|         self._position = old
 | |
|         ##  if undo is done during crating a polygon, the last vertex
 | |
|         ##  will be deleted. if the polygon is entirel deleted,
 | |
|         ##  creatigPoly will be set to False.
 | |
|         ##  Polygons created before the last one will not be affected by undo()
 | |
|         if self._creatingPoly:
 | |
|             if len(self._poly) > 0:
 | |
|                 self._poly.pop()
 | |
|             if self._poly == []:
 | |
|                 self._creatingPoly = False
 | |
|                 self._poly = None
 | |
|         if filling:
 | |
|             if self._fillpath == []:
 | |
|                 self._fillpath = None
 | |
|                 print "Unwahrscheinlich in _undogoto!"
 | |
|             elif self._fillpath is not None:
 | |
|                 self._fillpath.pop()
 | |
|         self._update() #count=True)
 | |
| 
 | |
|     def _rotate(self, angle):
 | |
|         """Turns pen clockwise by angle.
 | |
|         """
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(("rot", angle, self._degreesPerAU))
 | |
|         angle *= self._degreesPerAU
 | |
|         neworient = self._orient.rotate(angle)
 | |
|         tracing = self.screen._tracing
 | |
|         if tracing == 1 and self._speed > 0:
 | |
|             anglevel = 3.0 * self._speed
 | |
|             steps = 1 + int(abs(angle)/anglevel)
 | |
|             delta = 1.0*angle/steps
 | |
|             for _ in range(steps):
 | |
|                 self._orient = self._orient.rotate(delta)
 | |
|                 self._update()
 | |
|         self._orient = neworient
 | |
|         self._update()
 | |
| 
 | |
|     def _newLine(self, usePos=True):
 | |
|         """Closes current line item and starts a new one.
 | |
|            Remark: if current line became too long, animation
 | |
|            performance (via _drawline) slowed down considerably.
 | |
|         """
 | |
|         if len(self.currentLine) > 1:
 | |
|             self.screen._drawline(self.currentLineItem, self.currentLine,
 | |
|                                       self._pencolor, self._pensize)
 | |
|             self.currentLineItem = self.screen._createline()
 | |
|             self.items.append(self.currentLineItem)
 | |
|         else:
 | |
|             self.screen._drawline(self.currentLineItem, top=True)
 | |
|         self.currentLine = []
 | |
|         if usePos:
 | |
|             self.currentLine = [self._position]
 | |
| 
 | |
|     def fill(self, flag=None):
 | |
|         """Call fill(True) before drawing a shape to fill, fill(False) when done.
 | |
| 
 | |
|         Optional argument:
 | |
|         flag -- True/False (or 1/0 respectively)
 | |
| 
 | |
|         Call fill(True) before drawing the shape you want to fill,
 | |
|         and  fill(False) when done.
 | |
|         When used without argument: return fillstate (True if filling,
 | |
|         False else)
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.fill(True)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.fill(False)
 | |
|         """
 | |
|         filling = isinstance(self._fillpath, list)
 | |
|         if flag is None:
 | |
|             return filling
 | |
|         screen = self.screen
 | |
|         entry1 = entry2 = ()
 | |
|         if filling:
 | |
|             if len(self._fillpath) > 2:
 | |
|                 self.screen._drawpoly(self._fillitem, self._fillpath,
 | |
|                                       fill=self._fillcolor)
 | |
|                 entry1 = ("dofill", self._fillitem)
 | |
|         if flag:
 | |
|             self._fillitem = self.screen._createpoly()
 | |
|             self.items.append(self._fillitem)
 | |
|             self._fillpath = [self._position]
 | |
|             entry2 = ("beginfill", self._fillitem) # , self._fillpath)
 | |
|             self._newLine()
 | |
|         else:
 | |
|             self._fillitem = self._fillpath = None
 | |
|         if self.undobuffer:
 | |
|             if entry1 == ():
 | |
|                 if entry2 != ():
 | |
|                     self.undobuffer.push(entry2)
 | |
|             else:
 | |
|                 if entry2 == ():
 | |
|                     self.undobuffer.push(entry1)
 | |
|                 else:
 | |
|                     self.undobuffer.push(["seq", entry1, entry2])
 | |
|         self._update()
 | |
| 
 | |
|     def begin_fill(self):
 | |
|         """Called just before drawing a shape to be filled.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.begin_fill()
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.end_fill()
 | |
|         """
 | |
|         self.fill(True)
 | |
| 
 | |
|     def end_fill(self):
 | |
|         """Fill the shape drawn after the call begin_fill().
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.begin_fill()
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.left(90)
 | |
|         >>> turtle.forward(100)
 | |
|         >>> turtle.end_fill()
 | |
|         """
 | |
|         self.fill(False)
 | |
| 
 | |
|     def dot(self, size=None, *color):
 | |
|         """Draw a dot with diameter size, using color.
 | |
| 
 | |
|         Optional argumentS:
 | |
|         size -- an integer >= 1 (if given)
 | |
|         color -- a colorstring or a numeric color tuple
 | |
| 
 | |
|         Draw a circular dot with diameter size, using color.
 | |
|         If size is not given, the maximum of pensize+4 and 2*pensize is used.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.dot()
 | |
|         >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50)
 | |
|         """
 | |
|         #print "dot-1:", size, color
 | |
|         if not color:
 | |
|             if isinstance(size, (str, tuple)):
 | |
|                 color = self._colorstr(size)
 | |
|                 size = self._pensize + max(self._pensize, 4)
 | |
|             else:
 | |
|                 color = self._pencolor
 | |
|                 if not size:
 | |
|                     size = self._pensize + max(self._pensize, 4)
 | |
|         else:
 | |
|             if size is None:
 | |
|                 size = self._pensize + max(self._pensize, 4)
 | |
|             color = self._colorstr(color)
 | |
|         #print "dot-2:", size, color
 | |
|         if hasattr(self.screen, "_dot"):
 | |
|             item = self.screen._dot(self._position, size, color)
 | |
|             #print "dot:", size, color, "item:", item
 | |
|             self.items.append(item)
 | |
|             if self.undobuffer:
 | |
|                 self.undobuffer.push(("dot", item))
 | |
|         else:
 | |
|             pen = self.pen()
 | |
|             if self.undobuffer:
 | |
|                 self.undobuffer.push(["seq"])
 | |
|                 self.undobuffer.cumulate = True
 | |
|             try:
 | |
|                 if self.resizemode() == 'auto':
 | |
|                     self.ht()
 | |
|                 self.pendown()
 | |
|                 self.pensize(size)
 | |
|                 self.pencolor(color)
 | |
|                 self.forward(0)
 | |
|             finally:
 | |
|                 self.pen(pen)
 | |
|             if self.undobuffer:
 | |
|                 self.undobuffer.cumulate = False
 | |
| 
 | |
|     def _write(self, txt, align, font):
 | |
|         """Performs the writing for write()
 | |
|         """
 | |
|         item, end = self.screen._write(self._position, txt, align, font,
 | |
|                                                           self._pencolor)
 | |
|         self.items.append(item)
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(("wri", item))
 | |
|         return end
 | |
| 
 | |
|     def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")):
 | |
|         """Write text at the current turtle position.
 | |
| 
 | |
|         Arguments:
 | |
|         arg -- info, which is to be written to the TurtleScreen
 | |
|         move (optional) -- True/False
 | |
|         align (optional) -- one of the strings "left", "center" or right"
 | |
|         font (optional) -- a triple (fontname, fontsize, fonttype)
 | |
| 
 | |
|         Write text - the string representation of arg - at the current
 | |
|         turtle position according to align ("left", "center" or right")
 | |
|         and with the given font.
 | |
|         If move is True, the pen is moved to the bottom-right corner
 | |
|         of the text. By default, move is False.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.write('Home = ', True, align="center")
 | |
|         >>> turtle.write((0,0), True)
 | |
|         """
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.push(["seq"])
 | |
|             self.undobuffer.cumulate = True
 | |
|         end = self._write(str(arg), align.lower(), font)
 | |
|         if move:
 | |
|             x, y = self.pos()
 | |
|             self.setpos(end, y)
 | |
|         if self.undobuffer:
 | |
|             self.undobuffer.cumulate = False
 | |
| 
 | |
|     def begin_poly(self):
 | |
|         """Start recording the vertices of a polygon.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Start recording the vertices of a polygon. Current turtle position
 | |
|         is first point of polygon.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.begin_poly()
 | |
|         """
 | |
|         self._poly = [self._position]
 | |
|         self._creatingPoly = True
 | |
| 
 | |
|     def end_poly(self):
 | |
|         """Stop recording the vertices of a polygon.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Stop recording the vertices of a polygon. Current turtle position is
 | |
|         last point of polygon. This will be connected with the first point.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.end_poly()
 | |
|         """
 | |
|         self._creatingPoly = False
 | |
| 
 | |
|     def get_poly(self):
 | |
|         """Return the lastly recorded polygon.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> p = turtle.get_poly()
 | |
|         >>> turtle.register_shape("myFavouriteShape", p)
 | |
|         """
 | |
|         ## check if there is any poly?  -- 1st solution:
 | |
|         if self._poly is not None:
 | |
|             return tuple(self._poly)
 | |
| 
 | |
|     def getscreen(self):
 | |
|         """Return the TurtleScreen object, the turtle is drawing  on.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Return the TurtleScreen object, the turtle is drawing  on.
 | |
|         So TurtleScreen-methods can be called for that object.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> ts = turtle.getscreen()
 | |
|         >>> ts
 | |
|         <turtle.TurtleScreen object at 0x0106B770>
 | |
|         >>> ts.bgcolor("pink")
 | |
|         """
 | |
|         return self.screen
 | |
| 
 | |
|     def getturtle(self):
 | |
|         """Return the Turtleobject itself.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Only reasonable use: as a function to return the 'anonymous turtle':
 | |
| 
 | |
|         Example:
 | |
|         >>> pet = getturtle()
 | |
|         >>> pet.fd(50)
 | |
|         >>> pet
 | |
|         <turtle.Turtle object at 0x0187D810>
 | |
|         >>> turtles()
 | |
|         [<turtle.Turtle object at 0x0187D810>]
 | |
|         """
 | |
|         return self
 | |
| 
 | |
|     getpen = getturtle
 | |
| 
 | |
| 
 | |
|     ################################################################
 | |
|     ### screen oriented methods recurring to methods of TurtleScreen
 | |
|     ################################################################
 | |
| 
 | |
|     def window_width(self):
 | |
|         """ Returns the width of the turtle window.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.window_width()
 | |
|         640
 | |
|         """
 | |
|         return self.screen._window_size()[0]
 | |
| 
 | |
|     def window_height(self):
 | |
|         """ Return the height of the turtle window.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.window_height()
 | |
|         480
 | |
|         """
 | |
|         return self.screen._window_size()[1]
 | |
| 
 | |
|     def _delay(self, delay=None):
 | |
|         """Set delay value which determines speed of turtle animation.
 | |
|         """
 | |
|         return self.screen.delay(delay)
 | |
| 
 | |
|     #####   event binding methods   #####
 | |
| 
 | |
|     def onclick(self, fun, btn=1, add=None):
 | |
|         """Bind fun to mouse-click event on this turtle on canvas.
 | |
| 
 | |
|         Arguments:
 | |
|         fun --  a function with two arguments, to which will be assigned
 | |
|                 the coordinates of the clicked point on the canvas.
 | |
|         num --  number of the mouse-button defaults to 1 (left mouse button).
 | |
|         add --  True or False. If True, new binding will be added, otherwise
 | |
|                 it will replace a former binding.
 | |
| 
 | |
|         Example for the anonymous turtle, i. e. the procedural way:
 | |
| 
 | |
|         >>> def turn(x, y):
 | |
|                 left(360)
 | |
| 
 | |
|         >>> onclick(turn) # Now clicking into the turtle will turn it.
 | |
|         >>> onclick(None)  # event-binding will be removed
 | |
|         """
 | |
|         self.screen._onclick(self.turtle._item, fun, btn, add)
 | |
|         self._update()
 | |
| 
 | |
|     def onrelease(self, fun, btn=1, add=None):
 | |
|         """Bind fun to mouse-button-release event on this turtle on canvas.
 | |
| 
 | |
|         Arguments:
 | |
|         fun -- a function with two arguments, to which will be assigned
 | |
|                 the coordinates of the clicked point on the canvas.
 | |
|         num --  number of the mouse-button defaults to 1 (left mouse button).
 | |
| 
 | |
|         Example (for a MyTurtle instance named joe):
 | |
|         >>> class MyTurtle(Turtle):
 | |
|                 def glow(self,x,y):
 | |
|                         self.fillcolor("red")
 | |
|                 def unglow(self,x,y):
 | |
|                         self.fillcolor("")
 | |
| 
 | |
|         >>> joe = MyTurtle()
 | |
|         >>> joe.onclick(joe.glow)
 | |
|         >>> joe.onrelease(joe.unglow)
 | |
|         ### clicking on joe turns fillcolor red,
 | |
|         ### unclicking turns it to transparent.
 | |
|         """
 | |
|         self.screen._onrelease(self.turtle._item, fun, btn, add)
 | |
|         self._update()
 | |
| 
 | |
|     def ondrag(self, fun, btn=1, add=None):
 | |
|         """Bind fun to mouse-move event on this turtle on canvas.
 | |
| 
 | |
|         Arguments:
 | |
|         fun -- a function with two arguments, to which will be assigned
 | |
|                the coordinates of the clicked point on the canvas.
 | |
|         num -- number of the mouse-button defaults to 1 (left mouse button).
 | |
| 
 | |
|         Every sequence of mouse-move-events on a turtle is preceded by a
 | |
|         mouse-click event on that turtle.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> turtle.ondrag(turtle.goto)
 | |
| 
 | |
|         ### Subsequently clicking and dragging a Turtle will
 | |
|         ### move it across the screen thereby producing handdrawings
 | |
|         ### (if pen is down).
 | |
|         """
 | |
|         self.screen._ondrag(self.turtle._item, fun, btn, add)
 | |
| 
 | |
| 
 | |
|     def _undo(self, action, data):
 | |
|         """Does the main part of the work for undo()
 | |
|         """
 | |
|         if self.undobuffer is None:
 | |
|             return
 | |
|         if action == "rot":
 | |
|             angle, degPAU = data
 | |
|             self._rotate(-angle*degPAU/self._degreesPerAU)
 | |
|             dummy = self.undobuffer.pop()
 | |
|         elif action == "stamp":
 | |
|             stitem = data[0]
 | |
|             self.clearstamp(stitem)
 | |
|         elif action == "go":
 | |
|             self._undogoto(data)
 | |
|         elif action in ["wri", "dot"]:
 | |
|             item = data[0]
 | |
|             self.screen._delete(item)
 | |
|             self.items.remove(item)
 | |
|         elif action == "dofill":
 | |
|             item = data[0]
 | |
|             self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)),
 | |
|                                   fill="", outline="")
 | |
|         elif action == "beginfill":
 | |
|             item = data[0]
 | |
|             self._fillitem = self._fillpath = None
 | |
|             self.screen._delete(item)
 | |
|             self.items.remove(item)
 | |
|         elif action == "pen":
 | |
|             TPen.pen(self, data[0])
 | |
|             self.undobuffer.pop()
 | |
| 
 | |
|     def undo(self):
 | |
|         """undo (repeatedly) the last turtle action.
 | |
| 
 | |
|         No argument.
 | |
| 
 | |
|         undo (repeatedly) the last turtle action.
 | |
|         Number of available undo actions is determined by the size of
 | |
|         the undobuffer.
 | |
| 
 | |
|         Example (for a Turtle instance named turtle):
 | |
|         >>> for i in range(4):
 | |
|                 turtle.fd(50); turtle.lt(80)
 | |
| 
 | |
|         >>> for i in range(8):
 | |
|                 turtle.undo()
 | |
|         """
 | |
|         if self.undobuffer is None:
 | |
|             return
 | |
|         item = self.undobuffer.pop()
 | |
|         action = item[0]
 | |
|         data = item[1:]
 | |
|         if action == "seq":
 | |
|             while data:
 | |
|                 item = data.pop()
 | |
|                 self._undo(item[0], item[1:])
 | |
|         else:
 | |
|             self._undo(action, data)
 | |
| 
 | |
|     turtlesize = shapesize
 | |
| 
 | |
| RawPen = RawTurtle
 | |
| 
 | |
| ###  Screen - Singleton  ########################
 | |
| 
 | |
| def Screen():
 | |
|     """Return the singleton screen object.
 | |
|     If none exists at the moment, create a new one and return it,
 | |
|     else return the existing one."""
 | |
|     if Turtle._screen is None:
 | |
|         Turtle._screen = _Screen()
 | |
|     return Turtle._screen
 | |
| 
 | |
| class _Screen(TurtleScreen):
 | |
| 
 | |
|     _root = None
 | |
|     _canvas = None
 | |
|     _title = _CFG["title"]
 | |
| 
 | |
|     def __init__(self):
 | |
|         # XXX there is no need for this code to be conditional,
 | |
|         # as there will be only a single _Screen instance, anyway
 | |
|         # XXX actually, the turtle demo is injecting root window,
 | |
|         # so perhaps the conditional creation of a root should be
 | |
|         # preserved (perhaps by passing it as an optional parameter)
 | |
|         if _Screen._root is None:
 | |
|             _Screen._root = self._root = _Root()
 | |
|             self._root.title(_Screen._title)
 | |
|             self._root.ondestroy(self._destroy)
 | |
|         if _Screen._canvas is None:
 | |
|             width = _CFG["width"]
 | |
|             height = _CFG["height"]
 | |
|             canvwidth = _CFG["canvwidth"]
 | |
|             canvheight = _CFG["canvheight"]
 | |
|             leftright = _CFG["leftright"]
 | |
|             topbottom = _CFG["topbottom"]
 | |
|             self._root.setupcanvas(width, height, canvwidth, canvheight)
 | |
|             _Screen._canvas = self._root._getcanvas()
 | |
|             self.setup(width, height, leftright, topbottom)
 | |
|         TurtleScreen.__init__(self, _Screen._canvas)
 | |
| 
 | |
|     def setup(self, width=_CFG["width"], height=_CFG["height"],
 | |
|               startx=_CFG["leftright"], starty=_CFG["topbottom"]):
 | |
|         """ Set the size and position of the main window.
 | |
| 
 | |
|         Arguments:
 | |
|         width: as integer a size in pixels, as float a fraction of the screen.
 | |
|           Default is 50% of screen.
 | |
|         height: as integer the height in pixels, as float a fraction of the
 | |
|           screen. Default is 75% of screen.
 | |
|         startx: if positive, starting position in pixels from the left
 | |
|           edge of the screen, if negative from the right edge
 | |
|           Default, startx=None is to center window horizontally.
 | |
|         starty: if positive, starting position in pixels from the top
 | |
|           edge of the screen, if negative from the bottom edge
 | |
|           Default, starty=None is to center window vertically.
 | |
| 
 | |
|         Examples (for a Screen instance named screen):
 | |
|         >>> screen.setup (width=200, height=200, startx=0, starty=0)
 | |
| 
 | |
|         sets window to 200x200 pixels, in upper left of screen
 | |
| 
 | |
|         >>> screen.setup(width=.75, height=0.5, startx=None, starty=None)
 | |
| 
 | |
|         sets window to 75% of screen by 50% of screen and centers
 | |
|         """
 | |
|         if not hasattr(self._root, "set_geometry"):
 | |
|             return
 | |
|         sw = self._root.win_width()
 | |
|         sh = self._root.win_height()
 | |
|         if isinstance(width, float) and 0 <= width <= 1:
 | |
|             width = sw*width
 | |
|         if startx is None:
 | |
|             startx = (sw - width) / 2
 | |
|         if isinstance(height, float) and 0 <= height <= 1:
 | |
|             height = sh*height
 | |
|         if starty is None:
 | |
|             starty = (sh - height) / 2
 | |
|         self._root.set_geometry(width, height, startx, starty)
 | |
| 
 | |
|     def title(self, titlestring):
 | |
|         """Set title of turtle-window
 | |
| 
 | |
|         Argument:
 | |
|         titlestring -- a string, to appear in the titlebar of the
 | |
|                        turtle graphics window.
 | |
| 
 | |
|         This is a method of Screen-class. Not available for TurtleScreen-
 | |
|         objects.
 | |
| 
 | |
|         Example (for a Screen instance named screen):
 | |
|         >>> screen.title("Welcome to the turtle-zoo!")
 | |
|         """
 | |
|         if _Screen._root is not None:
 | |
|             _Screen._root.title(titlestring)
 | |
|         _Screen._title = titlestring
 | |
| 
 | |
|     def _destroy(self):
 | |
|         root = self._root
 | |
|         if root is _Screen._root:
 | |
|             Turtle._pen = None
 | |
|             Turtle._screen = None
 | |
|             _Screen._root = None
 | |
|             _Screen._canvas = None
 | |
|         TurtleScreen._RUNNING = True
 | |
|         root.destroy()
 | |
| 
 | |
|     def bye(self):
 | |
|         """Shut the turtlegraphics window.
 | |
| 
 | |
|         Example (for a TurtleScreen instance named screen):
 | |
|         >>> screen.bye()
 | |
|         """
 | |
|         self._destroy()
 | |
| 
 | |
|     def exitonclick(self):
 | |
|         """Go into mainloop until the mouse is clicked.
 | |
| 
 | |
|         No arguments.
 | |
| 
 | |
|         Bind bye() method to mouseclick on TurtleScreen.
 | |
|         If "using_IDLE" - value in configuration dictionary is False
 | |
|         (default value), enter mainloop.
 | |
|         If IDLE with -n switch (no subprocess) is used, this value should be
 | |
|         set to True in turtle.cfg. In this case IDLE's mainloop
 | |
|         is active also for the client script.
 | |
| 
 | |
|         This is a method of the Screen-class and not available for
 | |
|         TurtleScreen instances.
 | |
| 
 | |
|         Example (for a Screen instance named screen):
 | |
|         >>> screen.exitonclick()
 | |
| 
 | |
|         """
 | |
|         def exitGracefully(x, y):
 | |
|             """Screen.bye() with two dummy-parameters"""
 | |
|             self.bye()
 | |
|         self.onclick(exitGracefully)
 | |
|         if _CFG["using_IDLE"]:
 | |
|             return
 | |
|         try:
 | |
|             mainloop()
 | |
|         except AttributeError:
 | |
|             exit(0)
 | |
| 
 | |
| 
 | |
| class Turtle(RawTurtle):
 | |
|     """RawTurtle auto-crating (scrolled) canvas.
 | |
| 
 | |
|     When a Turtle object is created or a function derived from some
 | |
|     Turtle method is called a TurtleScreen object is automatically created.
 | |
|     """
 | |
|     _pen = None
 | |
|     _screen = None
 | |
| 
 | |
|     def __init__(self,
 | |
|                  shape=_CFG["shape"],
 | |
|                  undobuffersize=_CFG["undobuffersize"],
 | |
|                  visible=_CFG["visible"]):
 | |
|         if Turtle._screen is None:
 | |
|             Turtle._screen = Screen()
 | |
|         RawTurtle.__init__(self, Turtle._screen,
 | |
|                            shape=shape,
 | |
|                            undobuffersize=undobuffersize,
 | |
|                            visible=visible)
 | |
| 
 | |
| Pen = Turtle
 | |
| 
 | |
| def _getpen():
 | |
|     """Create the 'anonymous' turtle if not already present."""
 | |
|     if Turtle._pen is None:
 | |
|         Turtle._pen = Turtle()
 | |
|     return Turtle._pen
 | |
| 
 | |
| def _getscreen():
 | |
|     """Create a TurtleScreen if not already present."""
 | |
|     if Turtle._screen is None:
 | |
|         Turtle._screen = Screen()
 | |
|     return Turtle._screen
 | |
| 
 | |
| def write_docstringdict(filename="turtle_docstringdict"):
 | |
|     """Create and write docstring-dictionary to file.
 | |
| 
 | |
|     Optional argument:
 | |
|     filename -- a string, used as filename
 | |
|                 default value is turtle_docstringdict
 | |
| 
 | |
|     Has to be called explicitely, (not used by the turtle-graphics classes)
 | |
|     The docstring dictionary will be written to the Python script <filname>.py
 | |
|     It is intended to serve as a template for translation of the docstrings
 | |
|     into different languages.
 | |
|     """
 | |
|     docsdict = {}
 | |
| 
 | |
|     for methodname in _tg_screen_functions:
 | |
|         key = "_Screen."+methodname
 | |
|         docsdict[key] = eval(key).__doc__
 | |
|     for methodname in _tg_turtle_functions:
 | |
|         key = "Turtle."+methodname
 | |
|         docsdict[key] = eval(key).__doc__
 | |
| 
 | |
|     f = open("%s.py" % filename,"w")
 | |
|     keys = sorted([x for x in docsdict.keys()
 | |
|                         if x.split('.')[1] not in _alias_list])
 | |
|     f.write('docsdict = {\n\n')
 | |
|     for key in keys[:-1]:
 | |
|         f.write('%s :\n' % repr(key))
 | |
|         f.write('        """%s\n""",\n\n' % docsdict[key])
 | |
|     key = keys[-1]
 | |
|     f.write('%s :\n' % repr(key))
 | |
|     f.write('        """%s\n"""\n\n' % docsdict[key])
 | |
|     f.write("}\n")
 | |
|     f.close()
 | |
| 
 | |
| def read_docstrings(lang):
 | |
|     """Read in docstrings from lang-specific docstring dictionary.
 | |
| 
 | |
|     Transfer docstrings, translated to lang, from a dictionary-file
 | |
|     to the methods of classes Screen and Turtle and - in revised form -
 | |
|     to the corresponding functions.
 | |
|     """
 | |
|     modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()}
 | |
|     module = __import__(modname)
 | |
|     docsdict = module.docsdict
 | |
|     for key in docsdict:
 | |
|         #print key
 | |
|         try:
 | |
|             eval(key).im_func.__doc__ = docsdict[key]
 | |
|         except:
 | |
|             print "Bad docstring-entry: %s" % key
 | |
| 
 | |
| _LANGUAGE = _CFG["language"]
 | |
| 
 | |
| try:
 | |
|     if _LANGUAGE != "english":
 | |
|         read_docstrings(_LANGUAGE)
 | |
| except ImportError:
 | |
|     print "Cannot find docsdict for", _LANGUAGE
 | |
| except:
 | |
|     print ("Unknown Error when trying to import %s-docstring-dictionary" %
 | |
|                                                                   _LANGUAGE)
 | |
| 
 | |
| 
 | |
| def getmethparlist(ob):
 | |
|     "Get strings describing the arguments for the given object"
 | |
|     argText1 = argText2 = ""
 | |
|     # bit of a hack for methods - turn it into a function
 | |
|     # but we drop the "self" param.
 | |
|     if type(ob)==types.MethodType:
 | |
|         fob = ob.im_func
 | |
|         argOffset = 1
 | |
|     else:
 | |
|         fob = ob
 | |
|         argOffset = 0
 | |
|     # Try and build one for Python defined functions
 | |
|     if type(fob) in [types.FunctionType, types.LambdaType]:
 | |
|         try:
 | |
|             counter = fob.func_code.co_argcount
 | |
|             items2 = list(fob.func_code.co_varnames[argOffset:counter])
 | |
|             realArgs = fob.func_code.co_varnames[argOffset:counter]
 | |
|             defaults = fob.func_defaults or []
 | |
|             defaults = list(map(lambda name: "=%s" % repr(name), defaults))
 | |
|             defaults = [""] * (len(realArgs)-len(defaults)) + defaults
 | |
|             items1 = map(lambda arg, dflt: arg+dflt, realArgs, defaults)
 | |
|             if fob.func_code.co_flags & 0x4:
 | |
|                 items1.append("*"+fob.func_code.co_varnames[counter])
 | |
|                 items2.append("*"+fob.func_code.co_varnames[counter])
 | |
|                 counter += 1
 | |
|             if fob.func_code.co_flags & 0x8:
 | |
|                 items1.append("**"+fob.func_code.co_varnames[counter])
 | |
|                 items2.append("**"+fob.func_code.co_varnames[counter])
 | |
|             argText1 = ", ".join(items1)
 | |
|             argText1 = "(%s)" % argText1
 | |
|             argText2 = ", ".join(items2)
 | |
|             argText2 = "(%s)" % argText2
 | |
|         except:
 | |
|             pass
 | |
|     return argText1, argText2
 | |
| 
 | |
| def _turtle_docrevise(docstr):
 | |
|     """To reduce docstrings from RawTurtle class for functions
 | |
|     """
 | |
|     import re
 | |
|     if docstr is None:
 | |
|         return None
 | |
|     turtlename = _CFG["exampleturtle"]
 | |
|     newdocstr = docstr.replace("%s." % turtlename,"")
 | |
|     parexp = re.compile(r' \(.+ %s\):' % turtlename)
 | |
|     newdocstr = parexp.sub(":", newdocstr)
 | |
|     return newdocstr
 | |
| 
 | |
| def _screen_docrevise(docstr):
 | |
|     """To reduce docstrings from TurtleScreen class for functions
 | |
|     """
 | |
|     import re
 | |
|     if docstr is None:
 | |
|         return None
 | |
|     screenname = _CFG["examplescreen"]
 | |
|     newdocstr = docstr.replace("%s." % screenname,"")
 | |
|     parexp = re.compile(r' \(.+ %s\):' % screenname)
 | |
|     newdocstr = parexp.sub(":", newdocstr)
 | |
|     return newdocstr
 | |
| 
 | |
| ## The following mechanism makes all methods of RawTurtle and Turtle available
 | |
| ## as functions. So we can enhance, change, add, delete methods to these
 | |
| ## classes and do not need to change anything here.
 | |
| 
 | |
| 
 | |
| for methodname in _tg_screen_functions:
 | |
|     pl1, pl2 = getmethparlist(eval('_Screen.' + methodname))
 | |
|     if pl1 == "":
 | |
|         print ">>>>>>", pl1, pl2
 | |
|         continue
 | |
|     defstr = ("def %(key)s%(pl1)s: return _getscreen().%(key)s%(pl2)s" %
 | |
|                                    {'key':methodname, 'pl1':pl1, 'pl2':pl2})
 | |
|     exec defstr
 | |
|     eval(methodname).__doc__ = _screen_docrevise(eval('_Screen.'+methodname).__doc__)
 | |
| 
 | |
| for methodname in _tg_turtle_functions:
 | |
|     pl1, pl2 = getmethparlist(eval('Turtle.' + methodname))
 | |
|     if pl1 == "":
 | |
|         print ">>>>>>", pl1, pl2
 | |
|         continue
 | |
|     defstr = ("def %(key)s%(pl1)s: return _getpen().%(key)s%(pl2)s" %
 | |
|                                    {'key':methodname, 'pl1':pl1, 'pl2':pl2})
 | |
|     exec defstr
 | |
|     eval(methodname).__doc__ = _turtle_docrevise(eval('Turtle.'+methodname).__doc__)
 | |
| 
 | |
| 
 | |
| done = mainloop = TK.mainloop
 | |
| del pl1, pl2, defstr
 | |
| 
 | |
| if __name__ == "__main__":
 | |
|     def switchpen():
 | |
|         if isdown():
 | |
|             pu()
 | |
|         else:
 | |
|             pd()
 | |
| 
 | |
|     def demo1():
 | |
|         """Demo of old turtle.py - module"""
 | |
|         reset()
 | |
|         tracer(True)
 | |
|         up()
 | |
|         backward(100)
 | |
|         down()
 | |
|         # draw 3 squares; the last filled
 | |
|         width(3)
 | |
|         for i in range(3):
 | |
|             if i == 2:
 | |
|                 fill(1)
 | |
|             for _ in range(4):
 | |
|                 forward(20)
 | |
|                 left(90)
 | |
|             if i == 2:
 | |
|                 color("maroon")
 | |
|                 fill(0)
 | |
|             up()
 | |
|             forward(30)
 | |
|             down()
 | |
|         width(1)
 | |
|         color("black")
 | |
|         # move out of the way
 | |
|         tracer(False)
 | |
|         up()
 | |
|         right(90)
 | |
|         forward(100)
 | |
|         right(90)
 | |
|         forward(100)
 | |
|         right(180)
 | |
|         down()
 | |
|         # some text
 | |
|         write("startstart", 1)
 | |
|         write("start", 1)
 | |
|         color("red")
 | |
|         # staircase
 | |
|         for i in range(5):
 | |
|             forward(20)
 | |
|             left(90)
 | |
|             forward(20)
 | |
|             right(90)
 | |
|         # filled staircase
 | |
|         tracer(True)
 | |
|         fill(1)
 | |
|         for i in range(5):
 | |
|             forward(20)
 | |
|             left(90)
 | |
|             forward(20)
 | |
|             right(90)
 | |
|         fill(0)
 | |
|         # more text
 | |
| 
 | |
|     def demo2():
 | |
|         """Demo of some new features."""
 | |
|         speed(1)
 | |
|         st()
 | |
|         pensize(3)
 | |
|         setheading(towards(0, 0))
 | |
|         radius = distance(0, 0)/2.0
 | |
|         rt(90)
 | |
|         for _ in range(18):
 | |
|             switchpen()
 | |
|             circle(radius, 10)
 | |
|         write("wait a moment...")
 | |
|         while undobufferentries():
 | |
|             undo()
 | |
|         reset()
 | |
|         lt(90)
 | |
|         colormode(255)
 | |
|         laenge = 10
 | |
|         pencolor("green")
 | |
|         pensize(3)
 | |
|         lt(180)
 | |
|         for i in range(-2, 16):
 | |
|             if i > 0:
 | |
|                 begin_fill()
 | |
|                 fillcolor(255-15*i, 0, 15*i)
 | |
|             for _ in range(3):
 | |
|                 fd(laenge)
 | |
|                 lt(120)
 | |
|             laenge += 10
 | |
|             lt(15)
 | |
|             speed((speed()+1)%12)
 | |
|         end_fill()
 | |
| 
 | |
|         lt(120)
 | |
|         pu()
 | |
|         fd(70)
 | |
|         rt(30)
 | |
|         pd()
 | |
|         color("red","yellow")
 | |
|         speed(0)
 | |
|         fill(1)
 | |
|         for _ in range(4):
 | |
|             circle(50, 90)
 | |
|             rt(90)
 | |
|             fd(30)
 | |
|             rt(90)
 | |
|         fill(0)
 | |
|         lt(90)
 | |
|         pu()
 | |
|         fd(30)
 | |
|         pd()
 | |
|         shape("turtle")
 | |
| 
 | |
|         tri = getturtle()
 | |
|         tri.resizemode("auto")
 | |
|         turtle = Turtle()
 | |
|         turtle.resizemode("auto")
 | |
|         turtle.shape("turtle")
 | |
|         turtle.reset()
 | |
|         turtle.left(90)
 | |
|         turtle.speed(0)
 | |
|         turtle.up()
 | |
|         turtle.goto(280, 40)
 | |
|         turtle.lt(30)
 | |
|         turtle.down()
 | |
|         turtle.speed(6)
 | |
|         turtle.color("blue","orange")
 | |
|         turtle.pensize(2)
 | |
|         tri.speed(6)
 | |
|         setheading(towards(turtle))
 | |
|         count = 1
 | |
|         while tri.distance(turtle) > 4:
 | |
|             turtle.fd(3.5)
 | |
|             turtle.lt(0.6)
 | |
|             tri.setheading(tri.towards(turtle))
 | |
|             tri.fd(4)
 | |
|             if count % 20 == 0:
 | |
|                 turtle.stamp()
 | |
|                 tri.stamp()
 | |
|                 switchpen()
 | |
|             count += 1
 | |
|         tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align="right")
 | |
|         tri.pencolor("black")
 | |
|         tri.pencolor("red")
 | |
| 
 | |
|         def baba(xdummy, ydummy):
 | |
|             clearscreen()
 | |
|             bye()
 | |
| 
 | |
|         time.sleep(2)
 | |
| 
 | |
|         while undobufferentries():
 | |
|             tri.undo()
 | |
|             turtle.undo()
 | |
|         tri.fd(50)
 | |
|         tri.write("  Click me!", font = ("Courier", 12, "bold") )
 | |
|         tri.onclick(baba, 1)
 | |
| 
 | |
|     demo1()
 | |
|     demo2()
 | |
|     exitonclick()
 | 
