mirror of
				https://github.com/python/cpython.git
				synced 2025-11-04 07:31:38 +00:00 
			
		
		
		
	
		
			
				
	
	
		
			4139 lines
		
	
	
	
		
			140 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
			
		
		
	
	
			4139 lines
		
	
	
	
		
			140 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
#
 | 
						|
# turtle.py: a Tkinter based turtle graphics module for Python
 | 
						|
# Version 1.1b - 4. 5. 2009
 | 
						|
#
 | 
						|
# Copyright (C) 2006 - 2010  Gregor Lingl
 | 
						|
# email: glingl@aon.at
 | 
						|
#
 | 
						|
# This software is provided 'as-is', without any express or implied
 | 
						|
# warranty.  In no event will the authors be held liable for any damages
 | 
						|
# arising from the use of this software.
 | 
						|
#
 | 
						|
# Permission is granted to anyone to use this software for any purpose,
 | 
						|
# including commercial applications, and to alter it and redistribute it
 | 
						|
# freely, subject to the following restrictions:
 | 
						|
#
 | 
						|
# 1. The origin of this software must not be misrepresented; you must not
 | 
						|
#    claim that you wrote the original software. If you use this software
 | 
						|
#    in a product, an acknowledgment in the product documentation would be
 | 
						|
#    appreciated but is not required.
 | 
						|
# 2. Altered source versions must be plainly marked as such, and must not be
 | 
						|
#    misrepresented as being the original software.
 | 
						|
# 3. This notice may not be removed or altered from any source distribution.
 | 
						|
 | 
						|
 | 
						|
"""
 | 
						|
Turtle graphics is a popular way for introducing programming to
 | 
						|
kids. It was part of the original Logo programming language developed
 | 
						|
by Wally Feurzig and Seymour Papert in 1966.
 | 
						|
 | 
						|
Imagine a robotic turtle starting at (0, 0) in the x-y plane. After an ``import turtle``, give it
 | 
						|
the command turtle.forward(15), and it moves (on-screen!) 15 pixels in
 | 
						|
the direction it is facing, drawing a line as it moves. Give it the
 | 
						|
command turtle.right(25), and it rotates in-place 25 degrees clockwise.
 | 
						|
 | 
						|
By combining together these and similar commands, intricate shapes and
 | 
						|
pictures can easily be drawn.
 | 
						|
 | 
						|
----- turtle.py
 | 
						|
 | 
						|
This module is an extended reimplementation of turtle.py from the
 | 
						|
Python standard distribution up to Python 2.5. (See: http://www.python.org)
 | 
						|
 | 
						|
It tries to keep the merits of turtle.py and to be (nearly) 100%
 | 
						|
compatible with it. This means in the first place to enable the
 | 
						|
learning programmer to use all the commands, classes and methods
 | 
						|
interactively when using the module from within IDLE run with
 | 
						|
the -n switch.
 | 
						|
 | 
						|
Roughly it has the following features added:
 | 
						|
 | 
						|
- Better animation of the turtle movements, especially of turning the
 | 
						|
  turtle. So the turtles can more easily be used as a visual feedback
 | 
						|
  instrument by the (beginning) programmer.
 | 
						|
 | 
						|
- Different turtle shapes, gif-images as turtle shapes, user defined
 | 
						|
  and user controllable turtle shapes, among them compound
 | 
						|
  (multicolored) shapes. Turtle shapes can be stretched and tilted, which
 | 
						|
  makes turtles very versatile geometrical objects.
 | 
						|
 | 
						|
- Fine control over turtle movement and screen updates via delay(),
 | 
						|
  and enhanced tracer() and speed() methods.
 | 
						|
 | 
						|
- Aliases for the most commonly used commands, like fd for forward etc.,
 | 
						|
  following the early Logo traditions. This reduces the boring work of
 | 
						|
  typing long sequences of commands, which often occur in a natural way
 | 
						|
  when kids try to program fancy pictures on their first encounter with
 | 
						|
  turtle graphics.
 | 
						|
 | 
						|
- Turtles now have an undo()-method with configurable undo-buffer.
 | 
						|
 | 
						|
- Some simple commands/methods for creating event driven programs
 | 
						|
  (mouse-, key-, timer-events). Especially useful for programming games.
 | 
						|
 | 
						|
- A scrollable Canvas class. The default scrollable Canvas can be
 | 
						|
  extended interactively as needed while playing around with the turtle(s).
 | 
						|
 | 
						|
- A TurtleScreen class with methods controlling background color or
 | 
						|
  background image, window and canvas size and other properties of the
 | 
						|
  TurtleScreen.
 | 
						|
 | 
						|
- There is a method, setworldcoordinates(), to install a user defined
 | 
						|
  coordinate-system for the TurtleScreen.
 | 
						|
 | 
						|
- The implementation uses a 2-vector class named Vec2D, derived from tuple.
 | 
						|
  This class is public, so it can be imported by the application programmer,
 | 
						|
  which makes certain types of computations very natural and compact.
 | 
						|
 | 
						|
- Appearance of the TurtleScreen and the Turtles at startup/import can be
 | 
						|
  configured by means of a turtle.cfg configuration file.
 | 
						|
  The default configuration mimics the appearance of the old turtle module.
 | 
						|
 | 
						|
- If configured appropriately the module reads in docstrings from a docstring
 | 
						|
  dictionary in some different language, supplied separately  and replaces
 | 
						|
  the English ones by those read in. There is a utility function
 | 
						|
  write_docstringdict() to write a dictionary with the original (English)
 | 
						|
  docstrings to disc, so it can serve as a template for translations.
 | 
						|
 | 
						|
Behind the scenes there are some features included with possible
 | 
						|
extensions in mind. These will be commented and documented elsewhere.
 | 
						|
 | 
						|
"""
 | 
						|
 | 
						|
_ver = "turtle 1.1b- - for Python 3.1   -  4. 5. 2009"
 | 
						|
 | 
						|
# print(_ver)
 | 
						|
 | 
						|
import tkinter as TK
 | 
						|
import types
 | 
						|
import math
 | 
						|
import time
 | 
						|
import inspect
 | 
						|
import sys
 | 
						|
 | 
						|
from os.path import isfile, split, join
 | 
						|
from copy import deepcopy
 | 
						|
from tkinter import simpledialog
 | 
						|
 | 
						|
_tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen',
 | 
						|
               'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D']
 | 
						|
_tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye',
 | 
						|
        'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas',
 | 
						|
        'getshapes', 'listen', 'mainloop', 'mode', 'numinput',
 | 
						|
        'onkey', 'onkeypress', 'onkeyrelease', 'onscreenclick', 'ontimer',
 | 
						|
        'register_shape', 'resetscreen', 'screensize', 'setup',
 | 
						|
        'setworldcoordinates', 'textinput', 'title', 'tracer', 'turtles', 'update',
 | 
						|
        'window_height', 'window_width']
 | 
						|
_tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk',
 | 
						|
        'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color',
 | 
						|
        'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd',
 | 
						|
        'fillcolor', 'filling', 'forward', 'get_poly', 'getpen', 'getscreen', 'get_shapepoly',
 | 
						|
        'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown',
 | 
						|
        'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd',
 | 
						|
        'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position',
 | 
						|
        'pu', 'radians', 'right', 'reset', 'resizemode', 'rt',
 | 
						|
        'seth', 'setheading', 'setpos', 'setposition', 'settiltangle',
 | 
						|
        'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'shapetransform', 'shearfactor', 'showturtle',
 | 
						|
        'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards',
 | 
						|
        'turtlesize', 'undo', 'undobufferentries', 'up', 'width',
 | 
						|
        'write', 'xcor', 'ycor']
 | 
						|
_tg_utilities = ['write_docstringdict', 'done']
 | 
						|
 | 
						|
__all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions +
 | 
						|
           _tg_utilities + ['Terminator']) # + _math_functions)
 | 
						|
 | 
						|
_alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos',
 | 
						|
               'pu', 'rt', 'seth', 'setpos', 'setposition', 'st',
 | 
						|
               'turtlesize', 'up', 'width']
 | 
						|
 | 
						|
_CFG = {"width" : 0.5,               # Screen
 | 
						|
        "height" : 0.75,
 | 
						|
        "canvwidth" : 400,
 | 
						|
        "canvheight": 300,
 | 
						|
        "leftright": None,
 | 
						|
        "topbottom": None,
 | 
						|
        "mode": "standard",          # TurtleScreen
 | 
						|
        "colormode": 1.0,
 | 
						|
        "delay": 10,
 | 
						|
        "undobuffersize": 1000,      # RawTurtle
 | 
						|
        "shape": "classic",
 | 
						|
        "pencolor" : "black",
 | 
						|
        "fillcolor" : "black",
 | 
						|
        "resizemode" : "noresize",
 | 
						|
        "visible" : True,
 | 
						|
        "language": "english",        # docstrings
 | 
						|
        "exampleturtle": "turtle",
 | 
						|
        "examplescreen": "screen",
 | 
						|
        "title": "Python Turtle Graphics",
 | 
						|
        "using_IDLE": False
 | 
						|
       }
 | 
						|
 | 
						|
def config_dict(filename):
 | 
						|
    """Convert content of config-file into dictionary."""
 | 
						|
    with open(filename, "r") as f:
 | 
						|
        cfglines = f.readlines()
 | 
						|
    cfgdict = {}
 | 
						|
    for line in cfglines:
 | 
						|
        line = line.strip()
 | 
						|
        if not line or line.startswith("#"):
 | 
						|
            continue
 | 
						|
        try:
 | 
						|
            key, value = line.split("=")
 | 
						|
        except ValueError:
 | 
						|
            print("Bad line in config-file %s:\n%s" % (filename,line))
 | 
						|
            continue
 | 
						|
        key = key.strip()
 | 
						|
        value = value.strip()
 | 
						|
        if value in ["True", "False", "None", "''", '""']:
 | 
						|
            value = eval(value)
 | 
						|
        else:
 | 
						|
            try:
 | 
						|
                if "." in value:
 | 
						|
                    value = float(value)
 | 
						|
                else:
 | 
						|
                    value = int(value)
 | 
						|
            except ValueError:
 | 
						|
                pass # value need not be converted
 | 
						|
        cfgdict[key] = value
 | 
						|
    return cfgdict
 | 
						|
 | 
						|
def readconfig(cfgdict):
 | 
						|
    """Read config-files, change configuration-dict accordingly.
 | 
						|
 | 
						|
    If there is a turtle.cfg file in the current working directory,
 | 
						|
    read it from there. If this contains an importconfig-value,
 | 
						|
    say 'myway', construct filename turtle_mayway.cfg else use
 | 
						|
    turtle.cfg and read it from the import-directory, where
 | 
						|
    turtle.py is located.
 | 
						|
    Update configuration dictionary first according to config-file,
 | 
						|
    in the import directory, then according to config-file in the
 | 
						|
    current working directory.
 | 
						|
    If no config-file is found, the default configuration is used.
 | 
						|
    """
 | 
						|
    default_cfg = "turtle.cfg"
 | 
						|
    cfgdict1 = {}
 | 
						|
    cfgdict2 = {}
 | 
						|
    if isfile(default_cfg):
 | 
						|
        cfgdict1 = config_dict(default_cfg)
 | 
						|
    if "importconfig" in cfgdict1:
 | 
						|
        default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"]
 | 
						|
    try:
 | 
						|
        head, tail = split(__file__)
 | 
						|
        cfg_file2 = join(head, default_cfg)
 | 
						|
    except Exception:
 | 
						|
        cfg_file2 = ""
 | 
						|
    if isfile(cfg_file2):
 | 
						|
        cfgdict2 = config_dict(cfg_file2)
 | 
						|
    _CFG.update(cfgdict2)
 | 
						|
    _CFG.update(cfgdict1)
 | 
						|
 | 
						|
try:
 | 
						|
    readconfig(_CFG)
 | 
						|
except Exception:
 | 
						|
    print ("No configfile read, reason unknown")
 | 
						|
 | 
						|
 | 
						|
class Vec2D(tuple):
 | 
						|
    """A 2 dimensional vector class, used as a helper class
 | 
						|
    for implementing turtle graphics.
 | 
						|
    May be useful for turtle graphics programs also.
 | 
						|
    Derived from tuple, so a vector is a tuple!
 | 
						|
 | 
						|
    Provides (for a, b vectors, k number):
 | 
						|
       a+b vector addition
 | 
						|
       a-b vector subtraction
 | 
						|
       a*b inner product
 | 
						|
       k*a and a*k multiplication with scalar
 | 
						|
       |a| absolute value of a
 | 
						|
       a.rotate(angle) rotation
 | 
						|
    """
 | 
						|
    def __new__(cls, x, y):
 | 
						|
        return tuple.__new__(cls, (x, y))
 | 
						|
    def __add__(self, other):
 | 
						|
        return Vec2D(self[0]+other[0], self[1]+other[1])
 | 
						|
    def __mul__(self, other):
 | 
						|
        if isinstance(other, Vec2D):
 | 
						|
            return self[0]*other[0]+self[1]*other[1]
 | 
						|
        return Vec2D(self[0]*other, self[1]*other)
 | 
						|
    def __rmul__(self, other):
 | 
						|
        if isinstance(other, int) or isinstance(other, float):
 | 
						|
            return Vec2D(self[0]*other, self[1]*other)
 | 
						|
    def __sub__(self, other):
 | 
						|
        return Vec2D(self[0]-other[0], self[1]-other[1])
 | 
						|
    def __neg__(self):
 | 
						|
        return Vec2D(-self[0], -self[1])
 | 
						|
    def __abs__(self):
 | 
						|
        return (self[0]**2 + self[1]**2)**0.5
 | 
						|
    def rotate(self, angle):
 | 
						|
        """rotate self counterclockwise by angle
 | 
						|
        """
 | 
						|
        perp = Vec2D(-self[1], self[0])
 | 
						|
        angle = angle * math.pi / 180.0
 | 
						|
        c, s = math.cos(angle), math.sin(angle)
 | 
						|
        return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s)
 | 
						|
    def __getnewargs__(self):
 | 
						|
        return (self[0], self[1])
 | 
						|
    def __repr__(self):
 | 
						|
        return "(%.2f,%.2f)" % self
 | 
						|
 | 
						|
 | 
						|
##############################################################################
 | 
						|
### From here up to line    : Tkinter - Interface for turtle.py            ###
 | 
						|
### May be replaced by an interface to some different graphics toolkit     ###
 | 
						|
##############################################################################
 | 
						|
 | 
						|
## helper functions for Scrolled Canvas, to forward Canvas-methods
 | 
						|
## to ScrolledCanvas class
 | 
						|
 | 
						|
def __methodDict(cls, _dict):
 | 
						|
    """helper function for Scrolled Canvas"""
 | 
						|
    baseList = list(cls.__bases__)
 | 
						|
    baseList.reverse()
 | 
						|
    for _super in baseList:
 | 
						|
        __methodDict(_super, _dict)
 | 
						|
    for key, value in cls.__dict__.items():
 | 
						|
        if type(value) == types.FunctionType:
 | 
						|
            _dict[key] = value
 | 
						|
 | 
						|
def __methods(cls):
 | 
						|
    """helper function for Scrolled Canvas"""
 | 
						|
    _dict = {}
 | 
						|
    __methodDict(cls, _dict)
 | 
						|
    return _dict.keys()
 | 
						|
 | 
						|
__stringBody = (
 | 
						|
    'def %(method)s(self, *args, **kw): return ' +
 | 
						|
    'self.%(attribute)s.%(method)s(*args, **kw)')
 | 
						|
 | 
						|
def __forwardmethods(fromClass, toClass, toPart, exclude = ()):
 | 
						|
    ### MANY CHANGES ###
 | 
						|
    _dict_1 = {}
 | 
						|
    __methodDict(toClass, _dict_1)
 | 
						|
    _dict = {}
 | 
						|
    mfc = __methods(fromClass)
 | 
						|
    for ex in _dict_1.keys():
 | 
						|
        if ex[:1] == '_' or ex[-1:] == '_' or ex in exclude or ex in mfc:
 | 
						|
            pass
 | 
						|
        else:
 | 
						|
            _dict[ex] = _dict_1[ex]
 | 
						|
 | 
						|
    for method, func in _dict.items():
 | 
						|
        d = {'method': method, 'func': func}
 | 
						|
        if isinstance(toPart, str):
 | 
						|
            execString = \
 | 
						|
                __stringBody % {'method' : method, 'attribute' : toPart}
 | 
						|
        exec(execString, d)
 | 
						|
        setattr(fromClass, method, d[method])   ### NEWU!
 | 
						|
 | 
						|
 | 
						|
class ScrolledCanvas(TK.Frame):
 | 
						|
    """Modeled after the scrolled canvas class from Grayons's Tkinter book.
 | 
						|
 | 
						|
    Used as the default canvas, which pops up automatically when
 | 
						|
    using turtle graphics functions or the Turtle class.
 | 
						|
    """
 | 
						|
    def __init__(self, master, width=500, height=350,
 | 
						|
                                          canvwidth=600, canvheight=500):
 | 
						|
        TK.Frame.__init__(self, master, width=width, height=height)
 | 
						|
        self._rootwindow = self.winfo_toplevel()
 | 
						|
        self.width, self.height = width, height
 | 
						|
        self.canvwidth, self.canvheight = canvwidth, canvheight
 | 
						|
        self.bg = "white"
 | 
						|
        self._canvas = TK.Canvas(master, width=width, height=height,
 | 
						|
                                 bg=self.bg, relief=TK.SUNKEN, borderwidth=2)
 | 
						|
        self.hscroll = TK.Scrollbar(master, command=self._canvas.xview,
 | 
						|
                                    orient=TK.HORIZONTAL)
 | 
						|
        self.vscroll = TK.Scrollbar(master, command=self._canvas.yview)
 | 
						|
        self._canvas.configure(xscrollcommand=self.hscroll.set,
 | 
						|
                               yscrollcommand=self.vscroll.set)
 | 
						|
        self.rowconfigure(0, weight=1, minsize=0)
 | 
						|
        self.columnconfigure(0, weight=1, minsize=0)
 | 
						|
        self._canvas.grid(padx=1, in_ = self, pady=1, row=0,
 | 
						|
                column=0, rowspan=1, columnspan=1, sticky='news')
 | 
						|
        self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
 | 
						|
                column=1, rowspan=1, columnspan=1, sticky='news')
 | 
						|
        self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
 | 
						|
                column=0, rowspan=1, columnspan=1, sticky='news')
 | 
						|
        self.reset()
 | 
						|
        self._rootwindow.bind('<Configure>', self.onResize)
 | 
						|
 | 
						|
    def reset(self, canvwidth=None, canvheight=None, bg = None):
 | 
						|
        """Adjust canvas and scrollbars according to given canvas size."""
 | 
						|
        if canvwidth:
 | 
						|
            self.canvwidth = canvwidth
 | 
						|
        if canvheight:
 | 
						|
            self.canvheight = canvheight
 | 
						|
        if bg:
 | 
						|
            self.bg = bg
 | 
						|
        self._canvas.config(bg=bg,
 | 
						|
                        scrollregion=(-self.canvwidth//2, -self.canvheight//2,
 | 
						|
                                       self.canvwidth//2, self.canvheight//2))
 | 
						|
        self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) /
 | 
						|
                                                               self.canvwidth)
 | 
						|
        self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) /
 | 
						|
                                                              self.canvheight)
 | 
						|
        self.adjustScrolls()
 | 
						|
 | 
						|
 | 
						|
    def adjustScrolls(self):
 | 
						|
        """ Adjust scrollbars according to window- and canvas-size.
 | 
						|
        """
 | 
						|
        cwidth = self._canvas.winfo_width()
 | 
						|
        cheight = self._canvas.winfo_height()
 | 
						|
        self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth)
 | 
						|
        self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight)
 | 
						|
        if cwidth < self.canvwidth or cheight < self.canvheight:
 | 
						|
            self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
 | 
						|
                              column=0, rowspan=1, columnspan=1, sticky='news')
 | 
						|
            self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
 | 
						|
                              column=1, rowspan=1, columnspan=1, sticky='news')
 | 
						|
        else:
 | 
						|
            self.hscroll.grid_forget()
 | 
						|
            self.vscroll.grid_forget()
 | 
						|
 | 
						|
    def onResize(self, event):
 | 
						|
        """self-explanatory"""
 | 
						|
        self.adjustScrolls()
 | 
						|
 | 
						|
    def bbox(self, *args):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        return self._canvas.bbox(*args)
 | 
						|
 | 
						|
    def cget(self, *args, **kwargs):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        return self._canvas.cget(*args, **kwargs)
 | 
						|
 | 
						|
    def config(self, *args, **kwargs):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        self._canvas.config(*args, **kwargs)
 | 
						|
 | 
						|
    def bind(self, *args, **kwargs):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        self._canvas.bind(*args, **kwargs)
 | 
						|
 | 
						|
    def unbind(self, *args, **kwargs):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        self._canvas.unbind(*args, **kwargs)
 | 
						|
 | 
						|
    def focus_force(self):
 | 
						|
        """ 'forward' method, which canvas itself has inherited...
 | 
						|
        """
 | 
						|
        self._canvas.focus_force()
 | 
						|
 | 
						|
__forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas')
 | 
						|
 | 
						|
 | 
						|
class _Root(TK.Tk):
 | 
						|
    """Root class for Screen based on Tkinter."""
 | 
						|
    def __init__(self):
 | 
						|
        TK.Tk.__init__(self)
 | 
						|
 | 
						|
    def setupcanvas(self, width, height, cwidth, cheight):
 | 
						|
        self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight)
 | 
						|
        self._canvas.pack(expand=1, fill="both")
 | 
						|
 | 
						|
    def _getcanvas(self):
 | 
						|
        return self._canvas
 | 
						|
 | 
						|
    def set_geometry(self, width, height, startx, starty):
 | 
						|
        self.geometry("%dx%d%+d%+d"%(width, height, startx, starty))
 | 
						|
 | 
						|
    def ondestroy(self, destroy):
 | 
						|
        self.wm_protocol("WM_DELETE_WINDOW", destroy)
 | 
						|
 | 
						|
    def win_width(self):
 | 
						|
        return self.winfo_screenwidth()
 | 
						|
 | 
						|
    def win_height(self):
 | 
						|
        return self.winfo_screenheight()
 | 
						|
 | 
						|
Canvas = TK.Canvas
 | 
						|
 | 
						|
 | 
						|
class TurtleScreenBase(object):
 | 
						|
    """Provide the basic graphics functionality.
 | 
						|
       Interface between Tkinter and turtle.py.
 | 
						|
 | 
						|
       To port turtle.py to some different graphics toolkit
 | 
						|
       a corresponding TurtleScreenBase class has to be implemented.
 | 
						|
    """
 | 
						|
 | 
						|
    @staticmethod
 | 
						|
    def _blankimage():
 | 
						|
        """return a blank image object
 | 
						|
        """
 | 
						|
        img = TK.PhotoImage(width=1, height=1)
 | 
						|
        img.blank()
 | 
						|
        return img
 | 
						|
 | 
						|
    @staticmethod
 | 
						|
    def _image(filename):
 | 
						|
        """return an image object containing the
 | 
						|
        imagedata from a gif-file named filename.
 | 
						|
        """
 | 
						|
        return TK.PhotoImage(file=filename)
 | 
						|
 | 
						|
    def __init__(self, cv):
 | 
						|
        self.cv = cv
 | 
						|
        if isinstance(cv, ScrolledCanvas):
 | 
						|
            w = self.cv.canvwidth
 | 
						|
            h = self.cv.canvheight
 | 
						|
        else:  # expected: ordinary TK.Canvas
 | 
						|
            w = int(self.cv.cget("width"))
 | 
						|
            h = int(self.cv.cget("height"))
 | 
						|
            self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 ))
 | 
						|
        self.canvwidth = w
 | 
						|
        self.canvheight = h
 | 
						|
        self.xscale = self.yscale = 1.0
 | 
						|
 | 
						|
    def _createpoly(self):
 | 
						|
        """Create an invisible polygon item on canvas self.cv)
 | 
						|
        """
 | 
						|
        return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="")
 | 
						|
 | 
						|
    def _drawpoly(self, polyitem, coordlist, fill=None,
 | 
						|
                  outline=None, width=None, top=False):
 | 
						|
        """Configure polygonitem polyitem according to provided
 | 
						|
        arguments:
 | 
						|
        coordlist is sequence of coordinates
 | 
						|
        fill is filling color
 | 
						|
        outline is outline color
 | 
						|
        top is a boolean value, which specifies if polyitem
 | 
						|
        will be put on top of the canvas' displaylist so it
 | 
						|
        will not be covered by other items.
 | 
						|
        """
 | 
						|
        cl = []
 | 
						|
        for x, y in coordlist:
 | 
						|
            cl.append(x * self.xscale)
 | 
						|
            cl.append(-y * self.yscale)
 | 
						|
        self.cv.coords(polyitem, *cl)
 | 
						|
        if fill is not None:
 | 
						|
            self.cv.itemconfigure(polyitem, fill=fill)
 | 
						|
        if outline is not None:
 | 
						|
            self.cv.itemconfigure(polyitem, outline=outline)
 | 
						|
        if width is not None:
 | 
						|
            self.cv.itemconfigure(polyitem, width=width)
 | 
						|
        if top:
 | 
						|
            self.cv.tag_raise(polyitem)
 | 
						|
 | 
						|
    def _createline(self):
 | 
						|
        """Create an invisible line item on canvas self.cv)
 | 
						|
        """
 | 
						|
        return self.cv.create_line(0, 0, 0, 0, fill="", width=2,
 | 
						|
                                   capstyle = TK.ROUND)
 | 
						|
 | 
						|
    def _drawline(self, lineitem, coordlist=None,
 | 
						|
                  fill=None, width=None, top=False):
 | 
						|
        """Configure lineitem according to provided arguments:
 | 
						|
        coordlist is sequence of coordinates
 | 
						|
        fill is drawing color
 | 
						|
        width is width of drawn line.
 | 
						|
        top is a boolean value, which specifies if polyitem
 | 
						|
        will be put on top of the canvas' displaylist so it
 | 
						|
        will not be covered by other items.
 | 
						|
        """
 | 
						|
        if coordlist is not None:
 | 
						|
            cl = []
 | 
						|
            for x, y in coordlist:
 | 
						|
                cl.append(x * self.xscale)
 | 
						|
                cl.append(-y * self.yscale)
 | 
						|
            self.cv.coords(lineitem, *cl)
 | 
						|
        if fill is not None:
 | 
						|
            self.cv.itemconfigure(lineitem, fill=fill)
 | 
						|
        if width is not None:
 | 
						|
            self.cv.itemconfigure(lineitem, width=width)
 | 
						|
        if top:
 | 
						|
            self.cv.tag_raise(lineitem)
 | 
						|
 | 
						|
    def _delete(self, item):
 | 
						|
        """Delete graphics item from canvas.
 | 
						|
        If item is"all" delete all graphics items.
 | 
						|
        """
 | 
						|
        self.cv.delete(item)
 | 
						|
 | 
						|
    def _update(self):
 | 
						|
        """Redraw graphics items on canvas
 | 
						|
        """
 | 
						|
        self.cv.update()
 | 
						|
 | 
						|
    def _delay(self, delay):
 | 
						|
        """Delay subsequent canvas actions for delay ms."""
 | 
						|
        self.cv.after(delay)
 | 
						|
 | 
						|
    def _iscolorstring(self, color):
 | 
						|
        """Check if the string color is a legal Tkinter color string.
 | 
						|
        """
 | 
						|
        try:
 | 
						|
            rgb = self.cv.winfo_rgb(color)
 | 
						|
            ok = True
 | 
						|
        except TK.TclError:
 | 
						|
            ok = False
 | 
						|
        return ok
 | 
						|
 | 
						|
    def _bgcolor(self, color=None):
 | 
						|
        """Set canvas' backgroundcolor if color is not None,
 | 
						|
        else return backgroundcolor."""
 | 
						|
        if color is not None:
 | 
						|
            self.cv.config(bg = color)
 | 
						|
            self._update()
 | 
						|
        else:
 | 
						|
            return self.cv.cget("bg")
 | 
						|
 | 
						|
    def _write(self, pos, txt, align, font, pencolor):
 | 
						|
        """Write txt at pos in canvas with specified font
 | 
						|
        and color.
 | 
						|
        Return text item and x-coord of right bottom corner
 | 
						|
        of text's bounding box."""
 | 
						|
        x, y = pos
 | 
						|
        x = x * self.xscale
 | 
						|
        y = y * self.yscale
 | 
						|
        anchor = {"left":"sw", "center":"s", "right":"se" }
 | 
						|
        item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align],
 | 
						|
                                        fill = pencolor, font = font)
 | 
						|
        x0, y0, x1, y1 = self.cv.bbox(item)
 | 
						|
        self.cv.update()
 | 
						|
        return item, x1-1
 | 
						|
 | 
						|
##    def _dot(self, pos, size, color):
 | 
						|
##        """may be implemented for some other graphics toolkit"""
 | 
						|
 | 
						|
    def _onclick(self, item, fun, num=1, add=None):
 | 
						|
        """Bind fun to mouse-click event on turtle.
 | 
						|
        fun must be a function with two arguments, the coordinates
 | 
						|
        of the clicked point on the canvas.
 | 
						|
        num, the number of the mouse-button defaults to 1
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            self.cv.tag_unbind(item, "<Button-%s>" % num)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                x, y = (self.cv.canvasx(event.x)/self.xscale,
 | 
						|
                        -self.cv.canvasy(event.y)/self.yscale)
 | 
						|
                fun(x, y)
 | 
						|
            self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add)
 | 
						|
 | 
						|
    def _onrelease(self, item, fun, num=1, add=None):
 | 
						|
        """Bind fun to mouse-button-release event on turtle.
 | 
						|
        fun must be a function with two arguments, the coordinates
 | 
						|
        of the point on the canvas where mouse button is released.
 | 
						|
        num, the number of the mouse-button defaults to 1
 | 
						|
 | 
						|
        If a turtle is clicked, first _onclick-event will be performed,
 | 
						|
        then _onscreensclick-event.
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                x, y = (self.cv.canvasx(event.x)/self.xscale,
 | 
						|
                        -self.cv.canvasy(event.y)/self.yscale)
 | 
						|
                fun(x, y)
 | 
						|
            self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num,
 | 
						|
                             eventfun, add)
 | 
						|
 | 
						|
    def _ondrag(self, item, fun, num=1, add=None):
 | 
						|
        """Bind fun to mouse-move-event (with pressed mouse button) on turtle.
 | 
						|
        fun must be a function with two arguments, the coordinates of the
 | 
						|
        actual mouse position on the canvas.
 | 
						|
        num, the number of the mouse-button defaults to 1
 | 
						|
 | 
						|
        Every sequence of mouse-move-events on a turtle is preceded by a
 | 
						|
        mouse-click event on that turtle.
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            self.cv.tag_unbind(item, "<Button%s-Motion>" % num)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                try:
 | 
						|
                    x, y = (self.cv.canvasx(event.x)/self.xscale,
 | 
						|
                           -self.cv.canvasy(event.y)/self.yscale)
 | 
						|
                    fun(x, y)
 | 
						|
                except Exception:
 | 
						|
                    pass
 | 
						|
            self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add)
 | 
						|
 | 
						|
    def _onscreenclick(self, fun, num=1, add=None):
 | 
						|
        """Bind fun to mouse-click event on canvas.
 | 
						|
        fun must be a function with two arguments, the coordinates
 | 
						|
        of the clicked point on the canvas.
 | 
						|
        num, the number of the mouse-button defaults to 1
 | 
						|
 | 
						|
        If a turtle is clicked, first _onclick-event will be performed,
 | 
						|
        then _onscreensclick-event.
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            self.cv.unbind("<Button-%s>" % num)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                x, y = (self.cv.canvasx(event.x)/self.xscale,
 | 
						|
                        -self.cv.canvasy(event.y)/self.yscale)
 | 
						|
                fun(x, y)
 | 
						|
            self.cv.bind("<Button-%s>" % num, eventfun, add)
 | 
						|
 | 
						|
    def _onkeyrelease(self, fun, key):
 | 
						|
        """Bind fun to key-release event of key.
 | 
						|
        Canvas must have focus. See method listen
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            self.cv.unbind("<KeyRelease-%s>" % key, None)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                fun()
 | 
						|
            self.cv.bind("<KeyRelease-%s>" % key, eventfun)
 | 
						|
 | 
						|
    def _onkeypress(self, fun, key=None):
 | 
						|
        """If key is given, bind fun to key-press event of key.
 | 
						|
        Otherwise bind fun to any key-press.
 | 
						|
        Canvas must have focus. See method listen.
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            if key is None:
 | 
						|
                self.cv.unbind("<KeyPress>", None)
 | 
						|
            else:
 | 
						|
                self.cv.unbind("<KeyPress-%s>" % key, None)
 | 
						|
        else:
 | 
						|
            def eventfun(event):
 | 
						|
                fun()
 | 
						|
            if key is None:
 | 
						|
                self.cv.bind("<KeyPress>", eventfun)
 | 
						|
            else:
 | 
						|
                self.cv.bind("<KeyPress-%s>" % key, eventfun)
 | 
						|
 | 
						|
    def _listen(self):
 | 
						|
        """Set focus on canvas (in order to collect key-events)
 | 
						|
        """
 | 
						|
        self.cv.focus_force()
 | 
						|
 | 
						|
    def _ontimer(self, fun, t):
 | 
						|
        """Install a timer, which calls fun after t milliseconds.
 | 
						|
        """
 | 
						|
        if t == 0:
 | 
						|
            self.cv.after_idle(fun)
 | 
						|
        else:
 | 
						|
            self.cv.after(t, fun)
 | 
						|
 | 
						|
    def _createimage(self, image):
 | 
						|
        """Create and return image item on canvas.
 | 
						|
        """
 | 
						|
        return self.cv.create_image(0, 0, image=image)
 | 
						|
 | 
						|
    def _drawimage(self, item, pos, image):
 | 
						|
        """Configure image item as to draw image object
 | 
						|
        at position (x,y) on canvas)
 | 
						|
        """
 | 
						|
        x, y = pos
 | 
						|
        self.cv.coords(item, (x * self.xscale, -y * self.yscale))
 | 
						|
        self.cv.itemconfig(item, image=image)
 | 
						|
 | 
						|
    def _setbgpic(self, item, image):
 | 
						|
        """Configure image item as to draw image object
 | 
						|
        at center of canvas. Set item to the first item
 | 
						|
        in the displaylist, so it will be drawn below
 | 
						|
        any other item ."""
 | 
						|
        self.cv.itemconfig(item, image=image)
 | 
						|
        self.cv.tag_lower(item)
 | 
						|
 | 
						|
    def _type(self, item):
 | 
						|
        """Return 'line' or 'polygon' or 'image' depending on
 | 
						|
        type of item.
 | 
						|
        """
 | 
						|
        return self.cv.type(item)
 | 
						|
 | 
						|
    def _pointlist(self, item):
 | 
						|
        """returns list of coordinate-pairs of points of item
 | 
						|
        Example (for insiders):
 | 
						|
        >>> from turtle import *
 | 
						|
        >>> getscreen()._pointlist(getturtle().turtle._item)
 | 
						|
        [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982),
 | 
						|
        (9.9999999999999982, 0.0)]
 | 
						|
        >>> """
 | 
						|
        cl = self.cv.coords(item)
 | 
						|
        pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)]
 | 
						|
        return  pl
 | 
						|
 | 
						|
    def _setscrollregion(self, srx1, sry1, srx2, sry2):
 | 
						|
        self.cv.config(scrollregion=(srx1, sry1, srx2, sry2))
 | 
						|
 | 
						|
    def _rescale(self, xscalefactor, yscalefactor):
 | 
						|
        items = self.cv.find_all()
 | 
						|
        for item in items:
 | 
						|
            coordinates = list(self.cv.coords(item))
 | 
						|
            newcoordlist = []
 | 
						|
            while coordinates:
 | 
						|
                x, y = coordinates[:2]
 | 
						|
                newcoordlist.append(x * xscalefactor)
 | 
						|
                newcoordlist.append(y * yscalefactor)
 | 
						|
                coordinates = coordinates[2:]
 | 
						|
            self.cv.coords(item, *newcoordlist)
 | 
						|
 | 
						|
    def _resize(self, canvwidth=None, canvheight=None, bg=None):
 | 
						|
        """Resize the canvas the turtles are drawing on. Does
 | 
						|
        not alter the drawing window.
 | 
						|
        """
 | 
						|
        # needs amendment
 | 
						|
        if not isinstance(self.cv, ScrolledCanvas):
 | 
						|
            return self.canvwidth, self.canvheight
 | 
						|
        if canvwidth is canvheight is bg is None:
 | 
						|
            return self.cv.canvwidth, self.cv.canvheight
 | 
						|
        if canvwidth is not None:
 | 
						|
            self.canvwidth = canvwidth
 | 
						|
        if canvheight is not None:
 | 
						|
            self.canvheight = canvheight
 | 
						|
        self.cv.reset(canvwidth, canvheight, bg)
 | 
						|
 | 
						|
    def _window_size(self):
 | 
						|
        """ Return the width and height of the turtle window.
 | 
						|
        """
 | 
						|
        width = self.cv.winfo_width()
 | 
						|
        if width <= 1:  # the window isn't managed by a geometry manager
 | 
						|
            width = self.cv['width']
 | 
						|
        height = self.cv.winfo_height()
 | 
						|
        if height <= 1: # the window isn't managed by a geometry manager
 | 
						|
            height = self.cv['height']
 | 
						|
        return width, height
 | 
						|
 | 
						|
    def mainloop(self):
 | 
						|
        """Starts event loop - calling Tkinter's mainloop function.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Must be last statement in a turtle graphics program.
 | 
						|
        Must NOT be used if a script is run from within IDLE in -n mode
 | 
						|
        (No subprocess) - for interactive use of turtle graphics.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.mainloop()
 | 
						|
 | 
						|
        """
 | 
						|
        TK.mainloop()
 | 
						|
 | 
						|
    def textinput(self, title, prompt):
 | 
						|
        """Pop up a dialog window for input of a string.
 | 
						|
 | 
						|
        Arguments: title is the title of the dialog window,
 | 
						|
        prompt is a text mostly describing what information to input.
 | 
						|
 | 
						|
        Return the string input
 | 
						|
        If the dialog is canceled, return None.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.textinput("NIM", "Name of first player:")
 | 
						|
 | 
						|
        """
 | 
						|
        return simpledialog.askstring(title, prompt)
 | 
						|
 | 
						|
    def numinput(self, title, prompt, default=None, minval=None, maxval=None):
 | 
						|
        """Pop up a dialog window for input of a number.
 | 
						|
 | 
						|
        Arguments: title is the title of the dialog window,
 | 
						|
        prompt is a text mostly describing what numerical information to input.
 | 
						|
        default: default value
 | 
						|
        minval: minimum value for imput
 | 
						|
        maxval: maximum value for input
 | 
						|
 | 
						|
        The number input must be in the range minval .. maxval if these are
 | 
						|
        given. If not, a hint is issued and the dialog remains open for
 | 
						|
        correction. Return the number input.
 | 
						|
        If the dialog is canceled,  return None.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.numinput("Poker", "Your stakes:", 1000, minval=10, maxval=10000)
 | 
						|
 | 
						|
        """
 | 
						|
        return simpledialog.askfloat(title, prompt, initialvalue=default,
 | 
						|
                                     minvalue=minval, maxvalue=maxval)
 | 
						|
 | 
						|
 | 
						|
##############################################################################
 | 
						|
###                  End of Tkinter - interface                            ###
 | 
						|
##############################################################################
 | 
						|
 | 
						|
 | 
						|
class Terminator (Exception):
 | 
						|
    """Will be raised in TurtleScreen.update, if _RUNNING becomes False.
 | 
						|
 | 
						|
    This stops execution of a turtle graphics script.
 | 
						|
    Main purpose: use in the Demo-Viewer turtle.Demo.py.
 | 
						|
    """
 | 
						|
    pass
 | 
						|
 | 
						|
 | 
						|
class TurtleGraphicsError(Exception):
 | 
						|
    """Some TurtleGraphics Error
 | 
						|
    """
 | 
						|
 | 
						|
 | 
						|
class Shape(object):
 | 
						|
    """Data structure modeling shapes.
 | 
						|
 | 
						|
    attribute _type is one of "polygon", "image", "compound"
 | 
						|
    attribute _data is - depending on _type a poygon-tuple,
 | 
						|
    an image or a list constructed using the addcomponent method.
 | 
						|
    """
 | 
						|
    def __init__(self, type_, data=None):
 | 
						|
        self._type = type_
 | 
						|
        if type_ == "polygon":
 | 
						|
            if isinstance(data, list):
 | 
						|
                data = tuple(data)
 | 
						|
        elif type_ == "image":
 | 
						|
            if isinstance(data, str):
 | 
						|
                if data.lower().endswith(".gif") and isfile(data):
 | 
						|
                    data = TurtleScreen._image(data)
 | 
						|
                # else data assumed to be Photoimage
 | 
						|
        elif type_ == "compound":
 | 
						|
            data = []
 | 
						|
        else:
 | 
						|
            raise TurtleGraphicsError("There is no shape type %s" % type_)
 | 
						|
        self._data = data
 | 
						|
 | 
						|
    def addcomponent(self, poly, fill, outline=None):
 | 
						|
        """Add component to a shape of type compound.
 | 
						|
 | 
						|
        Arguments: poly is a polygon, i. e. a tuple of number pairs.
 | 
						|
        fill is the fillcolor of the component,
 | 
						|
        outline is the outline color of the component.
 | 
						|
 | 
						|
        call (for a Shapeobject namend s):
 | 
						|
        --   s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue")
 | 
						|
 | 
						|
        Example:
 | 
						|
        >>> poly = ((0,0),(10,-5),(0,10),(-10,-5))
 | 
						|
        >>> s = Shape("compound")
 | 
						|
        >>> s.addcomponent(poly, "red", "blue")
 | 
						|
        >>> # .. add more components and then use register_shape()
 | 
						|
        """
 | 
						|
        if self._type != "compound":
 | 
						|
            raise TurtleGraphicsError("Cannot add component to %s Shape"
 | 
						|
                                                                % self._type)
 | 
						|
        if outline is None:
 | 
						|
            outline = fill
 | 
						|
        self._data.append([poly, fill, outline])
 | 
						|
 | 
						|
 | 
						|
class Tbuffer(object):
 | 
						|
    """Ring buffer used as undobuffer for RawTurtle objects."""
 | 
						|
    def __init__(self, bufsize=10):
 | 
						|
        self.bufsize = bufsize
 | 
						|
        self.buffer = [[None]] * bufsize
 | 
						|
        self.ptr = -1
 | 
						|
        self.cumulate = False
 | 
						|
    def reset(self, bufsize=None):
 | 
						|
        if bufsize is None:
 | 
						|
            for i in range(self.bufsize):
 | 
						|
                self.buffer[i] = [None]
 | 
						|
        else:
 | 
						|
            self.bufsize = bufsize
 | 
						|
            self.buffer = [[None]] * bufsize
 | 
						|
        self.ptr = -1
 | 
						|
    def push(self, item):
 | 
						|
        if self.bufsize > 0:
 | 
						|
            if not self.cumulate:
 | 
						|
                self.ptr = (self.ptr + 1) % self.bufsize
 | 
						|
                self.buffer[self.ptr] = item
 | 
						|
            else:
 | 
						|
                self.buffer[self.ptr].append(item)
 | 
						|
    def pop(self):
 | 
						|
        if self.bufsize > 0:
 | 
						|
            item = self.buffer[self.ptr]
 | 
						|
            if item is None:
 | 
						|
                return None
 | 
						|
            else:
 | 
						|
                self.buffer[self.ptr] = [None]
 | 
						|
                self.ptr = (self.ptr - 1) % self.bufsize
 | 
						|
                return (item)
 | 
						|
    def nr_of_items(self):
 | 
						|
        return self.bufsize - self.buffer.count([None])
 | 
						|
    def __repr__(self):
 | 
						|
        return str(self.buffer) + " " + str(self.ptr)
 | 
						|
 | 
						|
 | 
						|
 | 
						|
class TurtleScreen(TurtleScreenBase):
 | 
						|
    """Provides screen oriented methods like setbg etc.
 | 
						|
 | 
						|
    Only relies upon the methods of TurtleScreenBase and NOT
 | 
						|
    upon components of the underlying graphics toolkit -
 | 
						|
    which is Tkinter in this case.
 | 
						|
    """
 | 
						|
    _RUNNING = True
 | 
						|
 | 
						|
    def __init__(self, cv, mode=_CFG["mode"],
 | 
						|
                 colormode=_CFG["colormode"], delay=_CFG["delay"]):
 | 
						|
        self._shapes = {
 | 
						|
                   "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))),
 | 
						|
                  "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7),
 | 
						|
                              (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6),
 | 
						|
                              (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6),
 | 
						|
                              (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10),
 | 
						|
                              (2,14))),
 | 
						|
                  "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88),
 | 
						|
                              (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51),
 | 
						|
                              (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0),
 | 
						|
                              (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09),
 | 
						|
                              (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51),
 | 
						|
                              (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))),
 | 
						|
                  "square" : Shape("polygon", ((10,-10), (10,10), (-10,10),
 | 
						|
                              (-10,-10))),
 | 
						|
                "triangle" : Shape("polygon", ((10,-5.77), (0,11.55),
 | 
						|
                              (-10,-5.77))),
 | 
						|
                  "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))),
 | 
						|
                   "blank" : Shape("image", self._blankimage())
 | 
						|
                  }
 | 
						|
 | 
						|
        self._bgpics = {"nopic" : ""}
 | 
						|
 | 
						|
        TurtleScreenBase.__init__(self, cv)
 | 
						|
        self._mode = mode
 | 
						|
        self._delayvalue = delay
 | 
						|
        self._colormode = _CFG["colormode"]
 | 
						|
        self._keys = []
 | 
						|
        self.clear()
 | 
						|
        if sys.platform == 'darwin':
 | 
						|
            # Force Turtle window to the front on OS X. This is needed because
 | 
						|
            # the Turtle window will show behind the Terminal window when you
 | 
						|
            # start the demo from the command line.
 | 
						|
            rootwindow = cv.winfo_toplevel()
 | 
						|
            rootwindow.call('wm', 'attributes', '.', '-topmost', '1')
 | 
						|
            rootwindow.call('wm', 'attributes', '.', '-topmost', '0')
 | 
						|
 | 
						|
    def clear(self):
 | 
						|
        """Delete all drawings and all turtles from the TurtleScreen.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Reset empty TurtleScreen to its initial state: white background,
 | 
						|
        no backgroundimage, no eventbindings and tracing on.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.clear()
 | 
						|
 | 
						|
        Note: this method is not available as function.
 | 
						|
        """
 | 
						|
        self._delayvalue = _CFG["delay"]
 | 
						|
        self._colormode = _CFG["colormode"]
 | 
						|
        self._delete("all")
 | 
						|
        self._bgpic = self._createimage("")
 | 
						|
        self._bgpicname = "nopic"
 | 
						|
        self._tracing = 1
 | 
						|
        self._updatecounter = 0
 | 
						|
        self._turtles = []
 | 
						|
        self.bgcolor("white")
 | 
						|
        for btn in 1, 2, 3:
 | 
						|
            self.onclick(None, btn)
 | 
						|
        self.onkeypress(None)
 | 
						|
        for key in self._keys[:]:
 | 
						|
            self.onkey(None, key)
 | 
						|
            self.onkeypress(None, key)
 | 
						|
        Turtle._pen = None
 | 
						|
 | 
						|
    def mode(self, mode=None):
 | 
						|
        """Set turtle-mode ('standard', 'logo' or 'world') and perform reset.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        mode -- one of the strings 'standard', 'logo' or 'world'
 | 
						|
 | 
						|
        Mode 'standard' is compatible with turtle.py.
 | 
						|
        Mode 'logo' is compatible with most Logo-Turtle-Graphics.
 | 
						|
        Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in
 | 
						|
        this mode angles appear distorted if x/y unit-ratio doesn't equal 1.
 | 
						|
        If mode is not given, return the current mode.
 | 
						|
 | 
						|
             Mode      Initial turtle heading     positive angles
 | 
						|
         ------------|-------------------------|-------------------
 | 
						|
          'standard'    to the right (east)       counterclockwise
 | 
						|
            'logo'        upward    (north)         clockwise
 | 
						|
 | 
						|
        Examples:
 | 
						|
        >>> mode('logo')   # resets turtle heading to north
 | 
						|
        >>> mode()
 | 
						|
        'logo'
 | 
						|
        """
 | 
						|
        if mode is None:
 | 
						|
            return self._mode
 | 
						|
        mode = mode.lower()
 | 
						|
        if mode not in ["standard", "logo", "world"]:
 | 
						|
            raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode)
 | 
						|
        self._mode = mode
 | 
						|
        if mode in ["standard", "logo"]:
 | 
						|
            self._setscrollregion(-self.canvwidth//2, -self.canvheight//2,
 | 
						|
                                       self.canvwidth//2, self.canvheight//2)
 | 
						|
            self.xscale = self.yscale = 1.0
 | 
						|
        self.reset()
 | 
						|
 | 
						|
    def setworldcoordinates(self, llx, lly, urx, ury):
 | 
						|
        """Set up a user defined coordinate-system.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        llx -- a number, x-coordinate of lower left corner of canvas
 | 
						|
        lly -- a number, y-coordinate of lower left corner of canvas
 | 
						|
        urx -- a number, x-coordinate of upper right corner of canvas
 | 
						|
        ury -- a number, y-coordinate of upper right corner of canvas
 | 
						|
 | 
						|
        Set up user coodinat-system and switch to mode 'world' if necessary.
 | 
						|
        This performs a screen.reset. If mode 'world' is already active,
 | 
						|
        all drawings are redrawn according to the new coordinates.
 | 
						|
 | 
						|
        But ATTENTION: in user-defined coordinatesystems angles may appear
 | 
						|
        distorted. (see Screen.mode())
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.setworldcoordinates(-10,-0.5,50,1.5)
 | 
						|
        >>> for _ in range(36):
 | 
						|
        ...     left(10)
 | 
						|
        ...     forward(0.5)
 | 
						|
        """
 | 
						|
        if self.mode() != "world":
 | 
						|
            self.mode("world")
 | 
						|
        xspan = float(urx - llx)
 | 
						|
        yspan = float(ury - lly)
 | 
						|
        wx, wy = self._window_size()
 | 
						|
        self.screensize(wx-20, wy-20)
 | 
						|
        oldxscale, oldyscale = self.xscale, self.yscale
 | 
						|
        self.xscale = self.canvwidth / xspan
 | 
						|
        self.yscale = self.canvheight / yspan
 | 
						|
        srx1 = llx * self.xscale
 | 
						|
        sry1 = -ury * self.yscale
 | 
						|
        srx2 = self.canvwidth + srx1
 | 
						|
        sry2 = self.canvheight + sry1
 | 
						|
        self._setscrollregion(srx1, sry1, srx2, sry2)
 | 
						|
        self._rescale(self.xscale/oldxscale, self.yscale/oldyscale)
 | 
						|
        self.update()
 | 
						|
 | 
						|
    def register_shape(self, name, shape=None):
 | 
						|
        """Adds a turtle shape to TurtleScreen's shapelist.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        (1) name is the name of a gif-file and shape is None.
 | 
						|
            Installs the corresponding image shape.
 | 
						|
            !! Image-shapes DO NOT rotate when turning the turtle,
 | 
						|
            !! so they do not display the heading of the turtle!
 | 
						|
        (2) name is an arbitrary string and shape is a tuple
 | 
						|
            of pairs of coordinates. Installs the corresponding
 | 
						|
            polygon shape
 | 
						|
        (3) name is an arbitrary string and shape is a
 | 
						|
            (compound) Shape object. Installs the corresponding
 | 
						|
            compound shape.
 | 
						|
        To use a shape, you have to issue the command shape(shapename).
 | 
						|
 | 
						|
        call: register_shape("turtle.gif")
 | 
						|
        --or: register_shape("tri", ((0,0), (10,10), (-10,10)))
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3)))
 | 
						|
 | 
						|
        """
 | 
						|
        if shape is None:
 | 
						|
            # image
 | 
						|
            if name.lower().endswith(".gif"):
 | 
						|
                shape = Shape("image", self._image(name))
 | 
						|
            else:
 | 
						|
                raise TurtleGraphicsError("Bad arguments for register_shape.\n"
 | 
						|
                                          + "Use  help(register_shape)" )
 | 
						|
        elif isinstance(shape, tuple):
 | 
						|
            shape = Shape("polygon", shape)
 | 
						|
        ## else shape assumed to be Shape-instance
 | 
						|
        self._shapes[name] = shape
 | 
						|
 | 
						|
    def _colorstr(self, color):
 | 
						|
        """Return color string corresponding to args.
 | 
						|
 | 
						|
        Argument may be a string or a tuple of three
 | 
						|
        numbers corresponding to actual colormode,
 | 
						|
        i.e. in the range 0<=n<=colormode.
 | 
						|
 | 
						|
        If the argument doesn't represent a color,
 | 
						|
        an error is raised.
 | 
						|
        """
 | 
						|
        if len(color) == 1:
 | 
						|
            color = color[0]
 | 
						|
        if isinstance(color, str):
 | 
						|
            if self._iscolorstring(color) or color == "":
 | 
						|
                return color
 | 
						|
            else:
 | 
						|
                raise TurtleGraphicsError("bad color string: %s" % str(color))
 | 
						|
        try:
 | 
						|
            r, g, b = color
 | 
						|
        except (TypeError, ValueError):
 | 
						|
            raise TurtleGraphicsError("bad color arguments: %s" % str(color))
 | 
						|
        if self._colormode == 1.0:
 | 
						|
            r, g, b = [round(255.0*x) for x in (r, g, b)]
 | 
						|
        if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
 | 
						|
            raise TurtleGraphicsError("bad color sequence: %s" % str(color))
 | 
						|
        return "#%02x%02x%02x" % (r, g, b)
 | 
						|
 | 
						|
    def _color(self, cstr):
 | 
						|
        if not cstr.startswith("#"):
 | 
						|
            return cstr
 | 
						|
        if len(cstr) == 7:
 | 
						|
            cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)]
 | 
						|
        elif len(cstr) == 4:
 | 
						|
            cl = [16*int(cstr[h], 16) for h in cstr[1:]]
 | 
						|
        else:
 | 
						|
            raise TurtleGraphicsError("bad colorstring: %s" % cstr)
 | 
						|
        return tuple(c * self._colormode/255 for c in cl)
 | 
						|
 | 
						|
    def colormode(self, cmode=None):
 | 
						|
        """Return the colormode or set it to 1.0 or 255.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        cmode -- one of the values 1.0 or 255
 | 
						|
 | 
						|
        r, g, b values of colortriples have to be in range 0..cmode.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.colormode()
 | 
						|
        1.0
 | 
						|
        >>> screen.colormode(255)
 | 
						|
        >>> pencolor(240,160,80)
 | 
						|
        """
 | 
						|
        if cmode is None:
 | 
						|
            return self._colormode
 | 
						|
        if cmode == 1.0:
 | 
						|
            self._colormode = float(cmode)
 | 
						|
        elif cmode == 255:
 | 
						|
            self._colormode = int(cmode)
 | 
						|
 | 
						|
    def reset(self):
 | 
						|
        """Reset all Turtles on the Screen to their initial state.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.reset()
 | 
						|
        """
 | 
						|
        for turtle in self._turtles:
 | 
						|
            turtle._setmode(self._mode)
 | 
						|
            turtle.reset()
 | 
						|
 | 
						|
    def turtles(self):
 | 
						|
        """Return the list of turtles on the screen.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.turtles()
 | 
						|
        [<turtle.Turtle object at 0x00E11FB0>]
 | 
						|
        """
 | 
						|
        return self._turtles
 | 
						|
 | 
						|
    def bgcolor(self, *args):
 | 
						|
        """Set or return backgroundcolor of the TurtleScreen.
 | 
						|
 | 
						|
        Arguments (if given): a color string or three numbers
 | 
						|
        in the range 0..colormode or a 3-tuple of such numbers.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.bgcolor("orange")
 | 
						|
        >>> screen.bgcolor()
 | 
						|
        'orange'
 | 
						|
        >>> screen.bgcolor(0.5,0,0.5)
 | 
						|
        >>> screen.bgcolor()
 | 
						|
        '#800080'
 | 
						|
        """
 | 
						|
        if args:
 | 
						|
            color = self._colorstr(args)
 | 
						|
        else:
 | 
						|
            color = None
 | 
						|
        color = self._bgcolor(color)
 | 
						|
        if color is not None:
 | 
						|
            color = self._color(color)
 | 
						|
        return color
 | 
						|
 | 
						|
    def tracer(self, n=None, delay=None):
 | 
						|
        """Turns turtle animation on/off and set delay for update drawings.
 | 
						|
 | 
						|
        Optional arguments:
 | 
						|
        n -- nonnegative  integer
 | 
						|
        delay -- nonnegative  integer
 | 
						|
 | 
						|
        If n is given, only each n-th regular screen update is really performed.
 | 
						|
        (Can be used to accelerate the drawing of complex graphics.)
 | 
						|
        Second arguments sets delay value (see RawTurtle.delay())
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.tracer(8, 25)
 | 
						|
        >>> dist = 2
 | 
						|
        >>> for i in range(200):
 | 
						|
        ...     fd(dist)
 | 
						|
        ...     rt(90)
 | 
						|
        ...     dist += 2
 | 
						|
        """
 | 
						|
        if n is None:
 | 
						|
            return self._tracing
 | 
						|
        self._tracing = int(n)
 | 
						|
        self._updatecounter = 0
 | 
						|
        if delay is not None:
 | 
						|
            self._delayvalue = int(delay)
 | 
						|
        if self._tracing:
 | 
						|
            self.update()
 | 
						|
 | 
						|
    def delay(self, delay=None):
 | 
						|
        """ Return or set the drawing delay in milliseconds.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        delay -- positive integer
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.delay(15)
 | 
						|
        >>> screen.delay()
 | 
						|
        15
 | 
						|
        """
 | 
						|
        if delay is None:
 | 
						|
            return self._delayvalue
 | 
						|
        self._delayvalue = int(delay)
 | 
						|
 | 
						|
    def _incrementudc(self):
 | 
						|
        """Increment update counter."""
 | 
						|
        if not TurtleScreen._RUNNING:
 | 
						|
            TurtleScreen._RUNNING = True
 | 
						|
            raise Terminator
 | 
						|
        if self._tracing > 0:
 | 
						|
            self._updatecounter += 1
 | 
						|
            self._updatecounter %= self._tracing
 | 
						|
 | 
						|
    def update(self):
 | 
						|
        """Perform a TurtleScreen update.
 | 
						|
        """
 | 
						|
        tracing = self._tracing
 | 
						|
        self._tracing = True
 | 
						|
        for t in self.turtles():
 | 
						|
            t._update_data()
 | 
						|
            t._drawturtle()
 | 
						|
        self._tracing = tracing
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def window_width(self):
 | 
						|
        """ Return the width of the turtle window.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.window_width()
 | 
						|
        640
 | 
						|
        """
 | 
						|
        return self._window_size()[0]
 | 
						|
 | 
						|
    def window_height(self):
 | 
						|
        """ Return the height of the turtle window.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.window_height()
 | 
						|
        480
 | 
						|
        """
 | 
						|
        return self._window_size()[1]
 | 
						|
 | 
						|
    def getcanvas(self):
 | 
						|
        """Return the Canvas of this TurtleScreen.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Screen instance named screen):
 | 
						|
        >>> cv = screen.getcanvas()
 | 
						|
        >>> cv
 | 
						|
        <turtle.ScrolledCanvas instance at 0x010742D8>
 | 
						|
        """
 | 
						|
        return self.cv
 | 
						|
 | 
						|
    def getshapes(self):
 | 
						|
        """Return a list of names of all currently available turtle shapes.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.getshapes()
 | 
						|
        ['arrow', 'blank', 'circle', ... , 'turtle']
 | 
						|
        """
 | 
						|
        return sorted(self._shapes.keys())
 | 
						|
 | 
						|
    def onclick(self, fun, btn=1, add=None):
 | 
						|
        """Bind fun to mouse-click event on canvas.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with two arguments, the coordinates of the
 | 
						|
               clicked point on the canvas.
 | 
						|
        btn -- the number of the mouse-button, defaults to 1
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen)
 | 
						|
 | 
						|
        >>> screen.onclick(goto)
 | 
						|
        >>> # Subsequently clicking into the TurtleScreen will
 | 
						|
        >>> # make the turtle move to the clicked point.
 | 
						|
        >>> screen.onclick(None)
 | 
						|
        """
 | 
						|
        self._onscreenclick(fun, btn, add)
 | 
						|
 | 
						|
    def onkey(self, fun, key):
 | 
						|
        """Bind fun to key-release event of key.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with no arguments
 | 
						|
        key -- a string: key (e.g. "a") or key-symbol (e.g. "space")
 | 
						|
 | 
						|
        In order to be able to register key-events, TurtleScreen
 | 
						|
        must have focus. (See method listen.)
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
 | 
						|
        >>> def f():
 | 
						|
        ...     fd(50)
 | 
						|
        ...     lt(60)
 | 
						|
        ...
 | 
						|
        >>> screen.onkey(f, "Up")
 | 
						|
        >>> screen.listen()
 | 
						|
 | 
						|
        Subsequently the turtle can be moved by repeatedly pressing
 | 
						|
        the up-arrow key, consequently drawing a hexagon
 | 
						|
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            if key in self._keys:
 | 
						|
                self._keys.remove(key)
 | 
						|
        elif key not in self._keys:
 | 
						|
            self._keys.append(key)
 | 
						|
        self._onkeyrelease(fun, key)
 | 
						|
 | 
						|
    def onkeypress(self, fun, key=None):
 | 
						|
        """Bind fun to key-press event of key if key is given,
 | 
						|
        or to any key-press-event if no key is given.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with no arguments
 | 
						|
        key -- a string: key (e.g. "a") or key-symbol (e.g. "space")
 | 
						|
 | 
						|
        In order to be able to register key-events, TurtleScreen
 | 
						|
        must have focus. (See method listen.)
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen
 | 
						|
        and a Turtle instance named turtle):
 | 
						|
 | 
						|
        >>> def f():
 | 
						|
        ...     fd(50)
 | 
						|
        ...     lt(60)
 | 
						|
        ...
 | 
						|
        >>> screen.onkeypress(f, "Up")
 | 
						|
        >>> screen.listen()
 | 
						|
 | 
						|
        Subsequently the turtle can be moved by repeatedly pressing
 | 
						|
        the up-arrow key, or by keeping pressed the up-arrow key.
 | 
						|
        consequently drawing a hexagon.
 | 
						|
        """
 | 
						|
        if fun is None:
 | 
						|
            if key in self._keys:
 | 
						|
                self._keys.remove(key)
 | 
						|
        elif key is not None and key not in self._keys:
 | 
						|
            self._keys.append(key)
 | 
						|
        self._onkeypress(fun, key)
 | 
						|
 | 
						|
    def listen(self, xdummy=None, ydummy=None):
 | 
						|
        """Set focus on TurtleScreen (in order to collect key-events)
 | 
						|
 | 
						|
        No arguments.
 | 
						|
        Dummy arguments are provided in order
 | 
						|
        to be able to pass listen to the onclick method.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.listen()
 | 
						|
        """
 | 
						|
        self._listen()
 | 
						|
 | 
						|
    def ontimer(self, fun, t=0):
 | 
						|
        """Install a timer, which calls fun after t milliseconds.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with no arguments.
 | 
						|
        t -- a number >= 0
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
 | 
						|
        >>> running = True
 | 
						|
        >>> def f():
 | 
						|
        ...     if running:
 | 
						|
        ...             fd(50)
 | 
						|
        ...             lt(60)
 | 
						|
        ...             screen.ontimer(f, 250)
 | 
						|
        ...
 | 
						|
        >>> f()   # makes the turtle marching around
 | 
						|
        >>> running = False
 | 
						|
        """
 | 
						|
        self._ontimer(fun, t)
 | 
						|
 | 
						|
    def bgpic(self, picname=None):
 | 
						|
        """Set background image or return name of current backgroundimage.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        picname -- a string, name of a gif-file or "nopic".
 | 
						|
 | 
						|
        If picname is a filename, set the corresponding image as background.
 | 
						|
        If picname is "nopic", delete backgroundimage, if present.
 | 
						|
        If picname is None, return the filename of the current backgroundimage.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.bgpic()
 | 
						|
        'nopic'
 | 
						|
        >>> screen.bgpic("landscape.gif")
 | 
						|
        >>> screen.bgpic()
 | 
						|
        'landscape.gif'
 | 
						|
        """
 | 
						|
        if picname is None:
 | 
						|
            return self._bgpicname
 | 
						|
        if picname not in self._bgpics:
 | 
						|
            self._bgpics[picname] = self._image(picname)
 | 
						|
        self._setbgpic(self._bgpic, self._bgpics[picname])
 | 
						|
        self._bgpicname = picname
 | 
						|
 | 
						|
    def screensize(self, canvwidth=None, canvheight=None, bg=None):
 | 
						|
        """Resize the canvas the turtles are drawing on.
 | 
						|
 | 
						|
        Optional arguments:
 | 
						|
        canvwidth -- positive integer, new width of canvas in pixels
 | 
						|
        canvheight --  positive integer, new height of canvas in pixels
 | 
						|
        bg -- colorstring or color-tuple, new backgroundcolor
 | 
						|
        If no arguments are given, return current (canvaswidth, canvasheight)
 | 
						|
 | 
						|
        Do not alter the drawing window. To observe hidden parts of
 | 
						|
        the canvas use the scrollbars. (Can make visible those parts
 | 
						|
        of a drawing, which were outside the canvas before!)
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.screensize(2000,1500)
 | 
						|
        >>> # e.g. to search for an erroneously escaped turtle ;-)
 | 
						|
        """
 | 
						|
        return self._resize(canvwidth, canvheight, bg)
 | 
						|
 | 
						|
    onscreenclick = onclick
 | 
						|
    resetscreen = reset
 | 
						|
    clearscreen = clear
 | 
						|
    addshape = register_shape
 | 
						|
    onkeyrelease = onkey
 | 
						|
 | 
						|
class TNavigator(object):
 | 
						|
    """Navigation part of the RawTurtle.
 | 
						|
    Implements methods for turtle movement.
 | 
						|
    """
 | 
						|
    START_ORIENTATION = {
 | 
						|
        "standard": Vec2D(1.0, 0.0),
 | 
						|
        "world"   : Vec2D(1.0, 0.0),
 | 
						|
        "logo"    : Vec2D(0.0, 1.0)  }
 | 
						|
    DEFAULT_MODE = "standard"
 | 
						|
    DEFAULT_ANGLEOFFSET = 0
 | 
						|
    DEFAULT_ANGLEORIENT = 1
 | 
						|
 | 
						|
    def __init__(self, mode=DEFAULT_MODE):
 | 
						|
        self._angleOffset = self.DEFAULT_ANGLEOFFSET
 | 
						|
        self._angleOrient = self.DEFAULT_ANGLEORIENT
 | 
						|
        self._mode = mode
 | 
						|
        self.undobuffer = None
 | 
						|
        self.degrees()
 | 
						|
        self._mode = None
 | 
						|
        self._setmode(mode)
 | 
						|
        TNavigator.reset(self)
 | 
						|
 | 
						|
    def reset(self):
 | 
						|
        """reset turtle to its initial values
 | 
						|
 | 
						|
        Will be overwritten by parent class
 | 
						|
        """
 | 
						|
        self._position = Vec2D(0.0, 0.0)
 | 
						|
        self._orient =  TNavigator.START_ORIENTATION[self._mode]
 | 
						|
 | 
						|
    def _setmode(self, mode=None):
 | 
						|
        """Set turtle-mode to 'standard', 'world' or 'logo'.
 | 
						|
        """
 | 
						|
        if mode is None:
 | 
						|
            return self._mode
 | 
						|
        if mode not in ["standard", "logo", "world"]:
 | 
						|
            return
 | 
						|
        self._mode = mode
 | 
						|
        if mode in ["standard", "world"]:
 | 
						|
            self._angleOffset = 0
 | 
						|
            self._angleOrient = 1
 | 
						|
        else: # mode == "logo":
 | 
						|
            self._angleOffset = self._fullcircle/4.
 | 
						|
            self._angleOrient = -1
 | 
						|
 | 
						|
    def _setDegreesPerAU(self, fullcircle):
 | 
						|
        """Helper function for degrees() and radians()"""
 | 
						|
        self._fullcircle = fullcircle
 | 
						|
        self._degreesPerAU = 360/fullcircle
 | 
						|
        if self._mode == "standard":
 | 
						|
            self._angleOffset = 0
 | 
						|
        else:
 | 
						|
            self._angleOffset = fullcircle/4.
 | 
						|
 | 
						|
    def degrees(self, fullcircle=360.0):
 | 
						|
        """ Set angle measurement units to degrees.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        fullcircle -  a number
 | 
						|
 | 
						|
        Set angle measurement units, i. e. set number
 | 
						|
        of 'degrees' for a full circle. Dafault value is
 | 
						|
        360 degrees.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.left(90)
 | 
						|
        >>> turtle.heading()
 | 
						|
        90
 | 
						|
 | 
						|
        Change angle measurement unit to grad (also known as gon,
 | 
						|
        grade, or gradian and equals 1/100-th of the right angle.)
 | 
						|
        >>> turtle.degrees(400.0)
 | 
						|
        >>> turtle.heading()
 | 
						|
        100
 | 
						|
 | 
						|
        """
 | 
						|
        self._setDegreesPerAU(fullcircle)
 | 
						|
 | 
						|
    def radians(self):
 | 
						|
        """ Set the angle measurement units to radians.
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.heading()
 | 
						|
        90
 | 
						|
        >>> turtle.radians()
 | 
						|
        >>> turtle.heading()
 | 
						|
        1.5707963267948966
 | 
						|
        """
 | 
						|
        self._setDegreesPerAU(2*math.pi)
 | 
						|
 | 
						|
    def _go(self, distance):
 | 
						|
        """move turtle forward by specified distance"""
 | 
						|
        ende = self._position + self._orient * distance
 | 
						|
        self._goto(ende)
 | 
						|
 | 
						|
    def _rotate(self, angle):
 | 
						|
        """Turn turtle counterclockwise by specified angle if angle > 0."""
 | 
						|
        angle *= self._degreesPerAU
 | 
						|
        self._orient = self._orient.rotate(angle)
 | 
						|
 | 
						|
    def _goto(self, end):
 | 
						|
        """move turtle to position end."""
 | 
						|
        self._position = end
 | 
						|
 | 
						|
    def forward(self, distance):
 | 
						|
        """Move the turtle forward by the specified distance.
 | 
						|
 | 
						|
        Aliases: forward | fd
 | 
						|
 | 
						|
        Argument:
 | 
						|
        distance -- a number (integer or float)
 | 
						|
 | 
						|
        Move the turtle forward by the specified distance, in the direction
 | 
						|
        the turtle is headed.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00, 0.00)
 | 
						|
        >>> turtle.forward(25)
 | 
						|
        >>> turtle.position()
 | 
						|
        (25.00,0.00)
 | 
						|
        >>> turtle.forward(-75)
 | 
						|
        >>> turtle.position()
 | 
						|
        (-50.00,0.00)
 | 
						|
        """
 | 
						|
        self._go(distance)
 | 
						|
 | 
						|
    def back(self, distance):
 | 
						|
        """Move the turtle backward by distance.
 | 
						|
 | 
						|
        Aliases: back | backward | bk
 | 
						|
 | 
						|
        Argument:
 | 
						|
        distance -- a number
 | 
						|
 | 
						|
        Move the turtle backward by distance ,opposite to the direction the
 | 
						|
        turtle is headed. Do not change the turtle's heading.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00, 0.00)
 | 
						|
        >>> turtle.backward(30)
 | 
						|
        >>> turtle.position()
 | 
						|
        (-30.00, 0.00)
 | 
						|
        """
 | 
						|
        self._go(-distance)
 | 
						|
 | 
						|
    def right(self, angle):
 | 
						|
        """Turn turtle right by angle units.
 | 
						|
 | 
						|
        Aliases: right | rt
 | 
						|
 | 
						|
        Argument:
 | 
						|
        angle -- a number (integer or float)
 | 
						|
 | 
						|
        Turn turtle right by angle units. (Units are by default degrees,
 | 
						|
        but can be set via the degrees() and radians() functions.)
 | 
						|
        Angle orientation depends on mode. (See this.)
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.heading()
 | 
						|
        22.0
 | 
						|
        >>> turtle.right(45)
 | 
						|
        >>> turtle.heading()
 | 
						|
        337.0
 | 
						|
        """
 | 
						|
        self._rotate(-angle)
 | 
						|
 | 
						|
    def left(self, angle):
 | 
						|
        """Turn turtle left by angle units.
 | 
						|
 | 
						|
        Aliases: left | lt
 | 
						|
 | 
						|
        Argument:
 | 
						|
        angle -- a number (integer or float)
 | 
						|
 | 
						|
        Turn turtle left by angle units. (Units are by default degrees,
 | 
						|
        but can be set via the degrees() and radians() functions.)
 | 
						|
        Angle orientation depends on mode. (See this.)
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.heading()
 | 
						|
        22.0
 | 
						|
        >>> turtle.left(45)
 | 
						|
        >>> turtle.heading()
 | 
						|
        67.0
 | 
						|
        """
 | 
						|
        self._rotate(angle)
 | 
						|
 | 
						|
    def pos(self):
 | 
						|
        """Return the turtle's current location (x,y), as a Vec2D-vector.
 | 
						|
 | 
						|
        Aliases: pos | position
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pos()
 | 
						|
        (0.00, 240.00)
 | 
						|
        """
 | 
						|
        return self._position
 | 
						|
 | 
						|
    def xcor(self):
 | 
						|
        """ Return the turtle's x coordinate.
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> reset()
 | 
						|
        >>> turtle.left(60)
 | 
						|
        >>> turtle.forward(100)
 | 
						|
        >>> print turtle.xcor()
 | 
						|
        50.0
 | 
						|
        """
 | 
						|
        return self._position[0]
 | 
						|
 | 
						|
    def ycor(self):
 | 
						|
        """ Return the turtle's y coordinate
 | 
						|
        ---
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> reset()
 | 
						|
        >>> turtle.left(60)
 | 
						|
        >>> turtle.forward(100)
 | 
						|
        >>> print turtle.ycor()
 | 
						|
        86.6025403784
 | 
						|
        """
 | 
						|
        return self._position[1]
 | 
						|
 | 
						|
 | 
						|
    def goto(self, x, y=None):
 | 
						|
        """Move turtle to an absolute position.
 | 
						|
 | 
						|
        Aliases: setpos | setposition | goto:
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        x -- a number      or     a pair/vector of numbers
 | 
						|
        y -- a number             None
 | 
						|
 | 
						|
        call: goto(x, y)         # two coordinates
 | 
						|
        --or: goto((x, y))       # a pair (tuple) of coordinates
 | 
						|
        --or: goto(vec)          # e.g. as returned by pos()
 | 
						|
 | 
						|
        Move turtle to an absolute position. If the pen is down,
 | 
						|
        a line will be drawn. The turtle's orientation does not change.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> tp = turtle.pos()
 | 
						|
        >>> tp
 | 
						|
        (0.00, 0.00)
 | 
						|
        >>> turtle.setpos(60,30)
 | 
						|
        >>> turtle.pos()
 | 
						|
        (60.00,30.00)
 | 
						|
        >>> turtle.setpos((20,80))
 | 
						|
        >>> turtle.pos()
 | 
						|
        (20.00,80.00)
 | 
						|
        >>> turtle.setpos(tp)
 | 
						|
        >>> turtle.pos()
 | 
						|
        (0.00,0.00)
 | 
						|
        """
 | 
						|
        if y is None:
 | 
						|
            self._goto(Vec2D(*x))
 | 
						|
        else:
 | 
						|
            self._goto(Vec2D(x, y))
 | 
						|
 | 
						|
    def home(self):
 | 
						|
        """Move turtle to the origin - coordinates (0,0).
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Move turtle to the origin - coordinates (0,0) and set its
 | 
						|
        heading to its start-orientation (which depends on mode).
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.home()
 | 
						|
        """
 | 
						|
        self.goto(0, 0)
 | 
						|
        self.setheading(0)
 | 
						|
 | 
						|
    def setx(self, x):
 | 
						|
        """Set the turtle's first coordinate to x
 | 
						|
 | 
						|
        Argument:
 | 
						|
        x -- a number (integer or float)
 | 
						|
 | 
						|
        Set the turtle's first coordinate to x, leave second coordinate
 | 
						|
        unchanged.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00, 240.00)
 | 
						|
        >>> turtle.setx(10)
 | 
						|
        >>> turtle.position()
 | 
						|
        (10.00, 240.00)
 | 
						|
        """
 | 
						|
        self._goto(Vec2D(x, self._position[1]))
 | 
						|
 | 
						|
    def sety(self, y):
 | 
						|
        """Set the turtle's second coordinate to y
 | 
						|
 | 
						|
        Argument:
 | 
						|
        y -- a number (integer or float)
 | 
						|
 | 
						|
        Set the turtle's first coordinate to x, second coordinate remains
 | 
						|
        unchanged.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00, 40.00)
 | 
						|
        >>> turtle.sety(-10)
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00, -10.00)
 | 
						|
        """
 | 
						|
        self._goto(Vec2D(self._position[0], y))
 | 
						|
 | 
						|
    def distance(self, x, y=None):
 | 
						|
        """Return the distance from the turtle to (x,y) in turtle step units.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        x -- a number   or  a pair/vector of numbers   or   a turtle instance
 | 
						|
        y -- a number       None                            None
 | 
						|
 | 
						|
        call: distance(x, y)         # two coordinates
 | 
						|
        --or: distance((x, y))       # a pair (tuple) of coordinates
 | 
						|
        --or: distance(vec)          # e.g. as returned by pos()
 | 
						|
        --or: distance(mypen)        # where mypen is another turtle
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pos()
 | 
						|
        (0.00, 0.00)
 | 
						|
        >>> turtle.distance(30,40)
 | 
						|
        50.0
 | 
						|
        >>> pen = Turtle()
 | 
						|
        >>> pen.forward(77)
 | 
						|
        >>> turtle.distance(pen)
 | 
						|
        77.0
 | 
						|
        """
 | 
						|
        if y is not None:
 | 
						|
            pos = Vec2D(x, y)
 | 
						|
        if isinstance(x, Vec2D):
 | 
						|
            pos = x
 | 
						|
        elif isinstance(x, tuple):
 | 
						|
            pos = Vec2D(*x)
 | 
						|
        elif isinstance(x, TNavigator):
 | 
						|
            pos = x._position
 | 
						|
        return abs(pos - self._position)
 | 
						|
 | 
						|
    def towards(self, x, y=None):
 | 
						|
        """Return the angle of the line from the turtle's position to (x, y).
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        x -- a number   or  a pair/vector of numbers   or   a turtle instance
 | 
						|
        y -- a number       None                            None
 | 
						|
 | 
						|
        call: distance(x, y)         # two coordinates
 | 
						|
        --or: distance((x, y))       # a pair (tuple) of coordinates
 | 
						|
        --or: distance(vec)          # e.g. as returned by pos()
 | 
						|
        --or: distance(mypen)        # where mypen is another turtle
 | 
						|
 | 
						|
        Return the angle, between the line from turtle-position to position
 | 
						|
        specified by x, y and the turtle's start orientation. (Depends on
 | 
						|
        modes - "standard" or "logo")
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pos()
 | 
						|
        (10.00, 10.00)
 | 
						|
        >>> turtle.towards(0,0)
 | 
						|
        225.0
 | 
						|
        """
 | 
						|
        if y is not None:
 | 
						|
            pos = Vec2D(x, y)
 | 
						|
        if isinstance(x, Vec2D):
 | 
						|
            pos = x
 | 
						|
        elif isinstance(x, tuple):
 | 
						|
            pos = Vec2D(*x)
 | 
						|
        elif isinstance(x, TNavigator):
 | 
						|
            pos = x._position
 | 
						|
        x, y = pos - self._position
 | 
						|
        result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
 | 
						|
        result /= self._degreesPerAU
 | 
						|
        return (self._angleOffset + self._angleOrient*result) % self._fullcircle
 | 
						|
 | 
						|
    def heading(self):
 | 
						|
        """ Return the turtle's current heading.
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.left(67)
 | 
						|
        >>> turtle.heading()
 | 
						|
        67.0
 | 
						|
        """
 | 
						|
        x, y = self._orient
 | 
						|
        result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
 | 
						|
        result /= self._degreesPerAU
 | 
						|
        return (self._angleOffset + self._angleOrient*result) % self._fullcircle
 | 
						|
 | 
						|
    def setheading(self, to_angle):
 | 
						|
        """Set the orientation of the turtle to to_angle.
 | 
						|
 | 
						|
        Aliases:  setheading | seth
 | 
						|
 | 
						|
        Argument:
 | 
						|
        to_angle -- a number (integer or float)
 | 
						|
 | 
						|
        Set the orientation of the turtle to to_angle.
 | 
						|
        Here are some common directions in degrees:
 | 
						|
 | 
						|
         standard - mode:          logo-mode:
 | 
						|
        -------------------|--------------------
 | 
						|
           0 - east                0 - north
 | 
						|
          90 - north              90 - east
 | 
						|
         180 - west              180 - south
 | 
						|
         270 - south             270 - west
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.setheading(90)
 | 
						|
        >>> turtle.heading()
 | 
						|
        90
 | 
						|
        """
 | 
						|
        angle = (to_angle - self.heading())*self._angleOrient
 | 
						|
        full = self._fullcircle
 | 
						|
        angle = (angle+full/2.)%full - full/2.
 | 
						|
        self._rotate(angle)
 | 
						|
 | 
						|
    def circle(self, radius, extent = None, steps = None):
 | 
						|
        """ Draw a circle with given radius.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        radius -- a number
 | 
						|
        extent (optional) -- a number
 | 
						|
        steps (optional) -- an integer
 | 
						|
 | 
						|
        Draw a circle with given radius. The center is radius units left
 | 
						|
        of the turtle; extent - an angle - determines which part of the
 | 
						|
        circle is drawn. If extent is not given, draw the entire circle.
 | 
						|
        If extent is not a full circle, one endpoint of the arc is the
 | 
						|
        current pen position. Draw the arc in counterclockwise direction
 | 
						|
        if radius is positive, otherwise in clockwise direction. Finally
 | 
						|
        the direction of the turtle is changed by the amount of extent.
 | 
						|
 | 
						|
        As the circle is approximated by an inscribed regular polygon,
 | 
						|
        steps determines the number of steps to use. If not given,
 | 
						|
        it will be calculated automatically. Maybe used to draw regular
 | 
						|
        polygons.
 | 
						|
 | 
						|
        call: circle(radius)                  # full circle
 | 
						|
        --or: circle(radius, extent)          # arc
 | 
						|
        --or: circle(radius, extent, steps)
 | 
						|
        --or: circle(radius, steps=6)         # 6-sided polygon
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.circle(50)
 | 
						|
        >>> turtle.circle(120, 180)  # semicircle
 | 
						|
        """
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(["seq"])
 | 
						|
            self.undobuffer.cumulate = True
 | 
						|
        speed = self.speed()
 | 
						|
        if extent is None:
 | 
						|
            extent = self._fullcircle
 | 
						|
        if steps is None:
 | 
						|
            frac = abs(extent)/self._fullcircle
 | 
						|
            steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac)
 | 
						|
        w = 1.0 * extent / steps
 | 
						|
        w2 = 0.5 * w
 | 
						|
        l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU)
 | 
						|
        if radius < 0:
 | 
						|
            l, w, w2 = -l, -w, -w2
 | 
						|
        tr = self._tracer()
 | 
						|
        dl = self._delay()
 | 
						|
        if speed == 0:
 | 
						|
            self._tracer(0, 0)
 | 
						|
        else:
 | 
						|
            self.speed(0)
 | 
						|
        self._rotate(w2)
 | 
						|
        for i in range(steps):
 | 
						|
            self.speed(speed)
 | 
						|
            self._go(l)
 | 
						|
            self.speed(0)
 | 
						|
            self._rotate(w)
 | 
						|
        self._rotate(-w2)
 | 
						|
        if speed == 0:
 | 
						|
            self._tracer(tr, dl)
 | 
						|
        self.speed(speed)
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.cumulate = False
 | 
						|
 | 
						|
## three dummy methods to be implemented by child class:
 | 
						|
 | 
						|
    def speed(self, s=0):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
    def _tracer(self, a=None, b=None):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
    def _delay(self, n=None):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
 | 
						|
    fd = forward
 | 
						|
    bk = back
 | 
						|
    backward = back
 | 
						|
    rt = right
 | 
						|
    lt = left
 | 
						|
    position = pos
 | 
						|
    setpos = goto
 | 
						|
    setposition = goto
 | 
						|
    seth = setheading
 | 
						|
 | 
						|
 | 
						|
class TPen(object):
 | 
						|
    """Drawing part of the RawTurtle.
 | 
						|
    Implements drawing properties.
 | 
						|
    """
 | 
						|
    def __init__(self, resizemode=_CFG["resizemode"]):
 | 
						|
        self._resizemode = resizemode # or "user" or "noresize"
 | 
						|
        self.undobuffer = None
 | 
						|
        TPen._reset(self)
 | 
						|
 | 
						|
    def _reset(self, pencolor=_CFG["pencolor"],
 | 
						|
                     fillcolor=_CFG["fillcolor"]):
 | 
						|
        self._pensize = 1
 | 
						|
        self._shown = True
 | 
						|
        self._pencolor = pencolor
 | 
						|
        self._fillcolor = fillcolor
 | 
						|
        self._drawing = True
 | 
						|
        self._speed = 3
 | 
						|
        self._stretchfactor = (1., 1.)
 | 
						|
        self._shearfactor = 0.
 | 
						|
        self._tilt = 0.
 | 
						|
        self._shapetrafo = (1., 0., 0., 1.)
 | 
						|
        self._outlinewidth = 1
 | 
						|
 | 
						|
    def resizemode(self, rmode=None):
 | 
						|
        """Set resizemode to one of the values: "auto", "user", "noresize".
 | 
						|
 | 
						|
        (Optional) Argument:
 | 
						|
        rmode -- one of the strings "auto", "user", "noresize"
 | 
						|
 | 
						|
        Different resizemodes have the following effects:
 | 
						|
          - "auto" adapts the appearance of the turtle
 | 
						|
                   corresponding to the value of pensize.
 | 
						|
          - "user" adapts the appearance of the turtle according to the
 | 
						|
                   values of stretchfactor and outlinewidth (outline),
 | 
						|
                   which are set by shapesize()
 | 
						|
          - "noresize" no adaption of the turtle's appearance takes place.
 | 
						|
        If no argument is given, return current resizemode.
 | 
						|
        resizemode("user") is called by a call of shapesize with arguments.
 | 
						|
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.resizemode("noresize")
 | 
						|
        >>> turtle.resizemode()
 | 
						|
        'noresize'
 | 
						|
        """
 | 
						|
        if rmode is None:
 | 
						|
            return self._resizemode
 | 
						|
        rmode = rmode.lower()
 | 
						|
        if rmode in ["auto", "user", "noresize"]:
 | 
						|
            self.pen(resizemode=rmode)
 | 
						|
 | 
						|
    def pensize(self, width=None):
 | 
						|
        """Set or return the line thickness.
 | 
						|
 | 
						|
        Aliases:  pensize | width
 | 
						|
 | 
						|
        Argument:
 | 
						|
        width -- positive number
 | 
						|
 | 
						|
        Set the line thickness to width or return it. If resizemode is set
 | 
						|
        to "auto" and turtleshape is a polygon, that polygon is drawn with
 | 
						|
        the same line thickness. If no argument is given, current pensize
 | 
						|
        is returned.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pensize()
 | 
						|
        1
 | 
						|
        >>> turtle.pensize(10)   # from here on lines of width 10 are drawn
 | 
						|
        """
 | 
						|
        if width is None:
 | 
						|
            return self._pensize
 | 
						|
        self.pen(pensize=width)
 | 
						|
 | 
						|
 | 
						|
    def penup(self):
 | 
						|
        """Pull the pen up -- no drawing when moving.
 | 
						|
 | 
						|
        Aliases: penup | pu | up
 | 
						|
 | 
						|
        No argument
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.penup()
 | 
						|
        """
 | 
						|
        if not self._drawing:
 | 
						|
            return
 | 
						|
        self.pen(pendown=False)
 | 
						|
 | 
						|
    def pendown(self):
 | 
						|
        """Pull the pen down -- drawing when moving.
 | 
						|
 | 
						|
        Aliases: pendown | pd | down
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pendown()
 | 
						|
        """
 | 
						|
        if self._drawing:
 | 
						|
            return
 | 
						|
        self.pen(pendown=True)
 | 
						|
 | 
						|
    def isdown(self):
 | 
						|
        """Return True if pen is down, False if it's up.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.penup()
 | 
						|
        >>> turtle.isdown()
 | 
						|
        False
 | 
						|
        >>> turtle.pendown()
 | 
						|
        >>> turtle.isdown()
 | 
						|
        True
 | 
						|
        """
 | 
						|
        return self._drawing
 | 
						|
 | 
						|
    def speed(self, speed=None):
 | 
						|
        """ Return or set the turtle's speed.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        speed -- an integer in the range 0..10 or a speedstring (see below)
 | 
						|
 | 
						|
        Set the turtle's speed to an integer value in the range 0 .. 10.
 | 
						|
        If no argument is given: return current speed.
 | 
						|
 | 
						|
        If input is a number greater than 10 or smaller than 0.5,
 | 
						|
        speed is set to 0.
 | 
						|
        Speedstrings  are mapped to speedvalues in the following way:
 | 
						|
            'fastest' :  0
 | 
						|
            'fast'    :  10
 | 
						|
            'normal'  :  6
 | 
						|
            'slow'    :  3
 | 
						|
            'slowest' :  1
 | 
						|
        speeds from 1 to 10 enforce increasingly faster animation of
 | 
						|
        line drawing and turtle turning.
 | 
						|
 | 
						|
        Attention:
 | 
						|
        speed = 0 : *no* animation takes place. forward/back makes turtle jump
 | 
						|
        and likewise left/right make the turtle turn instantly.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.speed(3)
 | 
						|
        """
 | 
						|
        speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 }
 | 
						|
        if speed is None:
 | 
						|
            return self._speed
 | 
						|
        if speed in speeds:
 | 
						|
            speed = speeds[speed]
 | 
						|
        elif 0.5 < speed < 10.5:
 | 
						|
            speed = int(round(speed))
 | 
						|
        else:
 | 
						|
            speed = 0
 | 
						|
        self.pen(speed=speed)
 | 
						|
 | 
						|
    def color(self, *args):
 | 
						|
        """Return or set the pencolor and fillcolor.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        Several input formats are allowed.
 | 
						|
        They use 0, 1, 2, or 3 arguments as follows:
 | 
						|
 | 
						|
        color()
 | 
						|
            Return the current pencolor and the current fillcolor
 | 
						|
            as a pair of color specification strings as are returned
 | 
						|
            by pencolor and fillcolor.
 | 
						|
        color(colorstring), color((r,g,b)), color(r,g,b)
 | 
						|
            inputs as in pencolor, set both, fillcolor and pencolor,
 | 
						|
            to the given value.
 | 
						|
        color(colorstring1, colorstring2),
 | 
						|
        color((r1,g1,b1), (r2,g2,b2))
 | 
						|
            equivalent to pencolor(colorstring1) and fillcolor(colorstring2)
 | 
						|
            and analogously, if the other input format is used.
 | 
						|
 | 
						|
        If turtleshape is a polygon, outline and interior of that polygon
 | 
						|
        is drawn with the newly set colors.
 | 
						|
        For more info see: pencolor, fillcolor
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.color('red', 'green')
 | 
						|
        >>> turtle.color()
 | 
						|
        ('red', 'green')
 | 
						|
        >>> colormode(255)
 | 
						|
        >>> color((40, 80, 120), (160, 200, 240))
 | 
						|
        >>> color()
 | 
						|
        ('#285078', '#a0c8f0')
 | 
						|
        """
 | 
						|
        if args:
 | 
						|
            l = len(args)
 | 
						|
            if l == 1:
 | 
						|
                pcolor = fcolor = args[0]
 | 
						|
            elif l == 2:
 | 
						|
                pcolor, fcolor = args
 | 
						|
            elif l == 3:
 | 
						|
                pcolor = fcolor = args
 | 
						|
            pcolor = self._colorstr(pcolor)
 | 
						|
            fcolor = self._colorstr(fcolor)
 | 
						|
            self.pen(pencolor=pcolor, fillcolor=fcolor)
 | 
						|
        else:
 | 
						|
            return self._color(self._pencolor), self._color(self._fillcolor)
 | 
						|
 | 
						|
    def pencolor(self, *args):
 | 
						|
        """ Return or set the pencolor.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        Four input formats are allowed:
 | 
						|
          - pencolor()
 | 
						|
            Return the current pencolor as color specification string,
 | 
						|
            possibly in hex-number format (see example).
 | 
						|
            May be used as input to another color/pencolor/fillcolor call.
 | 
						|
          - pencolor(colorstring)
 | 
						|
            s is a Tk color specification string, such as "red" or "yellow"
 | 
						|
          - pencolor((r, g, b))
 | 
						|
            *a tuple* of r, g, and b, which represent, an RGB color,
 | 
						|
            and each of r, g, and b are in the range 0..colormode,
 | 
						|
            where colormode is either 1.0 or 255
 | 
						|
          - pencolor(r, g, b)
 | 
						|
            r, g, and b represent an RGB color, and each of r, g, and b
 | 
						|
            are in the range 0..colormode
 | 
						|
 | 
						|
        If turtleshape is a polygon, the outline of that polygon is drawn
 | 
						|
        with the newly set pencolor.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pencolor('brown')
 | 
						|
        >>> tup = (0.2, 0.8, 0.55)
 | 
						|
        >>> turtle.pencolor(tup)
 | 
						|
        >>> turtle.pencolor()
 | 
						|
        '#33cc8c'
 | 
						|
        """
 | 
						|
        if args:
 | 
						|
            color = self._colorstr(args)
 | 
						|
            if color == self._pencolor:
 | 
						|
                return
 | 
						|
            self.pen(pencolor=color)
 | 
						|
        else:
 | 
						|
            return self._color(self._pencolor)
 | 
						|
 | 
						|
    def fillcolor(self, *args):
 | 
						|
        """ Return or set the fillcolor.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        Four input formats are allowed:
 | 
						|
          - fillcolor()
 | 
						|
            Return the current fillcolor as color specification string,
 | 
						|
            possibly in hex-number format (see example).
 | 
						|
            May be used as input to another color/pencolor/fillcolor call.
 | 
						|
          - fillcolor(colorstring)
 | 
						|
            s is a Tk color specification string, such as "red" or "yellow"
 | 
						|
          - fillcolor((r, g, b))
 | 
						|
            *a tuple* of r, g, and b, which represent, an RGB color,
 | 
						|
            and each of r, g, and b are in the range 0..colormode,
 | 
						|
            where colormode is either 1.0 or 255
 | 
						|
          - fillcolor(r, g, b)
 | 
						|
            r, g, and b represent an RGB color, and each of r, g, and b
 | 
						|
            are in the range 0..colormode
 | 
						|
 | 
						|
        If turtleshape is a polygon, the interior of that polygon is drawn
 | 
						|
        with the newly set fillcolor.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.fillcolor('violet')
 | 
						|
        >>> col = turtle.pencolor()
 | 
						|
        >>> turtle.fillcolor(col)
 | 
						|
        >>> turtle.fillcolor(0, .5, 0)
 | 
						|
        """
 | 
						|
        if args:
 | 
						|
            color = self._colorstr(args)
 | 
						|
            if color == self._fillcolor:
 | 
						|
                return
 | 
						|
            self.pen(fillcolor=color)
 | 
						|
        else:
 | 
						|
            return self._color(self._fillcolor)
 | 
						|
 | 
						|
    def showturtle(self):
 | 
						|
        """Makes the turtle visible.
 | 
						|
 | 
						|
        Aliases: showturtle | st
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.hideturtle()
 | 
						|
        >>> turtle.showturtle()
 | 
						|
        """
 | 
						|
        self.pen(shown=True)
 | 
						|
 | 
						|
    def hideturtle(self):
 | 
						|
        """Makes the turtle invisible.
 | 
						|
 | 
						|
        Aliases: hideturtle | ht
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        It's a good idea to do this while you're in the
 | 
						|
        middle of a complicated drawing, because hiding
 | 
						|
        the turtle speeds up the drawing observably.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.hideturtle()
 | 
						|
        """
 | 
						|
        self.pen(shown=False)
 | 
						|
 | 
						|
    def isvisible(self):
 | 
						|
        """Return True if the Turtle is shown, False if it's hidden.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.hideturtle()
 | 
						|
        >>> print turtle.isvisible():
 | 
						|
        False
 | 
						|
        """
 | 
						|
        return self._shown
 | 
						|
 | 
						|
    def pen(self, pen=None, **pendict):
 | 
						|
        """Return or set the pen's attributes.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
            pen -- a dictionary with some or all of the below listed keys.
 | 
						|
            **pendict -- one or more keyword-arguments with the below
 | 
						|
                         listed keys as keywords.
 | 
						|
 | 
						|
        Return or set the pen's attributes in a 'pen-dictionary'
 | 
						|
        with the following key/value pairs:
 | 
						|
           "shown"      :   True/False
 | 
						|
           "pendown"    :   True/False
 | 
						|
           "pencolor"   :   color-string or color-tuple
 | 
						|
           "fillcolor"  :   color-string or color-tuple
 | 
						|
           "pensize"    :   positive number
 | 
						|
           "speed"      :   number in range 0..10
 | 
						|
           "resizemode" :   "auto" or "user" or "noresize"
 | 
						|
           "stretchfactor": (positive number, positive number)
 | 
						|
           "shearfactor":   number
 | 
						|
           "outline"    :   positive number
 | 
						|
           "tilt"       :   number
 | 
						|
 | 
						|
        This dictionary can be used as argument for a subsequent
 | 
						|
        pen()-call to restore the former pen-state. Moreover one
 | 
						|
        or more of these attributes can be provided as keyword-arguments.
 | 
						|
        This can be used to set several pen attributes in one statement.
 | 
						|
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10)
 | 
						|
        >>> turtle.pen()
 | 
						|
        {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | 
						|
        'pencolor': 'red', 'pendown': True, 'fillcolor': 'black',
 | 
						|
        'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0}
 | 
						|
        >>> penstate=turtle.pen()
 | 
						|
        >>> turtle.color("yellow","")
 | 
						|
        >>> turtle.penup()
 | 
						|
        >>> turtle.pen()
 | 
						|
        {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | 
						|
        'pencolor': 'yellow', 'pendown': False, 'fillcolor': '',
 | 
						|
        'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0}
 | 
						|
        >>> p.pen(penstate, fillcolor="green")
 | 
						|
        >>> p.pen()
 | 
						|
        {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
 | 
						|
        'pencolor': 'red', 'pendown': True, 'fillcolor': 'green',
 | 
						|
        'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0}
 | 
						|
        """
 | 
						|
        _pd =  {"shown"         : self._shown,
 | 
						|
                "pendown"       : self._drawing,
 | 
						|
                "pencolor"      : self._pencolor,
 | 
						|
                "fillcolor"     : self._fillcolor,
 | 
						|
                "pensize"       : self._pensize,
 | 
						|
                "speed"         : self._speed,
 | 
						|
                "resizemode"    : self._resizemode,
 | 
						|
                "stretchfactor" : self._stretchfactor,
 | 
						|
                "shearfactor"   : self._shearfactor,
 | 
						|
                "outline"       : self._outlinewidth,
 | 
						|
                "tilt"          : self._tilt
 | 
						|
               }
 | 
						|
 | 
						|
        if not (pen or pendict):
 | 
						|
            return _pd
 | 
						|
 | 
						|
        if isinstance(pen, dict):
 | 
						|
            p = pen
 | 
						|
        else:
 | 
						|
            p = {}
 | 
						|
        p.update(pendict)
 | 
						|
 | 
						|
        _p_buf = {}
 | 
						|
        for key in p:
 | 
						|
            _p_buf[key] = _pd[key]
 | 
						|
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(("pen", _p_buf))
 | 
						|
 | 
						|
        newLine = False
 | 
						|
        if "pendown" in p:
 | 
						|
            if self._drawing != p["pendown"]:
 | 
						|
                newLine = True
 | 
						|
        if "pencolor" in p:
 | 
						|
            if isinstance(p["pencolor"], tuple):
 | 
						|
                p["pencolor"] = self._colorstr((p["pencolor"],))
 | 
						|
            if self._pencolor != p["pencolor"]:
 | 
						|
                newLine = True
 | 
						|
        if "pensize" in p:
 | 
						|
            if self._pensize != p["pensize"]:
 | 
						|
                newLine = True
 | 
						|
        if newLine:
 | 
						|
            self._newLine()
 | 
						|
        if "pendown" in p:
 | 
						|
            self._drawing = p["pendown"]
 | 
						|
        if "pencolor" in p:
 | 
						|
            self._pencolor = p["pencolor"]
 | 
						|
        if "pensize" in p:
 | 
						|
            self._pensize = p["pensize"]
 | 
						|
        if "fillcolor" in p:
 | 
						|
            if isinstance(p["fillcolor"], tuple):
 | 
						|
                p["fillcolor"] = self._colorstr((p["fillcolor"],))
 | 
						|
            self._fillcolor = p["fillcolor"]
 | 
						|
        if "speed" in p:
 | 
						|
            self._speed = p["speed"]
 | 
						|
        if "resizemode" in p:
 | 
						|
            self._resizemode = p["resizemode"]
 | 
						|
        if "stretchfactor" in p:
 | 
						|
            sf = p["stretchfactor"]
 | 
						|
            if isinstance(sf, (int, float)):
 | 
						|
                sf = (sf, sf)
 | 
						|
            self._stretchfactor = sf
 | 
						|
        if "shearfactor" in p:
 | 
						|
            self._shearfactor = p["shearfactor"]
 | 
						|
        if "outline" in p:
 | 
						|
            self._outlinewidth = p["outline"]
 | 
						|
        if "shown" in p:
 | 
						|
            self._shown = p["shown"]
 | 
						|
        if "tilt" in p:
 | 
						|
            self._tilt = p["tilt"]
 | 
						|
        if "stretchfactor" in p or "tilt" in p or "shearfactor" in p:
 | 
						|
            scx, scy = self._stretchfactor
 | 
						|
            shf = self._shearfactor
 | 
						|
            sa, ca = math.sin(self._tilt), math.cos(self._tilt)
 | 
						|
            self._shapetrafo = ( scx*ca, scy*(shf*ca + sa),
 | 
						|
                                -scx*sa, scy*(ca - shf*sa))
 | 
						|
        self._update()
 | 
						|
 | 
						|
## three dummy methods to be implemented by child class:
 | 
						|
 | 
						|
    def _newLine(self, usePos = True):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
    def _update(self, count=True, forced=False):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
    def _color(self, args):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
    def _colorstr(self, args):
 | 
						|
        """dummy method - to be overwritten by child class"""
 | 
						|
 | 
						|
    width = pensize
 | 
						|
    up = penup
 | 
						|
    pu = penup
 | 
						|
    pd = pendown
 | 
						|
    down = pendown
 | 
						|
    st = showturtle
 | 
						|
    ht = hideturtle
 | 
						|
 | 
						|
 | 
						|
class _TurtleImage(object):
 | 
						|
    """Helper class: Datatype to store Turtle attributes
 | 
						|
    """
 | 
						|
 | 
						|
    def __init__(self, screen, shapeIndex):
 | 
						|
        self.screen = screen
 | 
						|
        self._type = None
 | 
						|
        self._setshape(shapeIndex)
 | 
						|
 | 
						|
    def _setshape(self, shapeIndex):
 | 
						|
        screen = self.screen
 | 
						|
        self.shapeIndex = shapeIndex
 | 
						|
        if self._type == "polygon" == screen._shapes[shapeIndex]._type:
 | 
						|
            return
 | 
						|
        if self._type == "image" == screen._shapes[shapeIndex]._type:
 | 
						|
            return
 | 
						|
        if self._type in ["image", "polygon"]:
 | 
						|
            screen._delete(self._item)
 | 
						|
        elif self._type == "compound":
 | 
						|
            for item in self._item:
 | 
						|
                screen._delete(item)
 | 
						|
        self._type = screen._shapes[shapeIndex]._type
 | 
						|
        if self._type == "polygon":
 | 
						|
            self._item = screen._createpoly()
 | 
						|
        elif self._type == "image":
 | 
						|
            self._item = screen._createimage(screen._shapes["blank"]._data)
 | 
						|
        elif self._type == "compound":
 | 
						|
            self._item = [screen._createpoly() for item in
 | 
						|
                                          screen._shapes[shapeIndex]._data]
 | 
						|
 | 
						|
 | 
						|
class RawTurtle(TPen, TNavigator):
 | 
						|
    """Animation part of the RawTurtle.
 | 
						|
    Puts RawTurtle upon a TurtleScreen and provides tools for
 | 
						|
    its animation.
 | 
						|
    """
 | 
						|
    screens = []
 | 
						|
 | 
						|
    def __init__(self, canvas=None,
 | 
						|
                 shape=_CFG["shape"],
 | 
						|
                 undobuffersize=_CFG["undobuffersize"],
 | 
						|
                 visible=_CFG["visible"]):
 | 
						|
        if isinstance(canvas, _Screen):
 | 
						|
            self.screen = canvas
 | 
						|
        elif isinstance(canvas, TurtleScreen):
 | 
						|
            if canvas not in RawTurtle.screens:
 | 
						|
                RawTurtle.screens.append(canvas)
 | 
						|
            self.screen = canvas
 | 
						|
        elif isinstance(canvas, (ScrolledCanvas, Canvas)):
 | 
						|
            for screen in RawTurtle.screens:
 | 
						|
                if screen.cv == canvas:
 | 
						|
                    self.screen = screen
 | 
						|
                    break
 | 
						|
            else:
 | 
						|
                self.screen = TurtleScreen(canvas)
 | 
						|
                RawTurtle.screens.append(self.screen)
 | 
						|
        else:
 | 
						|
            raise TurtleGraphicsError("bad canvas argument %s" % canvas)
 | 
						|
 | 
						|
        screen = self.screen
 | 
						|
        TNavigator.__init__(self, screen.mode())
 | 
						|
        TPen.__init__(self)
 | 
						|
        screen._turtles.append(self)
 | 
						|
        self.drawingLineItem = screen._createline()
 | 
						|
        self.turtle = _TurtleImage(screen, shape)
 | 
						|
        self._poly = None
 | 
						|
        self._creatingPoly = False
 | 
						|
        self._fillitem = self._fillpath = None
 | 
						|
        self._shown = visible
 | 
						|
        self._hidden_from_screen = False
 | 
						|
        self.currentLineItem = screen._createline()
 | 
						|
        self.currentLine = [self._position]
 | 
						|
        self.items = [self.currentLineItem]
 | 
						|
        self.stampItems = []
 | 
						|
        self._undobuffersize = undobuffersize
 | 
						|
        self.undobuffer = Tbuffer(undobuffersize)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def reset(self):
 | 
						|
        """Delete the turtle's drawings and restore its default values.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Delete the turtle's drawings from the screen, re-center the turtle
 | 
						|
        and set variables to the default values.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00,-22.00)
 | 
						|
        >>> turtle.heading()
 | 
						|
        100.0
 | 
						|
        >>> turtle.reset()
 | 
						|
        >>> turtle.position()
 | 
						|
        (0.00,0.00)
 | 
						|
        >>> turtle.heading()
 | 
						|
        0.0
 | 
						|
        """
 | 
						|
        TNavigator.reset(self)
 | 
						|
        TPen._reset(self)
 | 
						|
        self._clear()
 | 
						|
        self._drawturtle()
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def setundobuffer(self, size):
 | 
						|
        """Set or disable undobuffer.
 | 
						|
 | 
						|
        Argument:
 | 
						|
        size -- an integer or None
 | 
						|
 | 
						|
        If size is an integer an empty undobuffer of given size is installed.
 | 
						|
        Size gives the maximum number of turtle-actions that can be undone
 | 
						|
        by the undo() function.
 | 
						|
        If size is None, no undobuffer is present.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.setundobuffer(42)
 | 
						|
        """
 | 
						|
        if size is None or size <= 0:
 | 
						|
            self.undobuffer = None
 | 
						|
        else:
 | 
						|
            self.undobuffer = Tbuffer(size)
 | 
						|
 | 
						|
    def undobufferentries(self):
 | 
						|
        """Return count of entries in the undobuffer.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> while undobufferentries():
 | 
						|
        ...     undo()
 | 
						|
        """
 | 
						|
        if self.undobuffer is None:
 | 
						|
            return 0
 | 
						|
        return self.undobuffer.nr_of_items()
 | 
						|
 | 
						|
    def _clear(self):
 | 
						|
        """Delete all of pen's drawings"""
 | 
						|
        self._fillitem = self._fillpath = None
 | 
						|
        for item in self.items:
 | 
						|
            self.screen._delete(item)
 | 
						|
        self.currentLineItem = self.screen._createline()
 | 
						|
        self.currentLine = []
 | 
						|
        if self._drawing:
 | 
						|
            self.currentLine.append(self._position)
 | 
						|
        self.items = [self.currentLineItem]
 | 
						|
        self.clearstamps()
 | 
						|
        self.setundobuffer(self._undobuffersize)
 | 
						|
 | 
						|
 | 
						|
    def clear(self):
 | 
						|
        """Delete the turtle's drawings from the screen. Do not move turtle.
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Delete the turtle's drawings from the screen. Do not move turtle.
 | 
						|
        State and position of the turtle as well as drawings of other
 | 
						|
        turtles are not affected.
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.clear()
 | 
						|
        """
 | 
						|
        self._clear()
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def _update_data(self):
 | 
						|
        self.screen._incrementudc()
 | 
						|
        if self.screen._updatecounter != 0:
 | 
						|
            return
 | 
						|
        if len(self.currentLine)>1:
 | 
						|
            self.screen._drawline(self.currentLineItem, self.currentLine,
 | 
						|
                                  self._pencolor, self._pensize)
 | 
						|
 | 
						|
    def _update(self):
 | 
						|
        """Perform a Turtle-data update.
 | 
						|
        """
 | 
						|
        screen = self.screen
 | 
						|
        if screen._tracing == 0:
 | 
						|
            return
 | 
						|
        elif screen._tracing == 1:
 | 
						|
            self._update_data()
 | 
						|
            self._drawturtle()
 | 
						|
            screen._update()                  # TurtleScreenBase
 | 
						|
            screen._delay(screen._delayvalue) # TurtleScreenBase
 | 
						|
        else:
 | 
						|
            self._update_data()
 | 
						|
            if screen._updatecounter == 0:
 | 
						|
                for t in screen.turtles():
 | 
						|
                    t._drawturtle()
 | 
						|
                screen._update()
 | 
						|
 | 
						|
    def _tracer(self, flag=None, delay=None):
 | 
						|
        """Turns turtle animation on/off and set delay for update drawings.
 | 
						|
 | 
						|
        Optional arguments:
 | 
						|
        n -- nonnegative  integer
 | 
						|
        delay -- nonnegative  integer
 | 
						|
 | 
						|
        If n is given, only each n-th regular screen update is really performed.
 | 
						|
        (Can be used to accelerate the drawing of complex graphics.)
 | 
						|
        Second arguments sets delay value (see RawTurtle.delay())
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.tracer(8, 25)
 | 
						|
        >>> dist = 2
 | 
						|
        >>> for i in range(200):
 | 
						|
        ...     turtle.fd(dist)
 | 
						|
        ...     turtle.rt(90)
 | 
						|
        ...     dist += 2
 | 
						|
        """
 | 
						|
        return self.screen.tracer(flag, delay)
 | 
						|
 | 
						|
    def _color(self, args):
 | 
						|
        return self.screen._color(args)
 | 
						|
 | 
						|
    def _colorstr(self, args):
 | 
						|
        return self.screen._colorstr(args)
 | 
						|
 | 
						|
    def _cc(self, args):
 | 
						|
        """Convert colortriples to hexstrings.
 | 
						|
        """
 | 
						|
        if isinstance(args, str):
 | 
						|
            return args
 | 
						|
        try:
 | 
						|
            r, g, b = args
 | 
						|
        except (TypeError, ValueError):
 | 
						|
            raise TurtleGraphicsError("bad color arguments: %s" % str(args))
 | 
						|
        if self.screen._colormode == 1.0:
 | 
						|
            r, g, b = [round(255.0*x) for x in (r, g, b)]
 | 
						|
        if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
 | 
						|
            raise TurtleGraphicsError("bad color sequence: %s" % str(args))
 | 
						|
        return "#%02x%02x%02x" % (r, g, b)
 | 
						|
 | 
						|
    def clone(self):
 | 
						|
        """Create and return a clone of the turtle.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Create and return a clone of the turtle with same position, heading
 | 
						|
        and turtle properties.
 | 
						|
 | 
						|
        Example (for a Turtle instance named mick):
 | 
						|
        mick = Turtle()
 | 
						|
        joe = mick.clone()
 | 
						|
        """
 | 
						|
        screen = self.screen
 | 
						|
        self._newLine(self._drawing)
 | 
						|
 | 
						|
        turtle = self.turtle
 | 
						|
        self.screen = None
 | 
						|
        self.turtle = None  # too make self deepcopy-able
 | 
						|
 | 
						|
        q = deepcopy(self)
 | 
						|
 | 
						|
        self.screen = screen
 | 
						|
        self.turtle = turtle
 | 
						|
 | 
						|
        q.screen = screen
 | 
						|
        q.turtle = _TurtleImage(screen, self.turtle.shapeIndex)
 | 
						|
 | 
						|
        screen._turtles.append(q)
 | 
						|
        ttype = screen._shapes[self.turtle.shapeIndex]._type
 | 
						|
        if ttype == "polygon":
 | 
						|
            q.turtle._item = screen._createpoly()
 | 
						|
        elif ttype == "image":
 | 
						|
            q.turtle._item = screen._createimage(screen._shapes["blank"]._data)
 | 
						|
        elif ttype == "compound":
 | 
						|
            q.turtle._item = [screen._createpoly() for item in
 | 
						|
                              screen._shapes[self.turtle.shapeIndex]._data]
 | 
						|
        q.currentLineItem = screen._createline()
 | 
						|
        q._update()
 | 
						|
        return q
 | 
						|
 | 
						|
    def shape(self, name=None):
 | 
						|
        """Set turtle shape to shape with given name / return current shapename.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        name -- a string, which is a valid shapename
 | 
						|
 | 
						|
        Set turtle shape to shape with given name or, if name is not given,
 | 
						|
        return name of current shape.
 | 
						|
        Shape with name must exist in the TurtleScreen's shape dictionary.
 | 
						|
        Initially there are the following polygon shapes:
 | 
						|
        'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'.
 | 
						|
        To learn about how to deal with shapes see Screen-method register_shape.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape()
 | 
						|
        'arrow'
 | 
						|
        >>> turtle.shape("turtle")
 | 
						|
        >>> turtle.shape()
 | 
						|
        'turtle'
 | 
						|
        """
 | 
						|
        if name is None:
 | 
						|
            return self.turtle.shapeIndex
 | 
						|
        if not name in self.screen.getshapes():
 | 
						|
            raise TurtleGraphicsError("There is no shape named %s" % name)
 | 
						|
        self.turtle._setshape(name)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def shapesize(self, stretch_wid=None, stretch_len=None, outline=None):
 | 
						|
        """Set/return turtle's stretchfactors/outline. Set resizemode to "user".
 | 
						|
 | 
						|
        Optional arguments:
 | 
						|
           stretch_wid : positive number
 | 
						|
           stretch_len : positive number
 | 
						|
           outline  : positive number
 | 
						|
 | 
						|
        Return or set the pen's attributes x/y-stretchfactors and/or outline.
 | 
						|
        Set resizemode to "user".
 | 
						|
        If and only if resizemode is set to "user", the turtle will be displayed
 | 
						|
        stretched according to its stretchfactors:
 | 
						|
        stretch_wid is stretchfactor perpendicular to orientation
 | 
						|
        stretch_len is stretchfactor in direction of turtles orientation.
 | 
						|
        outline determines the width of the shapes's outline.
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.resizemode("user")
 | 
						|
        >>> turtle.shapesize(5, 5, 12)
 | 
						|
        >>> turtle.shapesize(outline=8)
 | 
						|
        """
 | 
						|
        if stretch_wid is stretch_len is outline is None:
 | 
						|
            stretch_wid, stretch_len = self._stretchfactor
 | 
						|
            return stretch_wid, stretch_len, self._outlinewidth
 | 
						|
        if stretch_wid == 0 or stretch_len == 0:
 | 
						|
            raise TurtleGraphicsError("stretch_wid/stretch_len must not be zero")
 | 
						|
        if stretch_wid is not None:
 | 
						|
            if stretch_len is None:
 | 
						|
                stretchfactor = stretch_wid, stretch_wid
 | 
						|
            else:
 | 
						|
                stretchfactor = stretch_wid, stretch_len
 | 
						|
        elif stretch_len is not None:
 | 
						|
            stretchfactor = self._stretchfactor[0], stretch_len
 | 
						|
        else:
 | 
						|
            stretchfactor = self._stretchfactor
 | 
						|
        if outline is None:
 | 
						|
            outline = self._outlinewidth
 | 
						|
        self.pen(resizemode="user",
 | 
						|
                 stretchfactor=stretchfactor, outline=outline)
 | 
						|
 | 
						|
    def shearfactor(self, shear=None):
 | 
						|
        """Set or return the current shearfactor.
 | 
						|
 | 
						|
        Optional argument: shear -- number, tangent of the shear angle
 | 
						|
 | 
						|
        Shear the turtleshape according to the given shearfactor shear,
 | 
						|
        which is the tangent of the shear angle. DO NOT change the
 | 
						|
        turtle's heading (direction of movement).
 | 
						|
        If shear is not given: return the current shearfactor, i. e. the
 | 
						|
        tangent of the shear angle, by which lines parallel to the
 | 
						|
        heading of the turtle are sheared.
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("circle")
 | 
						|
        >>> turtle.shapesize(5,2)
 | 
						|
        >>> turtle.shearfactor(0.5)
 | 
						|
        >>> turtle.shearfactor()
 | 
						|
        >>> 0.5
 | 
						|
        """
 | 
						|
        if shear is None:
 | 
						|
            return self._shearfactor
 | 
						|
        self.pen(resizemode="user", shearfactor=shear)
 | 
						|
 | 
						|
    def settiltangle(self, angle):
 | 
						|
        """Rotate the turtleshape to point in the specified direction
 | 
						|
 | 
						|
        Argument: angle -- number
 | 
						|
 | 
						|
        Rotate the turtleshape to point in the direction specified by angle,
 | 
						|
        regardless of its current tilt-angle. DO NOT change the turtle's
 | 
						|
        heading (direction of movement).
 | 
						|
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("circle")
 | 
						|
        >>> turtle.shapesize(5,2)
 | 
						|
        >>> turtle.settiltangle(45)
 | 
						|
        >>> stamp()
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        >>> turtle.settiltangle(-45)
 | 
						|
        >>> stamp()
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        """
 | 
						|
        tilt = -angle * self._degreesPerAU * self._angleOrient
 | 
						|
        tilt = (tilt * math.pi / 180.0) % (2*math.pi)
 | 
						|
        self.pen(resizemode="user", tilt=tilt)
 | 
						|
 | 
						|
    def tiltangle(self, angle=None):
 | 
						|
        """Set or return the current tilt-angle.
 | 
						|
 | 
						|
        Optional argument: angle -- number
 | 
						|
 | 
						|
        Rotate the turtleshape to point in the direction specified by angle,
 | 
						|
        regardless of its current tilt-angle. DO NOT change the turtle's
 | 
						|
        heading (direction of movement).
 | 
						|
        If angle is not given: return the current tilt-angle, i. e. the angle
 | 
						|
        between the orientation of the turtleshape and the heading of the
 | 
						|
        turtle (its direction of movement).
 | 
						|
 | 
						|
        Deprecated since Python 3.1
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("circle")
 | 
						|
        >>> turtle.shapesize(5,2)
 | 
						|
        >>> turtle.tilt(45)
 | 
						|
        >>> turtle.tiltangle()
 | 
						|
        """
 | 
						|
        if angle is None:
 | 
						|
            tilt = -self._tilt * (180.0/math.pi) * self._angleOrient
 | 
						|
            return (tilt / self._degreesPerAU) % self._fullcircle
 | 
						|
        else:
 | 
						|
            self.settiltangle(angle)
 | 
						|
 | 
						|
    def tilt(self, angle):
 | 
						|
        """Rotate the turtleshape by angle.
 | 
						|
 | 
						|
        Argument:
 | 
						|
        angle - a number
 | 
						|
 | 
						|
        Rotate the turtleshape by angle from its current tilt-angle,
 | 
						|
        but do NOT change the turtle's heading (direction of movement).
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("circle")
 | 
						|
        >>> turtle.shapesize(5,2)
 | 
						|
        >>> turtle.tilt(30)
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        >>> turtle.tilt(30)
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        """
 | 
						|
        self.settiltangle(angle + self.tiltangle())
 | 
						|
 | 
						|
    def shapetransform(self, t11=None, t12=None, t21=None, t22=None):
 | 
						|
        """Set or return the current transformation matrix of the turtle shape.
 | 
						|
 | 
						|
        Optional arguments: t11, t12, t21, t22 -- numbers.
 | 
						|
 | 
						|
        If none of the matrix elements are given, return the transformation
 | 
						|
        matrix.
 | 
						|
        Otherwise set the given elements and transform the turtleshape
 | 
						|
        according to the matrix consisting of first row t11, t12 and
 | 
						|
        second row t21, 22.
 | 
						|
        Modify stretchfactor, shearfactor and tiltangle according to the
 | 
						|
        given matrix.
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("square")
 | 
						|
        >>> turtle.shapesize(4,2)
 | 
						|
        >>> turtle.shearfactor(-0.5)
 | 
						|
        >>> turtle.shapetransform()
 | 
						|
        (4.0, -1.0, -0.0, 2.0)
 | 
						|
        """
 | 
						|
        if t11 is t12 is t21 is t22 is None:
 | 
						|
            return self._shapetrafo
 | 
						|
        m11, m12, m21, m22 = self._shapetrafo
 | 
						|
        if t11 is not None: m11 = t11
 | 
						|
        if t12 is not None: m12 = t12
 | 
						|
        if t21 is not None: m21 = t21
 | 
						|
        if t22 is not None: m22 = t22
 | 
						|
        if t11 * t22 - t12 * t21 == 0:
 | 
						|
            raise TurtleGraphicsError("Bad shape transform matrix: must not be singular")
 | 
						|
        self._shapetrafo = (m11, m12, m21, m22)
 | 
						|
        alfa = math.atan2(-m21, m11) % (2 * math.pi)
 | 
						|
        sa, ca = math.sin(alfa), math.cos(alfa)
 | 
						|
        a11, a12, a21, a22 = (ca*m11 - sa*m21, ca*m12 - sa*m22,
 | 
						|
                              sa*m11 + ca*m21, sa*m12 + ca*m22)
 | 
						|
        self._stretchfactor = a11, a22
 | 
						|
        self._shearfactor = a12/a22
 | 
						|
        self._tilt = alfa
 | 
						|
        self.pen(resizemode="user")
 | 
						|
 | 
						|
 | 
						|
    def _polytrafo(self, poly):
 | 
						|
        """Computes transformed polygon shapes from a shape
 | 
						|
        according to current position and heading.
 | 
						|
        """
 | 
						|
        screen = self.screen
 | 
						|
        p0, p1 = self._position
 | 
						|
        e0, e1 = self._orient
 | 
						|
        e = Vec2D(e0, e1 * screen.yscale / screen.xscale)
 | 
						|
        e0, e1 = (1.0 / abs(e)) * e
 | 
						|
        return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale)
 | 
						|
                                                           for (x, y) in poly]
 | 
						|
 | 
						|
    def get_shapepoly(self):
 | 
						|
        """Return the current shape polygon as tuple of coordinate pairs.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Examples (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.shape("square")
 | 
						|
        >>> turtle.shapetransform(4, -1, 0, 2)
 | 
						|
        >>> turtle.get_shapepoly()
 | 
						|
        ((50, -20), (30, 20), (-50, 20), (-30, -20))
 | 
						|
 | 
						|
        """
 | 
						|
        shape = self.screen._shapes[self.turtle.shapeIndex]
 | 
						|
        if shape._type == "polygon":
 | 
						|
            return self._getshapepoly(shape._data, shape._type == "compound")
 | 
						|
        # else return None
 | 
						|
 | 
						|
    def _getshapepoly(self, polygon, compound=False):
 | 
						|
        """Calculate transformed shape polygon according to resizemode
 | 
						|
        and shapetransform.
 | 
						|
        """
 | 
						|
        if self._resizemode == "user" or compound:
 | 
						|
            t11, t12, t21, t22 = self._shapetrafo
 | 
						|
        elif self._resizemode == "auto":
 | 
						|
            l = max(1, self._pensize/5.0)
 | 
						|
            t11, t12, t21, t22 = l, 0, 0, l
 | 
						|
        elif self._resizemode == "noresize":
 | 
						|
            return polygon
 | 
						|
        return tuple((t11*x + t12*y, t21*x + t22*y) for (x, y) in polygon)
 | 
						|
 | 
						|
    def _drawturtle(self):
 | 
						|
        """Manages the correct rendering of the turtle with respect to
 | 
						|
        its shape, resizemode, stretch and tilt etc."""
 | 
						|
        screen = self.screen
 | 
						|
        shape = screen._shapes[self.turtle.shapeIndex]
 | 
						|
        ttype = shape._type
 | 
						|
        titem = self.turtle._item
 | 
						|
        if self._shown and screen._updatecounter == 0 and screen._tracing > 0:
 | 
						|
            self._hidden_from_screen = False
 | 
						|
            tshape = shape._data
 | 
						|
            if ttype == "polygon":
 | 
						|
                if self._resizemode == "noresize": w = 1
 | 
						|
                elif self._resizemode == "auto": w = self._pensize
 | 
						|
                else: w =self._outlinewidth
 | 
						|
                shape = self._polytrafo(self._getshapepoly(tshape))
 | 
						|
                fc, oc = self._fillcolor, self._pencolor
 | 
						|
                screen._drawpoly(titem, shape, fill=fc, outline=oc,
 | 
						|
                                                      width=w, top=True)
 | 
						|
            elif ttype == "image":
 | 
						|
                screen._drawimage(titem, self._position, tshape)
 | 
						|
            elif ttype == "compound":
 | 
						|
                for item, (poly, fc, oc) in zip(titem, tshape):
 | 
						|
                    poly = self._polytrafo(self._getshapepoly(poly, True))
 | 
						|
                    screen._drawpoly(item, poly, fill=self._cc(fc),
 | 
						|
                                     outline=self._cc(oc), width=self._outlinewidth, top=True)
 | 
						|
        else:
 | 
						|
            if self._hidden_from_screen:
 | 
						|
                return
 | 
						|
            if ttype == "polygon":
 | 
						|
                screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "")
 | 
						|
            elif ttype == "image":
 | 
						|
                screen._drawimage(titem, self._position,
 | 
						|
                                          screen._shapes["blank"]._data)
 | 
						|
            elif ttype == "compound":
 | 
						|
                for item in titem:
 | 
						|
                    screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "")
 | 
						|
            self._hidden_from_screen = True
 | 
						|
 | 
						|
##############################  stamp stuff  ###############################
 | 
						|
 | 
						|
    def stamp(self):
 | 
						|
        """Stamp a copy of the turtleshape onto the canvas and return its id.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Stamp a copy of the turtle shape onto the canvas at the current
 | 
						|
        turtle position. Return a stamp_id for that stamp, which can be
 | 
						|
        used to delete it by calling clearstamp(stamp_id).
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.color("blue")
 | 
						|
        >>> turtle.stamp()
 | 
						|
        13
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        """
 | 
						|
        screen = self.screen
 | 
						|
        shape = screen._shapes[self.turtle.shapeIndex]
 | 
						|
        ttype = shape._type
 | 
						|
        tshape = shape._data
 | 
						|
        if ttype == "polygon":
 | 
						|
            stitem = screen._createpoly()
 | 
						|
            if self._resizemode == "noresize": w = 1
 | 
						|
            elif self._resizemode == "auto": w = self._pensize
 | 
						|
            else: w =self._outlinewidth
 | 
						|
            shape = self._polytrafo(self._getshapepoly(tshape))
 | 
						|
            fc, oc = self._fillcolor, self._pencolor
 | 
						|
            screen._drawpoly(stitem, shape, fill=fc, outline=oc,
 | 
						|
                                                  width=w, top=True)
 | 
						|
        elif ttype == "image":
 | 
						|
            stitem = screen._createimage("")
 | 
						|
            screen._drawimage(stitem, self._position, tshape)
 | 
						|
        elif ttype == "compound":
 | 
						|
            stitem = []
 | 
						|
            for element in tshape:
 | 
						|
                item = screen._createpoly()
 | 
						|
                stitem.append(item)
 | 
						|
            stitem = tuple(stitem)
 | 
						|
            for item, (poly, fc, oc) in zip(stitem, tshape):
 | 
						|
                poly = self._polytrafo(self._getshapepoly(poly, True))
 | 
						|
                screen._drawpoly(item, poly, fill=self._cc(fc),
 | 
						|
                                 outline=self._cc(oc), width=self._outlinewidth, top=True)
 | 
						|
        self.stampItems.append(stitem)
 | 
						|
        self.undobuffer.push(("stamp", stitem))
 | 
						|
        return stitem
 | 
						|
 | 
						|
    def _clearstamp(self, stampid):
 | 
						|
        """does the work for clearstamp() and clearstamps()
 | 
						|
        """
 | 
						|
        if stampid in self.stampItems:
 | 
						|
            if isinstance(stampid, tuple):
 | 
						|
                for subitem in stampid:
 | 
						|
                    self.screen._delete(subitem)
 | 
						|
            else:
 | 
						|
                self.screen._delete(stampid)
 | 
						|
            self.stampItems.remove(stampid)
 | 
						|
        # Delete stampitem from undobuffer if necessary
 | 
						|
        # if clearstamp is called directly.
 | 
						|
        item = ("stamp", stampid)
 | 
						|
        buf = self.undobuffer
 | 
						|
        if item not in buf.buffer:
 | 
						|
            return
 | 
						|
        index = buf.buffer.index(item)
 | 
						|
        buf.buffer.remove(item)
 | 
						|
        if index <= buf.ptr:
 | 
						|
            buf.ptr = (buf.ptr - 1) % buf.bufsize
 | 
						|
        buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None])
 | 
						|
 | 
						|
    def clearstamp(self, stampid):
 | 
						|
        """Delete stamp with given stampid
 | 
						|
 | 
						|
        Argument:
 | 
						|
        stampid - an integer, must be return value of previous stamp() call.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.color("blue")
 | 
						|
        >>> astamp = turtle.stamp()
 | 
						|
        >>> turtle.fd(50)
 | 
						|
        >>> turtle.clearstamp(astamp)
 | 
						|
        """
 | 
						|
        self._clearstamp(stampid)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def clearstamps(self, n=None):
 | 
						|
        """Delete all or first/last n of turtle's stamps.
 | 
						|
 | 
						|
        Optional argument:
 | 
						|
        n -- an integer
 | 
						|
 | 
						|
        If n is None, delete all of pen's stamps,
 | 
						|
        else if n > 0 delete first n stamps
 | 
						|
        else if n < 0 delete last n stamps.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> for i in range(8):
 | 
						|
        ...     turtle.stamp(); turtle.fd(30)
 | 
						|
        ...
 | 
						|
        >>> turtle.clearstamps(2)
 | 
						|
        >>> turtle.clearstamps(-2)
 | 
						|
        >>> turtle.clearstamps()
 | 
						|
        """
 | 
						|
        if n is None:
 | 
						|
            toDelete = self.stampItems[:]
 | 
						|
        elif n >= 0:
 | 
						|
            toDelete = self.stampItems[:n]
 | 
						|
        else:
 | 
						|
            toDelete = self.stampItems[n:]
 | 
						|
        for item in toDelete:
 | 
						|
            self._clearstamp(item)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def _goto(self, end):
 | 
						|
        """Move the pen to the point end, thereby drawing a line
 | 
						|
        if pen is down. All other methods for turtle movement depend
 | 
						|
        on this one.
 | 
						|
        """
 | 
						|
        ## Version with undo-stuff
 | 
						|
        go_modes = ( self._drawing,
 | 
						|
                     self._pencolor,
 | 
						|
                     self._pensize,
 | 
						|
                     isinstance(self._fillpath, list))
 | 
						|
        screen = self.screen
 | 
						|
        undo_entry = ("go", self._position, end, go_modes,
 | 
						|
                      (self.currentLineItem,
 | 
						|
                      self.currentLine[:],
 | 
						|
                      screen._pointlist(self.currentLineItem),
 | 
						|
                      self.items[:])
 | 
						|
                      )
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(undo_entry)
 | 
						|
        start = self._position
 | 
						|
        if self._speed and screen._tracing == 1:
 | 
						|
            diff = (end-start)
 | 
						|
            diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
 | 
						|
            nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
 | 
						|
            delta = diff * (1.0/nhops)
 | 
						|
            for n in range(1, nhops):
 | 
						|
                if n == 1:
 | 
						|
                    top = True
 | 
						|
                else:
 | 
						|
                    top = False
 | 
						|
                self._position = start + delta * n
 | 
						|
                if self._drawing:
 | 
						|
                    screen._drawline(self.drawingLineItem,
 | 
						|
                                     (start, self._position),
 | 
						|
                                     self._pencolor, self._pensize, top)
 | 
						|
                self._update()
 | 
						|
            if self._drawing:
 | 
						|
                screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
 | 
						|
                                               fill="", width=self._pensize)
 | 
						|
        # Turtle now at end,
 | 
						|
        if self._drawing: # now update currentLine
 | 
						|
            self.currentLine.append(end)
 | 
						|
        if isinstance(self._fillpath, list):
 | 
						|
            self._fillpath.append(end)
 | 
						|
        ######    vererbung!!!!!!!!!!!!!!!!!!!!!!
 | 
						|
        self._position = end
 | 
						|
        if self._creatingPoly:
 | 
						|
            self._poly.append(end)
 | 
						|
        if len(self.currentLine) > 42: # 42! answer to the ultimate question
 | 
						|
                                       # of life, the universe and everything
 | 
						|
            self._newLine()
 | 
						|
        self._update() #count=True)
 | 
						|
 | 
						|
    def _undogoto(self, entry):
 | 
						|
        """Reverse a _goto. Used for undo()
 | 
						|
        """
 | 
						|
        old, new, go_modes, coodata = entry
 | 
						|
        drawing, pc, ps, filling = go_modes
 | 
						|
        cLI, cL, pl, items = coodata
 | 
						|
        screen = self.screen
 | 
						|
        if abs(self._position - new) > 0.5:
 | 
						|
            print ("undogoto: HALLO-DA-STIMMT-WAS-NICHT!")
 | 
						|
        # restore former situation
 | 
						|
        self.currentLineItem = cLI
 | 
						|
        self.currentLine = cL
 | 
						|
 | 
						|
        if pl == [(0, 0), (0, 0)]:
 | 
						|
            usepc = ""
 | 
						|
        else:
 | 
						|
            usepc = pc
 | 
						|
        screen._drawline(cLI, pl, fill=usepc, width=ps)
 | 
						|
 | 
						|
        todelete = [i for i in self.items if (i not in items) and
 | 
						|
                                       (screen._type(i) == "line")]
 | 
						|
        for i in todelete:
 | 
						|
            screen._delete(i)
 | 
						|
            self.items.remove(i)
 | 
						|
 | 
						|
        start = old
 | 
						|
        if self._speed and screen._tracing == 1:
 | 
						|
            diff = old - new
 | 
						|
            diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
 | 
						|
            nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
 | 
						|
            delta = diff * (1.0/nhops)
 | 
						|
            for n in range(1, nhops):
 | 
						|
                if n == 1:
 | 
						|
                    top = True
 | 
						|
                else:
 | 
						|
                    top = False
 | 
						|
                self._position = new + delta * n
 | 
						|
                if drawing:
 | 
						|
                    screen._drawline(self.drawingLineItem,
 | 
						|
                                     (start, self._position),
 | 
						|
                                     pc, ps, top)
 | 
						|
                self._update()
 | 
						|
            if drawing:
 | 
						|
                screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
 | 
						|
                                               fill="", width=ps)
 | 
						|
        # Turtle now at position old,
 | 
						|
        self._position = old
 | 
						|
        ##  if undo is done during creating a polygon, the last vertex
 | 
						|
        ##  will be deleted. if the polygon is entirely deleted,
 | 
						|
        ##  creatingPoly will be set to False.
 | 
						|
        ##  Polygons created before the last one will not be affected by undo()
 | 
						|
        if self._creatingPoly:
 | 
						|
            if len(self._poly) > 0:
 | 
						|
                self._poly.pop()
 | 
						|
            if self._poly == []:
 | 
						|
                self._creatingPoly = False
 | 
						|
                self._poly = None
 | 
						|
        if filling:
 | 
						|
            if self._fillpath == []:
 | 
						|
                self._fillpath = None
 | 
						|
                print("Unwahrscheinlich in _undogoto!")
 | 
						|
            elif self._fillpath is not None:
 | 
						|
                self._fillpath.pop()
 | 
						|
        self._update() #count=True)
 | 
						|
 | 
						|
    def _rotate(self, angle):
 | 
						|
        """Turns pen clockwise by angle.
 | 
						|
        """
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(("rot", angle, self._degreesPerAU))
 | 
						|
        angle *= self._degreesPerAU
 | 
						|
        neworient = self._orient.rotate(angle)
 | 
						|
        tracing = self.screen._tracing
 | 
						|
        if tracing == 1 and self._speed > 0:
 | 
						|
            anglevel = 3.0 * self._speed
 | 
						|
            steps = 1 + int(abs(angle)/anglevel)
 | 
						|
            delta = 1.0*angle/steps
 | 
						|
            for _ in range(steps):
 | 
						|
                self._orient = self._orient.rotate(delta)
 | 
						|
                self._update()
 | 
						|
        self._orient = neworient
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def _newLine(self, usePos=True):
 | 
						|
        """Closes current line item and starts a new one.
 | 
						|
           Remark: if current line became too long, animation
 | 
						|
           performance (via _drawline) slowed down considerably.
 | 
						|
        """
 | 
						|
        if len(self.currentLine) > 1:
 | 
						|
            self.screen._drawline(self.currentLineItem, self.currentLine,
 | 
						|
                                      self._pencolor, self._pensize)
 | 
						|
            self.currentLineItem = self.screen._createline()
 | 
						|
            self.items.append(self.currentLineItem)
 | 
						|
        else:
 | 
						|
            self.screen._drawline(self.currentLineItem, top=True)
 | 
						|
        self.currentLine = []
 | 
						|
        if usePos:
 | 
						|
            self.currentLine = [self._position]
 | 
						|
 | 
						|
    def filling(self):
 | 
						|
        """Return fillstate (True if filling, False else).
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.begin_fill()
 | 
						|
        >>> if turtle.filling():
 | 
						|
        ...     turtle.pensize(5)
 | 
						|
        ... else:
 | 
						|
        ...     turtle.pensize(3)
 | 
						|
        """
 | 
						|
        return isinstance(self._fillpath, list)
 | 
						|
 | 
						|
    def begin_fill(self):
 | 
						|
        """Called just before drawing a shape to be filled.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.color("black", "red")
 | 
						|
        >>> turtle.begin_fill()
 | 
						|
        >>> turtle.circle(60)
 | 
						|
        >>> turtle.end_fill()
 | 
						|
        """
 | 
						|
        if not self.filling():
 | 
						|
            self._fillitem = self.screen._createpoly()
 | 
						|
            self.items.append(self._fillitem)
 | 
						|
        self._fillpath = [self._position]
 | 
						|
        self._newLine()
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(("beginfill", self._fillitem))
 | 
						|
        self._update()
 | 
						|
 | 
						|
 | 
						|
    def end_fill(self):
 | 
						|
        """Fill the shape drawn after the call begin_fill().
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.color("black", "red")
 | 
						|
        >>> turtle.begin_fill()
 | 
						|
        >>> turtle.circle(60)
 | 
						|
        >>> turtle.end_fill()
 | 
						|
        """
 | 
						|
        if self.filling():
 | 
						|
            if len(self._fillpath) > 2:
 | 
						|
                self.screen._drawpoly(self._fillitem, self._fillpath,
 | 
						|
                                      fill=self._fillcolor)
 | 
						|
                if self.undobuffer:
 | 
						|
                    self.undobuffer.push(("dofill", self._fillitem))
 | 
						|
            self._fillitem = self._fillpath = None
 | 
						|
            self._update()
 | 
						|
 | 
						|
    def dot(self, size=None, *color):
 | 
						|
        """Draw a dot with diameter size, using color.
 | 
						|
 | 
						|
        Optional arguments:
 | 
						|
        size -- an integer >= 1 (if given)
 | 
						|
        color -- a colorstring or a numeric color tuple
 | 
						|
 | 
						|
        Draw a circular dot with diameter size, using color.
 | 
						|
        If size is not given, the maximum of pensize+4 and 2*pensize is used.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.dot()
 | 
						|
        >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50)
 | 
						|
        """
 | 
						|
        if not color:
 | 
						|
            if isinstance(size, (str, tuple)):
 | 
						|
                color = self._colorstr(size)
 | 
						|
                size = self._pensize + max(self._pensize, 4)
 | 
						|
            else:
 | 
						|
                color = self._pencolor
 | 
						|
                if not size:
 | 
						|
                    size = self._pensize + max(self._pensize, 4)
 | 
						|
        else:
 | 
						|
            if size is None:
 | 
						|
                size = self._pensize + max(self._pensize, 4)
 | 
						|
            color = self._colorstr(color)
 | 
						|
        if hasattr(self.screen, "_dot"):
 | 
						|
            item = self.screen._dot(self._position, size, color)
 | 
						|
            self.items.append(item)
 | 
						|
            if self.undobuffer:
 | 
						|
                self.undobuffer.push(("dot", item))
 | 
						|
        else:
 | 
						|
            pen = self.pen()
 | 
						|
            if self.undobuffer:
 | 
						|
                self.undobuffer.push(["seq"])
 | 
						|
                self.undobuffer.cumulate = True
 | 
						|
            try:
 | 
						|
                if self.resizemode() == 'auto':
 | 
						|
                    self.ht()
 | 
						|
                self.pendown()
 | 
						|
                self.pensize(size)
 | 
						|
                self.pencolor(color)
 | 
						|
                self.forward(0)
 | 
						|
            finally:
 | 
						|
                self.pen(pen)
 | 
						|
            if self.undobuffer:
 | 
						|
                self.undobuffer.cumulate = False
 | 
						|
 | 
						|
    def _write(self, txt, align, font):
 | 
						|
        """Performs the writing for write()
 | 
						|
        """
 | 
						|
        item, end = self.screen._write(self._position, txt, align, font,
 | 
						|
                                                          self._pencolor)
 | 
						|
        self.items.append(item)
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(("wri", item))
 | 
						|
        return end
 | 
						|
 | 
						|
    def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")):
 | 
						|
        """Write text at the current turtle position.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        arg -- info, which is to be written to the TurtleScreen
 | 
						|
        move (optional) -- True/False
 | 
						|
        align (optional) -- one of the strings "left", "center" or right"
 | 
						|
        font (optional) -- a triple (fontname, fontsize, fonttype)
 | 
						|
 | 
						|
        Write text - the string representation of arg - at the current
 | 
						|
        turtle position according to align ("left", "center" or right")
 | 
						|
        and with the given font.
 | 
						|
        If move is True, the pen is moved to the bottom-right corner
 | 
						|
        of the text. By default, move is False.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.write('Home = ', True, align="center")
 | 
						|
        >>> turtle.write((0,0), True)
 | 
						|
        """
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.push(["seq"])
 | 
						|
            self.undobuffer.cumulate = True
 | 
						|
        end = self._write(str(arg), align.lower(), font)
 | 
						|
        if move:
 | 
						|
            x, y = self.pos()
 | 
						|
            self.setpos(end, y)
 | 
						|
        if self.undobuffer:
 | 
						|
            self.undobuffer.cumulate = False
 | 
						|
 | 
						|
    def begin_poly(self):
 | 
						|
        """Start recording the vertices of a polygon.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Start recording the vertices of a polygon. Current turtle position
 | 
						|
        is first point of polygon.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.begin_poly()
 | 
						|
        """
 | 
						|
        self._poly = [self._position]
 | 
						|
        self._creatingPoly = True
 | 
						|
 | 
						|
    def end_poly(self):
 | 
						|
        """Stop recording the vertices of a polygon.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Stop recording the vertices of a polygon. Current turtle position is
 | 
						|
        last point of polygon. This will be connected with the first point.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.end_poly()
 | 
						|
        """
 | 
						|
        self._creatingPoly = False
 | 
						|
 | 
						|
    def get_poly(self):
 | 
						|
        """Return the lastly recorded polygon.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> p = turtle.get_poly()
 | 
						|
        >>> turtle.register_shape("myFavouriteShape", p)
 | 
						|
        """
 | 
						|
        ## check if there is any poly?
 | 
						|
        if self._poly is not None:
 | 
						|
            return tuple(self._poly)
 | 
						|
 | 
						|
    def getscreen(self):
 | 
						|
        """Return the TurtleScreen object, the turtle is drawing  on.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Return the TurtleScreen object, the turtle is drawing  on.
 | 
						|
        So TurtleScreen-methods can be called for that object.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> ts = turtle.getscreen()
 | 
						|
        >>> ts
 | 
						|
        <turtle.TurtleScreen object at 0x0106B770>
 | 
						|
        >>> ts.bgcolor("pink")
 | 
						|
        """
 | 
						|
        return self.screen
 | 
						|
 | 
						|
    def getturtle(self):
 | 
						|
        """Return the Turtleobject itself.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        Only reasonable use: as a function to return the 'anonymous turtle':
 | 
						|
 | 
						|
        Example:
 | 
						|
        >>> pet = getturtle()
 | 
						|
        >>> pet.fd(50)
 | 
						|
        >>> pet
 | 
						|
        <turtle.Turtle object at 0x0187D810>
 | 
						|
        >>> turtles()
 | 
						|
        [<turtle.Turtle object at 0x0187D810>]
 | 
						|
        """
 | 
						|
        return self
 | 
						|
 | 
						|
    getpen = getturtle
 | 
						|
 | 
						|
 | 
						|
    ################################################################
 | 
						|
    ### screen oriented methods recurring to methods of TurtleScreen
 | 
						|
    ################################################################
 | 
						|
 | 
						|
    def _delay(self, delay=None):
 | 
						|
        """Set delay value which determines speed of turtle animation.
 | 
						|
        """
 | 
						|
        return self.screen.delay(delay)
 | 
						|
 | 
						|
    def onclick(self, fun, btn=1, add=None):
 | 
						|
        """Bind fun to mouse-click event on this turtle on canvas.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun --  a function with two arguments, to which will be assigned
 | 
						|
                the coordinates of the clicked point on the canvas.
 | 
						|
        btn --  number of the mouse-button defaults to 1 (left mouse button).
 | 
						|
        add --  True or False. If True, new binding will be added, otherwise
 | 
						|
                it will replace a former binding.
 | 
						|
 | 
						|
        Example for the anonymous turtle, i. e. the procedural way:
 | 
						|
 | 
						|
        >>> def turn(x, y):
 | 
						|
        ...     left(360)
 | 
						|
        ...
 | 
						|
        >>> onclick(turn)  # Now clicking into the turtle will turn it.
 | 
						|
        >>> onclick(None)  # event-binding will be removed
 | 
						|
        """
 | 
						|
        self.screen._onclick(self.turtle._item, fun, btn, add)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def onrelease(self, fun, btn=1, add=None):
 | 
						|
        """Bind fun to mouse-button-release event on this turtle on canvas.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with two arguments, to which will be assigned
 | 
						|
                the coordinates of the clicked point on the canvas.
 | 
						|
        btn --  number of the mouse-button defaults to 1 (left mouse button).
 | 
						|
 | 
						|
        Example (for a MyTurtle instance named joe):
 | 
						|
        >>> class MyTurtle(Turtle):
 | 
						|
        ...     def glow(self,x,y):
 | 
						|
        ...             self.fillcolor("red")
 | 
						|
        ...     def unglow(self,x,y):
 | 
						|
        ...             self.fillcolor("")
 | 
						|
        ...
 | 
						|
        >>> joe = MyTurtle()
 | 
						|
        >>> joe.onclick(joe.glow)
 | 
						|
        >>> joe.onrelease(joe.unglow)
 | 
						|
 | 
						|
        Clicking on joe turns fillcolor red, unclicking turns it to
 | 
						|
        transparent.
 | 
						|
        """
 | 
						|
        self.screen._onrelease(self.turtle._item, fun, btn, add)
 | 
						|
        self._update()
 | 
						|
 | 
						|
    def ondrag(self, fun, btn=1, add=None):
 | 
						|
        """Bind fun to mouse-move event on this turtle on canvas.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        fun -- a function with two arguments, to which will be assigned
 | 
						|
               the coordinates of the clicked point on the canvas.
 | 
						|
        btn -- number of the mouse-button defaults to 1 (left mouse button).
 | 
						|
 | 
						|
        Every sequence of mouse-move-events on a turtle is preceded by a
 | 
						|
        mouse-click event on that turtle.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> turtle.ondrag(turtle.goto)
 | 
						|
 | 
						|
        Subsequently clicking and dragging a Turtle will move it
 | 
						|
        across the screen thereby producing handdrawings (if pen is
 | 
						|
        down).
 | 
						|
        """
 | 
						|
        self.screen._ondrag(self.turtle._item, fun, btn, add)
 | 
						|
 | 
						|
 | 
						|
    def _undo(self, action, data):
 | 
						|
        """Does the main part of the work for undo()
 | 
						|
        """
 | 
						|
        if self.undobuffer is None:
 | 
						|
            return
 | 
						|
        if action == "rot":
 | 
						|
            angle, degPAU = data
 | 
						|
            self._rotate(-angle*degPAU/self._degreesPerAU)
 | 
						|
            dummy = self.undobuffer.pop()
 | 
						|
        elif action == "stamp":
 | 
						|
            stitem = data[0]
 | 
						|
            self.clearstamp(stitem)
 | 
						|
        elif action == "go":
 | 
						|
            self._undogoto(data)
 | 
						|
        elif action in ["wri", "dot"]:
 | 
						|
            item = data[0]
 | 
						|
            self.screen._delete(item)
 | 
						|
            self.items.remove(item)
 | 
						|
        elif action == "dofill":
 | 
						|
            item = data[0]
 | 
						|
            self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)),
 | 
						|
                                  fill="", outline="")
 | 
						|
        elif action == "beginfill":
 | 
						|
            item = data[0]
 | 
						|
            self._fillitem = self._fillpath = None
 | 
						|
            if item in self.items:
 | 
						|
                self.screen._delete(item)
 | 
						|
                self.items.remove(item)
 | 
						|
        elif action == "pen":
 | 
						|
            TPen.pen(self, data[0])
 | 
						|
            self.undobuffer.pop()
 | 
						|
 | 
						|
    def undo(self):
 | 
						|
        """undo (repeatedly) the last turtle action.
 | 
						|
 | 
						|
        No argument.
 | 
						|
 | 
						|
        undo (repeatedly) the last turtle action.
 | 
						|
        Number of available undo actions is determined by the size of
 | 
						|
        the undobuffer.
 | 
						|
 | 
						|
        Example (for a Turtle instance named turtle):
 | 
						|
        >>> for i in range(4):
 | 
						|
        ...     turtle.fd(50); turtle.lt(80)
 | 
						|
        ...
 | 
						|
        >>> for i in range(8):
 | 
						|
        ...     turtle.undo()
 | 
						|
        ...
 | 
						|
        """
 | 
						|
        if self.undobuffer is None:
 | 
						|
            return
 | 
						|
        item = self.undobuffer.pop()
 | 
						|
        action = item[0]
 | 
						|
        data = item[1:]
 | 
						|
        if action == "seq":
 | 
						|
            while data:
 | 
						|
                item = data.pop()
 | 
						|
                self._undo(item[0], item[1:])
 | 
						|
        else:
 | 
						|
            self._undo(action, data)
 | 
						|
 | 
						|
    turtlesize = shapesize
 | 
						|
 | 
						|
RawPen = RawTurtle
 | 
						|
 | 
						|
###  Screen - Singleton  ########################
 | 
						|
 | 
						|
def Screen():
 | 
						|
    """Return the singleton screen object.
 | 
						|
    If none exists at the moment, create a new one and return it,
 | 
						|
    else return the existing one."""
 | 
						|
    if Turtle._screen is None:
 | 
						|
        Turtle._screen = _Screen()
 | 
						|
    return Turtle._screen
 | 
						|
 | 
						|
class _Screen(TurtleScreen):
 | 
						|
 | 
						|
    _root = None
 | 
						|
    _canvas = None
 | 
						|
    _title = _CFG["title"]
 | 
						|
 | 
						|
    def __init__(self):
 | 
						|
        # XXX there is no need for this code to be conditional,
 | 
						|
        # as there will be only a single _Screen instance, anyway
 | 
						|
        # XXX actually, the turtle demo is injecting root window,
 | 
						|
        # so perhaps the conditional creation of a root should be
 | 
						|
        # preserved (perhaps by passing it as an optional parameter)
 | 
						|
        if _Screen._root is None:
 | 
						|
            _Screen._root = self._root = _Root()
 | 
						|
            self._root.title(_Screen._title)
 | 
						|
            self._root.ondestroy(self._destroy)
 | 
						|
        if _Screen._canvas is None:
 | 
						|
            width = _CFG["width"]
 | 
						|
            height = _CFG["height"]
 | 
						|
            canvwidth = _CFG["canvwidth"]
 | 
						|
            canvheight = _CFG["canvheight"]
 | 
						|
            leftright = _CFG["leftright"]
 | 
						|
            topbottom = _CFG["topbottom"]
 | 
						|
            self._root.setupcanvas(width, height, canvwidth, canvheight)
 | 
						|
            _Screen._canvas = self._root._getcanvas()
 | 
						|
            TurtleScreen.__init__(self, _Screen._canvas)
 | 
						|
            self.setup(width, height, leftright, topbottom)
 | 
						|
 | 
						|
    def setup(self, width=_CFG["width"], height=_CFG["height"],
 | 
						|
              startx=_CFG["leftright"], starty=_CFG["topbottom"]):
 | 
						|
        """ Set the size and position of the main window.
 | 
						|
 | 
						|
        Arguments:
 | 
						|
        width: as integer a size in pixels, as float a fraction of the screen.
 | 
						|
          Default is 50% of screen.
 | 
						|
        height: as integer the height in pixels, as float a fraction of the
 | 
						|
          screen. Default is 75% of screen.
 | 
						|
        startx: if positive, starting position in pixels from the left
 | 
						|
          edge of the screen, if negative from the right edge
 | 
						|
          Default, startx=None is to center window horizontally.
 | 
						|
        starty: if positive, starting position in pixels from the top
 | 
						|
          edge of the screen, if negative from the bottom edge
 | 
						|
          Default, starty=None is to center window vertically.
 | 
						|
 | 
						|
        Examples (for a Screen instance named screen):
 | 
						|
        >>> screen.setup (width=200, height=200, startx=0, starty=0)
 | 
						|
 | 
						|
        sets window to 200x200 pixels, in upper left of screen
 | 
						|
 | 
						|
        >>> screen.setup(width=.75, height=0.5, startx=None, starty=None)
 | 
						|
 | 
						|
        sets window to 75% of screen by 50% of screen and centers
 | 
						|
        """
 | 
						|
        if not hasattr(self._root, "set_geometry"):
 | 
						|
            return
 | 
						|
        sw = self._root.win_width()
 | 
						|
        sh = self._root.win_height()
 | 
						|
        if isinstance(width, float) and 0 <= width <= 1:
 | 
						|
            width = sw*width
 | 
						|
        if startx is None:
 | 
						|
            startx = (sw - width) / 2
 | 
						|
        if isinstance(height, float) and 0 <= height <= 1:
 | 
						|
            height = sh*height
 | 
						|
        if starty is None:
 | 
						|
            starty = (sh - height) / 2
 | 
						|
        self._root.set_geometry(width, height, startx, starty)
 | 
						|
        self.update()
 | 
						|
 | 
						|
    def title(self, titlestring):
 | 
						|
        """Set title of turtle-window
 | 
						|
 | 
						|
        Argument:
 | 
						|
        titlestring -- a string, to appear in the titlebar of the
 | 
						|
                       turtle graphics window.
 | 
						|
 | 
						|
        This is a method of Screen-class. Not available for TurtleScreen-
 | 
						|
        objects.
 | 
						|
 | 
						|
        Example (for a Screen instance named screen):
 | 
						|
        >>> screen.title("Welcome to the turtle-zoo!")
 | 
						|
        """
 | 
						|
        if _Screen._root is not None:
 | 
						|
            _Screen._root.title(titlestring)
 | 
						|
        _Screen._title = titlestring
 | 
						|
 | 
						|
    def _destroy(self):
 | 
						|
        root = self._root
 | 
						|
        if root is _Screen._root:
 | 
						|
            Turtle._pen = None
 | 
						|
            Turtle._screen = None
 | 
						|
            _Screen._root = None
 | 
						|
            _Screen._canvas = None
 | 
						|
        TurtleScreen._RUNNING = False
 | 
						|
        root.destroy()
 | 
						|
 | 
						|
    def bye(self):
 | 
						|
        """Shut the turtlegraphics window.
 | 
						|
 | 
						|
        Example (for a TurtleScreen instance named screen):
 | 
						|
        >>> screen.bye()
 | 
						|
        """
 | 
						|
        self._destroy()
 | 
						|
 | 
						|
    def exitonclick(self):
 | 
						|
        """Go into mainloop until the mouse is clicked.
 | 
						|
 | 
						|
        No arguments.
 | 
						|
 | 
						|
        Bind bye() method to mouseclick on TurtleScreen.
 | 
						|
        If "using_IDLE" - value in configuration dictionary is False
 | 
						|
        (default value), enter mainloop.
 | 
						|
        If IDLE with -n switch (no subprocess) is used, this value should be
 | 
						|
        set to True in turtle.cfg. In this case IDLE's mainloop
 | 
						|
        is active also for the client script.
 | 
						|
 | 
						|
        This is a method of the Screen-class and not available for
 | 
						|
        TurtleScreen instances.
 | 
						|
 | 
						|
        Example (for a Screen instance named screen):
 | 
						|
        >>> screen.exitonclick()
 | 
						|
 | 
						|
        """
 | 
						|
        def exitGracefully(x, y):
 | 
						|
            """Screen.bye() with two dummy-parameters"""
 | 
						|
            self.bye()
 | 
						|
        self.onclick(exitGracefully)
 | 
						|
        if _CFG["using_IDLE"]:
 | 
						|
            return
 | 
						|
        try:
 | 
						|
            mainloop()
 | 
						|
        except AttributeError:
 | 
						|
            exit(0)
 | 
						|
 | 
						|
class Turtle(RawTurtle):
 | 
						|
    """RawTurtle auto-creating (scrolled) canvas.
 | 
						|
 | 
						|
    When a Turtle object is created or a function derived from some
 | 
						|
    Turtle method is called a TurtleScreen object is automatically created.
 | 
						|
    """
 | 
						|
    _pen = None
 | 
						|
    _screen = None
 | 
						|
 | 
						|
    def __init__(self,
 | 
						|
                 shape=_CFG["shape"],
 | 
						|
                 undobuffersize=_CFG["undobuffersize"],
 | 
						|
                 visible=_CFG["visible"]):
 | 
						|
        if Turtle._screen is None:
 | 
						|
            Turtle._screen = Screen()
 | 
						|
        RawTurtle.__init__(self, Turtle._screen,
 | 
						|
                           shape=shape,
 | 
						|
                           undobuffersize=undobuffersize,
 | 
						|
                           visible=visible)
 | 
						|
 | 
						|
Pen = Turtle
 | 
						|
 | 
						|
def write_docstringdict(filename="turtle_docstringdict"):
 | 
						|
    """Create and write docstring-dictionary to file.
 | 
						|
 | 
						|
    Optional argument:
 | 
						|
    filename -- a string, used as filename
 | 
						|
                default value is turtle_docstringdict
 | 
						|
 | 
						|
    Has to be called explicitly, (not used by the turtle-graphics classes)
 | 
						|
    The docstring dictionary will be written to the Python script <filname>.py
 | 
						|
    It is intended to serve as a template for translation of the docstrings
 | 
						|
    into different languages.
 | 
						|
    """
 | 
						|
    docsdict = {}
 | 
						|
 | 
						|
    for methodname in _tg_screen_functions:
 | 
						|
        key = "_Screen."+methodname
 | 
						|
        docsdict[key] = eval(key).__doc__
 | 
						|
    for methodname in _tg_turtle_functions:
 | 
						|
        key = "Turtle."+methodname
 | 
						|
        docsdict[key] = eval(key).__doc__
 | 
						|
 | 
						|
    with open("%s.py" % filename,"w") as f:
 | 
						|
        keys = sorted(x for x in docsdict
 | 
						|
                      if x.split('.')[1] not in _alias_list)
 | 
						|
        f.write('docsdict = {\n\n')
 | 
						|
        for key in keys[:-1]:
 | 
						|
            f.write('%s :\n' % repr(key))
 | 
						|
            f.write('        """%s\n""",\n\n' % docsdict[key])
 | 
						|
        key = keys[-1]
 | 
						|
        f.write('%s :\n' % repr(key))
 | 
						|
        f.write('        """%s\n"""\n\n' % docsdict[key])
 | 
						|
        f.write("}\n")
 | 
						|
        f.close()
 | 
						|
 | 
						|
def read_docstrings(lang):
 | 
						|
    """Read in docstrings from lang-specific docstring dictionary.
 | 
						|
 | 
						|
    Transfer docstrings, translated to lang, from a dictionary-file
 | 
						|
    to the methods of classes Screen and Turtle and - in revised form -
 | 
						|
    to the corresponding functions.
 | 
						|
    """
 | 
						|
    modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()}
 | 
						|
    module = __import__(modname)
 | 
						|
    docsdict = module.docsdict
 | 
						|
    for key in docsdict:
 | 
						|
        try:
 | 
						|
#            eval(key).im_func.__doc__ = docsdict[key]
 | 
						|
            eval(key).__doc__ = docsdict[key]
 | 
						|
        except Exception:
 | 
						|
            print("Bad docstring-entry: %s" % key)
 | 
						|
 | 
						|
_LANGUAGE = _CFG["language"]
 | 
						|
 | 
						|
try:
 | 
						|
    if _LANGUAGE != "english":
 | 
						|
        read_docstrings(_LANGUAGE)
 | 
						|
except ImportError:
 | 
						|
    print("Cannot find docsdict for", _LANGUAGE)
 | 
						|
except Exception:
 | 
						|
    print ("Unknown Error when trying to import %s-docstring-dictionary" %
 | 
						|
                                                                  _LANGUAGE)
 | 
						|
 | 
						|
 | 
						|
def getmethparlist(ob):
 | 
						|
    """Get strings describing the arguments for the given object
 | 
						|
 | 
						|
    Returns a pair of strings representing function parameter lists
 | 
						|
    including parenthesis.  The first string is suitable for use in
 | 
						|
    function definition and the second is suitable for use in function
 | 
						|
    call.  The "self" parameter is not included.
 | 
						|
    """
 | 
						|
    defText = callText = ""
 | 
						|
    # bit of a hack for methods - turn it into a function
 | 
						|
    # but we drop the "self" param.
 | 
						|
    # Try and build one for Python defined functions
 | 
						|
    args, varargs, varkw = inspect.getargs(ob.__code__)
 | 
						|
    items2 = args[1:]
 | 
						|
    realArgs = args[1:]
 | 
						|
    defaults = ob.__defaults__ or []
 | 
						|
    defaults = ["=%r" % (value,) for value in defaults]
 | 
						|
    defaults = [""] * (len(realArgs)-len(defaults)) + defaults
 | 
						|
    items1 = [arg + dflt for arg, dflt in zip(realArgs, defaults)]
 | 
						|
    if varargs is not None:
 | 
						|
        items1.append("*" + varargs)
 | 
						|
        items2.append("*" + varargs)
 | 
						|
    if varkw is not None:
 | 
						|
        items1.append("**" + varkw)
 | 
						|
        items2.append("**" + varkw)
 | 
						|
    defText = ", ".join(items1)
 | 
						|
    defText = "(%s)" % defText
 | 
						|
    callText = ", ".join(items2)
 | 
						|
    callText = "(%s)" % callText
 | 
						|
    return defText, callText
 | 
						|
 | 
						|
def _turtle_docrevise(docstr):
 | 
						|
    """To reduce docstrings from RawTurtle class for functions
 | 
						|
    """
 | 
						|
    import re
 | 
						|
    if docstr is None:
 | 
						|
        return None
 | 
						|
    turtlename = _CFG["exampleturtle"]
 | 
						|
    newdocstr = docstr.replace("%s." % turtlename,"")
 | 
						|
    parexp = re.compile(r' \(.+ %s\):' % turtlename)
 | 
						|
    newdocstr = parexp.sub(":", newdocstr)
 | 
						|
    return newdocstr
 | 
						|
 | 
						|
def _screen_docrevise(docstr):
 | 
						|
    """To reduce docstrings from TurtleScreen class for functions
 | 
						|
    """
 | 
						|
    import re
 | 
						|
    if docstr is None:
 | 
						|
        return None
 | 
						|
    screenname = _CFG["examplescreen"]
 | 
						|
    newdocstr = docstr.replace("%s." % screenname,"")
 | 
						|
    parexp = re.compile(r' \(.+ %s\):' % screenname)
 | 
						|
    newdocstr = parexp.sub(":", newdocstr)
 | 
						|
    return newdocstr
 | 
						|
 | 
						|
## The following mechanism makes all methods of RawTurtle and Turtle available
 | 
						|
## as functions. So we can enhance, change, add, delete methods to these
 | 
						|
## classes and do not need to change anything here.
 | 
						|
 | 
						|
__func_body = """\
 | 
						|
def {name}{paramslist}:
 | 
						|
    if {obj} is None:
 | 
						|
        if not TurtleScreen._RUNNING:
 | 
						|
            TurtleScreen._RUNNING = True
 | 
						|
            raise Terminator
 | 
						|
        {obj} = {init}
 | 
						|
    try:
 | 
						|
        return {obj}.{name}{argslist}
 | 
						|
    except TK.TclError:
 | 
						|
        if not TurtleScreen._RUNNING:
 | 
						|
            TurtleScreen._RUNNING = True
 | 
						|
            raise Terminator
 | 
						|
        raise
 | 
						|
"""
 | 
						|
 | 
						|
def _make_global_funcs(functions, cls, obj, init, docrevise):
 | 
						|
    for methodname in functions:
 | 
						|
        method = getattr(cls, methodname)
 | 
						|
        pl1, pl2 = getmethparlist(method)
 | 
						|
        if pl1 == "":
 | 
						|
            print(">>>>>>", pl1, pl2)
 | 
						|
            continue
 | 
						|
        defstr = __func_body.format(obj=obj, init=init, name=methodname,
 | 
						|
                                    paramslist=pl1, argslist=pl2)
 | 
						|
        exec(defstr, globals())
 | 
						|
        globals()[methodname].__doc__ = docrevise(method.__doc__)
 | 
						|
 | 
						|
_make_global_funcs(_tg_screen_functions, _Screen,
 | 
						|
                   'Turtle._screen', 'Screen()', _screen_docrevise)
 | 
						|
_make_global_funcs(_tg_turtle_functions, Turtle,
 | 
						|
                   'Turtle._pen', 'Turtle()', _turtle_docrevise)
 | 
						|
 | 
						|
 | 
						|
done = mainloop
 | 
						|
 | 
						|
if __name__ == "__main__":
 | 
						|
    def switchpen():
 | 
						|
        if isdown():
 | 
						|
            pu()
 | 
						|
        else:
 | 
						|
            pd()
 | 
						|
 | 
						|
    def demo1():
 | 
						|
        """Demo of old turtle.py - module"""
 | 
						|
        reset()
 | 
						|
        tracer(True)
 | 
						|
        up()
 | 
						|
        backward(100)
 | 
						|
        down()
 | 
						|
        # draw 3 squares; the last filled
 | 
						|
        width(3)
 | 
						|
        for i in range(3):
 | 
						|
            if i == 2:
 | 
						|
                begin_fill()
 | 
						|
            for _ in range(4):
 | 
						|
                forward(20)
 | 
						|
                left(90)
 | 
						|
            if i == 2:
 | 
						|
                color("maroon")
 | 
						|
                end_fill()
 | 
						|
            up()
 | 
						|
            forward(30)
 | 
						|
            down()
 | 
						|
        width(1)
 | 
						|
        color("black")
 | 
						|
        # move out of the way
 | 
						|
        tracer(False)
 | 
						|
        up()
 | 
						|
        right(90)
 | 
						|
        forward(100)
 | 
						|
        right(90)
 | 
						|
        forward(100)
 | 
						|
        right(180)
 | 
						|
        down()
 | 
						|
        # some text
 | 
						|
        write("startstart", 1)
 | 
						|
        write("start", 1)
 | 
						|
        color("red")
 | 
						|
        # staircase
 | 
						|
        for i in range(5):
 | 
						|
            forward(20)
 | 
						|
            left(90)
 | 
						|
            forward(20)
 | 
						|
            right(90)
 | 
						|
        # filled staircase
 | 
						|
        tracer(True)
 | 
						|
        begin_fill()
 | 
						|
        for i in range(5):
 | 
						|
            forward(20)
 | 
						|
            left(90)
 | 
						|
            forward(20)
 | 
						|
            right(90)
 | 
						|
        end_fill()
 | 
						|
        # more text
 | 
						|
 | 
						|
    def demo2():
 | 
						|
        """Demo of some new features."""
 | 
						|
        speed(1)
 | 
						|
        st()
 | 
						|
        pensize(3)
 | 
						|
        setheading(towards(0, 0))
 | 
						|
        radius = distance(0, 0)/2.0
 | 
						|
        rt(90)
 | 
						|
        for _ in range(18):
 | 
						|
            switchpen()
 | 
						|
            circle(radius, 10)
 | 
						|
        write("wait a moment...")
 | 
						|
        while undobufferentries():
 | 
						|
            undo()
 | 
						|
        reset()
 | 
						|
        lt(90)
 | 
						|
        colormode(255)
 | 
						|
        laenge = 10
 | 
						|
        pencolor("green")
 | 
						|
        pensize(3)
 | 
						|
        lt(180)
 | 
						|
        for i in range(-2, 16):
 | 
						|
            if i > 0:
 | 
						|
                begin_fill()
 | 
						|
                fillcolor(255-15*i, 0, 15*i)
 | 
						|
            for _ in range(3):
 | 
						|
                fd(laenge)
 | 
						|
                lt(120)
 | 
						|
            end_fill()
 | 
						|
            laenge += 10
 | 
						|
            lt(15)
 | 
						|
            speed((speed()+1)%12)
 | 
						|
        #end_fill()
 | 
						|
 | 
						|
        lt(120)
 | 
						|
        pu()
 | 
						|
        fd(70)
 | 
						|
        rt(30)
 | 
						|
        pd()
 | 
						|
        color("red","yellow")
 | 
						|
        speed(0)
 | 
						|
        begin_fill()
 | 
						|
        for _ in range(4):
 | 
						|
            circle(50, 90)
 | 
						|
            rt(90)
 | 
						|
            fd(30)
 | 
						|
            rt(90)
 | 
						|
        end_fill()
 | 
						|
        lt(90)
 | 
						|
        pu()
 | 
						|
        fd(30)
 | 
						|
        pd()
 | 
						|
        shape("turtle")
 | 
						|
 | 
						|
        tri = getturtle()
 | 
						|
        tri.resizemode("auto")
 | 
						|
        turtle = Turtle()
 | 
						|
        turtle.resizemode("auto")
 | 
						|
        turtle.shape("turtle")
 | 
						|
        turtle.reset()
 | 
						|
        turtle.left(90)
 | 
						|
        turtle.speed(0)
 | 
						|
        turtle.up()
 | 
						|
        turtle.goto(280, 40)
 | 
						|
        turtle.lt(30)
 | 
						|
        turtle.down()
 | 
						|
        turtle.speed(6)
 | 
						|
        turtle.color("blue","orange")
 | 
						|
        turtle.pensize(2)
 | 
						|
        tri.speed(6)
 | 
						|
        setheading(towards(turtle))
 | 
						|
        count = 1
 | 
						|
        while tri.distance(turtle) > 4:
 | 
						|
            turtle.fd(3.5)
 | 
						|
            turtle.lt(0.6)
 | 
						|
            tri.setheading(tri.towards(turtle))
 | 
						|
            tri.fd(4)
 | 
						|
            if count % 20 == 0:
 | 
						|
                turtle.stamp()
 | 
						|
                tri.stamp()
 | 
						|
                switchpen()
 | 
						|
            count += 1
 | 
						|
        tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align="right")
 | 
						|
        tri.pencolor("black")
 | 
						|
        tri.pencolor("red")
 | 
						|
 | 
						|
        def baba(xdummy, ydummy):
 | 
						|
            clearscreen()
 | 
						|
            bye()
 | 
						|
 | 
						|
        time.sleep(2)
 | 
						|
 | 
						|
        while undobufferentries():
 | 
						|
            tri.undo()
 | 
						|
            turtle.undo()
 | 
						|
        tri.fd(50)
 | 
						|
        tri.write("  Click me!", font = ("Courier", 12, "bold") )
 | 
						|
        tri.onclick(baba, 1)
 | 
						|
 | 
						|
    demo1()
 | 
						|
    demo2()
 | 
						|
    exitonclick()
 |