2020-01-18 09:38:21 +01:00
|
|
|
|
/*
|
2021-02-03 10:41:07 +01:00
|
|
|
|
* Copyright (c) 2018-2021, Andreas Kling <kling@serenityos.org>
|
2021-04-10 18:58:00 +02:00
|
|
|
|
* Copyright (c) 2021, Linus Groh <mail@linusgroh.de>
|
2020-01-18 09:38:21 +01:00
|
|
|
|
*
|
2021-04-22 01:24:48 -07:00
|
|
|
|
* SPDX-License-Identifier: BSD-2-Clause
|
2020-01-18 09:38:21 +01:00
|
|
|
|
*/
|
|
|
|
|
|
2019-10-05 10:16:27 +02:00
|
|
|
|
#include <AK/StringBuilder.h>
|
2020-12-06 21:21:18 +01:00
|
|
|
|
#include <AK/Utf8View.h>
|
2020-02-06 15:04:03 +01:00
|
|
|
|
#include <LibCore/Timer.h>
|
2020-03-14 12:41:51 +01:00
|
|
|
|
#include <LibJS/Interpreter.h>
|
2020-04-04 22:12:37 +02:00
|
|
|
|
#include <LibJS/Parser.h>
|
2020-03-21 18:55:37 +01:00
|
|
|
|
#include <LibJS/Runtime/Function.h>
|
2021-02-03 10:41:07 +01:00
|
|
|
|
#include <LibWeb/Bindings/MainThreadVM.h>
|
2020-04-01 18:53:28 +02:00
|
|
|
|
#include <LibWeb/Bindings/WindowObject.h>
|
2020-03-07 10:32:51 +01:00
|
|
|
|
#include <LibWeb/CSS/StyleResolver.h>
|
2021-04-15 10:36:20 -04:00
|
|
|
|
#include <LibWeb/Cookie/ParsedCookie.h>
|
2020-08-17 19:14:30 +01:00
|
|
|
|
#include <LibWeb/DOM/Comment.h>
|
2021-02-20 00:42:25 +01:00
|
|
|
|
#include <LibWeb/DOM/DOMException.h>
|
2020-03-07 10:32:51 +01:00
|
|
|
|
#include <LibWeb/DOM/Document.h>
|
2020-08-17 19:14:30 +01:00
|
|
|
|
#include <LibWeb/DOM/DocumentFragment.h>
|
2020-03-07 10:32:51 +01:00
|
|
|
|
#include <LibWeb/DOM/DocumentType.h>
|
|
|
|
|
#include <LibWeb/DOM/Element.h>
|
|
|
|
|
#include <LibWeb/DOM/ElementFactory.h>
|
2020-08-31 13:56:16 +01:00
|
|
|
|
#include <LibWeb/DOM/Event.h>
|
2021-02-20 00:42:25 +01:00
|
|
|
|
#include <LibWeb/DOM/ExceptionOr.h>
|
2021-04-22 21:11:20 +02:00
|
|
|
|
#include <LibWeb/DOM/HTMLCollection.h>
|
2021-02-21 23:41:54 +01:00
|
|
|
|
#include <LibWeb/DOM/Range.h>
|
2021-04-06 19:34:49 +01:00
|
|
|
|
#include <LibWeb/DOM/ShadowRoot.h>
|
2020-07-28 19:20:11 +02:00
|
|
|
|
#include <LibWeb/DOM/Text.h>
|
|
|
|
|
#include <LibWeb/DOM/Window.h>
|
2020-11-22 13:38:18 +01:00
|
|
|
|
#include <LibWeb/Dump.h>
|
2020-08-12 14:46:53 +02:00
|
|
|
|
#include <LibWeb/HTML/AttributeNames.h>
|
2020-11-21 19:15:57 +00:00
|
|
|
|
#include <LibWeb/HTML/EventNames.h>
|
2020-07-26 15:08:16 +02:00
|
|
|
|
#include <LibWeb/HTML/HTMLBodyElement.h>
|
2020-08-17 19:14:30 +01:00
|
|
|
|
#include <LibWeb/HTML/HTMLFrameSetElement.h>
|
2020-07-26 15:08:16 +02:00
|
|
|
|
#include <LibWeb/HTML/HTMLHeadElement.h>
|
|
|
|
|
#include <LibWeb/HTML/HTMLHtmlElement.h>
|
|
|
|
|
#include <LibWeb/HTML/HTMLScriptElement.h>
|
|
|
|
|
#include <LibWeb/HTML/HTMLTitleElement.h>
|
2020-09-18 09:49:51 +02:00
|
|
|
|
#include <LibWeb/InProcessWebView.h>
|
2020-11-22 13:38:18 +01:00
|
|
|
|
#include <LibWeb/Layout/BlockFormattingContext.h>
|
2020-11-22 15:53:01 +01:00
|
|
|
|
#include <LibWeb/Layout/InitialContainingBlockBox.h>
|
2020-11-25 20:29:03 +01:00
|
|
|
|
#include <LibWeb/Layout/TreeBuilder.h>
|
2020-10-10 02:48:05 +01:00
|
|
|
|
#include <LibWeb/Namespace.h>
|
2020-04-07 22:56:13 +02:00
|
|
|
|
#include <LibWeb/Origin.h>
|
2020-07-28 19:27:41 +02:00
|
|
|
|
#include <LibWeb/Page/Frame.h>
|
2020-07-23 09:44:42 -07:00
|
|
|
|
#include <LibWeb/SVG/TagNames.h>
|
2021-04-10 18:58:00 +02:00
|
|
|
|
#include <LibWeb/UIEvents/MouseEvent.h>
|
2020-12-06 21:21:18 +01:00
|
|
|
|
#include <ctype.h>
|
2019-06-15 18:55:47 +02:00
|
|
|
|
|
2020-07-26 19:37:56 +02:00
|
|
|
|
namespace Web::DOM {
|
2020-03-07 10:27:02 +01:00
|
|
|
|
|
2020-04-07 22:56:13 +02:00
|
|
|
|
Document::Document(const URL& url)
|
2019-09-29 11:43:07 +02:00
|
|
|
|
: ParentNode(*this, NodeType::DOCUMENT_NODE)
|
2020-07-26 20:01:35 +02:00
|
|
|
|
, m_style_resolver(make<CSS::StyleResolver>(*this))
|
2020-06-04 16:06:32 +02:00
|
|
|
|
, m_style_sheets(CSS::StyleSheetList::create(*this))
|
2020-04-07 22:56:13 +02:00
|
|
|
|
, m_url(url)
|
2020-04-01 18:53:28 +02:00
|
|
|
|
, m_window(Window::create_with_document(*this))
|
2020-11-13 06:08:06 +00:00
|
|
|
|
, m_implementation(DOMImplementation::create(*this))
|
2019-06-15 18:55:47 +02:00
|
|
|
|
{
|
2020-04-07 22:15:22 +02:00
|
|
|
|
m_style_update_timer = Core::Timer::create_single_shot(0, [this] {
|
2019-10-19 18:57:02 +02:00
|
|
|
|
update_style();
|
2020-04-07 22:15:22 +02:00
|
|
|
|
});
|
2021-01-09 15:07:37 +01:00
|
|
|
|
|
|
|
|
|
m_forced_layout_timer = Core::Timer::create_single_shot(0, [this] {
|
|
|
|
|
force_layout();
|
|
|
|
|
});
|
2019-06-15 18:55:47 +02:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
Document::~Document()
|
|
|
|
|
{
|
|
|
|
|
}
|
|
|
|
|
|
2020-10-11 21:52:59 +02:00
|
|
|
|
void Document::removed_last_ref()
|
|
|
|
|
{
|
2021-02-23 20:42:32 +01:00
|
|
|
|
VERIFY(!ref_count());
|
|
|
|
|
VERIFY(!m_deletion_has_begun);
|
2020-10-22 23:38:14 +02:00
|
|
|
|
|
|
|
|
|
if (m_referencing_node_count) {
|
|
|
|
|
// The document has reached ref_count==0 but still has nodes keeping it alive.
|
|
|
|
|
// At this point, sever all the node links we control.
|
|
|
|
|
// If nodes remain elsewhere (e.g JS wrappers), they will keep the document alive.
|
|
|
|
|
|
|
|
|
|
// NOTE: This makes sure we stay alive across for the duration of the cleanup below.
|
|
|
|
|
increment_referencing_node_count();
|
|
|
|
|
|
|
|
|
|
m_focused_element = nullptr;
|
|
|
|
|
m_hovered_node = nullptr;
|
|
|
|
|
m_pending_parsing_blocking_script = nullptr;
|
|
|
|
|
m_inspected_node = nullptr;
|
|
|
|
|
m_scripts_to_execute_when_parsing_has_finished.clear();
|
|
|
|
|
m_scripts_to_execute_as_soon_as_possible.clear();
|
|
|
|
|
m_associated_inert_template_document = nullptr;
|
|
|
|
|
|
|
|
|
|
m_interpreter = nullptr;
|
|
|
|
|
|
|
|
|
|
{
|
|
|
|
|
// Gather up all the descendants of this document and prune them from the tree.
|
|
|
|
|
// FIXME: This could definitely be more elegant.
|
|
|
|
|
NonnullRefPtrVector<Node> descendants;
|
2021-04-06 18:38:10 +01:00
|
|
|
|
for_each_in_inclusive_subtree([&](auto& node) {
|
2020-10-22 23:38:14 +02:00
|
|
|
|
if (&node != this)
|
|
|
|
|
descendants.append(node);
|
|
|
|
|
return IterationDecision::Continue;
|
|
|
|
|
});
|
|
|
|
|
|
|
|
|
|
for (auto& node : descendants) {
|
2021-02-23 20:42:32 +01:00
|
|
|
|
VERIFY(&node.document() == this);
|
|
|
|
|
VERIFY(!node.is_document());
|
2020-10-22 23:38:14 +02:00
|
|
|
|
if (node.parent())
|
2021-04-06 19:34:49 +01:00
|
|
|
|
node.remove();
|
2020-10-22 23:38:14 +02:00
|
|
|
|
}
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
m_in_removed_last_ref = false;
|
|
|
|
|
decrement_referencing_node_count();
|
2020-10-11 21:52:59 +02:00
|
|
|
|
return;
|
2020-10-22 23:38:14 +02:00
|
|
|
|
}
|
2020-10-11 21:52:59 +02:00
|
|
|
|
|
2020-10-22 23:38:14 +02:00
|
|
|
|
m_in_removed_last_ref = false;
|
|
|
|
|
m_deletion_has_begun = true;
|
2020-10-11 21:52:59 +02:00
|
|
|
|
delete this;
|
|
|
|
|
}
|
|
|
|
|
|
2020-04-07 22:56:13 +02:00
|
|
|
|
Origin Document::origin() const
|
|
|
|
|
{
|
|
|
|
|
if (!m_url.is_valid())
|
|
|
|
|
return {};
|
|
|
|
|
return { m_url.protocol(), m_url.host(), m_url.port() };
|
|
|
|
|
}
|
|
|
|
|
|
2020-11-13 06:08:06 +00:00
|
|
|
|
void Document::set_origin(const Origin& origin)
|
|
|
|
|
{
|
|
|
|
|
m_url.set_protocol(origin.protocol());
|
|
|
|
|
m_url.set_host(origin.host());
|
|
|
|
|
m_url.set_port(origin.port());
|
|
|
|
|
}
|
|
|
|
|
|
2019-10-19 18:57:02 +02:00
|
|
|
|
void Document::schedule_style_update()
|
|
|
|
|
{
|
|
|
|
|
if (m_style_update_timer->is_active())
|
|
|
|
|
return;
|
|
|
|
|
m_style_update_timer->start();
|
|
|
|
|
}
|
|
|
|
|
|
2021-01-09 15:07:37 +01:00
|
|
|
|
void Document::schedule_forced_layout()
|
|
|
|
|
{
|
|
|
|
|
if (m_forced_layout_timer->is_active())
|
|
|
|
|
return;
|
|
|
|
|
m_forced_layout_timer->start();
|
|
|
|
|
}
|
|
|
|
|
|
2019-10-12 23:26:47 +02:00
|
|
|
|
bool Document::is_child_allowed(const Node& node) const
|
|
|
|
|
{
|
|
|
|
|
switch (node.type()) {
|
|
|
|
|
case NodeType::DOCUMENT_NODE:
|
|
|
|
|
case NodeType::TEXT_NODE:
|
|
|
|
|
return false;
|
|
|
|
|
case NodeType::COMMENT_NODE:
|
|
|
|
|
return true;
|
|
|
|
|
case NodeType::DOCUMENT_TYPE_NODE:
|
|
|
|
|
return !first_child_of_type<DocumentType>();
|
|
|
|
|
case NodeType::ELEMENT_NODE:
|
|
|
|
|
return !first_child_of_type<Element>();
|
|
|
|
|
default:
|
|
|
|
|
return false;
|
|
|
|
|
}
|
|
|
|
|
}
|
|
|
|
|
|
2021-02-22 14:00:47 +01:00
|
|
|
|
Element* Document::document_element()
|
|
|
|
|
{
|
|
|
|
|
return first_child_of_type<Element>();
|
|
|
|
|
}
|
|
|
|
|
|
2020-08-03 13:30:18 +02:00
|
|
|
|
const Element* Document::document_element() const
|
2019-09-29 16:24:57 +02:00
|
|
|
|
{
|
2020-08-03 13:30:18 +02:00
|
|
|
|
return first_child_of_type<Element>();
|
2019-09-29 16:24:57 +02:00
|
|
|
|
}
|
|
|
|
|
|
2020-08-03 21:23:40 +01:00
|
|
|
|
const HTML::HTMLHtmlElement* Document::html_element() const
|
2019-09-29 16:24:57 +02:00
|
|
|
|
{
|
|
|
|
|
auto* html = document_element();
|
2020-08-03 21:23:40 +01:00
|
|
|
|
if (is<HTML::HTMLHtmlElement>(html))
|
|
|
|
|
return downcast<HTML::HTMLHtmlElement>(html);
|
|
|
|
|
return nullptr;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
const HTML::HTMLHeadElement* Document::head() const
|
|
|
|
|
{
|
|
|
|
|
auto* html = html_element();
|
2019-09-29 16:24:57 +02:00
|
|
|
|
if (!html)
|
|
|
|
|
return nullptr;
|
2020-07-28 18:20:36 +02:00
|
|
|
|
return html->first_child_of_type<HTML::HTMLHeadElement>();
|
2019-09-29 16:24:57 +02:00
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
const HTML::HTMLElement* Document::body() const
|
2019-10-04 21:05:52 +02:00
|
|
|
|
{
|
2020-08-03 21:23:40 +01:00
|
|
|
|
auto* html = html_element();
|
2019-10-04 21:05:52 +02:00
|
|
|
|
if (!html)
|
|
|
|
|
return nullptr;
|
2020-08-17 19:14:30 +01:00
|
|
|
|
auto* first_body = html->first_child_of_type<HTML::HTMLBodyElement>();
|
|
|
|
|
if (first_body)
|
|
|
|
|
return first_body;
|
|
|
|
|
auto* first_frameset = html->first_child_of_type<HTML::HTMLFrameSetElement>();
|
|
|
|
|
if (first_frameset)
|
|
|
|
|
return first_frameset;
|
|
|
|
|
return nullptr;
|
|
|
|
|
}
|
|
|
|
|
|
2021-02-20 00:42:25 +01:00
|
|
|
|
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-body
|
|
|
|
|
ExceptionOr<void> Document::set_body(HTML::HTMLElement& new_body)
|
2020-08-17 19:14:30 +01:00
|
|
|
|
{
|
2021-02-20 00:42:25 +01:00
|
|
|
|
if (!is<HTML::HTMLBodyElement>(new_body) && !is<HTML::HTMLFrameSetElement>(new_body))
|
|
|
|
|
return DOM::HierarchyRequestError::create("Invalid document body element, must be 'body' or 'frameset'");
|
2020-08-17 19:14:30 +01:00
|
|
|
|
|
|
|
|
|
auto* existing_body = body();
|
|
|
|
|
if (existing_body) {
|
|
|
|
|
TODO();
|
2021-02-20 00:42:25 +01:00
|
|
|
|
return {};
|
2020-08-17 19:14:30 +01:00
|
|
|
|
}
|
|
|
|
|
|
2021-02-22 14:00:47 +01:00
|
|
|
|
auto* document_element = this->document_element();
|
|
|
|
|
if (!document_element)
|
2021-02-20 00:42:25 +01:00
|
|
|
|
return DOM::HierarchyRequestError::create("Missing document element");
|
2020-08-17 19:14:30 +01:00
|
|
|
|
|
2021-02-22 14:00:47 +01:00
|
|
|
|
document_element->append_child(new_body);
|
2021-02-20 00:42:25 +01:00
|
|
|
|
return {};
|
2019-10-04 21:05:52 +02:00
|
|
|
|
}
|
|
|
|
|
|
2019-09-29 16:24:57 +02:00
|
|
|
|
String Document::title() const
|
|
|
|
|
{
|
|
|
|
|
auto* head_element = head();
|
|
|
|
|
if (!head_element)
|
|
|
|
|
return {};
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
auto* title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
|
2019-09-29 16:24:57 +02:00
|
|
|
|
if (!title_element)
|
|
|
|
|
return {};
|
|
|
|
|
|
2020-12-06 21:21:18 +01:00
|
|
|
|
auto raw_title = title_element->text_content();
|
|
|
|
|
|
|
|
|
|
StringBuilder builder;
|
|
|
|
|
bool last_was_space = false;
|
|
|
|
|
for (auto code_point : Utf8View(raw_title)) {
|
|
|
|
|
if (isspace(code_point)) {
|
|
|
|
|
last_was_space = true;
|
|
|
|
|
} else {
|
|
|
|
|
if (last_was_space && !builder.is_empty())
|
|
|
|
|
builder.append(' ');
|
|
|
|
|
builder.append_code_point(code_point);
|
|
|
|
|
last_was_space = false;
|
|
|
|
|
}
|
|
|
|
|
}
|
|
|
|
|
return builder.to_string();
|
2019-09-29 16:24:57 +02:00
|
|
|
|
}
|
2019-10-04 15:50:04 +02:00
|
|
|
|
|
2020-12-06 21:39:36 +01:00
|
|
|
|
void Document::set_title(const String& title)
|
|
|
|
|
{
|
|
|
|
|
auto* head_element = const_cast<HTML::HTMLHeadElement*>(head());
|
|
|
|
|
if (!head_element)
|
|
|
|
|
return;
|
|
|
|
|
|
|
|
|
|
RefPtr<HTML::HTMLTitleElement> title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
|
|
|
|
|
if (!title_element) {
|
|
|
|
|
title_element = static_ptr_cast<HTML::HTMLTitleElement>(create_element(HTML::TagNames::title));
|
|
|
|
|
head_element->append_child(*title_element);
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-06 19:34:49 +01:00
|
|
|
|
title_element->remove_all_children(true);
|
2020-12-06 21:39:36 +01:00
|
|
|
|
title_element->append_child(adopt(*new Text(*this, title)));
|
|
|
|
|
|
2021-03-20 15:20:11 +01:00
|
|
|
|
if (auto* page = this->page()) {
|
|
|
|
|
if (frame() == &page->main_frame())
|
|
|
|
|
page->client().page_did_change_title(title);
|
|
|
|
|
}
|
2020-12-06 21:39:36 +01:00
|
|
|
|
}
|
|
|
|
|
|
2019-10-04 15:50:04 +02:00
|
|
|
|
void Document::attach_to_frame(Badge<Frame>, Frame& frame)
|
|
|
|
|
{
|
AK: Make RefPtr, NonnullRefPtr, WeakPtr thread safe
This makes most operations thread safe, especially so that they
can safely be used in the Kernel. This includes obtaining a strong
reference from a weak reference, which now requires an explicit
call to WeakPtr::strong_ref(). Another major change is that
Weakable::make_weak_ref() may require the explicit target type.
Previously we used reinterpret_cast in WeakPtr, assuming that it
can be properly converted. But WeakPtr does not necessarily have
the knowledge to be able to do this. Instead, we now ask the class
itself to deliver a WeakPtr to the type that we want.
Also, WeakLink is no longer specific to a target type. The reason
for this is that we want to be able to safely convert e.g. WeakPtr<T>
to WeakPtr<U>, and before this we just reinterpret_cast the internal
WeakLink<T> to WeakLink<U>, which is a bold assumption that it would
actually produce the correct code. Instead, WeakLink now operates
on just a raw pointer and we only make those constructors/operators
available if we can verify that it can be safely cast.
In order to guarantee thread safety, we now use the least significant
bit in the pointer for locking purposes. This also means that only
properly aligned pointers can be used.
2020-09-29 16:26:13 -06:00
|
|
|
|
m_frame = frame;
|
2020-12-14 10:39:39 +01:00
|
|
|
|
update_layout();
|
2019-10-04 15:50:04 +02:00
|
|
|
|
}
|
|
|
|
|
|
2020-06-06 15:07:07 +02:00
|
|
|
|
void Document::detach_from_frame(Badge<Frame>, Frame& frame)
|
2019-10-04 15:50:04 +02:00
|
|
|
|
{
|
2021-02-23 20:42:32 +01:00
|
|
|
|
VERIFY(&frame == m_frame);
|
2020-10-20 17:43:13 +02:00
|
|
|
|
tear_down_layout_tree();
|
2019-10-09 21:52:38 +02:00
|
|
|
|
m_frame = nullptr;
|
2019-10-04 15:50:04 +02:00
|
|
|
|
}
|
2019-10-04 21:05:52 +02:00
|
|
|
|
|
2020-10-20 17:43:13 +02:00
|
|
|
|
void Document::tear_down_layout_tree()
|
|
|
|
|
{
|
|
|
|
|
if (!m_layout_root)
|
|
|
|
|
return;
|
|
|
|
|
|
|
|
|
|
// Gather up all the layout nodes in a vector and detach them from parents
|
|
|
|
|
// while the vector keeps them alive.
|
|
|
|
|
|
2020-11-22 15:53:01 +01:00
|
|
|
|
NonnullRefPtrVector<Layout::Node> layout_nodes;
|
2020-10-20 17:43:13 +02:00
|
|
|
|
|
2021-04-06 18:38:10 +01:00
|
|
|
|
m_layout_root->for_each_in_inclusive_subtree([&](auto& layout_node) {
|
2020-10-22 23:38:14 +02:00
|
|
|
|
layout_nodes.append(layout_node);
|
2020-10-20 17:43:13 +02:00
|
|
|
|
return IterationDecision::Continue;
|
|
|
|
|
});
|
|
|
|
|
|
|
|
|
|
for (auto& layout_node : layout_nodes) {
|
|
|
|
|
if (layout_node.parent())
|
|
|
|
|
layout_node.parent()->remove_child(layout_node);
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
m_layout_root = nullptr;
|
|
|
|
|
}
|
|
|
|
|
|
2020-01-05 00:09:35 +03:00
|
|
|
|
Color Document::background_color(const Palette& palette) const
|
2019-10-04 21:05:52 +02:00
|
|
|
|
{
|
2020-01-05 00:09:35 +03:00
|
|
|
|
auto default_color = palette.base();
|
2019-10-04 21:05:52 +02:00
|
|
|
|
auto* body_element = body();
|
|
|
|
|
if (!body_element)
|
2020-01-05 00:09:35 +03:00
|
|
|
|
return default_color;
|
2019-10-04 21:05:52 +02:00
|
|
|
|
|
|
|
|
|
auto* body_layout_node = body_element->layout_node();
|
|
|
|
|
if (!body_layout_node)
|
2020-01-05 00:09:35 +03:00
|
|
|
|
return default_color;
|
2019-10-04 21:05:52 +02:00
|
|
|
|
|
2021-01-06 10:34:31 +01:00
|
|
|
|
auto color = body_layout_node->computed_values().background_color();
|
2020-12-15 16:13:05 +01:00
|
|
|
|
if (!color.alpha())
|
2020-01-05 00:09:35 +03:00
|
|
|
|
return default_color;
|
2020-12-15 16:13:05 +01:00
|
|
|
|
return color;
|
2019-10-04 21:05:52 +02:00
|
|
|
|
}
|
2019-10-05 10:16:27 +02:00
|
|
|
|
|
2020-02-06 11:56:38 +01:00
|
|
|
|
RefPtr<Gfx::Bitmap> Document::background_image() const
|
2019-10-19 11:49:46 +02:00
|
|
|
|
{
|
|
|
|
|
auto* body_element = body();
|
|
|
|
|
if (!body_element)
|
|
|
|
|
return {};
|
|
|
|
|
|
|
|
|
|
auto* body_layout_node = body_element->layout_node();
|
|
|
|
|
if (!body_layout_node)
|
|
|
|
|
return {};
|
|
|
|
|
|
2021-01-06 11:31:19 +01:00
|
|
|
|
auto background_image = body_layout_node->background_image();
|
|
|
|
|
if (!background_image)
|
2019-10-19 11:49:46 +02:00
|
|
|
|
return {};
|
2021-01-06 11:31:19 +01:00
|
|
|
|
return background_image->bitmap();
|
2019-10-19 11:49:46 +02:00
|
|
|
|
}
|
|
|
|
|
|
2021-04-05 12:05:35 -04:00
|
|
|
|
CSS::Repeat Document::background_repeat_x() const
|
2021-04-02 18:19:33 -04:00
|
|
|
|
{
|
|
|
|
|
auto* body_element = body();
|
|
|
|
|
if (!body_element)
|
|
|
|
|
return CSS::Repeat::Repeat;
|
|
|
|
|
|
|
|
|
|
auto* body_layout_node = body_element->layout_node();
|
|
|
|
|
if (!body_layout_node)
|
|
|
|
|
return CSS::Repeat::Repeat;
|
|
|
|
|
|
2021-04-05 12:05:35 -04:00
|
|
|
|
return body_layout_node->computed_values().background_repeat_x();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
CSS::Repeat Document::background_repeat_y() const
|
|
|
|
|
{
|
|
|
|
|
auto* body_element = body();
|
|
|
|
|
if (!body_element)
|
|
|
|
|
return CSS::Repeat::Repeat;
|
|
|
|
|
|
|
|
|
|
auto* body_layout_node = body_element->layout_node();
|
|
|
|
|
if (!body_layout_node)
|
|
|
|
|
return CSS::Repeat::Repeat;
|
|
|
|
|
|
|
|
|
|
return body_layout_node->computed_values().background_repeat_y();
|
2021-04-02 18:19:33 -04:00
|
|
|
|
}
|
|
|
|
|
|
2019-10-05 10:16:27 +02:00
|
|
|
|
URL Document::complete_url(const String& string) const
|
|
|
|
|
{
|
2019-11-18 22:04:39 +01:00
|
|
|
|
return m_url.complete_url(string);
|
2019-10-05 10:16:27 +02:00
|
|
|
|
}
|
2019-10-05 22:27:52 +02:00
|
|
|
|
|
2020-03-25 18:51:04 +01:00
|
|
|
|
void Document::invalidate_layout()
|
2019-10-28 20:51:45 +01:00
|
|
|
|
{
|
2020-10-20 17:43:13 +02:00
|
|
|
|
tear_down_layout_tree();
|
2020-03-25 18:51:04 +01:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
void Document::force_layout()
|
|
|
|
|
{
|
|
|
|
|
invalidate_layout();
|
2020-12-14 10:39:39 +01:00
|
|
|
|
update_layout();
|
2019-10-28 20:51:45 +01:00
|
|
|
|
}
|
|
|
|
|
|
2020-12-14 10:39:39 +01:00
|
|
|
|
void Document::update_layout()
|
2019-10-13 12:34:25 +02:00
|
|
|
|
{
|
2020-03-25 18:51:04 +01:00
|
|
|
|
if (!frame())
|
|
|
|
|
return;
|
|
|
|
|
|
2019-10-15 12:22:41 +02:00
|
|
|
|
if (!m_layout_root) {
|
2020-11-25 20:29:03 +01:00
|
|
|
|
Layout::TreeBuilder tree_builder;
|
2020-11-22 15:53:01 +01:00
|
|
|
|
m_layout_root = static_ptr_cast<Layout::InitialContainingBlockBox>(tree_builder.build(*this));
|
2019-10-15 12:22:41 +02:00
|
|
|
|
}
|
2020-11-22 13:38:18 +01:00
|
|
|
|
|
2020-11-25 20:08:52 +01:00
|
|
|
|
Layout::BlockFormattingContext root_formatting_context(*m_layout_root, nullptr);
|
2020-12-06 19:48:02 +01:00
|
|
|
|
root_formatting_context.run(*m_layout_root, Layout::LayoutMode::Default);
|
2020-11-22 13:38:18 +01:00
|
|
|
|
|
2019-10-28 20:51:45 +01:00
|
|
|
|
m_layout_root->set_needs_display();
|
2020-06-23 18:02:08 +02:00
|
|
|
|
|
2020-11-12 18:23:05 +01:00
|
|
|
|
if (frame()->is_main_frame()) {
|
|
|
|
|
if (auto* page = this->page())
|
|
|
|
|
page->client().page_did_layout();
|
|
|
|
|
}
|
2019-10-13 12:34:25 +02:00
|
|
|
|
}
|
|
|
|
|
|
2020-12-14 12:04:30 +01:00
|
|
|
|
static void update_style_recursively(DOM::Node& node)
|
2019-10-13 12:49:43 +02:00
|
|
|
|
{
|
2020-12-14 12:04:30 +01:00
|
|
|
|
node.for_each_child([&](auto& child) {
|
|
|
|
|
if (child.needs_style_update()) {
|
|
|
|
|
if (is<Element>(child))
|
|
|
|
|
downcast<Element>(child).recompute_style();
|
|
|
|
|
child.set_needs_style_update(false);
|
|
|
|
|
}
|
|
|
|
|
if (child.child_needs_style_update()) {
|
|
|
|
|
update_style_recursively(child);
|
|
|
|
|
child.set_child_needs_style_update(false);
|
|
|
|
|
}
|
2019-10-21 12:01:30 +02:00
|
|
|
|
return IterationDecision::Continue;
|
2019-10-19 18:57:02 +02:00
|
|
|
|
});
|
2020-12-14 12:04:30 +01:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
void Document::update_style()
|
|
|
|
|
{
|
|
|
|
|
update_style_recursively(*this);
|
2019-10-14 17:56:19 +02:00
|
|
|
|
update_layout();
|
2019-10-13 12:49:43 +02:00
|
|
|
|
}
|
|
|
|
|
|
2021-01-06 14:27:40 +01:00
|
|
|
|
RefPtr<Layout::Node> Document::create_layout_node()
|
2019-10-05 22:27:52 +02:00
|
|
|
|
{
|
2020-11-22 15:53:01 +01:00
|
|
|
|
return adopt(*new Layout::InitialContainingBlockBox(*this, CSS::StyleProperties::create()));
|
2019-10-05 22:27:52 +02:00
|
|
|
|
}
|
2019-10-06 10:11:54 +02:00
|
|
|
|
|
|
|
|
|
void Document::set_link_color(Color color)
|
|
|
|
|
{
|
|
|
|
|
m_link_color = color;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
void Document::set_active_link_color(Color color)
|
|
|
|
|
{
|
|
|
|
|
m_active_link_color = color;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
void Document::set_visited_link_color(Color color)
|
|
|
|
|
{
|
|
|
|
|
m_visited_link_color = color;
|
|
|
|
|
}
|
2019-10-13 12:34:25 +02:00
|
|
|
|
|
2020-11-22 15:53:01 +01:00
|
|
|
|
const Layout::InitialContainingBlockBox* Document::layout_node() const
|
2019-10-13 12:34:25 +02:00
|
|
|
|
{
|
2020-11-22 15:53:01 +01:00
|
|
|
|
return static_cast<const Layout::InitialContainingBlockBox*>(Node::layout_node());
|
2019-10-13 12:34:25 +02:00
|
|
|
|
}
|
2019-10-14 17:54:17 +02:00
|
|
|
|
|
2020-11-22 15:53:01 +01:00
|
|
|
|
Layout::InitialContainingBlockBox* Document::layout_node()
|
2019-11-04 19:37:52 +01:00
|
|
|
|
{
|
2020-11-22 15:53:01 +01:00
|
|
|
|
return static_cast<Layout::InitialContainingBlockBox*>(Node::layout_node());
|
2019-11-04 19:37:52 +01:00
|
|
|
|
}
|
|
|
|
|
|
2019-11-09 11:58:50 +01:00
|
|
|
|
void Document::set_inspected_node(Node* node)
|
|
|
|
|
{
|
|
|
|
|
if (m_inspected_node == node)
|
|
|
|
|
return;
|
|
|
|
|
|
|
|
|
|
if (m_inspected_node && m_inspected_node->layout_node())
|
|
|
|
|
m_inspected_node->layout_node()->set_needs_display();
|
|
|
|
|
|
|
|
|
|
m_inspected_node = node;
|
|
|
|
|
|
|
|
|
|
if (m_inspected_node && m_inspected_node->layout_node())
|
|
|
|
|
m_inspected_node->layout_node()->set_needs_display();
|
|
|
|
|
}
|
|
|
|
|
|
2019-10-14 17:54:17 +02:00
|
|
|
|
void Document::set_hovered_node(Node* node)
|
|
|
|
|
{
|
|
|
|
|
if (m_hovered_node == node)
|
|
|
|
|
return;
|
|
|
|
|
|
2019-10-14 18:32:02 +02:00
|
|
|
|
RefPtr<Node> old_hovered_node = move(m_hovered_node);
|
2019-10-14 17:54:17 +02:00
|
|
|
|
m_hovered_node = node;
|
2019-10-14 18:32:02 +02:00
|
|
|
|
|
2019-10-19 18:57:02 +02:00
|
|
|
|
invalidate_style();
|
2019-10-14 17:54:17 +02:00
|
|
|
|
}
|
2019-10-21 12:01:30 +02:00
|
|
|
|
|
2021-04-22 21:11:20 +02:00
|
|
|
|
NonnullRefPtr<HTMLCollection> Document::get_elements_by_name(String const& name)
|
2019-10-21 12:01:30 +02:00
|
|
|
|
{
|
2021-04-22 21:11:20 +02:00
|
|
|
|
return HTMLCollection::create(*this, [name](Element const& element) {
|
|
|
|
|
return element.name() == name;
|
2019-10-21 12:01:30 +02:00
|
|
|
|
});
|
|
|
|
|
}
|
2020-01-13 20:33:15 +01:00
|
|
|
|
|
2021-04-22 21:11:20 +02:00
|
|
|
|
NonnullRefPtr<HTMLCollection> Document::get_elements_by_tag_name(FlyString const& tag_name)
|
2020-06-25 22:23:33 +02:00
|
|
|
|
{
|
2021-02-08 01:02:33 +01:00
|
|
|
|
// FIXME: Support "*" for tag_name
|
|
|
|
|
// https://dom.spec.whatwg.org/#concept-getelementsbytagname
|
2021-04-22 21:11:20 +02:00
|
|
|
|
return HTMLCollection::create(*this, [tag_name](Element const& element) {
|
|
|
|
|
if (element.namespace_() == Namespace::HTML)
|
|
|
|
|
return element.local_name().to_lowercase() == tag_name.to_lowercase();
|
|
|
|
|
return element.local_name() == tag_name;
|
2020-06-25 22:23:33 +02:00
|
|
|
|
});
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-22 21:11:20 +02:00
|
|
|
|
NonnullRefPtr<HTMLCollection> Document::get_elements_by_class_name(FlyString const& class_name)
|
2020-12-01 15:47:50 +01:00
|
|
|
|
{
|
2021-04-22 21:11:20 +02:00
|
|
|
|
return HTMLCollection::create(*this, [class_name, quirks_mode = document().in_quirks_mode()](Element const& element) {
|
|
|
|
|
return element.has_class(class_name, quirks_mode ? CaseSensitivity::CaseInsensitive : CaseSensitivity::CaseSensitive);
|
2020-12-01 15:47:50 +01:00
|
|
|
|
});
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-22 22:11:42 +02:00
|
|
|
|
NonnullRefPtr<HTMLCollection> Document::applets()
|
|
|
|
|
{
|
|
|
|
|
// FIXME: This should return the same HTMLCollection object every time,
|
|
|
|
|
// but that would cause a reference cycle since HTMLCollection refs the root.
|
|
|
|
|
return HTMLCollection::create(*this, [] { return false; });
|
|
|
|
|
}
|
|
|
|
|
|
2020-01-13 20:33:15 +01:00
|
|
|
|
Color Document::link_color() const
|
|
|
|
|
{
|
|
|
|
|
if (m_link_color.has_value())
|
|
|
|
|
return m_link_color.value();
|
2020-11-12 18:23:05 +01:00
|
|
|
|
if (!page())
|
2020-01-13 20:33:15 +01:00
|
|
|
|
return Color::Blue;
|
2020-11-12 18:23:05 +01:00
|
|
|
|
return page()->palette().link();
|
2020-01-13 20:33:15 +01:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
Color Document::active_link_color() const
|
|
|
|
|
{
|
|
|
|
|
if (m_active_link_color.has_value())
|
|
|
|
|
return m_active_link_color.value();
|
2020-11-12 18:23:05 +01:00
|
|
|
|
if (!page())
|
2020-01-13 20:33:15 +01:00
|
|
|
|
return Color::Red;
|
2020-11-12 18:23:05 +01:00
|
|
|
|
return page()->palette().active_link();
|
2020-01-13 20:33:15 +01:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
Color Document::visited_link_color() const
|
|
|
|
|
{
|
|
|
|
|
if (m_visited_link_color.has_value())
|
|
|
|
|
return m_visited_link_color.value();
|
2020-11-12 18:23:05 +01:00
|
|
|
|
if (!page())
|
2020-01-13 20:33:15 +01:00
|
|
|
|
return Color::Magenta;
|
2020-11-12 18:23:05 +01:00
|
|
|
|
return page()->palette().visited_link();
|
2020-01-13 20:33:15 +01:00
|
|
|
|
}
|
2020-03-07 10:27:02 +01:00
|
|
|
|
|
2020-03-14 12:41:51 +01:00
|
|
|
|
JS::Interpreter& Document::interpreter()
|
|
|
|
|
{
|
2021-04-01 22:13:42 +02:00
|
|
|
|
if (!m_interpreter) {
|
|
|
|
|
auto& vm = Bindings::main_thread_vm();
|
|
|
|
|
// TODO: Hook up vm.on_promise_unhandled_rejection and vm.on_promise_rejection_handled
|
|
|
|
|
// See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises#promise_rejection_events
|
|
|
|
|
m_interpreter = JS::Interpreter::create<Bindings::WindowObject>(vm, *m_window);
|
|
|
|
|
}
|
2020-03-14 12:41:51 +01:00
|
|
|
|
return *m_interpreter;
|
|
|
|
|
}
|
|
|
|
|
|
2021-02-27 19:35:45 +01:00
|
|
|
|
JS::Value Document::run_javascript(const StringView& source, const StringView& filename)
|
2020-04-04 22:12:37 +02:00
|
|
|
|
{
|
2021-02-27 19:35:45 +01:00
|
|
|
|
auto parser = JS::Parser(JS::Lexer(source, filename));
|
2020-04-13 02:05:21 +02:00
|
|
|
|
auto program = parser.parse_program();
|
|
|
|
|
if (parser.has_errors()) {
|
2020-05-14 16:26:01 +01:00
|
|
|
|
parser.print_errors();
|
2020-04-13 02:05:21 +02:00
|
|
|
|
return JS::js_undefined();
|
|
|
|
|
}
|
2020-08-11 17:42:18 +02:00
|
|
|
|
auto& interpreter = document().interpreter();
|
2021-03-16 09:09:56 +01:00
|
|
|
|
auto& vm = interpreter.vm();
|
|
|
|
|
interpreter.run(interpreter.global_object(), *program);
|
|
|
|
|
if (vm.exception())
|
|
|
|
|
vm.clear_exception();
|
|
|
|
|
return vm.last_value();
|
2020-04-04 22:12:37 +02:00
|
|
|
|
}
|
|
|
|
|
|
2021-01-28 20:15:04 +00:00
|
|
|
|
// https://dom.spec.whatwg.org/#dom-document-createelement
|
|
|
|
|
// FIXME: This only implements step 6 of the algorithm and does not take in options.
|
2020-05-10 20:43:54 +02:00
|
|
|
|
NonnullRefPtr<Element> Document::create_element(const String& tag_name)
|
|
|
|
|
{
|
2020-10-10 02:48:05 +01:00
|
|
|
|
// FIXME: Let namespace be the HTML namespace, if this is an HTML document or this’s content type is "application/xhtml+xml", and null otherwise.
|
|
|
|
|
return DOM::create_element(*this, tag_name, Namespace::HTML);
|
2020-05-10 20:43:54 +02:00
|
|
|
|
}
|
|
|
|
|
|
2021-01-28 20:15:04 +00:00
|
|
|
|
// https://dom.spec.whatwg.org/#internal-createelementns-steps
|
|
|
|
|
// FIXME: This only implements step 4 of the algorithm and does not take in options.
|
|
|
|
|
NonnullRefPtr<Element> Document::create_element_ns(const String& namespace_, const String& qualified_name)
|
|
|
|
|
{
|
|
|
|
|
return DOM::create_element(*this, qualified_name, namespace_);
|
|
|
|
|
}
|
|
|
|
|
|
2020-08-17 19:14:30 +01:00
|
|
|
|
NonnullRefPtr<DocumentFragment> Document::create_document_fragment()
|
|
|
|
|
{
|
|
|
|
|
return adopt(*new DocumentFragment(*this));
|
|
|
|
|
}
|
|
|
|
|
|
2020-05-10 20:43:54 +02:00
|
|
|
|
NonnullRefPtr<Text> Document::create_text_node(const String& data)
|
|
|
|
|
{
|
|
|
|
|
return adopt(*new Text(*this, data));
|
2020-08-17 19:14:30 +01:00
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
NonnullRefPtr<Comment> Document::create_comment(const String& data)
|
|
|
|
|
{
|
|
|
|
|
return adopt(*new Comment(*this, data));
|
2020-05-10 20:43:54 +02:00
|
|
|
|
}
|
|
|
|
|
|
2021-02-21 23:41:54 +01:00
|
|
|
|
NonnullRefPtr<Range> Document::create_range()
|
|
|
|
|
{
|
|
|
|
|
return Range::create(*this);
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-10 18:58:00 +02:00
|
|
|
|
// https://dom.spec.whatwg.org/#dom-document-createevent
|
|
|
|
|
NonnullRefPtr<Event> Document::create_event(const String& interface)
|
|
|
|
|
{
|
|
|
|
|
auto interface_lowercase = interface.to_lowercase();
|
|
|
|
|
RefPtr<Event> event;
|
|
|
|
|
if (interface_lowercase == "beforeunloadevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create BeforeUnloadEvent
|
|
|
|
|
} else if (interface_lowercase == "compositionevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create CompositionEvent
|
|
|
|
|
} else if (interface_lowercase == "customevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create CustomEvent
|
|
|
|
|
} else if (interface_lowercase == "devicemotionevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create DeviceMotionEvent
|
|
|
|
|
} else if (interface_lowercase == "deviceorientationevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create DeviceOrientationEvent
|
|
|
|
|
} else if (interface_lowercase == "dragevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create DragEvent
|
|
|
|
|
} else if (interface_lowercase.is_one_of("event", "events")) {
|
|
|
|
|
event = Event::create("");
|
|
|
|
|
} else if (interface_lowercase == "focusevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create FocusEvent
|
|
|
|
|
} else if (interface_lowercase == "hashchangeevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create HashChangeEvent
|
|
|
|
|
} else if (interface_lowercase == "htmlevents") {
|
|
|
|
|
event = Event::create("");
|
|
|
|
|
} else if (interface_lowercase == "keyboardevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create KeyboardEvent
|
|
|
|
|
} else if (interface_lowercase == "messageevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create MessageEvent
|
|
|
|
|
} else if (interface_lowercase.is_one_of("mouseevent", "mouseevents")) {
|
2021-04-15 20:50:02 +03:00
|
|
|
|
event = UIEvents::MouseEvent::create("", 0, 0, 0, 0);
|
2021-04-10 18:58:00 +02:00
|
|
|
|
} else if (interface_lowercase == "storageevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create StorageEvent
|
|
|
|
|
} else if (interface_lowercase == "svgevents") {
|
|
|
|
|
event = Event::create("");
|
|
|
|
|
} else if (interface_lowercase == "textevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create CompositionEvent
|
|
|
|
|
} else if (interface_lowercase == "touchevent") {
|
|
|
|
|
event = Event::create(""); // FIXME: Create TouchEvent
|
|
|
|
|
} else if (interface_lowercase.is_one_of("uievent", "uievents")) {
|
|
|
|
|
event = UIEvents::UIEvent::create("");
|
|
|
|
|
} else {
|
|
|
|
|
// FIXME:
|
|
|
|
|
// 3. If constructor is null, then throw a "NotSupportedError" DOMException.
|
|
|
|
|
// 4. If the interface indicated by constructor is not exposed on the relevant global object of this, then throw a "NotSupportedError" DOMException.
|
|
|
|
|
TODO();
|
|
|
|
|
}
|
|
|
|
|
// Setting type to empty string is handled by each constructor.
|
|
|
|
|
// FIXME:
|
|
|
|
|
// 7. Initialize event’s timeStamp attribute to a DOMHighResTimeStamp representing the high resolution time from the time origin to now.
|
|
|
|
|
event->set_is_trusted(false);
|
|
|
|
|
event->set_initialized(false);
|
|
|
|
|
return event.release_nonnull();
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
void Document::set_pending_parsing_blocking_script(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement* script)
|
2020-05-24 22:00:46 +02:00
|
|
|
|
{
|
|
|
|
|
m_pending_parsing_blocking_script = script;
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
NonnullRefPtr<HTML::HTMLScriptElement> Document::take_pending_parsing_blocking_script(Badge<HTML::HTMLDocumentParser>)
|
2020-05-27 23:01:04 +02:00
|
|
|
|
{
|
|
|
|
|
return m_pending_parsing_blocking_script.release_nonnull();
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
void Document::add_script_to_execute_when_parsing_has_finished(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
|
2020-05-30 12:26:15 +02:00
|
|
|
|
{
|
|
|
|
|
m_scripts_to_execute_when_parsing_has_finished.append(script);
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_when_parsing_has_finished(Badge<HTML::HTMLDocumentParser>)
|
2020-05-30 12:26:15 +02:00
|
|
|
|
{
|
|
|
|
|
return move(m_scripts_to_execute_when_parsing_has_finished);
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
void Document::add_script_to_execute_as_soon_as_possible(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
|
2020-05-30 12:26:15 +02:00
|
|
|
|
{
|
|
|
|
|
m_scripts_to_execute_as_soon_as_possible.append(script);
|
|
|
|
|
}
|
|
|
|
|
|
2020-07-28 18:20:36 +02:00
|
|
|
|
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_as_soon_as_possible(Badge<HTML::HTMLDocumentParser>)
|
2020-05-30 12:26:15 +02:00
|
|
|
|
{
|
|
|
|
|
return move(m_scripts_to_execute_as_soon_as_possible);
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-06 19:34:49 +01:00
|
|
|
|
// https://dom.spec.whatwg.org/#concept-node-adopt
|
|
|
|
|
void Document::adopt_node(Node& node)
|
2020-06-25 23:42:08 +02:00
|
|
|
|
{
|
2021-04-06 19:34:49 +01:00
|
|
|
|
auto& old_document = node.document();
|
|
|
|
|
if (node.parent())
|
|
|
|
|
node.remove();
|
|
|
|
|
|
|
|
|
|
if (&old_document != this) {
|
|
|
|
|
// FIXME: This should be shadow-including.
|
|
|
|
|
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
|
|
|
|
|
inclusive_descendant.set_document({}, *this);
|
|
|
|
|
// FIXME: If inclusiveDescendant is an element, then set the node document of each attribute in inclusiveDescendant’s attribute list to document.
|
|
|
|
|
return IterationDecision::Continue;
|
|
|
|
|
});
|
|
|
|
|
|
|
|
|
|
// FIXME: For each inclusiveDescendant in node’s shadow-including inclusive descendants that is custom,
|
|
|
|
|
// enqueue a custom element callback reaction with inclusiveDescendant, callback name "adoptedCallback",
|
|
|
|
|
// and an argument list containing oldDocument and document.
|
|
|
|
|
|
|
|
|
|
// FIXME: This should be shadow-including.
|
|
|
|
|
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
|
|
|
|
|
inclusive_descendant.adopted_from(old_document);
|
|
|
|
|
return IterationDecision::Continue;
|
|
|
|
|
});
|
|
|
|
|
}
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
// https://dom.spec.whatwg.org/#dom-document-adoptnode
|
2021-04-13 23:03:48 +04:30
|
|
|
|
ExceptionOr<NonnullRefPtr<Node>> Document::adopt_node_binding(NonnullRefPtr<Node> node)
|
2021-04-06 19:34:49 +01:00
|
|
|
|
{
|
2021-04-13 23:03:48 +04:30
|
|
|
|
if (is<Document>(*node))
|
|
|
|
|
return DOM ::NotSupportedError::create("Cannot adopt a document into a document");
|
2021-04-06 19:34:49 +01:00
|
|
|
|
|
2021-04-13 23:03:48 +04:30
|
|
|
|
if (is<ShadowRoot>(*node))
|
|
|
|
|
return DOM::HierarchyRequestError::create("Cannot adopt a shadow root into a document");
|
2021-04-06 19:34:49 +01:00
|
|
|
|
|
|
|
|
|
if (is<DocumentFragment>(*node) && downcast<DocumentFragment>(*node).host())
|
|
|
|
|
return node;
|
|
|
|
|
|
|
|
|
|
adopt_node(*node);
|
|
|
|
|
|
|
|
|
|
return node;
|
2020-06-25 23:42:08 +02:00
|
|
|
|
}
|
|
|
|
|
|
2020-07-18 21:17:17 +01:00
|
|
|
|
const DocumentType* Document::doctype() const
|
|
|
|
|
{
|
|
|
|
|
return first_child_of_type<DocumentType>();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
const String& Document::compat_mode() const
|
|
|
|
|
{
|
|
|
|
|
static String back_compat = "BackCompat";
|
|
|
|
|
static String css1_compat = "CSS1Compat";
|
|
|
|
|
|
|
|
|
|
if (m_quirks_mode == QuirksMode::Yes)
|
|
|
|
|
return back_compat;
|
|
|
|
|
|
|
|
|
|
return css1_compat;
|
|
|
|
|
}
|
|
|
|
|
|
2020-08-02 16:15:15 +02:00
|
|
|
|
bool Document::is_editable() const
|
|
|
|
|
{
|
|
|
|
|
return m_editable;
|
|
|
|
|
}
|
|
|
|
|
|
2020-08-14 19:40:37 +02:00
|
|
|
|
void Document::set_focused_element(Element* element)
|
|
|
|
|
{
|
|
|
|
|
if (m_focused_element == element)
|
|
|
|
|
return;
|
|
|
|
|
|
AK: Make RefPtr, NonnullRefPtr, WeakPtr thread safe
This makes most operations thread safe, especially so that they
can safely be used in the Kernel. This includes obtaining a strong
reference from a weak reference, which now requires an explicit
call to WeakPtr::strong_ref(). Another major change is that
Weakable::make_weak_ref() may require the explicit target type.
Previously we used reinterpret_cast in WeakPtr, assuming that it
can be properly converted. But WeakPtr does not necessarily have
the knowledge to be able to do this. Instead, we now ask the class
itself to deliver a WeakPtr to the type that we want.
Also, WeakLink is no longer specific to a target type. The reason
for this is that we want to be able to safely convert e.g. WeakPtr<T>
to WeakPtr<U>, and before this we just reinterpret_cast the internal
WeakLink<T> to WeakLink<U>, which is a bold assumption that it would
actually produce the correct code. Instead, WeakLink now operates
on just a raw pointer and we only make those constructors/operators
available if we can verify that it can be safely cast.
In order to guarantee thread safety, we now use the least significant
bit in the pointer for locking purposes. This also means that only
properly aligned pointers can be used.
2020-09-29 16:26:13 -06:00
|
|
|
|
m_focused_element = element;
|
2020-08-14 19:40:37 +02:00
|
|
|
|
|
|
|
|
|
if (m_layout_root)
|
|
|
|
|
m_layout_root->set_needs_display();
|
|
|
|
|
}
|
|
|
|
|
|
2020-08-31 13:56:16 +01:00
|
|
|
|
void Document::set_ready_state(const String& ready_state)
|
|
|
|
|
{
|
|
|
|
|
m_ready_state = ready_state;
|
2020-11-21 19:15:57 +00:00
|
|
|
|
dispatch_event(Event::create(HTML::EventNames::readystatechange));
|
2020-08-31 13:56:16 +01:00
|
|
|
|
}
|
|
|
|
|
|
2020-11-12 18:23:05 +01:00
|
|
|
|
Page* Document::page()
|
|
|
|
|
{
|
|
|
|
|
return m_frame ? m_frame->page() : nullptr;
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
const Page* Document::page() const
|
|
|
|
|
{
|
|
|
|
|
return m_frame ? m_frame->page() : nullptr;
|
|
|
|
|
}
|
|
|
|
|
|
2020-11-21 18:32:39 +00:00
|
|
|
|
EventTarget* Document::get_parent(const Event& event)
|
|
|
|
|
{
|
2020-11-21 19:15:57 +00:00
|
|
|
|
if (event.type() == HTML::EventNames::load)
|
2020-11-21 18:32:39 +00:00
|
|
|
|
return nullptr;
|
|
|
|
|
|
|
|
|
|
return &window();
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
void Document::completely_finish_loading()
|
|
|
|
|
{
|
|
|
|
|
// FIXME: This needs to handle iframes.
|
2020-11-21 19:15:57 +00:00
|
|
|
|
dispatch_event(DOM::Event::create(HTML::EventNames::load));
|
2020-11-21 18:32:39 +00:00
|
|
|
|
}
|
|
|
|
|
|
2021-04-13 17:30:41 -04:00
|
|
|
|
String Document::cookie(Cookie::Source source)
|
2021-03-14 16:35:28 +01:00
|
|
|
|
{
|
2021-04-11 10:54:11 -04:00
|
|
|
|
if (auto* page = this->page())
|
2021-04-13 17:30:41 -04:00
|
|
|
|
return page->client().page_did_request_cookie(m_url, source);
|
2021-03-14 16:35:28 +01:00
|
|
|
|
return {};
|
|
|
|
|
}
|
|
|
|
|
|
2021-04-15 10:36:20 -04:00
|
|
|
|
void Document::set_cookie(String cookie_string, Cookie::Source source)
|
2021-03-14 16:35:28 +01:00
|
|
|
|
{
|
2021-04-15 10:36:20 -04:00
|
|
|
|
auto cookie = Cookie::parse_cookie(cookie_string);
|
|
|
|
|
if (!cookie.has_value())
|
|
|
|
|
return;
|
|
|
|
|
|
2021-04-11 10:54:11 -04:00
|
|
|
|
if (auto* page = this->page())
|
2021-04-15 10:36:20 -04:00
|
|
|
|
page->client().page_did_set_cookie(m_url, cookie.value(), source);
|
2021-03-14 16:35:28 +01:00
|
|
|
|
}
|
|
|
|
|
|
2020-03-07 10:27:02 +01:00
|
|
|
|
}
|