mirror of
https://github.com/golang/go.git
synced 2025-12-08 06:10:04 +00:00
Change-Id: I429637ca91f7db4144f17621de851a548dc1ce76 Reviewed-on: https://go-review.googlesource.com/34923 Reviewed-by: Ian Lance Taylor <iant@golang.org> Reviewed-by: Daniel Martà <mvdan@mvdan.cc> Run-TryBot: Ian Lance Taylor <iant@golang.org> TryBot-Result: Gobot Gobot <gobot@golang.org>
2627 lines
77 KiB
Go
2627 lines
77 KiB
Go
// Copyright 2015 The Go Authors. All rights reserved.
|
|
// Use of this source code is governed by a BSD-style
|
|
// license that can be found in the LICENSE file.
|
|
|
|
// Register allocation.
|
|
//
|
|
// We use a version of a linear scan register allocator. We treat the
|
|
// whole function as a single long basic block and run through
|
|
// it using a greedy register allocator. Then all merge edges
|
|
// (those targeting a block with len(Preds)>1) are processed to
|
|
// shuffle data into the place that the target of the edge expects.
|
|
//
|
|
// The greedy allocator moves values into registers just before they
|
|
// are used, spills registers only when necessary, and spills the
|
|
// value whose next use is farthest in the future.
|
|
//
|
|
// The register allocator requires that a block is not scheduled until
|
|
// at least one of its predecessors have been scheduled. The most recent
|
|
// such predecessor provides the starting register state for a block.
|
|
//
|
|
// It also requires that there are no critical edges (critical =
|
|
// comes from a block with >1 successor and goes to a block with >1
|
|
// predecessor). This makes it easy to add fixup code on merge edges -
|
|
// the source of a merge edge has only one successor, so we can add
|
|
// fixup code to the end of that block.
|
|
|
|
// Spilling
|
|
//
|
|
// For every value, we generate a spill immediately after the value itself.
|
|
// x = Op y z : AX
|
|
// x2 = StoreReg x
|
|
// While AX still holds x, any uses of x will use that value. When AX is needed
|
|
// for another value, we simply reuse AX. Spill code has already been generated
|
|
// so there is no code generated at "spill" time. When x is referenced
|
|
// subsequently, we issue a load to restore x to a register using x2 as
|
|
// its argument:
|
|
// x3 = Restore x2 : CX
|
|
// x3 can then be used wherever x is referenced again.
|
|
// If the spill (x2) is never used, it will be removed at the end of regalloc.
|
|
//
|
|
// Phi values are special, as always. We define two kinds of phis, those
|
|
// where the merge happens in a register (a "register" phi) and those where
|
|
// the merge happens in a stack location (a "stack" phi).
|
|
//
|
|
// A register phi must have the phi and all of its inputs allocated to the
|
|
// same register. Register phis are spilled similarly to regular ops:
|
|
// b1: y = ... : AX b2: z = ... : AX
|
|
// goto b3 goto b3
|
|
// b3: x = phi(y, z) : AX
|
|
// x2 = StoreReg x
|
|
//
|
|
// A stack phi must have the phi and all of its inputs allocated to the same
|
|
// stack location. Stack phis start out life already spilled - each phi
|
|
// input must be a store (using StoreReg) at the end of the corresponding
|
|
// predecessor block.
|
|
// b1: y = ... : AX b2: z = ... : BX
|
|
// y2 = StoreReg y z2 = StoreReg z
|
|
// goto b3 goto b3
|
|
// b3: x = phi(y2, z2)
|
|
// The stack allocator knows that StoreReg args of stack-allocated phis
|
|
// must be allocated to the same stack slot as the phi that uses them.
|
|
// x is now a spilled value and a restore must appear before its first use.
|
|
|
|
// TODO
|
|
|
|
// Use an affinity graph to mark two values which should use the
|
|
// same register. This affinity graph will be used to prefer certain
|
|
// registers for allocation. This affinity helps eliminate moves that
|
|
// are required for phi implementations and helps generate allocations
|
|
// for 2-register architectures.
|
|
|
|
// Note: regalloc generates a not-quite-SSA output. If we have:
|
|
//
|
|
// b1: x = ... : AX
|
|
// x2 = StoreReg x
|
|
// ... AX gets reused for something else ...
|
|
// if ... goto b3 else b4
|
|
//
|
|
// b3: x3 = LoadReg x2 : BX b4: x4 = LoadReg x2 : CX
|
|
// ... use x3 ... ... use x4 ...
|
|
//
|
|
// b2: ... use x3 ...
|
|
//
|
|
// If b3 is the primary predecessor of b2, then we use x3 in b2 and
|
|
// add a x4:CX->BX copy at the end of b4.
|
|
// But the definition of x3 doesn't dominate b2. We should really
|
|
// insert a dummy phi at the start of b2 (x5=phi(x3,x4):BX) to keep
|
|
// SSA form. For now, we ignore this problem as remaining in strict
|
|
// SSA form isn't needed after regalloc. We'll just leave the use
|
|
// of x3 not dominated by the definition of x3, and the CX->BX copy
|
|
// will have no use (so don't run deadcode after regalloc!).
|
|
// TODO: maybe we should introduce these extra phis?
|
|
|
|
// Additional not-quite-SSA output occurs when spills are sunk out
|
|
// of loops to the targets of exit edges from the loop. Before sinking,
|
|
// there is one spill site (one StoreReg) targeting stack slot X, after
|
|
// sinking there may be multiple spill sites targeting stack slot X,
|
|
// with no phi functions at any join points reachable by the multiple
|
|
// spill sites. In addition, uses of the spill from copies of the original
|
|
// will not name the copy in their reference; instead they will name
|
|
// the original, though both will have the same spill location. The
|
|
// first sunk spill will be the original, but moved, to an exit block,
|
|
// thus ensuring that there is a definition somewhere corresponding to
|
|
// the original spill's uses.
|
|
|
|
package ssa
|
|
|
|
import (
|
|
"cmd/internal/obj"
|
|
"fmt"
|
|
"unsafe"
|
|
)
|
|
|
|
const (
|
|
moveSpills = iota
|
|
logSpills
|
|
regDebug
|
|
stackDebug
|
|
)
|
|
|
|
// distance is a measure of how far into the future values are used.
|
|
// distance is measured in units of instructions.
|
|
const (
|
|
likelyDistance = 1
|
|
normalDistance = 10
|
|
unlikelyDistance = 100
|
|
)
|
|
|
|
// regalloc performs register allocation on f. It sets f.RegAlloc
|
|
// to the resulting allocation.
|
|
func regalloc(f *Func) {
|
|
var s regAllocState
|
|
s.init(f)
|
|
s.regalloc(f)
|
|
}
|
|
|
|
type register uint8
|
|
|
|
const noRegister register = 255
|
|
|
|
type regMask uint64
|
|
|
|
func (m regMask) String() string {
|
|
s := ""
|
|
for r := register(0); m != 0; r++ {
|
|
if m>>r&1 == 0 {
|
|
continue
|
|
}
|
|
m &^= regMask(1) << r
|
|
if s != "" {
|
|
s += " "
|
|
}
|
|
s += fmt.Sprintf("r%d", r)
|
|
}
|
|
return s
|
|
}
|
|
|
|
// countRegs returns the number of set bits in the register mask.
|
|
func countRegs(r regMask) int {
|
|
n := 0
|
|
for r != 0 {
|
|
n += int(r & 1)
|
|
r >>= 1
|
|
}
|
|
return n
|
|
}
|
|
|
|
// pickReg picks an arbitrary register from the register mask.
|
|
func pickReg(r regMask) register {
|
|
// pick the lowest one
|
|
if r == 0 {
|
|
panic("can't pick a register from an empty set")
|
|
}
|
|
for i := register(0); ; i++ {
|
|
if r&1 != 0 {
|
|
return i
|
|
}
|
|
r >>= 1
|
|
}
|
|
}
|
|
|
|
type use struct {
|
|
dist int32 // distance from start of the block to a use of a value
|
|
line int32 // line number of the use
|
|
next *use // linked list of uses of a value in nondecreasing dist order
|
|
}
|
|
|
|
type valState struct {
|
|
regs regMask // the set of registers holding a Value (usually just one)
|
|
uses *use // list of uses in this block
|
|
spill *Value // spilled copy of the Value
|
|
spillUsed bool
|
|
spillUsedShuffle bool // true if used in shuffling, after ordinary uses
|
|
needReg bool // cached value of !v.Type.IsMemory() && !v.Type.IsVoid() && !.v.Type.IsFlags()
|
|
rematerializeable bool // cached value of v.rematerializeable()
|
|
}
|
|
|
|
type regState struct {
|
|
v *Value // Original (preregalloc) Value stored in this register.
|
|
c *Value // A Value equal to v which is currently in a register. Might be v or a copy of it.
|
|
// If a register is unused, v==c==nil
|
|
}
|
|
|
|
type regAllocState struct {
|
|
f *Func
|
|
|
|
registers []Register
|
|
numRegs register
|
|
SPReg register
|
|
SBReg register
|
|
GReg register
|
|
allocatable regMask
|
|
|
|
// for each block, its primary predecessor.
|
|
// A predecessor of b is primary if it is the closest
|
|
// predecessor that appears before b in the layout order.
|
|
// We record the index in the Preds list where the primary predecessor sits.
|
|
primary []int32
|
|
|
|
// live values at the end of each block. live[b.ID] is a list of value IDs
|
|
// which are live at the end of b, together with a count of how many instructions
|
|
// forward to the next use.
|
|
live [][]liveInfo
|
|
// desired register assignments at the end of each block.
|
|
// Note that this is a static map computed before allocation occurs. Dynamic
|
|
// register desires (from partially completed allocations) will trump
|
|
// this information.
|
|
desired []desiredState
|
|
|
|
// current state of each (preregalloc) Value
|
|
values []valState
|
|
|
|
// For each Value, map from its value ID back to the
|
|
// preregalloc Value it was derived from.
|
|
orig []*Value
|
|
|
|
// current state of each register
|
|
regs []regState
|
|
|
|
// registers that contain values which can't be kicked out
|
|
nospill regMask
|
|
|
|
// mask of registers currently in use
|
|
used regMask
|
|
|
|
// mask of registers used in the current instruction
|
|
tmpused regMask
|
|
|
|
// current block we're working on
|
|
curBlock *Block
|
|
|
|
// cache of use records
|
|
freeUseRecords *use
|
|
|
|
// endRegs[blockid] is the register state at the end of each block.
|
|
// encoded as a set of endReg records.
|
|
endRegs [][]endReg
|
|
|
|
// startRegs[blockid] is the register state at the start of merge blocks.
|
|
// saved state does not include the state of phi ops in the block.
|
|
startRegs [][]startReg
|
|
|
|
// spillLive[blockid] is the set of live spills at the end of each block
|
|
spillLive [][]ID
|
|
|
|
// a set of copies we generated to move things around, and
|
|
// whether it is used in shuffle. Unused copies will be deleted.
|
|
copies map[*Value]bool
|
|
|
|
loopnest *loopnest
|
|
}
|
|
|
|
type spillToSink struct {
|
|
spill *Value // Spill instruction to move (a StoreReg)
|
|
dests int32 // Bitmask indicating exit blocks from loop in which spill/val is defined. 1<<i set means val is live into loop.exitBlocks[i]
|
|
}
|
|
|
|
func (sts *spillToSink) spilledValue() *Value {
|
|
return sts.spill.Args[0]
|
|
}
|
|
|
|
type endReg struct {
|
|
r register
|
|
v *Value // pre-regalloc value held in this register (TODO: can we use ID here?)
|
|
c *Value // cached version of the value
|
|
}
|
|
|
|
type startReg struct {
|
|
r register
|
|
vid ID // pre-regalloc value needed in this register
|
|
line int32 // line number of use of this register
|
|
}
|
|
|
|
// freeReg frees up register r. Any current user of r is kicked out.
|
|
func (s *regAllocState) freeReg(r register) {
|
|
v := s.regs[r].v
|
|
if v == nil {
|
|
s.f.Fatalf("tried to free an already free register %d\n", r)
|
|
}
|
|
|
|
// Mark r as unused.
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("freeReg %s (dump %s/%s)\n", s.registers[r].Name(), v, s.regs[r].c)
|
|
}
|
|
s.regs[r] = regState{}
|
|
s.values[v.ID].regs &^= regMask(1) << r
|
|
s.used &^= regMask(1) << r
|
|
}
|
|
|
|
// freeRegs frees up all registers listed in m.
|
|
func (s *regAllocState) freeRegs(m regMask) {
|
|
for m&s.used != 0 {
|
|
s.freeReg(pickReg(m & s.used))
|
|
}
|
|
}
|
|
|
|
// setOrig records that c's original value is the same as
|
|
// v's original value.
|
|
func (s *regAllocState) setOrig(c *Value, v *Value) {
|
|
for int(c.ID) >= len(s.orig) {
|
|
s.orig = append(s.orig, nil)
|
|
}
|
|
if s.orig[c.ID] != nil {
|
|
s.f.Fatalf("orig value set twice %s %s", c, v)
|
|
}
|
|
s.orig[c.ID] = s.orig[v.ID]
|
|
}
|
|
|
|
// assignReg assigns register r to hold c, a copy of v.
|
|
// r must be unused.
|
|
func (s *regAllocState) assignReg(r register, v *Value, c *Value) {
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("assignReg %s %s/%s\n", s.registers[r].Name(), v, c)
|
|
}
|
|
if s.regs[r].v != nil {
|
|
s.f.Fatalf("tried to assign register %d to %s/%s but it is already used by %s", r, v, c, s.regs[r].v)
|
|
}
|
|
|
|
// Update state.
|
|
s.regs[r] = regState{v, c}
|
|
s.values[v.ID].regs |= regMask(1) << r
|
|
s.used |= regMask(1) << r
|
|
s.f.setHome(c, &s.registers[r])
|
|
}
|
|
|
|
// allocReg chooses a register from the set of registers in mask.
|
|
// If there is no unused register, a Value will be kicked out of
|
|
// a register to make room.
|
|
func (s *regAllocState) allocReg(mask regMask, v *Value) register {
|
|
mask &= s.allocatable
|
|
mask &^= s.nospill
|
|
if mask == 0 {
|
|
s.f.Fatalf("no register available for %s", v)
|
|
}
|
|
|
|
// Pick an unused register if one is available.
|
|
if mask&^s.used != 0 {
|
|
return pickReg(mask &^ s.used)
|
|
}
|
|
|
|
// Pick a value to spill. Spill the value with the
|
|
// farthest-in-the-future use.
|
|
// TODO: Prefer registers with already spilled Values?
|
|
// TODO: Modify preference using affinity graph.
|
|
// TODO: if a single value is in multiple registers, spill one of them
|
|
// before spilling a value in just a single register.
|
|
|
|
// Find a register to spill. We spill the register containing the value
|
|
// whose next use is as far in the future as possible.
|
|
// https://en.wikipedia.org/wiki/Page_replacement_algorithm#The_theoretically_optimal_page_replacement_algorithm
|
|
var r register
|
|
maxuse := int32(-1)
|
|
for t := register(0); t < s.numRegs; t++ {
|
|
if mask>>t&1 == 0 {
|
|
continue
|
|
}
|
|
v := s.regs[t].v
|
|
if n := s.values[v.ID].uses.dist; n > maxuse {
|
|
// v's next use is farther in the future than any value
|
|
// we've seen so far. A new best spill candidate.
|
|
r = t
|
|
maxuse = n
|
|
}
|
|
}
|
|
if maxuse == -1 {
|
|
s.f.Fatalf("couldn't find register to spill")
|
|
}
|
|
|
|
// Try to move it around before kicking out, if there is a free register.
|
|
// We generate a Copy and record it. It will be deleted if never used.
|
|
v2 := s.regs[r].v
|
|
m := s.compatRegs(v2.Type) &^ s.used &^ s.tmpused &^ (regMask(1) << r)
|
|
if m != 0 && !s.values[v2.ID].rematerializeable && countRegs(s.values[v2.ID].regs) == 1 {
|
|
r2 := pickReg(m)
|
|
c := s.curBlock.NewValue1(v2.Line, OpCopy, v2.Type, s.regs[r].c)
|
|
s.copies[c] = false
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("copy %s to %s : %s\n", v2, c, s.registers[r2].Name())
|
|
}
|
|
s.setOrig(c, v2)
|
|
s.assignReg(r2, v2, c)
|
|
}
|
|
s.freeReg(r)
|
|
return r
|
|
}
|
|
|
|
// allocValToReg allocates v to a register selected from regMask and
|
|
// returns the register copy of v. Any previous user is kicked out and spilled
|
|
// (if necessary). Load code is added at the current pc. If nospill is set the
|
|
// allocated register is marked nospill so the assignment cannot be
|
|
// undone until the caller allows it by clearing nospill. Returns a
|
|
// *Value which is either v or a copy of v allocated to the chosen register.
|
|
func (s *regAllocState) allocValToReg(v *Value, mask regMask, nospill bool, line int32) *Value {
|
|
vi := &s.values[v.ID]
|
|
|
|
// Check if v is already in a requested register.
|
|
if mask&vi.regs != 0 {
|
|
r := pickReg(mask & vi.regs)
|
|
if s.regs[r].v != v || s.regs[r].c == nil {
|
|
panic("bad register state")
|
|
}
|
|
if nospill {
|
|
s.nospill |= regMask(1) << r
|
|
}
|
|
return s.regs[r].c
|
|
}
|
|
|
|
// Allocate a register.
|
|
r := s.allocReg(mask, v)
|
|
|
|
// Allocate v to the new register.
|
|
var c *Value
|
|
if vi.regs != 0 {
|
|
// Copy from a register that v is already in.
|
|
r2 := pickReg(vi.regs)
|
|
if s.regs[r2].v != v {
|
|
panic("bad register state")
|
|
}
|
|
c = s.curBlock.NewValue1(line, OpCopy, v.Type, s.regs[r2].c)
|
|
} else if v.rematerializeable() {
|
|
// Rematerialize instead of loading from the spill location.
|
|
c = v.copyInto(s.curBlock)
|
|
} else {
|
|
switch {
|
|
// Load v from its spill location.
|
|
case vi.spill != nil:
|
|
if s.f.pass.debug > logSpills {
|
|
s.f.Config.Warnl(vi.spill.Line, "load spill for %v from %v", v, vi.spill)
|
|
}
|
|
c = s.curBlock.NewValue1(line, OpLoadReg, v.Type, vi.spill)
|
|
vi.spillUsed = true
|
|
default:
|
|
s.f.Fatalf("attempt to load unspilled value %v", v.LongString())
|
|
}
|
|
}
|
|
s.setOrig(c, v)
|
|
s.assignReg(r, v, c)
|
|
if nospill {
|
|
s.nospill |= regMask(1) << r
|
|
}
|
|
return c
|
|
}
|
|
|
|
// isLeaf reports whether f performs any calls.
|
|
func isLeaf(f *Func) bool {
|
|
for _, b := range f.Blocks {
|
|
for _, v := range b.Values {
|
|
if opcodeTable[v.Op].call {
|
|
return false
|
|
}
|
|
}
|
|
}
|
|
return true
|
|
}
|
|
|
|
func (s *regAllocState) init(f *Func) {
|
|
s.f = f
|
|
s.registers = f.Config.registers
|
|
if nr := len(s.registers); nr == 0 || nr > int(noRegister) || nr > int(unsafe.Sizeof(regMask(0))*8) {
|
|
s.f.Fatalf("bad number of registers: %d", nr)
|
|
} else {
|
|
s.numRegs = register(nr)
|
|
}
|
|
// Locate SP, SB, and g registers.
|
|
s.SPReg = noRegister
|
|
s.SBReg = noRegister
|
|
s.GReg = noRegister
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
switch s.registers[r].Name() {
|
|
case "SP":
|
|
s.SPReg = r
|
|
case "SB":
|
|
s.SBReg = r
|
|
case "g":
|
|
s.GReg = r
|
|
}
|
|
}
|
|
// Make sure we found all required registers.
|
|
switch noRegister {
|
|
case s.SPReg:
|
|
s.f.Fatalf("no SP register found")
|
|
case s.SBReg:
|
|
s.f.Fatalf("no SB register found")
|
|
case s.GReg:
|
|
if f.Config.hasGReg {
|
|
s.f.Fatalf("no g register found")
|
|
}
|
|
}
|
|
|
|
// Figure out which registers we're allowed to use.
|
|
s.allocatable = s.f.Config.gpRegMask | s.f.Config.fpRegMask | s.f.Config.specialRegMask
|
|
s.allocatable &^= 1 << s.SPReg
|
|
s.allocatable &^= 1 << s.SBReg
|
|
if s.f.Config.hasGReg {
|
|
s.allocatable &^= 1 << s.GReg
|
|
}
|
|
if s.f.Config.ctxt.Framepointer_enabled && s.f.Config.FPReg >= 0 {
|
|
s.allocatable &^= 1 << uint(s.f.Config.FPReg)
|
|
}
|
|
if s.f.Config.ctxt.Flag_shared {
|
|
switch s.f.Config.arch {
|
|
case "ppc64le": // R2 already reserved.
|
|
s.allocatable &^= 1 << 12 // R12
|
|
}
|
|
}
|
|
if s.f.Config.LinkReg != -1 {
|
|
if isLeaf(f) {
|
|
// Leaf functions don't save/restore the link register.
|
|
s.allocatable &^= 1 << uint(s.f.Config.LinkReg)
|
|
}
|
|
if s.f.Config.arch == "arm" && obj.GOARM == 5 {
|
|
// On ARMv5 we insert softfloat calls at each FP instruction.
|
|
// This clobbers LR almost everywhere. Disable allocating LR
|
|
// on ARMv5.
|
|
s.allocatable &^= 1 << uint(s.f.Config.LinkReg)
|
|
}
|
|
}
|
|
if s.f.Config.ctxt.Flag_dynlink {
|
|
switch s.f.Config.arch {
|
|
case "amd64":
|
|
s.allocatable &^= 1 << 15 // R15
|
|
case "arm":
|
|
s.allocatable &^= 1 << 9 // R9
|
|
case "ppc64le": // R2 already reserved.
|
|
s.allocatable &^= 1 << 12 // R12
|
|
case "arm64":
|
|
// nothing to do?
|
|
case "386":
|
|
// nothing to do.
|
|
// Note that for Flag_shared (position independent code)
|
|
// we do need to be careful, but that carefulness is hidden
|
|
// in the rewrite rules so we always have a free register
|
|
// available for global load/stores. See gen/386.rules (search for Flag_shared).
|
|
case "s390x":
|
|
// nothing to do, R10 & R11 already reserved
|
|
default:
|
|
s.f.Config.fe.Fatalf(0, "arch %s not implemented", s.f.Config.arch)
|
|
}
|
|
}
|
|
if s.f.Config.nacl {
|
|
switch s.f.Config.arch {
|
|
case "arm":
|
|
s.allocatable &^= 1 << 9 // R9 is "thread pointer" on nacl/arm
|
|
case "amd64p32":
|
|
s.allocatable &^= 1 << 5 // BP - reserved for nacl
|
|
s.allocatable &^= 1 << 15 // R15 - reserved for nacl
|
|
}
|
|
}
|
|
if s.f.Config.use387 {
|
|
s.allocatable &^= 1 << 15 // X7 disallowed (one 387 register is used as scratch space during SSE->387 generation in ../x86/387.go)
|
|
}
|
|
|
|
s.regs = make([]regState, s.numRegs)
|
|
s.values = make([]valState, f.NumValues())
|
|
s.orig = make([]*Value, f.NumValues())
|
|
s.copies = make(map[*Value]bool)
|
|
for _, b := range f.Blocks {
|
|
for _, v := range b.Values {
|
|
if !v.Type.IsMemory() && !v.Type.IsVoid() && !v.Type.IsFlags() && !v.Type.IsTuple() {
|
|
s.values[v.ID].needReg = true
|
|
s.values[v.ID].rematerializeable = v.rematerializeable()
|
|
s.orig[v.ID] = v
|
|
}
|
|
// Note: needReg is false for values returning Tuple types.
|
|
// Instead, we mark the corresponding Selects as needReg.
|
|
}
|
|
}
|
|
s.computeLive()
|
|
|
|
// Compute block order. This array allows us to distinguish forward edges
|
|
// from backward edges and compute how far they go.
|
|
blockOrder := make([]int32, f.NumBlocks())
|
|
for i, b := range f.Blocks {
|
|
blockOrder[b.ID] = int32(i)
|
|
}
|
|
|
|
// Compute primary predecessors.
|
|
s.primary = make([]int32, f.NumBlocks())
|
|
for _, b := range f.Blocks {
|
|
best := -1
|
|
for i, e := range b.Preds {
|
|
p := e.b
|
|
if blockOrder[p.ID] >= blockOrder[b.ID] {
|
|
continue // backward edge
|
|
}
|
|
if best == -1 || blockOrder[p.ID] > blockOrder[b.Preds[best].b.ID] {
|
|
best = i
|
|
}
|
|
}
|
|
s.primary[b.ID] = int32(best)
|
|
}
|
|
|
|
s.endRegs = make([][]endReg, f.NumBlocks())
|
|
s.startRegs = make([][]startReg, f.NumBlocks())
|
|
s.spillLive = make([][]ID, f.NumBlocks())
|
|
}
|
|
|
|
// Adds a use record for id at distance dist from the start of the block.
|
|
// All calls to addUse must happen with nonincreasing dist.
|
|
func (s *regAllocState) addUse(id ID, dist int32, line int32) {
|
|
r := s.freeUseRecords
|
|
if r != nil {
|
|
s.freeUseRecords = r.next
|
|
} else {
|
|
r = &use{}
|
|
}
|
|
r.dist = dist
|
|
r.line = line
|
|
r.next = s.values[id].uses
|
|
s.values[id].uses = r
|
|
if r.next != nil && dist > r.next.dist {
|
|
s.f.Fatalf("uses added in wrong order")
|
|
}
|
|
}
|
|
|
|
// advanceUses advances the uses of v's args from the state before v to the state after v.
|
|
// Any values which have no more uses are deallocated from registers.
|
|
func (s *regAllocState) advanceUses(v *Value) {
|
|
for _, a := range v.Args {
|
|
if !s.values[a.ID].needReg {
|
|
continue
|
|
}
|
|
ai := &s.values[a.ID]
|
|
r := ai.uses
|
|
ai.uses = r.next
|
|
if r.next == nil {
|
|
// Value is dead, free all registers that hold it.
|
|
s.freeRegs(ai.regs)
|
|
}
|
|
r.next = s.freeUseRecords
|
|
s.freeUseRecords = r
|
|
}
|
|
}
|
|
|
|
// liveAfterCurrentInstruction reports whether v is live after
|
|
// the current instruction is completed. v must be used by the
|
|
// current instruction.
|
|
func (s *regAllocState) liveAfterCurrentInstruction(v *Value) bool {
|
|
u := s.values[v.ID].uses
|
|
d := u.dist
|
|
for u != nil && u.dist == d {
|
|
u = u.next
|
|
}
|
|
return u != nil && u.dist > d
|
|
}
|
|
|
|
// Sets the state of the registers to that encoded in regs.
|
|
func (s *regAllocState) setState(regs []endReg) {
|
|
s.freeRegs(s.used)
|
|
for _, x := range regs {
|
|
s.assignReg(x.r, x.v, x.c)
|
|
}
|
|
}
|
|
|
|
// compatRegs returns the set of registers which can store a type t.
|
|
func (s *regAllocState) compatRegs(t Type) regMask {
|
|
var m regMask
|
|
if t.IsTuple() || t.IsFlags() {
|
|
return 0
|
|
}
|
|
if t.IsFloat() || t == TypeInt128 {
|
|
m = s.f.Config.fpRegMask
|
|
} else {
|
|
m = s.f.Config.gpRegMask
|
|
}
|
|
return m & s.allocatable
|
|
}
|
|
|
|
// loopForBlock returns the loop containing block b,
|
|
// provided that the loop is "interesting" for purposes
|
|
// of improving register allocation (= is inner, and does
|
|
// not contain a call)
|
|
func (s *regAllocState) loopForBlock(b *Block) *loop {
|
|
loop := s.loopnest.b2l[b.ID]
|
|
|
|
// Minor for-the-time-being optimization: nothing happens
|
|
// unless a loop is both inner and call-free, therefore
|
|
// don't bother with other loops.
|
|
if loop != nil && (loop.containsCall || !loop.isInner) {
|
|
loop = nil
|
|
}
|
|
return loop
|
|
}
|
|
|
|
func (s *regAllocState) regalloc(f *Func) {
|
|
liveSet := f.newSparseSet(f.NumValues())
|
|
defer f.retSparseSet(liveSet)
|
|
var oldSched []*Value
|
|
var phis []*Value
|
|
var phiRegs []register
|
|
var args []*Value
|
|
|
|
// statistics
|
|
var nSpills int // # of spills remaining
|
|
var nSpillsInner int // # of spills remaining in inner loops
|
|
var nSpillsSunk int // # of sunk spills remaining
|
|
var nSpillsChanged int // # of sunk spills lost because of register use change
|
|
var nSpillsSunkUnused int // # of spills not sunk because they were removed completely
|
|
var nSpillsNotSunkLateUse int // # of spills not sunk because of very late use (in shuffle)
|
|
|
|
// Data structure used for computing desired registers.
|
|
var desired desiredState
|
|
|
|
// Desired registers for inputs & outputs for each instruction in the block.
|
|
type dentry struct {
|
|
out [4]register // desired output registers
|
|
in [3][4]register // desired input registers (for inputs 0,1, and 2)
|
|
}
|
|
var dinfo []dentry
|
|
|
|
if f.Entry != f.Blocks[0] {
|
|
f.Fatalf("entry block must be first")
|
|
}
|
|
|
|
// Get loop nest so that spills in inner loops can be
|
|
// tracked. When the last block of a loop is processed,
|
|
// attempt to move spills out of the loop.
|
|
s.loopnest.findExits()
|
|
|
|
// Spills are moved from one block's slice of values to another's.
|
|
// This confuses register allocation if it occurs before it is
|
|
// complete, so candidates are recorded, then rechecked and
|
|
// moved after all allocation (register and stack) is complete.
|
|
// Because movement is only within a stack slot's lifetime, it
|
|
// is safe to do this.
|
|
var toSink []spillToSink
|
|
// Will be used to figure out live inputs to exit blocks of inner loops.
|
|
entryCandidates := newSparseMap(f.NumValues())
|
|
|
|
for _, b := range f.Blocks {
|
|
s.curBlock = b
|
|
loop := s.loopForBlock(b)
|
|
|
|
// Initialize liveSet and uses fields for this block.
|
|
// Walk backwards through the block doing liveness analysis.
|
|
liveSet.clear()
|
|
for _, e := range s.live[b.ID] {
|
|
s.addUse(e.ID, int32(len(b.Values))+e.dist, e.line) // pseudo-uses from beyond end of block
|
|
liveSet.add(e.ID)
|
|
}
|
|
if v := b.Control; v != nil && s.values[v.ID].needReg {
|
|
s.addUse(v.ID, int32(len(b.Values)), b.Line) // pseudo-use by control value
|
|
liveSet.add(v.ID)
|
|
}
|
|
for i := len(b.Values) - 1; i >= 0; i-- {
|
|
v := b.Values[i]
|
|
liveSet.remove(v.ID)
|
|
if v.Op == OpPhi {
|
|
// Remove v from the live set, but don't add
|
|
// any inputs. This is the state the len(b.Preds)>1
|
|
// case below desires; it wants to process phis specially.
|
|
continue
|
|
}
|
|
for _, a := range v.Args {
|
|
if !s.values[a.ID].needReg {
|
|
continue
|
|
}
|
|
s.addUse(a.ID, int32(i), v.Line)
|
|
liveSet.add(a.ID)
|
|
}
|
|
}
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("uses for %s:%s\n", s.f.Name, b)
|
|
for i := range s.values {
|
|
vi := &s.values[i]
|
|
u := vi.uses
|
|
if u == nil {
|
|
continue
|
|
}
|
|
fmt.Printf(" v%d:", i)
|
|
for u != nil {
|
|
fmt.Printf(" %d", u.dist)
|
|
u = u.next
|
|
}
|
|
fmt.Println()
|
|
}
|
|
}
|
|
|
|
// Make a copy of the block schedule so we can generate a new one in place.
|
|
// We make a separate copy for phis and regular values.
|
|
nphi := 0
|
|
for _, v := range b.Values {
|
|
if v.Op != OpPhi {
|
|
break
|
|
}
|
|
nphi++
|
|
}
|
|
phis = append(phis[:0], b.Values[:nphi]...)
|
|
oldSched = append(oldSched[:0], b.Values[nphi:]...)
|
|
b.Values = b.Values[:0]
|
|
|
|
// Initialize start state of block.
|
|
if b == f.Entry {
|
|
// Regalloc state is empty to start.
|
|
if nphi > 0 {
|
|
f.Fatalf("phis in entry block")
|
|
}
|
|
} else if len(b.Preds) == 1 {
|
|
// Start regalloc state with the end state of the previous block.
|
|
s.setState(s.endRegs[b.Preds[0].b.ID])
|
|
if nphi > 0 {
|
|
f.Fatalf("phis in single-predecessor block")
|
|
}
|
|
// Drop any values which are no longer live.
|
|
// This may happen because at the end of p, a value may be
|
|
// live but only used by some other successor of p.
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
v := s.regs[r].v
|
|
if v != nil && !liveSet.contains(v.ID) {
|
|
s.freeReg(r)
|
|
}
|
|
}
|
|
} else {
|
|
// This is the complicated case. We have more than one predecessor,
|
|
// which means we may have Phi ops.
|
|
|
|
// Copy phi ops into new schedule.
|
|
b.Values = append(b.Values, phis...)
|
|
|
|
// Start with the final register state of the primary predecessor
|
|
idx := s.primary[b.ID]
|
|
if idx < 0 {
|
|
f.Fatalf("block with no primary predecessor %s", b)
|
|
}
|
|
p := b.Preds[idx].b
|
|
s.setState(s.endRegs[p.ID])
|
|
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("starting merge block %s with end state of %s:\n", b, p)
|
|
for _, x := range s.endRegs[p.ID] {
|
|
fmt.Printf(" %s: orig:%s cache:%s\n", s.registers[x.r].Name(), x.v, x.c)
|
|
}
|
|
}
|
|
|
|
// Decide on registers for phi ops. Use the registers determined
|
|
// by the primary predecessor if we can.
|
|
// TODO: pick best of (already processed) predecessors?
|
|
// Majority vote? Deepest nesting level?
|
|
phiRegs = phiRegs[:0]
|
|
var phiUsed regMask
|
|
for _, v := range phis {
|
|
if !s.values[v.ID].needReg {
|
|
phiRegs = append(phiRegs, noRegister)
|
|
continue
|
|
}
|
|
a := v.Args[idx]
|
|
// Some instructions target not-allocatable registers.
|
|
// They're not suitable for further (phi-function) allocation.
|
|
m := s.values[a.ID].regs &^ phiUsed & s.allocatable
|
|
if m != 0 {
|
|
r := pickReg(m)
|
|
phiUsed |= regMask(1) << r
|
|
phiRegs = append(phiRegs, r)
|
|
} else {
|
|
phiRegs = append(phiRegs, noRegister)
|
|
}
|
|
}
|
|
|
|
// Second pass - deallocate any phi inputs which are now dead.
|
|
for i, v := range phis {
|
|
if !s.values[v.ID].needReg {
|
|
continue
|
|
}
|
|
a := v.Args[idx]
|
|
if !liveSet.contains(a.ID) {
|
|
// Input is dead beyond the phi, deallocate
|
|
// anywhere else it might live.
|
|
s.freeRegs(s.values[a.ID].regs)
|
|
} else {
|
|
// Input is still live.
|
|
// Try to move it around before kicking out, if there is a free register.
|
|
// We generate a Copy in the predecessor block and record it. It will be
|
|
// deleted if never used.
|
|
r := phiRegs[i]
|
|
if r == noRegister {
|
|
continue
|
|
}
|
|
// Pick a free register. At this point some registers used in the predecessor
|
|
// block may have been deallocated. Those are the ones used for Phis. Exclude
|
|
// them (and they are not going to be helpful anyway).
|
|
m := s.compatRegs(a.Type) &^ s.used &^ phiUsed
|
|
if m != 0 && !s.values[a.ID].rematerializeable && countRegs(s.values[a.ID].regs) == 1 {
|
|
r2 := pickReg(m)
|
|
c := p.NewValue1(a.Line, OpCopy, a.Type, s.regs[r].c)
|
|
s.copies[c] = false
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("copy %s to %s : %s\n", a, c, s.registers[r2].Name())
|
|
}
|
|
s.setOrig(c, a)
|
|
s.assignReg(r2, a, c)
|
|
s.endRegs[p.ID] = append(s.endRegs[p.ID], endReg{r2, a, c})
|
|
}
|
|
s.freeReg(r)
|
|
}
|
|
}
|
|
|
|
// Third pass - pick registers for phis whose inputs
|
|
// were not in a register.
|
|
for i, v := range phis {
|
|
if !s.values[v.ID].needReg {
|
|
continue
|
|
}
|
|
if phiRegs[i] != noRegister {
|
|
continue
|
|
}
|
|
if s.f.Config.use387 && v.Type.IsFloat() {
|
|
continue // 387 can't handle floats in registers between blocks
|
|
}
|
|
m := s.compatRegs(v.Type) &^ phiUsed &^ s.used
|
|
if m != 0 {
|
|
r := pickReg(m)
|
|
phiRegs[i] = r
|
|
phiUsed |= regMask(1) << r
|
|
}
|
|
}
|
|
|
|
// Set registers for phis. Add phi spill code.
|
|
for i, v := range phis {
|
|
if !s.values[v.ID].needReg {
|
|
continue
|
|
}
|
|
r := phiRegs[i]
|
|
if r == noRegister {
|
|
// stack-based phi
|
|
// Spills will be inserted in all the predecessors below.
|
|
s.values[v.ID].spill = v // v starts life spilled
|
|
s.values[v.ID].spillUsed = true // use is guaranteed
|
|
continue
|
|
}
|
|
// register-based phi
|
|
s.assignReg(r, v, v)
|
|
// Spill the phi in case we need to restore it later.
|
|
spill := b.NewValue1(v.Line, OpStoreReg, v.Type, v)
|
|
s.setOrig(spill, v)
|
|
s.values[v.ID].spill = spill
|
|
s.values[v.ID].spillUsed = false
|
|
if loop != nil {
|
|
loop.spills = append(loop.spills, v)
|
|
nSpillsInner++
|
|
}
|
|
nSpills++
|
|
}
|
|
|
|
// Save the starting state for use by merge edges.
|
|
var regList []startReg
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
v := s.regs[r].v
|
|
if v == nil {
|
|
continue
|
|
}
|
|
if phiUsed>>r&1 != 0 {
|
|
// Skip registers that phis used, we'll handle those
|
|
// specially during merge edge processing.
|
|
continue
|
|
}
|
|
regList = append(regList, startReg{r, v.ID, s.values[v.ID].uses.line})
|
|
}
|
|
s.startRegs[b.ID] = regList
|
|
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("after phis\n")
|
|
for _, x := range s.startRegs[b.ID] {
|
|
fmt.Printf(" %s: v%d\n", s.registers[x.r].Name(), x.vid)
|
|
}
|
|
}
|
|
}
|
|
|
|
// Allocate space to record the desired registers for each value.
|
|
dinfo = dinfo[:0]
|
|
for i := 0; i < len(oldSched); i++ {
|
|
dinfo = append(dinfo, dentry{})
|
|
}
|
|
|
|
// Load static desired register info at the end of the block.
|
|
desired.copy(&s.desired[b.ID])
|
|
|
|
// Check actual assigned registers at the start of the next block(s).
|
|
// Dynamically assigned registers will trump the static
|
|
// desired registers computed during liveness analysis.
|
|
// Note that we do this phase after startRegs is set above, so that
|
|
// we get the right behavior for a block which branches to itself.
|
|
for _, e := range b.Succs {
|
|
succ := e.b
|
|
// TODO: prioritize likely successor?
|
|
for _, x := range s.startRegs[succ.ID] {
|
|
desired.add(x.vid, x.r)
|
|
}
|
|
// Process phi ops in succ.
|
|
pidx := e.i
|
|
for _, v := range succ.Values {
|
|
if v.Op != OpPhi {
|
|
break
|
|
}
|
|
if !s.values[v.ID].needReg {
|
|
continue
|
|
}
|
|
rp, ok := s.f.getHome(v.ID).(*Register)
|
|
if !ok {
|
|
continue
|
|
}
|
|
desired.add(v.Args[pidx].ID, register(rp.num))
|
|
}
|
|
}
|
|
// Walk values backwards computing desired register info.
|
|
// See computeLive for more comments.
|
|
for i := len(oldSched) - 1; i >= 0; i-- {
|
|
v := oldSched[i]
|
|
prefs := desired.remove(v.ID)
|
|
desired.clobber(opcodeTable[v.Op].reg.clobbers)
|
|
for _, j := range opcodeTable[v.Op].reg.inputs {
|
|
if countRegs(j.regs) != 1 {
|
|
continue
|
|
}
|
|
desired.clobber(j.regs)
|
|
desired.add(v.Args[j.idx].ID, pickReg(j.regs))
|
|
}
|
|
if opcodeTable[v.Op].resultInArg0 {
|
|
if opcodeTable[v.Op].commutative {
|
|
desired.addList(v.Args[1].ID, prefs)
|
|
}
|
|
desired.addList(v.Args[0].ID, prefs)
|
|
}
|
|
// Save desired registers for this value.
|
|
dinfo[i].out = prefs
|
|
for j, a := range v.Args {
|
|
if j >= len(dinfo[i].in) {
|
|
break
|
|
}
|
|
dinfo[i].in[j] = desired.get(a.ID)
|
|
}
|
|
}
|
|
|
|
// Process all the non-phi values.
|
|
for idx, v := range oldSched {
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf(" processing %s\n", v.LongString())
|
|
}
|
|
regspec := opcodeTable[v.Op].reg
|
|
if v.Op == OpPhi {
|
|
f.Fatalf("phi %s not at start of block", v)
|
|
}
|
|
if v.Op == OpSP {
|
|
s.assignReg(s.SPReg, v, v)
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
continue
|
|
}
|
|
if v.Op == OpSB {
|
|
s.assignReg(s.SBReg, v, v)
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
continue
|
|
}
|
|
if v.Op == OpSelect0 || v.Op == OpSelect1 {
|
|
if s.values[v.ID].needReg {
|
|
var i = 0
|
|
if v.Op == OpSelect1 {
|
|
i = 1
|
|
}
|
|
s.assignReg(register(s.f.getHome(v.Args[0].ID).(LocPair)[i].(*Register).num), v, v)
|
|
}
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
goto issueSpill
|
|
}
|
|
if v.Op == OpGetG && s.f.Config.hasGReg {
|
|
// use hardware g register
|
|
if s.regs[s.GReg].v != nil {
|
|
s.freeReg(s.GReg) // kick out the old value
|
|
}
|
|
s.assignReg(s.GReg, v, v)
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
goto issueSpill
|
|
}
|
|
if v.Op == OpArg {
|
|
// Args are "pre-spilled" values. We don't allocate
|
|
// any register here. We just set up the spill pointer to
|
|
// point at itself and any later user will restore it to use it.
|
|
s.values[v.ID].spill = v
|
|
s.values[v.ID].spillUsed = true // use is guaranteed
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
continue
|
|
}
|
|
if v.Op == OpKeepAlive {
|
|
// Make sure the argument to v is still live here.
|
|
s.advanceUses(v)
|
|
vi := &s.values[v.Args[0].ID]
|
|
if vi.spillUsed {
|
|
// Use the spill location.
|
|
v.SetArg(0, vi.spill)
|
|
} else {
|
|
// No need to keep unspilled values live.
|
|
// These are typically rematerializeable constants like nil,
|
|
// or values of a variable that were modified since the last call.
|
|
v.Op = OpCopy
|
|
v.SetArgs1(v.Args[1])
|
|
}
|
|
b.Values = append(b.Values, v)
|
|
continue
|
|
}
|
|
if len(regspec.inputs) == 0 && len(regspec.outputs) == 0 {
|
|
// No register allocation required (or none specified yet)
|
|
s.freeRegs(regspec.clobbers)
|
|
b.Values = append(b.Values, v)
|
|
s.advanceUses(v)
|
|
continue
|
|
}
|
|
|
|
if s.values[v.ID].rematerializeable {
|
|
// Value is rematerializeable, don't issue it here.
|
|
// It will get issued just before each use (see
|
|
// allocValueToReg).
|
|
for _, a := range v.Args {
|
|
a.Uses--
|
|
}
|
|
s.advanceUses(v)
|
|
continue
|
|
}
|
|
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("value %s\n", v.LongString())
|
|
fmt.Printf(" out:")
|
|
for _, r := range dinfo[idx].out {
|
|
if r != noRegister {
|
|
fmt.Printf(" %s", s.registers[r].Name())
|
|
}
|
|
}
|
|
fmt.Println()
|
|
for i := 0; i < len(v.Args) && i < 3; i++ {
|
|
fmt.Printf(" in%d:", i)
|
|
for _, r := range dinfo[idx].in[i] {
|
|
if r != noRegister {
|
|
fmt.Printf(" %s", s.registers[r].Name())
|
|
}
|
|
}
|
|
fmt.Println()
|
|
}
|
|
}
|
|
|
|
// Move arguments to registers. Process in an ordering defined
|
|
// by the register specification (most constrained first).
|
|
args = append(args[:0], v.Args...)
|
|
for _, i := range regspec.inputs {
|
|
mask := i.regs
|
|
if mask&s.values[args[i.idx].ID].regs == 0 {
|
|
// Need a new register for the input.
|
|
mask &= s.allocatable
|
|
mask &^= s.nospill
|
|
// Used desired register if available.
|
|
if i.idx < 3 {
|
|
for _, r := range dinfo[idx].in[i.idx] {
|
|
if r != noRegister && (mask&^s.used)>>r&1 != 0 {
|
|
// Desired register is allowed and unused.
|
|
mask = regMask(1) << r
|
|
break
|
|
}
|
|
}
|
|
}
|
|
// Avoid registers we're saving for other values.
|
|
if mask&^desired.avoid != 0 {
|
|
mask &^= desired.avoid
|
|
}
|
|
}
|
|
args[i.idx] = s.allocValToReg(args[i.idx], mask, true, v.Line)
|
|
}
|
|
|
|
// If the output clobbers the input register, make sure we have
|
|
// at least two copies of the input register so we don't
|
|
// have to reload the value from the spill location.
|
|
if opcodeTable[v.Op].resultInArg0 {
|
|
var m regMask
|
|
if !s.liveAfterCurrentInstruction(v.Args[0]) {
|
|
// arg0 is dead. We can clobber its register.
|
|
goto ok
|
|
}
|
|
if s.values[v.Args[0].ID].rematerializeable {
|
|
// We can rematerialize the input, don't worry about clobbering it.
|
|
goto ok
|
|
}
|
|
if countRegs(s.values[v.Args[0].ID].regs) >= 2 {
|
|
// we have at least 2 copies of arg0. We can afford to clobber one.
|
|
goto ok
|
|
}
|
|
if opcodeTable[v.Op].commutative {
|
|
if !s.liveAfterCurrentInstruction(v.Args[1]) {
|
|
args[0], args[1] = args[1], args[0]
|
|
goto ok
|
|
}
|
|
if s.values[v.Args[1].ID].rematerializeable {
|
|
args[0], args[1] = args[1], args[0]
|
|
goto ok
|
|
}
|
|
if countRegs(s.values[v.Args[1].ID].regs) >= 2 {
|
|
args[0], args[1] = args[1], args[0]
|
|
goto ok
|
|
}
|
|
}
|
|
|
|
// We can't overwrite arg0 (or arg1, if commutative). So we
|
|
// need to make a copy of an input so we have a register we can modify.
|
|
|
|
// Possible new registers to copy into.
|
|
m = s.compatRegs(v.Args[0].Type) &^ s.used
|
|
if m == 0 {
|
|
// No free registers. In this case we'll just clobber
|
|
// an input and future uses of that input must use a restore.
|
|
// TODO(khr): We should really do this like allocReg does it,
|
|
// spilling the value with the most distant next use.
|
|
goto ok
|
|
}
|
|
|
|
// Try to move an input to the desired output.
|
|
for _, r := range dinfo[idx].out {
|
|
if r != noRegister && m>>r&1 != 0 {
|
|
m = regMask(1) << r
|
|
args[0] = s.allocValToReg(v.Args[0], m, true, v.Line)
|
|
// Note: we update args[0] so the instruction will
|
|
// use the register copy we just made.
|
|
goto ok
|
|
}
|
|
}
|
|
// Try to copy input to its desired location & use its old
|
|
// location as the result register.
|
|
for _, r := range dinfo[idx].in[0] {
|
|
if r != noRegister && m>>r&1 != 0 {
|
|
m = regMask(1) << r
|
|
c := s.allocValToReg(v.Args[0], m, true, v.Line)
|
|
s.copies[c] = false
|
|
// Note: no update to args[0] so the instruction will
|
|
// use the original copy.
|
|
goto ok
|
|
}
|
|
}
|
|
if opcodeTable[v.Op].commutative {
|
|
for _, r := range dinfo[idx].in[1] {
|
|
if r != noRegister && m>>r&1 != 0 {
|
|
m = regMask(1) << r
|
|
c := s.allocValToReg(v.Args[1], m, true, v.Line)
|
|
s.copies[c] = false
|
|
args[0], args[1] = args[1], args[0]
|
|
goto ok
|
|
}
|
|
}
|
|
}
|
|
// Avoid future fixed uses if we can.
|
|
if m&^desired.avoid != 0 {
|
|
m &^= desired.avoid
|
|
}
|
|
// Save input 0 to a new register so we can clobber it.
|
|
c := s.allocValToReg(v.Args[0], m, true, v.Line)
|
|
s.copies[c] = false
|
|
}
|
|
|
|
ok:
|
|
// Now that all args are in regs, we're ready to issue the value itself.
|
|
// Before we pick a register for the output value, allow input registers
|
|
// to be deallocated. We do this here so that the output can use the
|
|
// same register as a dying input.
|
|
if !opcodeTable[v.Op].resultNotInArgs {
|
|
s.tmpused = s.nospill
|
|
s.nospill = 0
|
|
s.advanceUses(v) // frees any registers holding args that are no longer live
|
|
}
|
|
|
|
// Dump any registers which will be clobbered
|
|
s.freeRegs(regspec.clobbers)
|
|
s.tmpused |= regspec.clobbers
|
|
|
|
// Pick registers for outputs.
|
|
{
|
|
outRegs := [2]register{noRegister, noRegister}
|
|
var used regMask
|
|
for _, out := range regspec.outputs {
|
|
mask := out.regs & s.allocatable &^ used
|
|
if mask == 0 {
|
|
continue
|
|
}
|
|
if opcodeTable[v.Op].resultInArg0 && out.idx == 0 {
|
|
if !opcodeTable[v.Op].commutative {
|
|
// Output must use the same register as input 0.
|
|
r := register(s.f.getHome(args[0].ID).(*Register).num)
|
|
mask = regMask(1) << r
|
|
} else {
|
|
// Output must use the same register as input 0 or 1.
|
|
r0 := register(s.f.getHome(args[0].ID).(*Register).num)
|
|
r1 := register(s.f.getHome(args[1].ID).(*Register).num)
|
|
// Check r0 and r1 for desired output register.
|
|
found := false
|
|
for _, r := range dinfo[idx].out {
|
|
if (r == r0 || r == r1) && (mask&^s.used)>>r&1 != 0 {
|
|
mask = regMask(1) << r
|
|
found = true
|
|
if r == r1 {
|
|
args[0], args[1] = args[1], args[0]
|
|
}
|
|
break
|
|
}
|
|
}
|
|
if !found {
|
|
// Neither are desired, pick r0.
|
|
mask = regMask(1) << r0
|
|
}
|
|
}
|
|
}
|
|
for _, r := range dinfo[idx].out {
|
|
if r != noRegister && (mask&^s.used)>>r&1 != 0 {
|
|
// Desired register is allowed and unused.
|
|
mask = regMask(1) << r
|
|
break
|
|
}
|
|
}
|
|
// Avoid registers we're saving for other values.
|
|
if mask&^desired.avoid != 0 {
|
|
mask &^= desired.avoid
|
|
}
|
|
r := s.allocReg(mask, v)
|
|
outRegs[out.idx] = r
|
|
used |= regMask(1) << r
|
|
s.tmpused |= regMask(1) << r
|
|
}
|
|
// Record register choices
|
|
if v.Type.IsTuple() {
|
|
var outLocs LocPair
|
|
if r := outRegs[0]; r != noRegister {
|
|
outLocs[0] = &s.registers[r]
|
|
}
|
|
if r := outRegs[1]; r != noRegister {
|
|
outLocs[1] = &s.registers[r]
|
|
}
|
|
s.f.setHome(v, outLocs)
|
|
// Note that subsequent SelectX instructions will do the assignReg calls.
|
|
} else {
|
|
if r := outRegs[0]; r != noRegister {
|
|
s.assignReg(r, v, v)
|
|
}
|
|
}
|
|
}
|
|
|
|
// deallocate dead args, if we have not done so
|
|
if opcodeTable[v.Op].resultNotInArgs {
|
|
s.nospill = 0
|
|
s.advanceUses(v) // frees any registers holding args that are no longer live
|
|
}
|
|
s.tmpused = 0
|
|
|
|
// Issue the Value itself.
|
|
for i, a := range args {
|
|
v.SetArg(i, a) // use register version of arguments
|
|
}
|
|
b.Values = append(b.Values, v)
|
|
|
|
// Issue a spill for this value. We issue spills unconditionally,
|
|
// then at the end of regalloc delete the ones we never use.
|
|
// TODO: schedule the spill at a point that dominates all restores.
|
|
// The restore may be off in an unlikely branch somewhere and it
|
|
// would be better to have the spill in that unlikely branch as well.
|
|
// v := ...
|
|
// if unlikely {
|
|
// f()
|
|
// }
|
|
// It would be good to have both spill and restore inside the IF.
|
|
issueSpill:
|
|
if s.values[v.ID].needReg {
|
|
spill := b.NewValue1(v.Line, OpStoreReg, v.Type, v)
|
|
s.setOrig(spill, v)
|
|
s.values[v.ID].spill = spill
|
|
s.values[v.ID].spillUsed = false
|
|
if loop != nil {
|
|
loop.spills = append(loop.spills, v)
|
|
nSpillsInner++
|
|
}
|
|
nSpills++
|
|
}
|
|
}
|
|
|
|
// Load control value into reg.
|
|
if v := b.Control; v != nil && s.values[v.ID].needReg {
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf(" processing control %s\n", v.LongString())
|
|
}
|
|
// We assume that a control input can be passed in any
|
|
// type-compatible register. If this turns out not to be true,
|
|
// we'll need to introduce a regspec for a block's control value.
|
|
b.Control = s.allocValToReg(v, s.compatRegs(v.Type), false, b.Line)
|
|
if b.Control != v {
|
|
v.Uses--
|
|
b.Control.Uses++
|
|
}
|
|
// Remove this use from the uses list.
|
|
vi := &s.values[v.ID]
|
|
u := vi.uses
|
|
vi.uses = u.next
|
|
if u.next == nil {
|
|
s.freeRegs(vi.regs) // value is dead
|
|
}
|
|
u.next = s.freeUseRecords
|
|
s.freeUseRecords = u
|
|
}
|
|
|
|
// Spill any values that can't live across basic block boundaries.
|
|
if s.f.Config.use387 {
|
|
s.freeRegs(s.f.Config.fpRegMask)
|
|
}
|
|
|
|
// If we are approaching a merge point and we are the primary
|
|
// predecessor of it, find live values that we use soon after
|
|
// the merge point and promote them to registers now.
|
|
if len(b.Succs) == 1 {
|
|
// For this to be worthwhile, the loop must have no calls in it.
|
|
top := b.Succs[0].b
|
|
loop := s.loopnest.b2l[top.ID]
|
|
if loop == nil || loop.header != top || loop.containsCall {
|
|
goto badloop
|
|
}
|
|
|
|
// TODO: sort by distance, pick the closest ones?
|
|
for _, live := range s.live[b.ID] {
|
|
if live.dist >= unlikelyDistance {
|
|
// Don't preload anything live after the loop.
|
|
continue
|
|
}
|
|
vid := live.ID
|
|
vi := &s.values[vid]
|
|
if vi.regs != 0 {
|
|
continue
|
|
}
|
|
if vi.rematerializeable {
|
|
continue
|
|
}
|
|
v := s.orig[vid]
|
|
if s.f.Config.use387 && v.Type.IsFloat() {
|
|
continue // 387 can't handle floats in registers between blocks
|
|
}
|
|
m := s.compatRegs(v.Type) &^ s.used
|
|
if m&^desired.avoid != 0 {
|
|
m &^= desired.avoid
|
|
}
|
|
if m != 0 {
|
|
s.allocValToReg(v, m, false, b.Line)
|
|
}
|
|
}
|
|
}
|
|
badloop:
|
|
;
|
|
|
|
// Save end-of-block register state.
|
|
// First count how many, this cuts allocations in half.
|
|
k := 0
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
v := s.regs[r].v
|
|
if v == nil {
|
|
continue
|
|
}
|
|
k++
|
|
}
|
|
regList := make([]endReg, 0, k)
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
v := s.regs[r].v
|
|
if v == nil {
|
|
continue
|
|
}
|
|
regList = append(regList, endReg{r, v, s.regs[r].c})
|
|
}
|
|
s.endRegs[b.ID] = regList
|
|
|
|
if checkEnabled {
|
|
liveSet.clear()
|
|
for _, x := range s.live[b.ID] {
|
|
liveSet.add(x.ID)
|
|
}
|
|
for r := register(0); r < s.numRegs; r++ {
|
|
v := s.regs[r].v
|
|
if v == nil {
|
|
continue
|
|
}
|
|
if !liveSet.contains(v.ID) {
|
|
s.f.Fatalf("val %s is in reg but not live at end of %s", v, b)
|
|
}
|
|
}
|
|
}
|
|
|
|
// If a value is live at the end of the block and
|
|
// isn't in a register, remember that its spill location
|
|
// is live. We need to remember this information so that
|
|
// the liveness analysis in stackalloc is correct.
|
|
for _, e := range s.live[b.ID] {
|
|
if s.values[e.ID].regs != 0 {
|
|
// in a register, we'll use that source for the merge.
|
|
continue
|
|
}
|
|
spill := s.values[e.ID].spill
|
|
if spill == nil {
|
|
// rematerializeable values will have spill==nil.
|
|
continue
|
|
}
|
|
s.spillLive[b.ID] = append(s.spillLive[b.ID], spill.ID)
|
|
s.values[e.ID].spillUsed = true
|
|
}
|
|
|
|
// Keep track of values that are spilled in the loop, but whose spill
|
|
// is not used in the loop. It may be possible to move ("sink") the
|
|
// spill out of the loop into one or more exit blocks.
|
|
if loop != nil {
|
|
loop.scratch++ // increment count of blocks in this loop that have been processed
|
|
if loop.scratch == loop.nBlocks { // just processed last block of loop, if it is an inner loop.
|
|
// This check is redundant with code at the top of the loop.
|
|
// This is definitive; the one at the top of the loop is an optimization.
|
|
if loop.isInner && // Common case, easier, most likely to be profitable
|
|
!loop.containsCall && // Calls force spills, also lead to puzzling spill info.
|
|
len(loop.exits) <= 32 { // Almost no inner loops have more than 32 exits,
|
|
// and this allows use of a bitvector and a sparseMap.
|
|
|
|
// TODO: exit calculation is messed up for non-inner loops
|
|
// because of multilevel exits that are not part of the "exit"
|
|
// count.
|
|
|
|
// Compute the set of spill-movement candidates live at entry to exit blocks.
|
|
// isLoopSpillCandidate filters for
|
|
// (1) defined in appropriate loop
|
|
// (2) needs a register
|
|
// (3) spill not already used (in the loop)
|
|
// Condition (3) === "in a register at all loop exits"
|
|
|
|
entryCandidates.clear()
|
|
|
|
for whichExit, ss := range loop.exits {
|
|
// Start with live at end.
|
|
for _, li := range s.live[ss.ID] {
|
|
if s.isLoopSpillCandidate(loop, s.orig[li.ID]) {
|
|
// s.live contains original IDs, use s.orig above to map back to *Value
|
|
entryCandidates.setBit(li.ID, uint(whichExit))
|
|
}
|
|
}
|
|
// Control can also be live.
|
|
if ss.Control != nil && s.orig[ss.Control.ID] != nil && s.isLoopSpillCandidate(loop, s.orig[ss.Control.ID]) {
|
|
entryCandidates.setBit(s.orig[ss.Control.ID].ID, uint(whichExit))
|
|
}
|
|
// Walk backwards, filling in locally live values, removing those defined.
|
|
for i := len(ss.Values) - 1; i >= 0; i-- {
|
|
v := ss.Values[i]
|
|
vorig := s.orig[v.ID]
|
|
if vorig != nil {
|
|
entryCandidates.remove(vorig.ID) // Cannot be an issue, only keeps the sets smaller.
|
|
}
|
|
for _, a := range v.Args {
|
|
aorig := s.orig[a.ID]
|
|
if aorig != nil && s.isLoopSpillCandidate(loop, aorig) {
|
|
entryCandidates.setBit(aorig.ID, uint(whichExit))
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
for _, e := range loop.spills {
|
|
whichblocks := entryCandidates.get(e.ID)
|
|
oldSpill := s.values[e.ID].spill
|
|
if whichblocks != 0 && whichblocks != -1 { // -1 = not in map.
|
|
toSink = append(toSink, spillToSink{spill: oldSpill, dests: whichblocks})
|
|
}
|
|
}
|
|
|
|
} // loop is inner etc
|
|
loop.scratch = 0 // Don't leave a mess, just in case.
|
|
loop.spills = nil
|
|
} // if scratch == nBlocks
|
|
} // if loop is not nil
|
|
|
|
// Clear any final uses.
|
|
// All that is left should be the pseudo-uses added for values which
|
|
// are live at the end of b.
|
|
for _, e := range s.live[b.ID] {
|
|
u := s.values[e.ID].uses
|
|
if u == nil {
|
|
f.Fatalf("live at end, no uses v%d", e.ID)
|
|
}
|
|
if u.next != nil {
|
|
f.Fatalf("live at end, too many uses v%d", e.ID)
|
|
}
|
|
s.values[e.ID].uses = nil
|
|
u.next = s.freeUseRecords
|
|
s.freeUseRecords = u
|
|
}
|
|
}
|
|
|
|
// Erase any spills we never used
|
|
for i := range s.values {
|
|
vi := s.values[i]
|
|
if vi.spillUsed {
|
|
if s.f.pass.debug > logSpills && vi.spill.Op != OpArg {
|
|
s.f.Config.Warnl(vi.spill.Line, "spilled value at %v remains", vi.spill)
|
|
}
|
|
continue
|
|
}
|
|
spill := vi.spill
|
|
if spill == nil {
|
|
// Constants, SP, SB, ...
|
|
continue
|
|
}
|
|
loop := s.loopForBlock(spill.Block)
|
|
if loop != nil {
|
|
nSpillsInner--
|
|
}
|
|
|
|
spill.Args[0].Uses--
|
|
f.freeValue(spill)
|
|
nSpills--
|
|
}
|
|
|
|
for _, b := range f.Blocks {
|
|
i := 0
|
|
for _, v := range b.Values {
|
|
if v.Op == OpInvalid {
|
|
continue
|
|
}
|
|
b.Values[i] = v
|
|
i++
|
|
}
|
|
b.Values = b.Values[:i]
|
|
// TODO: zero b.Values[i:], recycle Values
|
|
// Not important now because this is the last phase that manipulates Values
|
|
}
|
|
|
|
// Must clear these out before any potential recycling, though that's
|
|
// not currently implemented.
|
|
for i, ts := range toSink {
|
|
vsp := ts.spill
|
|
if vsp.Op == OpInvalid { // This spill was completely eliminated
|
|
toSink[i].spill = nil
|
|
}
|
|
}
|
|
|
|
// Anything that didn't get a register gets a stack location here.
|
|
// (StoreReg, stack-based phis, inputs, ...)
|
|
stacklive := stackalloc(s.f, s.spillLive)
|
|
|
|
// Fix up all merge edges.
|
|
s.shuffle(stacklive)
|
|
|
|
// Insert moved spills (that have not been marked invalid above)
|
|
// at start of appropriate block and remove the originals from their
|
|
// location within loops. Notice that this can break SSA form;
|
|
// if a spill is sunk to multiple exits, there will be no phi for that
|
|
// spill at a join point downstream of those two exits, though the
|
|
// two spills will target the same stack slot. Notice also that this
|
|
// takes place after stack allocation, so the stack allocator does
|
|
// not need to process these malformed flow graphs.
|
|
sinking:
|
|
for _, ts := range toSink {
|
|
vsp := ts.spill
|
|
if vsp == nil { // This spill was completely eliminated
|
|
nSpillsSunkUnused++
|
|
continue sinking
|
|
}
|
|
e := ts.spilledValue()
|
|
if s.values[e.ID].spillUsedShuffle {
|
|
nSpillsNotSunkLateUse++
|
|
continue sinking
|
|
}
|
|
|
|
// move spills to a better (outside of loop) block.
|
|
// This would be costly if it occurred very often, but it doesn't.
|
|
b := vsp.Block
|
|
loop := s.loopnest.b2l[b.ID]
|
|
dests := ts.dests
|
|
|
|
// Pre-check to be sure that spilled value is still in expected register on all exits where live.
|
|
check_val_still_in_reg:
|
|
for i := uint(0); i < 32 && dests != 0; i++ {
|
|
|
|
if dests&(1<<i) == 0 {
|
|
continue
|
|
}
|
|
dests ^= 1 << i
|
|
d := loop.exits[i]
|
|
if len(d.Preds) > 1 {
|
|
panic("Should be impossible given critical edges removed")
|
|
}
|
|
p := d.Preds[0].b // block in loop exiting to d.
|
|
|
|
endregs := s.endRegs[p.ID]
|
|
for _, regrec := range endregs {
|
|
if regrec.v == e && regrec.r != noRegister && regrec.c == e { // TODO: regrec.c != e implies different spill possible.
|
|
continue check_val_still_in_reg
|
|
}
|
|
}
|
|
// If here, the register assignment was lost down at least one exit and it can't be sunk
|
|
if s.f.pass.debug > moveSpills {
|
|
s.f.Config.Warnl(e.Line, "lost register assignment for spill %v in %v at exit %v to %v",
|
|
vsp, b, p, d)
|
|
}
|
|
nSpillsChanged++
|
|
continue sinking
|
|
}
|
|
|
|
nSpillsSunk++
|
|
nSpillsInner--
|
|
// don't update nSpills, since spill is only moved, and if it is duplicated, the spills-on-a-path is not increased.
|
|
|
|
dests = ts.dests
|
|
|
|
// remove vsp from b.Values
|
|
i := 0
|
|
for _, w := range b.Values {
|
|
if vsp == w {
|
|
continue
|
|
}
|
|
b.Values[i] = w
|
|
i++
|
|
}
|
|
b.Values = b.Values[:i]
|
|
|
|
first := true
|
|
for i := uint(0); i < 32 && dests != 0; i++ {
|
|
|
|
if dests&(1<<i) == 0 {
|
|
continue
|
|
}
|
|
|
|
dests ^= 1 << i
|
|
|
|
d := loop.exits[i]
|
|
vspnew := vsp // reuse original for first sunk spill, saves tracking down and renaming uses
|
|
if !first { // any sunk spills after first must make a copy
|
|
vspnew = d.NewValue1(e.Line, OpStoreReg, e.Type, e)
|
|
f.setHome(vspnew, f.getHome(vsp.ID)) // copy stack home
|
|
if s.f.pass.debug > moveSpills {
|
|
s.f.Config.Warnl(e.Line, "copied spill %v in %v for %v to %v in %v",
|
|
vsp, b, e, vspnew, d)
|
|
}
|
|
} else {
|
|
first = false
|
|
vspnew.Block = d
|
|
d.Values = append(d.Values, vspnew)
|
|
if s.f.pass.debug > moveSpills {
|
|
s.f.Config.Warnl(e.Line, "moved spill %v in %v for %v to %v in %v",
|
|
vsp, b, e, vspnew, d)
|
|
}
|
|
}
|
|
|
|
// shuffle vspnew to the beginning of its block
|
|
copy(d.Values[1:], d.Values[0:len(d.Values)-1])
|
|
d.Values[0] = vspnew
|
|
|
|
}
|
|
}
|
|
|
|
// Erase any copies we never used.
|
|
// Also, an unused copy might be the only use of another copy,
|
|
// so continue erasing until we reach a fixed point.
|
|
for {
|
|
progress := false
|
|
for c, used := range s.copies {
|
|
if !used && c.Uses == 0 {
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("delete copied value %s\n", c.LongString())
|
|
}
|
|
c.Args[0].Uses--
|
|
f.freeValue(c)
|
|
delete(s.copies, c)
|
|
progress = true
|
|
}
|
|
}
|
|
if !progress {
|
|
break
|
|
}
|
|
}
|
|
|
|
for _, b := range f.Blocks {
|
|
i := 0
|
|
for _, v := range b.Values {
|
|
if v.Op == OpInvalid {
|
|
continue
|
|
}
|
|
b.Values[i] = v
|
|
i++
|
|
}
|
|
b.Values = b.Values[:i]
|
|
}
|
|
|
|
if f.pass.stats > 0 {
|
|
f.LogStat("spills_info",
|
|
nSpills, "spills", nSpillsInner, "inner_spills_remaining", nSpillsSunk, "inner_spills_sunk", nSpillsSunkUnused, "inner_spills_unused", nSpillsNotSunkLateUse, "inner_spills_shuffled", nSpillsChanged, "inner_spills_changed")
|
|
}
|
|
}
|
|
|
|
// isLoopSpillCandidate indicates whether the spill for v satisfies preliminary
|
|
// spill-sinking conditions just after the last block of loop has been processed.
|
|
// In particular:
|
|
// v needs a register.
|
|
// v's spill is not (YET) used.
|
|
// v's definition is within loop.
|
|
// The spill may be used in the future, either by an outright use
|
|
// in the code, or by shuffling code inserted after stack allocation.
|
|
// Outright uses cause sinking; shuffling (within the loop) inhibits it.
|
|
func (s *regAllocState) isLoopSpillCandidate(loop *loop, v *Value) bool {
|
|
return s.values[v.ID].needReg && !s.values[v.ID].spillUsed && s.loopnest.b2l[v.Block.ID] == loop
|
|
}
|
|
|
|
// lateSpillUse notes a late (after stack allocation) use of the spill of value with ID vid.
|
|
// This will inhibit spill sinking.
|
|
func (s *regAllocState) lateSpillUse(vid ID) {
|
|
// TODO investigate why this is necessary.
|
|
// It appears that an outside-the-loop use of
|
|
// an otherwise sinkable spill makes the spill
|
|
// a candidate for shuffling, when it would not
|
|
// otherwise have been the case (spillUsed was not
|
|
// true when isLoopSpillCandidate was called, yet
|
|
// it was shuffled). Such shuffling cuts the amount
|
|
// of spill sinking by more than half (in make.bash)
|
|
s.values[vid].spillUsedShuffle = true
|
|
}
|
|
|
|
// shuffle fixes up all the merge edges (those going into blocks of indegree > 1).
|
|
func (s *regAllocState) shuffle(stacklive [][]ID) {
|
|
var e edgeState
|
|
e.s = s
|
|
e.cache = map[ID][]*Value{}
|
|
e.contents = map[Location]contentRecord{}
|
|
if s.f.pass.debug > regDebug {
|
|
fmt.Printf("shuffle %s\n", s.f.Name)
|
|
fmt.Println(s.f.String())
|
|
}
|
|
|
|
for _, b := range s.f.Blocks {
|
|
if len(b.Preds) <= 1 {
|
|
continue
|
|
}
|
|
e.b = b
|
|
for i, edge := range b.Preds {
|
|
p := edge.b
|
|
e.p = p
|
|
e.setup(i, s.endRegs[p.ID], s.startRegs[b.ID], stacklive[p.ID])
|
|
e.process()
|
|
}
|
|
}
|
|
}
|
|
|
|
type edgeState struct {
|
|
s *regAllocState
|
|
p, b *Block // edge goes from p->b.
|
|
|
|
// for each pre-regalloc value, a list of equivalent cached values
|
|
cache map[ID][]*Value
|
|
cachedVals []ID // (superset of) keys of the above map, for deterministic iteration
|
|
|
|
// map from location to the value it contains
|
|
contents map[Location]contentRecord
|
|
|
|
// desired destination locations
|
|
destinations []dstRecord
|
|
extra []dstRecord
|
|
|
|
usedRegs regMask // registers currently holding something
|
|
uniqueRegs regMask // registers holding the only copy of a value
|
|
finalRegs regMask // registers holding final target
|
|
}
|
|
|
|
type contentRecord struct {
|
|
vid ID // pre-regalloc value
|
|
c *Value // cached value
|
|
final bool // this is a satisfied destination
|
|
line int32 // line number of use of the value
|
|
}
|
|
|
|
type dstRecord struct {
|
|
loc Location // register or stack slot
|
|
vid ID // pre-regalloc value it should contain
|
|
splice **Value // place to store reference to the generating instruction
|
|
line int32 // line number of use of this location
|
|
}
|
|
|
|
// setup initializes the edge state for shuffling.
|
|
func (e *edgeState) setup(idx int, srcReg []endReg, dstReg []startReg, stacklive []ID) {
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf("edge %s->%s\n", e.p, e.b)
|
|
}
|
|
|
|
// Clear state.
|
|
for _, vid := range e.cachedVals {
|
|
delete(e.cache, vid)
|
|
}
|
|
e.cachedVals = e.cachedVals[:0]
|
|
for k := range e.contents {
|
|
delete(e.contents, k)
|
|
}
|
|
e.usedRegs = 0
|
|
e.uniqueRegs = 0
|
|
e.finalRegs = 0
|
|
|
|
// Live registers can be sources.
|
|
for _, x := range srcReg {
|
|
e.set(&e.s.registers[x.r], x.v.ID, x.c, false, 0) // don't care the line number of the source
|
|
}
|
|
// So can all of the spill locations.
|
|
for _, spillID := range stacklive {
|
|
v := e.s.orig[spillID]
|
|
spill := e.s.values[v.ID].spill
|
|
e.set(e.s.f.getHome(spillID), v.ID, spill, false, 0) // don't care the line number of the source
|
|
}
|
|
|
|
// Figure out all the destinations we need.
|
|
dsts := e.destinations[:0]
|
|
for _, x := range dstReg {
|
|
dsts = append(dsts, dstRecord{&e.s.registers[x.r], x.vid, nil, x.line})
|
|
}
|
|
// Phis need their args to end up in a specific location.
|
|
for _, v := range e.b.Values {
|
|
if v.Op != OpPhi {
|
|
break
|
|
}
|
|
loc := e.s.f.getHome(v.ID)
|
|
if loc == nil {
|
|
continue
|
|
}
|
|
dsts = append(dsts, dstRecord{loc, v.Args[idx].ID, &v.Args[idx], v.Line})
|
|
}
|
|
e.destinations = dsts
|
|
|
|
if e.s.f.pass.debug > regDebug {
|
|
for _, vid := range e.cachedVals {
|
|
a := e.cache[vid]
|
|
for _, c := range a {
|
|
fmt.Printf("src %s: v%d cache=%s\n", e.s.f.getHome(c.ID).Name(), vid, c)
|
|
}
|
|
}
|
|
for _, d := range e.destinations {
|
|
fmt.Printf("dst %s: v%d\n", d.loc.Name(), d.vid)
|
|
}
|
|
}
|
|
}
|
|
|
|
// process generates code to move all the values to the right destination locations.
|
|
func (e *edgeState) process() {
|
|
dsts := e.destinations
|
|
|
|
// Process the destinations until they are all satisfied.
|
|
for len(dsts) > 0 {
|
|
i := 0
|
|
for _, d := range dsts {
|
|
if !e.processDest(d.loc, d.vid, d.splice, d.line) {
|
|
// Failed - save for next iteration.
|
|
dsts[i] = d
|
|
i++
|
|
}
|
|
}
|
|
if i < len(dsts) {
|
|
// Made some progress. Go around again.
|
|
dsts = dsts[:i]
|
|
|
|
// Append any extras destinations we generated.
|
|
dsts = append(dsts, e.extra...)
|
|
e.extra = e.extra[:0]
|
|
continue
|
|
}
|
|
|
|
// We made no progress. That means that any
|
|
// remaining unsatisfied moves are in simple cycles.
|
|
// For example, A -> B -> C -> D -> A.
|
|
// A ----> B
|
|
// ^ |
|
|
// | |
|
|
// | v
|
|
// D <---- C
|
|
|
|
// To break the cycle, we pick an unused register, say R,
|
|
// and put a copy of B there.
|
|
// A ----> B
|
|
// ^ |
|
|
// | |
|
|
// | v
|
|
// D <---- C <---- R=copyofB
|
|
// When we resume the outer loop, the A->B move can now proceed,
|
|
// and eventually the whole cycle completes.
|
|
|
|
// Copy any cycle location to a temp register. This duplicates
|
|
// one of the cycle entries, allowing the just duplicated value
|
|
// to be overwritten and the cycle to proceed.
|
|
d := dsts[0]
|
|
loc := d.loc
|
|
vid := e.contents[loc].vid
|
|
c := e.contents[loc].c
|
|
r := e.findRegFor(c.Type)
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf("breaking cycle with v%d in %s:%s\n", vid, loc.Name(), c)
|
|
}
|
|
if _, isReg := loc.(*Register); isReg {
|
|
c = e.p.NewValue1(d.line, OpCopy, c.Type, c)
|
|
} else {
|
|
e.s.lateSpillUse(vid)
|
|
c = e.p.NewValue1(d.line, OpLoadReg, c.Type, c)
|
|
}
|
|
e.set(r, vid, c, false, d.line)
|
|
}
|
|
}
|
|
|
|
// processDest generates code to put value vid into location loc. Returns true
|
|
// if progress was made.
|
|
func (e *edgeState) processDest(loc Location, vid ID, splice **Value, line int32) bool {
|
|
occupant := e.contents[loc]
|
|
if occupant.vid == vid {
|
|
// Value is already in the correct place.
|
|
e.contents[loc] = contentRecord{vid, occupant.c, true, line}
|
|
if splice != nil {
|
|
(*splice).Uses--
|
|
*splice = occupant.c
|
|
occupant.c.Uses++
|
|
if occupant.c.Op == OpStoreReg {
|
|
e.s.lateSpillUse(vid)
|
|
}
|
|
}
|
|
// Note: if splice==nil then c will appear dead. This is
|
|
// non-SSA formed code, so be careful after this pass not to run
|
|
// deadcode elimination.
|
|
if _, ok := e.s.copies[occupant.c]; ok {
|
|
// The copy at occupant.c was used to avoid spill.
|
|
e.s.copies[occupant.c] = true
|
|
}
|
|
return true
|
|
}
|
|
|
|
// Check if we're allowed to clobber the destination location.
|
|
if len(e.cache[occupant.vid]) == 1 && !e.s.values[occupant.vid].rematerializeable {
|
|
// We can't overwrite the last copy
|
|
// of a value that needs to survive.
|
|
return false
|
|
}
|
|
|
|
// Copy from a source of v, register preferred.
|
|
v := e.s.orig[vid]
|
|
var c *Value
|
|
var src Location
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf("moving v%d to %s\n", vid, loc.Name())
|
|
fmt.Printf("sources of v%d:", vid)
|
|
}
|
|
for _, w := range e.cache[vid] {
|
|
h := e.s.f.getHome(w.ID)
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf(" %s:%s", h.Name(), w)
|
|
}
|
|
_, isreg := h.(*Register)
|
|
if src == nil || isreg {
|
|
c = w
|
|
src = h
|
|
}
|
|
}
|
|
if e.s.f.pass.debug > regDebug {
|
|
if src != nil {
|
|
fmt.Printf(" [use %s]\n", src.Name())
|
|
} else {
|
|
fmt.Printf(" [no source]\n")
|
|
}
|
|
}
|
|
_, dstReg := loc.(*Register)
|
|
var x *Value
|
|
if c == nil {
|
|
if !e.s.values[vid].rematerializeable {
|
|
e.s.f.Fatalf("can't find source for %s->%s: %s\n", e.p, e.b, v.LongString())
|
|
}
|
|
if dstReg {
|
|
x = v.copyInto(e.p)
|
|
} else {
|
|
// Rematerialize into stack slot. Need a free
|
|
// register to accomplish this.
|
|
e.erase(loc) // see pre-clobber comment below
|
|
r := e.findRegFor(v.Type)
|
|
x = v.copyInto(e.p)
|
|
e.set(r, vid, x, false, line)
|
|
// Make sure we spill with the size of the slot, not the
|
|
// size of x (which might be wider due to our dropping
|
|
// of narrowing conversions).
|
|
x = e.p.NewValue1(line, OpStoreReg, loc.(LocalSlot).Type, x)
|
|
}
|
|
} else {
|
|
// Emit move from src to dst.
|
|
_, srcReg := src.(*Register)
|
|
if srcReg {
|
|
if dstReg {
|
|
x = e.p.NewValue1(line, OpCopy, c.Type, c)
|
|
} else {
|
|
x = e.p.NewValue1(line, OpStoreReg, loc.(LocalSlot).Type, c)
|
|
}
|
|
} else {
|
|
if dstReg {
|
|
e.s.lateSpillUse(vid)
|
|
x = e.p.NewValue1(line, OpLoadReg, c.Type, c)
|
|
} else {
|
|
// mem->mem. Use temp register.
|
|
|
|
// Pre-clobber destination. This avoids the
|
|
// following situation:
|
|
// - v is currently held in R0 and stacktmp0.
|
|
// - We want to copy stacktmp1 to stacktmp0.
|
|
// - We choose R0 as the temporary register.
|
|
// During the copy, both R0 and stacktmp0 are
|
|
// clobbered, losing both copies of v. Oops!
|
|
// Erasing the destination early means R0 will not
|
|
// be chosen as the temp register, as it will then
|
|
// be the last copy of v.
|
|
e.erase(loc)
|
|
|
|
r := e.findRegFor(c.Type)
|
|
e.s.lateSpillUse(vid)
|
|
t := e.p.NewValue1(line, OpLoadReg, c.Type, c)
|
|
e.set(r, vid, t, false, line)
|
|
x = e.p.NewValue1(line, OpStoreReg, loc.(LocalSlot).Type, t)
|
|
}
|
|
}
|
|
}
|
|
e.set(loc, vid, x, true, line)
|
|
if splice != nil {
|
|
(*splice).Uses--
|
|
*splice = x
|
|
x.Uses++
|
|
}
|
|
return true
|
|
}
|
|
|
|
// set changes the contents of location loc to hold the given value and its cached representative.
|
|
func (e *edgeState) set(loc Location, vid ID, c *Value, final bool, line int32) {
|
|
e.s.f.setHome(c, loc)
|
|
e.erase(loc)
|
|
e.contents[loc] = contentRecord{vid, c, final, line}
|
|
a := e.cache[vid]
|
|
if len(a) == 0 {
|
|
e.cachedVals = append(e.cachedVals, vid)
|
|
}
|
|
a = append(a, c)
|
|
e.cache[vid] = a
|
|
if r, ok := loc.(*Register); ok {
|
|
e.usedRegs |= regMask(1) << uint(r.num)
|
|
if final {
|
|
e.finalRegs |= regMask(1) << uint(r.num)
|
|
}
|
|
if len(a) == 1 {
|
|
e.uniqueRegs |= regMask(1) << uint(r.num)
|
|
}
|
|
if len(a) == 2 {
|
|
if t, ok := e.s.f.getHome(a[0].ID).(*Register); ok {
|
|
e.uniqueRegs &^= regMask(1) << uint(t.num)
|
|
}
|
|
}
|
|
}
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf("%s\n", c.LongString())
|
|
fmt.Printf("v%d now available in %s:%s\n", vid, loc.Name(), c)
|
|
}
|
|
}
|
|
|
|
// erase removes any user of loc.
|
|
func (e *edgeState) erase(loc Location) {
|
|
cr := e.contents[loc]
|
|
if cr.c == nil {
|
|
return
|
|
}
|
|
vid := cr.vid
|
|
|
|
if cr.final {
|
|
// Add a destination to move this value back into place.
|
|
// Make sure it gets added to the tail of the destination queue
|
|
// so we make progress on other moves first.
|
|
e.extra = append(e.extra, dstRecord{loc, cr.vid, nil, cr.line})
|
|
}
|
|
|
|
// Remove c from the list of cached values.
|
|
a := e.cache[vid]
|
|
for i, c := range a {
|
|
if e.s.f.getHome(c.ID) == loc {
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf("v%d no longer available in %s:%s\n", vid, loc.Name(), c)
|
|
}
|
|
a[i], a = a[len(a)-1], a[:len(a)-1]
|
|
break
|
|
}
|
|
}
|
|
e.cache[vid] = a
|
|
|
|
// Update register masks.
|
|
if r, ok := loc.(*Register); ok {
|
|
e.usedRegs &^= regMask(1) << uint(r.num)
|
|
if cr.final {
|
|
e.finalRegs &^= regMask(1) << uint(r.num)
|
|
}
|
|
}
|
|
if len(a) == 1 {
|
|
if r, ok := e.s.f.getHome(a[0].ID).(*Register); ok {
|
|
e.uniqueRegs |= regMask(1) << uint(r.num)
|
|
}
|
|
}
|
|
}
|
|
|
|
// findRegFor finds a register we can use to make a temp copy of type typ.
|
|
func (e *edgeState) findRegFor(typ Type) Location {
|
|
// Which registers are possibilities.
|
|
var m regMask
|
|
if typ.IsFloat() {
|
|
m = e.s.compatRegs(e.s.f.Config.fe.TypeFloat64())
|
|
} else {
|
|
m = e.s.compatRegs(e.s.f.Config.fe.TypeInt64())
|
|
}
|
|
|
|
// Pick a register. In priority order:
|
|
// 1) an unused register
|
|
// 2) a non-unique register not holding a final value
|
|
// 3) a non-unique register
|
|
x := m &^ e.usedRegs
|
|
if x != 0 {
|
|
return &e.s.registers[pickReg(x)]
|
|
}
|
|
x = m &^ e.uniqueRegs &^ e.finalRegs
|
|
if x != 0 {
|
|
return &e.s.registers[pickReg(x)]
|
|
}
|
|
x = m &^ e.uniqueRegs
|
|
if x != 0 {
|
|
return &e.s.registers[pickReg(x)]
|
|
}
|
|
|
|
// No register is available. Allocate a temp location to spill a register to.
|
|
// The type of the slot is immaterial - it will not be live across
|
|
// any safepoint. Just use a type big enough to hold any register.
|
|
typ = e.s.f.Config.fe.TypeInt64()
|
|
t := LocalSlot{e.s.f.Config.fe.Auto(typ), typ, 0}
|
|
// TODO: reuse these slots.
|
|
|
|
// Pick a register to spill.
|
|
for _, vid := range e.cachedVals {
|
|
a := e.cache[vid]
|
|
for _, c := range a {
|
|
if r, ok := e.s.f.getHome(c.ID).(*Register); ok && m>>uint(r.num)&1 != 0 {
|
|
x := e.p.NewValue1(c.Line, OpStoreReg, c.Type, c)
|
|
e.set(t, vid, x, false, c.Line)
|
|
if e.s.f.pass.debug > regDebug {
|
|
fmt.Printf(" SPILL %s->%s %s\n", r.Name(), t.Name(), x.LongString())
|
|
}
|
|
// r will now be overwritten by the caller. At some point
|
|
// later, the newly saved value will be moved back to its
|
|
// final destination in processDest.
|
|
return r
|
|
}
|
|
}
|
|
}
|
|
|
|
fmt.Printf("m:%d unique:%d final:%d\n", m, e.uniqueRegs, e.finalRegs)
|
|
for _, vid := range e.cachedVals {
|
|
a := e.cache[vid]
|
|
for _, c := range a {
|
|
fmt.Printf("v%d: %s %s\n", vid, c, e.s.f.getHome(c.ID).Name())
|
|
}
|
|
}
|
|
e.s.f.Fatalf("can't find empty register on edge %s->%s", e.p, e.b)
|
|
return nil
|
|
}
|
|
|
|
// rematerializeable reports whether the register allocator should recompute
|
|
// a value instead of spilling/restoring it.
|
|
func (v *Value) rematerializeable() bool {
|
|
if !opcodeTable[v.Op].rematerializeable {
|
|
return false
|
|
}
|
|
for _, a := range v.Args {
|
|
// SP and SB (generated by OpSP and OpSB) are always available.
|
|
if a.Op != OpSP && a.Op != OpSB {
|
|
return false
|
|
}
|
|
}
|
|
return true
|
|
}
|
|
|
|
type liveInfo struct {
|
|
ID ID // ID of value
|
|
dist int32 // # of instructions before next use
|
|
line int32 // line number of next use
|
|
}
|
|
|
|
// dblock contains information about desired & avoid registers at the end of a block.
|
|
type dblock struct {
|
|
prefers []desiredStateEntry
|
|
avoid regMask
|
|
}
|
|
|
|
// computeLive computes a map from block ID to a list of value IDs live at the end
|
|
// of that block. Together with the value ID is a count of how many instructions
|
|
// to the next use of that value. The resulting map is stored in s.live.
|
|
// computeLive also computes the desired register information at the end of each block.
|
|
// This desired register information is stored in s.desired.
|
|
// TODO: this could be quadratic if lots of variables are live across lots of
|
|
// basic blocks. Figure out a way to make this function (or, more precisely, the user
|
|
// of this function) require only linear size & time.
|
|
func (s *regAllocState) computeLive() {
|
|
f := s.f
|
|
s.live = make([][]liveInfo, f.NumBlocks())
|
|
s.desired = make([]desiredState, f.NumBlocks())
|
|
var phis []*Value
|
|
|
|
live := newSparseMap(f.NumValues())
|
|
t := newSparseMap(f.NumValues())
|
|
|
|
// Keep track of which value we want in each register.
|
|
var desired desiredState
|
|
|
|
// Instead of iterating over f.Blocks, iterate over their postordering.
|
|
// Liveness information flows backward, so starting at the end
|
|
// increases the probability that we will stabilize quickly.
|
|
// TODO: Do a better job yet. Here's one possibility:
|
|
// Calculate the dominator tree and locate all strongly connected components.
|
|
// If a value is live in one block of an SCC, it is live in all.
|
|
// Walk the dominator tree from end to beginning, just once, treating SCC
|
|
// components as single blocks, duplicated calculated liveness information
|
|
// out to all of them.
|
|
po := f.postorder()
|
|
s.loopnest = f.loopnest()
|
|
for {
|
|
changed := false
|
|
|
|
for _, b := range po {
|
|
// Start with known live values at the end of the block.
|
|
// Add len(b.Values) to adjust from end-of-block distance
|
|
// to beginning-of-block distance.
|
|
live.clear()
|
|
for _, e := range s.live[b.ID] {
|
|
live.set(e.ID, e.dist+int32(len(b.Values)), e.line)
|
|
}
|
|
|
|
// Mark control value as live
|
|
if b.Control != nil && s.values[b.Control.ID].needReg {
|
|
live.set(b.Control.ID, int32(len(b.Values)), b.Line)
|
|
}
|
|
|
|
// Propagate backwards to the start of the block
|
|
// Assumes Values have been scheduled.
|
|
phis = phis[:0]
|
|
for i := len(b.Values) - 1; i >= 0; i-- {
|
|
v := b.Values[i]
|
|
live.remove(v.ID)
|
|
if v.Op == OpPhi {
|
|
// save phi ops for later
|
|
phis = append(phis, v)
|
|
continue
|
|
}
|
|
if opcodeTable[v.Op].call {
|
|
c := live.contents()
|
|
for i := range c {
|
|
c[i].val += unlikelyDistance
|
|
}
|
|
}
|
|
for _, a := range v.Args {
|
|
if s.values[a.ID].needReg {
|
|
live.set(a.ID, int32(i), v.Line)
|
|
}
|
|
}
|
|
}
|
|
// Propagate desired registers backwards.
|
|
desired.copy(&s.desired[b.ID])
|
|
for i := len(b.Values) - 1; i >= 0; i-- {
|
|
v := b.Values[i]
|
|
prefs := desired.remove(v.ID)
|
|
if v.Op == OpPhi {
|
|
// TODO: if v is a phi, save desired register for phi inputs.
|
|
// For now, we just drop it and don't propagate
|
|
// desired registers back though phi nodes.
|
|
continue
|
|
}
|
|
// Cancel desired registers if they get clobbered.
|
|
desired.clobber(opcodeTable[v.Op].reg.clobbers)
|
|
// Update desired registers if there are any fixed register inputs.
|
|
for _, j := range opcodeTable[v.Op].reg.inputs {
|
|
if countRegs(j.regs) != 1 {
|
|
continue
|
|
}
|
|
desired.clobber(j.regs)
|
|
desired.add(v.Args[j.idx].ID, pickReg(j.regs))
|
|
}
|
|
// Set desired register of input 0 if this is a 2-operand instruction.
|
|
if opcodeTable[v.Op].resultInArg0 {
|
|
if opcodeTable[v.Op].commutative {
|
|
desired.addList(v.Args[1].ID, prefs)
|
|
}
|
|
desired.addList(v.Args[0].ID, prefs)
|
|
}
|
|
}
|
|
|
|
// For each predecessor of b, expand its list of live-at-end values.
|
|
// invariant: live contains the values live at the start of b (excluding phi inputs)
|
|
for i, e := range b.Preds {
|
|
p := e.b
|
|
// Compute additional distance for the edge.
|
|
// Note: delta must be at least 1 to distinguish the control
|
|
// value use from the first user in a successor block.
|
|
delta := int32(normalDistance)
|
|
if len(p.Succs) == 2 {
|
|
if p.Succs[0].b == b && p.Likely == BranchLikely ||
|
|
p.Succs[1].b == b && p.Likely == BranchUnlikely {
|
|
delta = likelyDistance
|
|
}
|
|
if p.Succs[0].b == b && p.Likely == BranchUnlikely ||
|
|
p.Succs[1].b == b && p.Likely == BranchLikely {
|
|
delta = unlikelyDistance
|
|
}
|
|
}
|
|
|
|
// Update any desired registers at the end of p.
|
|
s.desired[p.ID].merge(&desired)
|
|
|
|
// Start t off with the previously known live values at the end of p.
|
|
t.clear()
|
|
for _, e := range s.live[p.ID] {
|
|
t.set(e.ID, e.dist, e.line)
|
|
}
|
|
update := false
|
|
|
|
// Add new live values from scanning this block.
|
|
for _, e := range live.contents() {
|
|
d := e.val + delta
|
|
if !t.contains(e.key) || d < t.get(e.key) {
|
|
update = true
|
|
t.set(e.key, d, e.aux)
|
|
}
|
|
}
|
|
// Also add the correct arg from the saved phi values.
|
|
// All phis are at distance delta (we consider them
|
|
// simultaneously happening at the start of the block).
|
|
for _, v := range phis {
|
|
id := v.Args[i].ID
|
|
if s.values[id].needReg && (!t.contains(id) || delta < t.get(id)) {
|
|
update = true
|
|
t.set(id, delta, v.Line)
|
|
}
|
|
}
|
|
|
|
if !update {
|
|
continue
|
|
}
|
|
// The live set has changed, update it.
|
|
l := s.live[p.ID][:0]
|
|
if cap(l) < t.size() {
|
|
l = make([]liveInfo, 0, t.size())
|
|
}
|
|
for _, e := range t.contents() {
|
|
l = append(l, liveInfo{e.key, e.val, e.aux})
|
|
}
|
|
s.live[p.ID] = l
|
|
changed = true
|
|
}
|
|
}
|
|
|
|
if !changed {
|
|
break
|
|
}
|
|
}
|
|
if f.pass.debug > regDebug {
|
|
fmt.Println("live values at end of each block")
|
|
for _, b := range f.Blocks {
|
|
fmt.Printf(" %s:", b)
|
|
for _, x := range s.live[b.ID] {
|
|
fmt.Printf(" v%d", x.ID)
|
|
for _, e := range s.desired[b.ID].entries {
|
|
if e.ID != x.ID {
|
|
continue
|
|
}
|
|
fmt.Printf("[")
|
|
first := true
|
|
for _, r := range e.regs {
|
|
if r == noRegister {
|
|
continue
|
|
}
|
|
if !first {
|
|
fmt.Printf(",")
|
|
}
|
|
fmt.Print(s.registers[r].Name())
|
|
first = false
|
|
}
|
|
fmt.Printf("]")
|
|
}
|
|
}
|
|
fmt.Printf(" avoid=%x", int64(s.desired[b.ID].avoid))
|
|
fmt.Println()
|
|
}
|
|
}
|
|
}
|
|
|
|
// A desiredState represents desired register assignments.
|
|
type desiredState struct {
|
|
// Desired assignments will be small, so we just use a list
|
|
// of valueID+registers entries.
|
|
entries []desiredStateEntry
|
|
// Registers that other values want to be in. This value will
|
|
// contain at least the union of the regs fields of entries, but
|
|
// may contain additional entries for values that were once in
|
|
// this data structure but are no longer.
|
|
avoid regMask
|
|
}
|
|
type desiredStateEntry struct {
|
|
// (pre-regalloc) value
|
|
ID ID
|
|
// Registers it would like to be in, in priority order.
|
|
// Unused slots are filled with noRegister.
|
|
regs [4]register
|
|
}
|
|
|
|
func (d *desiredState) clear() {
|
|
d.entries = d.entries[:0]
|
|
d.avoid = 0
|
|
}
|
|
|
|
// get returns a list of desired registers for value vid.
|
|
func (d *desiredState) get(vid ID) [4]register {
|
|
for _, e := range d.entries {
|
|
if e.ID == vid {
|
|
return e.regs
|
|
}
|
|
}
|
|
return [4]register{noRegister, noRegister, noRegister, noRegister}
|
|
}
|
|
|
|
// add records that we'd like value vid to be in register r.
|
|
func (d *desiredState) add(vid ID, r register) {
|
|
d.avoid |= regMask(1) << r
|
|
for i := range d.entries {
|
|
e := &d.entries[i]
|
|
if e.ID != vid {
|
|
continue
|
|
}
|
|
if e.regs[0] == r {
|
|
// Already known and highest priority
|
|
return
|
|
}
|
|
for j := 1; j < len(e.regs); j++ {
|
|
if e.regs[j] == r {
|
|
// Move from lower priority to top priority
|
|
copy(e.regs[1:], e.regs[:j])
|
|
e.regs[0] = r
|
|
return
|
|
}
|
|
}
|
|
copy(e.regs[1:], e.regs[:])
|
|
e.regs[0] = r
|
|
return
|
|
}
|
|
d.entries = append(d.entries, desiredStateEntry{vid, [4]register{r, noRegister, noRegister, noRegister}})
|
|
}
|
|
|
|
func (d *desiredState) addList(vid ID, regs [4]register) {
|
|
// regs is in priority order, so iterate in reverse order.
|
|
for i := len(regs) - 1; i >= 0; i-- {
|
|
r := regs[i]
|
|
if r != noRegister {
|
|
d.add(vid, r)
|
|
}
|
|
}
|
|
}
|
|
|
|
// clobber erases any desired registers in the set m.
|
|
func (d *desiredState) clobber(m regMask) {
|
|
for i := 0; i < len(d.entries); {
|
|
e := &d.entries[i]
|
|
j := 0
|
|
for _, r := range e.regs {
|
|
if r != noRegister && m>>r&1 == 0 {
|
|
e.regs[j] = r
|
|
j++
|
|
}
|
|
}
|
|
if j == 0 {
|
|
// No more desired registers for this value.
|
|
d.entries[i] = d.entries[len(d.entries)-1]
|
|
d.entries = d.entries[:len(d.entries)-1]
|
|
continue
|
|
}
|
|
for ; j < len(e.regs); j++ {
|
|
e.regs[j] = noRegister
|
|
}
|
|
i++
|
|
}
|
|
d.avoid &^= m
|
|
}
|
|
|
|
// copy copies a desired state from another desiredState x.
|
|
func (d *desiredState) copy(x *desiredState) {
|
|
d.entries = append(d.entries[:0], x.entries...)
|
|
d.avoid = x.avoid
|
|
}
|
|
|
|
// remove removes the desired registers for vid and returns them.
|
|
func (d *desiredState) remove(vid ID) [4]register {
|
|
for i := range d.entries {
|
|
if d.entries[i].ID == vid {
|
|
regs := d.entries[i].regs
|
|
d.entries[i] = d.entries[len(d.entries)-1]
|
|
d.entries = d.entries[:len(d.entries)-1]
|
|
return regs
|
|
}
|
|
}
|
|
return [4]register{noRegister, noRegister, noRegister, noRegister}
|
|
}
|
|
|
|
// merge merges another desired state x into d.
|
|
func (d *desiredState) merge(x *desiredState) {
|
|
d.avoid |= x.avoid
|
|
// There should only be a few desired registers, so
|
|
// linear insert is ok.
|
|
for _, e := range x.entries {
|
|
d.addList(e.ID, e.regs)
|
|
}
|
|
}
|