ladybird/Userland/Libraries/LibWeb/DOM/Document.cpp

1161 lines
39 KiB
C++
Raw Normal View History

/*
* Copyright (c) 2018-2021, Andreas Kling <kling@serenityos.org>
* Copyright (c) 2021, Linus Groh <linusg@serenityos.org>
* Copyright (c) 2021, Luke Wilde <lukew@serenityos.org>
* Copyright (c) 2021, Sam Atkins <atkinssj@serenityos.org>
*
* SPDX-License-Identifier: BSD-2-Clause
*/
#include <AK/CharacterTypes.h>
#include <AK/StringBuilder.h>
#include <AK/Utf8View.h>
#include <LibCore/Timer.h>
#include <LibJS/Interpreter.h>
#include <LibJS/Parser.h>
#include <LibJS/Runtime/FunctionObject.h>
#include <LibWeb/Bindings/MainThreadVM.h>
#include <LibWeb/Bindings/WindowObject.h>
#include <LibWeb/CSS/MediaQueryListEvent.h>
#include <LibWeb/CSS/StyleComputer.h>
#include <LibWeb/Cookie/ParsedCookie.h>
#include <LibWeb/DOM/Comment.h>
#include <LibWeb/DOM/CustomEvent.h>
#include <LibWeb/DOM/DOMException.h>
#include <LibWeb/DOM/Document.h>
#include <LibWeb/DOM/DocumentFragment.h>
#include <LibWeb/DOM/DocumentType.h>
#include <LibWeb/DOM/Element.h>
#include <LibWeb/DOM/ElementFactory.h>
2020-08-31 13:56:16 +01:00
#include <LibWeb/DOM/Event.h>
#include <LibWeb/DOM/ExceptionOr.h>
#include <LibWeb/DOM/HTMLCollection.h>
#include <LibWeb/DOM/Range.h>
#include <LibWeb/DOM/ShadowRoot.h>
#include <LibWeb/DOM/Text.h>
#include <LibWeb/DOM/Window.h>
#include <LibWeb/Dump.h>
#include <LibWeb/HTML/AttributeNames.h>
#include <LibWeb/HTML/EventLoop/EventLoop.h>
#include <LibWeb/HTML/EventNames.h>
#include <LibWeb/HTML/HTMLAnchorElement.h>
#include <LibWeb/HTML/HTMLAreaElement.h>
#include <LibWeb/HTML/HTMLBodyElement.h>
#include <LibWeb/HTML/HTMLEmbedElement.h>
#include <LibWeb/HTML/HTMLFormElement.h>
#include <LibWeb/HTML/HTMLFrameSetElement.h>
#include <LibWeb/HTML/HTMLHeadElement.h>
#include <LibWeb/HTML/HTMLHtmlElement.h>
#include <LibWeb/HTML/HTMLIFrameElement.h>
#include <LibWeb/HTML/HTMLImageElement.h>
#include <LibWeb/HTML/HTMLScriptElement.h>
#include <LibWeb/HTML/HTMLTitleElement.h>
#include <LibWeb/HTML/MessageEvent.h>
#include <LibWeb/Layout/BlockFormattingContext.h>
#include <LibWeb/Layout/InitialContainingBlock.h>
#include <LibWeb/Layout/TreeBuilder.h>
2020-10-10 02:48:05 +01:00
#include <LibWeb/Namespace.h>
#include <LibWeb/Origin.h>
#include <LibWeb/Page/BrowsingContext.h>
#include <LibWeb/Page/Page.h>
#include <LibWeb/SVG/TagNames.h>
#include <LibWeb/UIEvents/EventNames.h>
#include <LibWeb/UIEvents/KeyboardEvent.h>
#include <LibWeb/UIEvents/MouseEvent.h>
namespace Web::DOM {
Document::Document(const AK::URL& url)
: ParentNode(*this, NodeType::DOCUMENT_NODE)
, m_style_computer(make<CSS::StyleComputer>(*this))
, m_style_sheets(CSS::StyleSheetList::create(*this))
, m_url(url)
, m_window(Window::create_with_document(*this))
, m_implementation(DOMImplementation::create(*this))
, m_history(HTML::History::create(*this))
{
HTML::main_thread_event_loop().register_document({}, *this);
m_style_update_timer = Core::Timer::create_single_shot(0, [this] {
update_style();
});
m_layout_update_timer = Core::Timer::create_single_shot(0, [this] {
force_layout();
});
}
Document::~Document()
{
}
void Document::removed_last_ref()
{
VERIFY(!ref_count());
VERIFY(!m_deletion_has_begun);
if (m_referencing_node_count) {
// The document has reached ref_count==0 but still has nodes keeping it alive.
// At this point, sever all the node links we control.
// If nodes remain elsewhere (e.g JS wrappers), they will keep the document alive.
// NOTE: This makes sure we stay alive across for the duration of the cleanup below.
increment_referencing_node_count();
m_focused_element = nullptr;
m_hovered_node = nullptr;
m_pending_parsing_blocking_script = nullptr;
m_inspected_node = nullptr;
m_scripts_to_execute_when_parsing_has_finished.clear();
m_scripts_to_execute_as_soon_as_possible.clear();
m_associated_inert_template_document = nullptr;
m_interpreter = nullptr;
{
// Gather up all the descendants of this document and prune them from the tree.
// FIXME: This could definitely be more elegant.
NonnullRefPtrVector<Node> descendants;
for_each_in_inclusive_subtree([&](auto& node) {
if (&node != this)
descendants.append(node);
return IterationDecision::Continue;
});
for (auto& node : descendants) {
VERIFY(&node.document() == this);
VERIFY(!node.is_document());
if (node.parent())
node.remove();
}
}
m_in_removed_last_ref = false;
decrement_referencing_node_count();
return;
}
m_in_removed_last_ref = false;
m_deletion_has_begun = true;
HTML::main_thread_event_loop().unregister_document({}, *this);
delete this;
}
Origin Document::origin() const
{
if (!m_url.is_valid())
return {};
return { m_url.protocol(), m_url.host(), m_url.port_or_default() };
}
void Document::set_origin(const Origin& origin)
{
m_url.set_protocol(origin.protocol());
m_url.set_host(origin.host());
m_url.set_port(origin.port());
}
void Document::schedule_style_update()
{
if (m_style_update_timer->is_active())
return;
m_style_update_timer->start();
}
void Document::schedule_layout_update()
{
if (m_layout_update_timer->is_active())
return;
m_layout_update_timer->start();
}
bool Document::is_child_allowed(const Node& node) const
{
switch (node.type()) {
case NodeType::DOCUMENT_NODE:
case NodeType::TEXT_NODE:
return false;
case NodeType::COMMENT_NODE:
return true;
case NodeType::DOCUMENT_TYPE_NODE:
return !first_child_of_type<DocumentType>();
case NodeType::ELEMENT_NODE:
return !first_child_of_type<Element>();
default:
return false;
}
}
Element* Document::document_element()
{
return first_child_of_type<Element>();
}
const Element* Document::document_element() const
{
return first_child_of_type<Element>();
}
HTML::HTMLHtmlElement* Document::html_element()
{
auto* html = document_element();
if (is<HTML::HTMLHtmlElement>(html))
return verify_cast<HTML::HTMLHtmlElement>(html);
return nullptr;
}
HTML::HTMLHeadElement* Document::head()
{
auto* html = html_element();
if (!html)
return nullptr;
return html->first_child_of_type<HTML::HTMLHeadElement>();
}
HTML::HTMLElement* Document::body()
{
auto* html = html_element();
if (!html)
return nullptr;
auto* first_body = html->first_child_of_type<HTML::HTMLBodyElement>();
if (first_body)
return first_body;
auto* first_frameset = html->first_child_of_type<HTML::HTMLFrameSetElement>();
if (first_frameset)
return first_frameset;
return nullptr;
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-body
ExceptionOr<void> Document::set_body(HTML::HTMLElement* new_body)
{
if (!is<HTML::HTMLBodyElement>(new_body) && !is<HTML::HTMLFrameSetElement>(new_body))
return DOM::HierarchyRequestError::create("Invalid document body element, must be 'body' or 'frameset'");
auto* existing_body = body();
if (existing_body) {
auto replace_result = existing_body->parent()->replace_child(*new_body, *existing_body);
if (replace_result.is_exception())
return replace_result.exception();
return {};
}
auto* document_element = this->document_element();
if (!document_element)
return DOM::HierarchyRequestError::create("Missing document element");
auto append_result = document_element->append_child(*new_body);
if (append_result.is_exception())
return append_result.exception();
return {};
}
String Document::title() const
{
auto* head_element = head();
if (!head_element)
return {};
auto* title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
if (!title_element)
return {};
auto raw_title = title_element->text_content();
StringBuilder builder;
bool last_was_space = false;
for (auto code_point : Utf8View(raw_title)) {
if (is_ascii_space(code_point)) {
last_was_space = true;
} else {
if (last_was_space && !builder.is_empty())
builder.append(' ');
builder.append_code_point(code_point);
last_was_space = false;
}
}
return builder.to_string();
}
void Document::set_title(const String& title)
{
auto* head_element = const_cast<HTML::HTMLHeadElement*>(head());
if (!head_element)
return;
RefPtr<HTML::HTMLTitleElement> title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
if (!title_element) {
title_element = static_ptr_cast<HTML::HTMLTitleElement>(create_element(HTML::TagNames::title));
head_element->append_child(*title_element);
}
title_element->remove_all_children(true);
title_element->append_child(adopt_ref(*new Text(*this, title)));
if (auto* page = this->page()) {
if (browsing_context() == &page->top_level_browsing_context())
page->client().page_did_change_title(title);
}
}
void Document::attach_to_browsing_context(Badge<BrowsingContext>, BrowsingContext& browsing_context)
{
m_browsing_context = browsing_context;
update_layout();
}
void Document::detach_from_browsing_context(Badge<BrowsingContext>, BrowsingContext& browsing_context)
{
VERIFY(&browsing_context == m_browsing_context);
tear_down_layout_tree();
m_browsing_context = nullptr;
}
void Document::tear_down_layout_tree()
{
if (!m_layout_root)
return;
// Gather up all the layout nodes in a vector and detach them from parents
// while the vector keeps them alive.
NonnullRefPtrVector<Layout::Node> layout_nodes;
m_layout_root->for_each_in_inclusive_subtree([&](auto& layout_node) {
layout_nodes.append(layout_node);
return IterationDecision::Continue;
});
for (auto& layout_node : layout_nodes) {
if (layout_node.parent())
layout_node.parent()->remove_child(layout_node);
}
m_layout_root = nullptr;
}
Color Document::background_color(const Palette& palette) const
{
auto default_color = palette.base();
auto* body_element = body();
if (!body_element)
return default_color;
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return default_color;
auto color = body_layout_node->computed_values().background_color();
if (!color.alpha())
return default_color;
return color;
}
RefPtr<Gfx::Bitmap> Document::background_image() const
{
auto* body_element = body();
if (!body_element)
return {};
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return {};
auto background_image = body_layout_node->background_image();
if (!background_image)
return {};
return background_image->bitmap();
}
CSS::Repeat Document::background_repeat_x() const
{
auto* body_element = body();
if (!body_element)
return CSS::Repeat::Repeat;
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return CSS::Repeat::Repeat;
return body_layout_node->computed_values().background_repeat_x();
}
CSS::Repeat Document::background_repeat_y() const
{
auto* body_element = body();
if (!body_element)
return CSS::Repeat::Repeat;
auto* body_layout_node = body_element->layout_node();
if (!body_layout_node)
return CSS::Repeat::Repeat;
return body_layout_node->computed_values().background_repeat_y();
}
// https://html.spec.whatwg.org/multipage/urls-and-fetching.html#parse-a-url
AK::URL Document::parse_url(String const& url) const
{
// FIXME: Make sure we do this according to spec.
return m_url.complete_url(url);
}
void Document::set_needs_layout()
{
if (m_needs_layout)
return;
m_needs_layout = true;
schedule_layout_update();
}
void Document::force_layout()
{
tear_down_layout_tree();
update_layout();
}
void Document::ensure_layout()
{
if (m_needs_layout || !m_layout_root)
update_layout();
}
void Document::update_layout()
{
if (!m_needs_layout && m_layout_root)
return;
if (!browsing_context())
return;
update_style();
if (!m_layout_root) {
Layout::TreeBuilder tree_builder;
m_layout_root = static_ptr_cast<Layout::InitialContainingBlock>(tree_builder.build(*this));
}
Layout::BlockFormattingContext root_formatting_context(*m_layout_root, nullptr);
root_formatting_context.run(*m_layout_root, Layout::LayoutMode::Default);
m_layout_root->set_needs_display();
if (browsing_context()->is_top_level()) {
if (auto* page = this->page())
page->client().page_did_layout();
}
m_needs_layout = false;
}
static void update_style_recursively(DOM::Node& node)
{
node.for_each_child([&](auto& child) {
if (child.needs_style_update()) {
if (is<Element>(child))
verify_cast<Element>(child).recompute_style();
child.set_needs_style_update(false);
}
if (child.child_needs_style_update()) {
update_style_recursively(child);
child.set_child_needs_style_update(false);
}
return IterationDecision::Continue;
});
}
void Document::update_style()
{
if (!browsing_context())
return;
if (!needs_style_update() && !child_needs_style_update())
return;
update_style_recursively(*this);
set_needs_layout();
}
RefPtr<Layout::Node> Document::create_layout_node()
{
return adopt_ref(*new Layout::InitialContainingBlock(*this, style_computer().create_document_style()));
}
void Document::set_link_color(Color color)
{
m_link_color = color;
}
void Document::set_active_link_color(Color color)
{
m_active_link_color = color;
}
void Document::set_visited_link_color(Color color)
{
m_visited_link_color = color;
}
const Layout::InitialContainingBlock* Document::layout_node() const
{
return static_cast<const Layout::InitialContainingBlock*>(Node::layout_node());
}
Layout::InitialContainingBlock* Document::layout_node()
{
return static_cast<Layout::InitialContainingBlock*>(Node::layout_node());
}
void Document::set_inspected_node(Node* node)
{
if (m_inspected_node == node)
return;
if (m_inspected_node && m_inspected_node->layout_node())
m_inspected_node->layout_node()->set_needs_display();
m_inspected_node = node;
if (m_inspected_node && m_inspected_node->layout_node())
m_inspected_node->layout_node()->set_needs_display();
}
void Document::set_hovered_node(Node* node)
{
if (m_hovered_node == node)
return;
RefPtr<Node> old_hovered_node = move(m_hovered_node);
m_hovered_node = node;
invalidate_style();
}
NonnullRefPtr<HTMLCollection> Document::get_elements_by_name(String const& name)
{
return HTMLCollection::create(*this, [name](Element const& element) {
return element.name() == name;
});
}
NonnullRefPtr<HTMLCollection> Document::get_elements_by_class_name(FlyString const& class_name)
{
return HTMLCollection::create(*this, [class_name, quirks_mode = document().in_quirks_mode()](Element const& element) {
return element.has_class(class_name, quirks_mode ? CaseSensitivity::CaseInsensitive : CaseSensitivity::CaseSensitive);
});
}
// https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-applets
NonnullRefPtr<HTMLCollection> Document::applets()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](auto&) { return false; });
}
// https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-anchors
NonnullRefPtr<HTMLCollection> Document::anchors()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLAnchorElement>(element) && element.has_attribute(HTML::AttributeNames::name);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-images
NonnullRefPtr<HTMLCollection> Document::images()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLImageElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-embeds
NonnullRefPtr<HTMLCollection> Document::embeds()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLEmbedElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-plugins
NonnullRefPtr<HTMLCollection> Document::plugins()
{
return embeds();
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-links
NonnullRefPtr<HTMLCollection> Document::links()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return (is<HTML::HTMLAnchorElement>(element) || is<HTML::HTMLAreaElement>(element)) && element.has_attribute(HTML::AttributeNames::href);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-forms
NonnullRefPtr<HTMLCollection> Document::forms()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLFormElement>(element);
});
}
// https://html.spec.whatwg.org/multipage/dom.html#dom-document-scripts
NonnullRefPtr<HTMLCollection> Document::scripts()
{
// FIXME: This should return the same HTMLCollection object every time,
// but that would cause a reference cycle since HTMLCollection refs the root.
return HTMLCollection::create(*this, [](Element const& element) {
return is<HTML::HTMLScriptElement>(element);
});
}
Color Document::link_color() const
{
if (m_link_color.has_value())
return m_link_color.value();
if (!page())
return Color::Blue;
return page()->palette().link();
}
Color Document::active_link_color() const
{
if (m_active_link_color.has_value())
return m_active_link_color.value();
if (!page())
return Color::Red;
return page()->palette().active_link();
}
Color Document::visited_link_color() const
{
if (m_visited_link_color.has_value())
return m_visited_link_color.value();
if (!page())
return Color::Magenta;
return page()->palette().visited_link();
}
JS::Realm& Document::realm()
{
return interpreter().realm();
}
JS::Interpreter& Document::interpreter()
{
if (!m_interpreter) {
auto& vm = Bindings::main_thread_vm();
m_interpreter = JS::Interpreter::create<Bindings::WindowObject>(vm, *m_window);
// NOTE: We must hook `on_call_stack_emptied` after the interpreter was created, as the initialization of the
// WindowsObject can invoke some internal calls, which will eventually lead to this hook being called without
// `m_interpreter` being fully initialized yet.
// TODO: Hook up vm.on_promise_unhandled_rejection and vm.on_promise_rejection_handled
// See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises#promise_rejection_events
vm.on_call_stack_emptied = [this] {
auto& vm = m_interpreter->vm();
vm.run_queued_promise_jobs();
vm.run_queued_finalization_registry_cleanup_jobs();
// FIXME: This isn't exactly the right place for this.
HTML::main_thread_event_loop().perform_a_microtask_checkpoint();
// Note: This is not an exception check for the promise jobs, they will just leave any
// exception that already exists intact and never throw a new one (without cleaning it
// up, that is). Taking care of any previous unhandled exception just happens to be the
// very last thing we want to do, even after running promise jobs.
if (auto* exception = vm.exception()) {
auto value = exception->value();
if (value.is_object()) {
auto& object = value.as_object();
auto name = object.get_without_side_effects(vm.names.name).value_or(JS::js_undefined());
auto message = object.get_without_side_effects(vm.names.message).value_or(JS::js_undefined());
if (name.is_accessor() || message.is_accessor()) {
// The result is not going to be useful, let's just print the value. This affects DOMExceptions, for example.
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m {}", value);
} else {
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m [{}] {}", name, message);
}
} else {
dbgln("\033[31;1mUnhandled JavaScript exception:\033[0m {}", value);
}
for (auto& traceback_frame : exception->traceback()) {
auto& function_name = traceback_frame.function_name;
auto& source_range = traceback_frame.source_range;
dbgln(" {} at {}:{}:{}", function_name, source_range.filename, source_range.start.line, source_range.start.column);
}
}
vm.finish_execution_generation();
};
}
return *m_interpreter;
}
JS::Value Document::run_javascript(const StringView& source, const StringView& filename)
{
auto parser = JS::Parser(JS::Lexer(source, filename));
auto program = parser.parse_program();
if (parser.has_errors()) {
parser.print_errors(false);
return JS::js_undefined();
}
auto& interpreter = document().interpreter();
auto& vm = interpreter.vm();
interpreter.run(interpreter.global_object(), *program);
if (vm.exception())
vm.clear_exception();
return vm.last_value();
}
// https://dom.spec.whatwg.org/#dom-document-createelement
// FIXME: This only implements step 6 of the algorithm and does not take in options.
NonnullRefPtr<Element> Document::create_element(const String& tag_name)
{
2020-10-10 02:48:05 +01:00
// FIXME: Let namespace be the HTML namespace, if this is an HTML document or thiss content type is "application/xhtml+xml", and null otherwise.
return DOM::create_element(*this, tag_name, Namespace::HTML);
}
// https://dom.spec.whatwg.org/#internal-createelementns-steps
// FIXME: This only implements step 4 of the algorithm and does not take in options.
NonnullRefPtr<Element> Document::create_element_ns(const String& namespace_, const String& qualified_name)
{
return DOM::create_element(*this, qualified_name, namespace_);
}
NonnullRefPtr<DocumentFragment> Document::create_document_fragment()
{
return adopt_ref(*new DocumentFragment(*this));
}
NonnullRefPtr<Text> Document::create_text_node(const String& data)
{
return adopt_ref(*new Text(*this, data));
}
NonnullRefPtr<Comment> Document::create_comment(const String& data)
{
return adopt_ref(*new Comment(*this, data));
}
NonnullRefPtr<Range> Document::create_range()
{
return Range::create(*this);
}
// https://dom.spec.whatwg.org/#dom-document-createevent
NonnullRefPtr<Event> Document::create_event(const String& interface)
{
auto interface_lowercase = interface.to_lowercase();
RefPtr<Event> event;
if (interface_lowercase == "beforeunloadevent") {
event = Event::create(""); // FIXME: Create BeforeUnloadEvent
} else if (interface_lowercase == "compositionevent") {
event = Event::create(""); // FIXME: Create CompositionEvent
} else if (interface_lowercase == "customevent") {
event = CustomEvent::create("");
} else if (interface_lowercase == "devicemotionevent") {
event = Event::create(""); // FIXME: Create DeviceMotionEvent
} else if (interface_lowercase == "deviceorientationevent") {
event = Event::create(""); // FIXME: Create DeviceOrientationEvent
} else if (interface_lowercase == "dragevent") {
event = Event::create(""); // FIXME: Create DragEvent
} else if (interface_lowercase.is_one_of("event", "events")) {
event = Event::create("");
} else if (interface_lowercase == "focusevent") {
event = Event::create(""); // FIXME: Create FocusEvent
} else if (interface_lowercase == "hashchangeevent") {
event = Event::create(""); // FIXME: Create HashChangeEvent
} else if (interface_lowercase == "htmlevents") {
event = Event::create("");
} else if (interface_lowercase == "keyboardevent") {
event = UIEvents::KeyboardEvent::create("");
} else if (interface_lowercase == "messageevent") {
event = HTML::MessageEvent::create("");
} else if (interface_lowercase.is_one_of("mouseevent", "mouseevents")) {
event = UIEvents::MouseEvent::create("", 0, 0, 0, 0);
} else if (interface_lowercase == "storageevent") {
event = Event::create(""); // FIXME: Create StorageEvent
} else if (interface_lowercase == "svgevents") {
event = Event::create("");
} else if (interface_lowercase == "textevent") {
event = Event::create(""); // FIXME: Create CompositionEvent
} else if (interface_lowercase == "touchevent") {
event = Event::create(""); // FIXME: Create TouchEvent
} else if (interface_lowercase.is_one_of("uievent", "uievents")) {
event = UIEvents::UIEvent::create("");
} else {
// FIXME:
// 3. If constructor is null, then throw a "NotSupportedError" DOMException.
// 4. If the interface indicated by constructor is not exposed on the relevant global object of this, then throw a "NotSupportedError" DOMException.
TODO();
}
// Setting type to empty string is handled by each constructor.
// FIXME:
// 7. Initialize events timeStamp attribute to a DOMHighResTimeStamp representing the high resolution time from the time origin to now.
event->set_is_trusted(false);
event->set_initialized(false);
return event.release_nonnull();
}
void Document::set_pending_parsing_blocking_script(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement* script)
{
m_pending_parsing_blocking_script = script;
}
NonnullRefPtr<HTML::HTMLScriptElement> Document::take_pending_parsing_blocking_script(Badge<HTML::HTMLParser>)
{
return m_pending_parsing_blocking_script.release_nonnull();
}
void Document::add_script_to_execute_when_parsing_has_finished(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
{
m_scripts_to_execute_when_parsing_has_finished.append(script);
}
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_when_parsing_has_finished(Badge<HTML::HTMLParser>)
{
return move(m_scripts_to_execute_when_parsing_has_finished);
}
void Document::add_script_to_execute_as_soon_as_possible(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
{
m_scripts_to_execute_as_soon_as_possible.append(script);
}
NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_as_soon_as_possible(Badge<HTML::HTMLParser>)
{
return move(m_scripts_to_execute_as_soon_as_possible);
}
2021-09-26 17:41:51 +01:00
// https://dom.spec.whatwg.org/#dom-document-importnode
ExceptionOr<NonnullRefPtr<Node>> Document::import_node(NonnullRefPtr<Node> node, bool deep)
{
// 1. If node is a document or shadow root, then throw a "NotSupportedError" DOMException.
if (is<Document>(*node) || is<ShadowRoot>(*node))
return DOM::NotSupportedError::create("Cannot import a document or shadow root.");
// 2. Return a clone of node, with this and the clone children flag set if deep is true.
return node->clone_node(this, deep);
}
// https://dom.spec.whatwg.org/#concept-node-adopt
void Document::adopt_node(Node& node)
{
auto& old_document = node.document();
if (node.parent())
node.remove();
if (&old_document != this) {
// FIXME: This should be shadow-including.
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
inclusive_descendant.set_document({}, *this);
// FIXME: If inclusiveDescendant is an element, then set the node document of each attribute in inclusiveDescendants attribute list to document.
return IterationDecision::Continue;
});
// FIXME: For each inclusiveDescendant in nodes shadow-including inclusive descendants that is custom,
// enqueue a custom element callback reaction with inclusiveDescendant, callback name "adoptedCallback",
// and an argument list containing oldDocument and document.
// FIXME: This should be shadow-including.
node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
inclusive_descendant.adopted_from(old_document);
return IterationDecision::Continue;
});
}
}
// https://dom.spec.whatwg.org/#dom-document-adoptnode
ExceptionOr<NonnullRefPtr<Node>> Document::adopt_node_binding(NonnullRefPtr<Node> node)
{
if (is<Document>(*node))
return DOM::NotSupportedError::create("Cannot adopt a document into a document");
if (is<ShadowRoot>(*node))
return DOM::HierarchyRequestError::create("Cannot adopt a shadow root into a document");
if (is<DocumentFragment>(*node) && verify_cast<DocumentFragment>(*node).host())
return node;
adopt_node(*node);
return node;
}
const DocumentType* Document::doctype() const
{
return first_child_of_type<DocumentType>();
}
const String& Document::compat_mode() const
{
static String back_compat = "BackCompat";
static String css1_compat = "CSS1Compat";
if (m_quirks_mode == QuirksMode::Yes)
return back_compat;
return css1_compat;
}
bool Document::is_editable() const
{
return m_editable;
}
void Document::set_focused_element(Element* element)
{
if (m_focused_element == element)
return;
m_focused_element = element;
if (m_layout_root)
m_layout_root->set_needs_display();
}
void Document::set_active_element(Element* element)
{
if (m_active_element == element)
return;
m_active_element = element;
if (m_layout_root)
m_layout_root->set_needs_display();
}
String Document::ready_state() const
{
switch (m_readiness) {
case HTML::DocumentReadyState::Loading:
return "loading"sv;
case HTML::DocumentReadyState::Interactive:
return "interactive"sv;
case HTML::DocumentReadyState::Complete:
return "complete"sv;
}
VERIFY_NOT_REACHED();
}
// https://html.spec.whatwg.org/#update-the-current-document-readiness
void Document::update_readiness(HTML::DocumentReadyState readiness_value)
2020-08-31 13:56:16 +01:00
{
// 1. If document's current document readiness equals readinessValue, then return.
if (m_readiness == readiness_value)
return;
// The spec doesn't actually mention updating the current readiness value.
// FIXME: https://github.com/whatwg/html/issues/7120
m_readiness = readiness_value;
// FIXME: 2. If document is associated with an HTML parser, then:
// FIXME: 1. If document is associated with an HTML parser, then:
// FIXME: 2. If readinessValue is "complete", and document's load timing info's DOM complete time is 0, then set document's load timing info's DOM complete time to now.
// FIXME: 3. Otherwise, if readinessValue is "interactive", and document's load timing info's DOM interactive time is 0, then set document's load timing info's DOM interactive time to now.
// 3. Fire an event named readystatechange at document.
dispatch_event(Event::create(HTML::EventNames::readystatechange));
2020-08-31 13:56:16 +01:00
}
Page* Document::page()
{
return m_browsing_context ? m_browsing_context->page() : nullptr;
}
const Page* Document::page() const
{
return m_browsing_context ? m_browsing_context->page() : nullptr;
}
EventTarget* Document::get_parent(const Event& event)
{
if (event.type() == HTML::EventNames::load)
return nullptr;
return &window();
}
// https://html.spec.whatwg.org/multipage/browsing-the-web.html#completely-finish-loading
void Document::completely_finish_loading()
{
// 1. Assert: document's browsing context is non-null.
VERIFY(browsing_context());
// FIXME: 2. Set document's completely loaded time to the current time.
// 3. Let container be document's browsing context's container.
auto* container = browsing_context()->container();
// If container is an iframe element, then queue an element task on the DOM manipulation task source given container to run the iframe load event steps given container.
if (container && is<HTML::HTMLIFrameElement>(*container)) {
container->queue_an_element_task(HTML::Task::Source::DOMManipulation, [container]() mutable {
run_iframe_load_event_steps(static_cast<HTML::HTMLIFrameElement&>(*container));
});
}
// Otherwise, if container is non-null, then queue an element task on the DOM manipulation task source given container to fire an event named load at container.
else if (container) {
container->queue_an_element_task(HTML::Task::Source::DOMManipulation, [container]() mutable {
container->dispatch_event(DOM::Event::create(HTML::EventNames::load));
});
}
}
String Document::cookie(Cookie::Source source)
{
if (auto* page = this->page())
return page->client().page_did_request_cookie(m_url, source);
return {};
}
void Document::set_cookie(String cookie_string, Cookie::Source source)
{
auto cookie = Cookie::parse_cookie(cookie_string);
if (!cookie.has_value())
return;
if (auto* page = this->page())
page->client().page_did_set_cookie(m_url, cookie.value(), source);
}
String Document::dump_dom_tree_as_json() const
{
StringBuilder builder;
JsonObjectSerializer json(builder);
serialize_tree_as_json(json);
json.finish();
return builder.to_string();
}
// https://html.spec.whatwg.org/multipage/semantics.html#has-a-style-sheet-that-is-blocking-scripts
bool Document::has_a_style_sheet_that_is_blocking_scripts() const
{
// A Document has a style sheet that is blocking scripts if its script-blocking style sheet counter is greater than 0,
if (m_script_blocking_style_sheet_counter > 0)
return true;
// ...or if that Document has a non-null browsing context whose container document is non-null and has a script-blocking style sheet counter greater than 0.
if (!browsing_context() || !browsing_context()->container_document())
return false;
return browsing_context()->container_document()->m_script_blocking_style_sheet_counter > 0;
}
String Document::referrer() const
{
// FIXME: Return the document's actual referrer.
return "";
}
// https://html.spec.whatwg.org/multipage/browsers.html#fully-active
bool Document::is_fully_active() const
{
// A Document d is said to be fully active when d's browsing context is non-null, d's browsing context's active document is d,
// and either d's browsing context is a top-level browsing context, or d's browsing context's container document is fully active.
return browsing_context() && browsing_context()->active_document() == this && (browsing_context()->is_top_level() || browsing_context()->container_document()->is_fully_active());
}
// https://html.spec.whatwg.org/multipage/browsers.html#active-document
bool Document::is_active() const
{
// A browsing context's active document is its active window's associated Document.
return browsing_context() && browsing_context()->active_document() == this;
}
// https://html.spec.whatwg.org/multipage/history.html#dom-document-location
Bindings::LocationObject* Document::location()
{
// The Document object's location attribute's getter must return this Document object's relevant global object's Location object,
// if this Document object is fully active, and null otherwise.
if (!is_fully_active())
return nullptr;
return window().wrapper()->location_object();
}
// https://w3c.github.io/page-visibility/#hidden-attribute
bool Document::hidden() const
{
return false;
}
// https://w3c.github.io/page-visibility/#visibilitystate-attribute
String Document::visibility_state() const
{
return hidden() ? "hidden" : "visible";
}
// https://drafts.csswg.org/cssom-view/#run-the-resize-steps
void Document::run_the_resize_steps()
{
// 1. If docs viewport has had its width or height changed
// (e.g. as a result of the user resizing the browser window, or changing the page zoom scale factor,
// or an iframe elements dimensions are changed) since the last time these steps were run,
// fire an event named resize at the Window object associated with doc.
if (!browsing_context())
return;
auto viewport_size = browsing_context()->viewport_rect().size();
if (m_last_viewport_size == viewport_size)
return;
m_last_viewport_size = viewport_size;
dispatch_event(DOM::Event::create(UIEvents::EventNames::resize));
update_layout();
}
void Document::add_media_query_list(NonnullRefPtr<CSS::MediaQueryList>& media_query_list)
{
m_media_query_lists.append(media_query_list);
}
// https://drafts.csswg.org/cssom-view/#evaluate-media-queries-and-report-changes
void Document::evaluate_media_queries_and_report_changes()
{
// NOTE: Not in the spec, but we take this opportunity to prune null WeakPtrs.
m_media_query_lists.remove_all_matching([](auto& it) {
return it.is_null();
});
// 1. For each MediaQueryList object target that has doc as its document,
// in the order they were created, oldest first, run these substeps:
for (auto& media_query_list_ptr : m_media_query_lists) {
// 1.1. If targets matches state has changed since the last time these steps
// were run, fire an event at target using the MediaQueryListEvent constructor,
// with its type attribute initialized to change, its isTrusted attribute
// initialized to true, its media attribute initialized to targets media,
// and its matches attribute initialized to targets matches state.
if (media_query_list_ptr.is_null())
continue;
auto media_query_list = media_query_list_ptr.strong_ref();
bool did_match = media_query_list->matches();
bool now_matches = media_query_list->evaluate();
if (did_match != now_matches) {
CSS::MediaQueryListEventInit init;
init.media = media_query_list->media();
init.matches = now_matches;
auto event = CSS::MediaQueryListEvent::create(HTML::EventNames::change, init);
event->set_is_trusted(true);
media_query_list->dispatch_event(event);
}
}
}
}